sylabs / singularity

Wann jeder Stern und Fork hinzugefügt wurde, von GitHub erfasst und nach Tagen gruppiert. Das kumulierte Wachstum steht direkt über den täglichen Zugängen, aus denen es besteht, sodass beide gegeneinander lesbar sind: stetiger organischer Zuwachs sieht ganz anders aus als ein abrupter, kurzlebiger Ausschlag. Wo dieser Unterschied messbar ist, wird er als Wachstumsauthentizität ausgewiesen.

Jeder Punkt umfasst 5 Tage.

Vollständig aufgelöster Abhängigkeitssatz aus dem GitHub-Abhängigkeitsgraphen: 74 direkte und 208 indirekte (transitive) Pakete. Die transitive Hülle ist vollständig, wenn das Repository eine Lockfile eincheckt.

Dieses Repository veröffentlicht kein vom Index auflösbares Paket, daher wurde sein eigener Abhängigkeitsgraph bewertet – 282 Pakete, darunter auch Entwicklungs- und Test-Pins, die nie ausgeliefert werden: 5 tragen bekannte Advisories, davon 3 direkte.

Ein Advisory bedeutet, dass die im Abhängigkeitsgraphen erfasste Version in den betroffenen Bereich eines Advisories fällt. Erreichbarkeit wird nicht analysiert, und der Graph enthält Entwicklungs- und Test-Pins — ein Fund kann das Werkzeug betreffen und nicht die ausgelieferte Software.

{
  "data": {
    "repo": {
      "topics": [
        "containers",
        "hpc",
        "linux"
      ],
      "is_fork": false,
      "size_kb": 49514,
      "has_wiki": true,
      "homepage": "https://sylabs.io/docs/",
      "languages": {
        "C": 84910,
        "Go": 3604909,
        "Awk": 15526,
        "Shell": 69370,
        "Python": 4511,
        "Makefile": 15906,
        "Go Template": 2417
      },
      "pushed_at": "2026-07-24T08:09:13Z",
      "created_at": "2021-05-04T13:40:42Z",
      "owner_type": "Organization",
      "updated_at": "2026-07-23T06:55:57Z",
      "description": "SingularityCE is the Community Edition of Singularity, an open source container platform designed to be simple, fast, and secure.",
      "is_archived": false,
      "is_disabled": false,
      "license_spdx": null,
      "default_branch": "main",
      "license_spdx_raw": "NOASSERTION",
      "primary_language": "Go",
      "significant_languages": [
        "Go"
      ]
    },
    "owner": {
      "blog": "https://www.sylabs.io/",
      "name": "Sylabs Inc.",
      "type": "Organization",
      "login": "sylabs",
      "company": null,
      "location": null,
      "followers": 101,
      "avatar_url": "https://avatars.githubusercontent.com/u/32401844?v=4",
      "created_at": "2017-09-29T20:47:51Z",
      "is_verified": null,
      "public_repos": 35,
      "account_age_days": 3219
    },
    "license": {
      "state": "custom",
      "spdx_id": null,
      "raw_spdx": "NOASSERTION",
      "file_present": true,
      "scorecard_found": true,
      "profile_has_license": true
    },
    "activity": {
      "releases": [
        {
          "tag": "v4.5.0",
          "kind": "minor",
          "published_at": "2026-06-25T10:59:15Z"
        },
        {
          "tag": "v4.4.2",
          "kind": "patch",
          "published_at": "2026-06-04T16:07:31Z"
        },
        {
          "tag": "v4.4.1",
          "kind": "patch",
          "published_at": "2026-03-23T15:46:01Z"
        },
        {
          "tag": "v4.4.0",
          "kind": "minor",
          "published_at": "2026-02-26T17:39:03Z"
        },
        {
          "tag": "v4.3.7",
          "kind": "patch",
          "published_at": "2026-01-16T14:56:07Z"
        },
        {
          "tag": "v4.3.6",
          "kind": "patch",
          "published_at": "2025-12-16T15:25:05Z"
        },
        {
          "tag": "v4.3.5",
          "kind": "patch",
          "published_at": "2025-12-02T17:28:30Z"
        },
        {
          "tag": "v4.3.4",
          "kind": "patch",
          "published_at": "2025-10-14T10:49:50Z"
        },
        {
          "tag": "v4.3.3",
          "kind": "patch",
          "published_at": "2025-08-20T08:32:22Z"
        },
        {
          "tag": "v4.3.2",
          "kind": "patch",
          "published_at": "2025-06-19T10:30:10Z"
        },
        {
          "tag": "v4.3.1",
          "kind": "patch",
          "published_at": "2025-04-11T12:36:38Z"
        },
        {
          "tag": "v4.3.0",
          "kind": "minor",
          "published_at": "2025-03-13T14:07:53Z"
        },
        {
          "tag": "v4.3.0-rc.1",
          "kind": "prerelease",
          "published_at": "2025-03-04T16:19:41Z"
        },
        {
          "tag": "v4.2.2",
          "kind": "patch",
          "published_at": "2024-12-20T15:48:44Z"
        },
        {
          "tag": "v4.2.1",
          "kind": "patch",
          "published_at": "2024-09-13T15:57:50Z"
        },
        {
          "tag": "v4.2.0",
          "kind": "minor",
          "published_at": "2024-09-04T14:59:20Z"
        },
        {
          "tag": "v4.1.5",
          "kind": "patch",
          "published_at": "2024-08-14T15:02:17Z"
        },
        {
          "tag": "v4.2.0-rc.1",
          "kind": "prerelease",
          "published_at": "2024-08-13T09:39:47Z"
        },
        {
          "tag": "v4.1.4",
          "kind": "patch",
          "published_at": "2024-06-28T15:48:40Z"
        },
        {
          "tag": "v4.1.3",
          "kind": "patch",
          "published_at": "2024-05-08T13:52:58Z"
        },
        {
          "tag": "v4.1.2",
          "kind": "patch",
          "published_at": "2024-03-05T16:15:58Z"
        },
        {
          "tag": "v4.1.1",
          "kind": "patch",
          "published_at": "2024-02-01T11:42:58Z"
        },
        {
          "tag": "v4.1.0",
          "kind": "minor",
          "published_at": "2024-01-25T13:50:40Z"
        },
        {
          "tag": "v4.1.0-rc.1",
          "kind": "prerelease",
          "published_at": "2024-01-12T11:27:36Z"
        },
        {
          "tag": "v4.0.3",
          "kind": "patch",
          "published_at": "2024-01-11T10:26:10Z"
        },
        {
          "tag": "v4.0.2",
          "kind": "patch",
          "published_at": "2023-11-16T15:14:05Z"
        },
        {
          "tag": "v4.0.1",
          "kind": "patch",
          "published_at": "2023-10-13T15:10:41Z"
        },
        {
          "tag": "v4.0.0",
          "kind": "major",
          "published_at": "2023-09-19T14:25:00Z"
        },
        {
          "tag": "v3.11.5",
          "kind": "patch",
          "published_at": "2023-09-15T13:58:58Z"
        },
        {
          "tag": "v4.0.0-rc.2",
          "kind": "prerelease",
          "published_at": "2023-09-05T14:54:01Z"
        },
        {
          "tag": "v4.0.0-rc.1",
          "kind": "prerelease",
          "published_at": "2023-08-17T14:57:38Z"
        },
        {
          "tag": "v3.11.4",
          "kind": "patch",
          "published_at": "2023-06-22T13:16:41Z"
        },
        {
          "tag": "v3.11.3",
          "kind": "patch",
          "published_at": "2023-05-04T17:07:14Z"
        },
        {
          "tag": "v3.11.2",
          "kind": "patch",
          "published_at": "2023-04-27T13:32:01Z"
        },
        {
          "tag": "v3.11.1",
          "kind": "patch",
          "published_at": "2023-03-14T16:28:47Z"
        },
        {
          "tag": "v3.11.0",
          "kind": "minor",
          "published_at": "2023-02-10T12:39:32Z"
        },
        {
          "tag": "v3.11.0-rc.2",
          "kind": "prerelease",
          "published_at": "2023-02-03T16:02:51Z"
        },
        {
          "tag": "v3.10.5",
          "kind": "patch",
          "published_at": "2023-01-17T14:53:29Z"
        },
        {
          "tag": "v3.11.0-rc.1",
          "kind": "prerelease",
          "published_at": "2023-01-11T15:26:18Z"
        },
        {
          "tag": "v3.10.4",
          "kind": "patch",
          "published_at": "2022-11-10T15:20:16Z"
        },
        {
          "tag": "v3.10.3",
          "kind": "patch",
          "published_at": "2022-10-06T13:00:48Z"
        },
        {
          "tag": "v3.10.2",
          "kind": "patch",
          "published_at": "2022-07-25T21:07:44Z"
        },
        {
          "tag": "v3.10.1",
          "kind": "patch",
          "published_at": "2022-07-18T18:50:31Z"
        },
        {
          "tag": "v3.10.0",
          "kind": "minor",
          "published_at": "2022-05-17T19:17:14Z"
        },
        {
          "tag": "v3.10.0-rc.2",
          "kind": "prerelease",
          "published_at": "2022-05-11T21:33:20Z"
        },
        {
          "tag": "v3.10.0-rc.1",
          "kind": "prerelease",
          "published_at": "2022-05-04T19:20:54Z"
        },
        {
          "tag": "v3.9.9",
          "kind": "patch",
          "published_at": "2022-04-22T20:28:22Z"
        },
        {
          "tag": "v3.9.8",
          "kind": "patch",
          "published_at": "2022-04-07T21:06:17Z"
        },
        {
          "tag": "v3.9.7",
          "kind": "patch",
          "published_at": "2022-03-23T15:40:12Z"
        },
        {
          "tag": "v3.9.6",
          "kind": "patch",
          "published_at": "2022-03-10T21:39:35Z"
        },
        {
          "tag": "v3.9.5",
          "kind": "patch",
          "published_at": "2022-02-04T18:00:24Z"
        },
        {
          "tag": "v3.9.4",
          "kind": "patch",
          "published_at": "2022-01-19T22:05:17Z"
        },
        {
          "tag": "v3.9.3",
          "kind": "patch",
          "published_at": "2022-01-11T19:43:05Z"
        },
        {
          "tag": "v3.9.2",
          "kind": "patch",
          "published_at": "2021-12-10T20:33:53Z"
        },
        {
          "tag": "v3.9.1",
          "kind": "patch",
          "published_at": "2021-11-22T17:37:59Z"
        },
        {
          "tag": "v3.9.0",
          "kind": "minor",
          "published_at": "2021-11-16T15:07:07Z"
        },
        {
          "tag": "v3.9.0-rc.3",
          "kind": "prerelease",
          "published_at": "2021-11-05T20:06:44Z"
        },
        {
          "tag": "v3.8.4",
          "kind": "patch",
          "published_at": "2021-10-28T17:04:39Z"
        },
        {
          "tag": "v3.9.0-rc.2",
          "kind": "prerelease",
          "published_at": "2021-10-28T16:00:57Z"
        },
        {
          "tag": "v3.9.0-rc.1",
          "kind": "prerelease",
          "published_at": "2021-10-14T19:29:21Z"
        },
        {
          "tag": "v3.8.3",
          "kind": "patch",
          "published_at": "2021-09-01T17:25:19Z"
        },
        {
          "tag": "v3.8.2",
          "kind": "patch",
          "published_at": "2021-08-19T15:31:57Z"
        },
        {
          "tag": "v3.8.1",
          "kind": "patch",
          "published_at": "2021-07-20T18:48:58Z"
        },
        {
          "tag": "v3.8.0",
          "kind": "minor",
          "published_at": "2021-05-26T19:18:02Z"
        },
        {
          "tag": "v3.7.4",
          "kind": "patch",
          "published_at": "2021-05-26T17:44:32Z"
        },
        {
          "tag": "v3.8.0-rc.2",
          "kind": "prerelease",
          "published_at": "2021-05-18T22:30:43Z"
        },
        {
          "tag": "v3.8.0-rc.1",
          "kind": "prerelease",
          "published_at": "2021-05-18T22:32:10Z"
        },
        {
          "tag": "v3.7.3",
          "kind": "patch",
          "published_at": "2021-05-10T15:31:57Z"
        }
      ],
      "recent_commits": [
        {
          "oid": "6e4f96121cbe440600c9246136d8e66173a5eaaa",
          "body": "…-c3db7d4c44\n\nchore(deps): bump the minor group with 2 updates",
          "is_bot": false,
          "headline": "Merge pull request #4232 from sylabs/dependabot/go_modules/main/minor…",
          "author_name": "Dave Trudgian",
          "author_login": "dtrudg",
          "committed_at": "2026-07-22T13:33:11Z",
          "body_truncated": false,
          "is_coding_agent": false
        },
        {
          "oid": "4a29022629ee6f73ee826af3b5d2ef27fc4a585f",
          "body": "Bumps the minor group with 2 updates: [github.com/sigstore/cosign/v2](https://github.com/sigstore/cosign) and [github.com/vbauerster/mpb/v8](https://github.com/vbauerster/mpb).\n\n\nUpdates `github.com/sigstore/cosign/v2` from 2.6.3 to 2.6.4\n- [Release notes](https://github.com/sigstore/cosign/releases\n[…]\nr/mpb/v8\n  dependency-version: 8.13.0\n  dependency-type: direct:production\n  update-type: version-update:semver-minor\n  dependency-group: minor\n...\n\nSigned-off-by: dependabot[bot] <support@github.com>",
          "is_bot": true,
          "headline": "chore(deps): bump the minor group with 2 updates",
          "author_name": "dependabot[bot]",
          "author_login": "dependabot[bot]",
          "committed_at": "2026-07-22T13:18:01Z",
          "body_truncated": true,
          "is_coding_agent": false
        },
        {
          "oid": "3ff676c8f5648acfe8149530e9f66f4643043c3c",
          "body": "e2e: make instance tests more robust",
          "is_bot": false,
          "headline": "Merge pull request #4226 from dtrudg/instance-flakes",
          "author_name": "Dave Trudgian",
          "author_login": "dtrudg",
          "committed_at": "2026-07-20T12:37:21Z",
          "body_truncated": false,
          "is_coding_agent": false
        },
        {
          "oid": "790df90d09382c59ceecf118d5dbb4c8abf74273",
          "body": "…cf500c25f7\n\nchore(deps): bump the moby group with 2 updates",
          "is_bot": false,
          "headline": "Merge pull request #4227 from sylabs/dependabot/go_modules/main/moby-…",
          "author_name": "Dave Trudgian",
          "author_login": "dtrudg",
          "committed_at": "2026-07-20T12:19:39Z",
          "body_truncated": false,
          "is_coding_agent": false
        },
        {
          "oid": "89ca0d79938c6c710485aa5602665f875c4fc20b",
          "body": "Bumps the moby group with 2 updates: [github.com/docker/cli](https://github.com/docker/cli) and [github.com/moby/buildkit](https://github.com/moby/buildkit).\n\n\nUpdates `github.com/docker/cli` from 29.6.1+incompatible to 29.6.2+incompatible\n- [Commits](https://github.com/docker/cli/compare/v29.6.1...\n[…]\n/buildkit\n  dependency-version: 0.31.2\n  dependency-type: direct:production\n  update-type: version-update:semver-patch\n  dependency-group: moby\n...\n\nSigned-off-by: dependabot[bot] <support@github.com>",
          "is_bot": true,
          "headline": "chore(deps): bump the moby group with 2 updates",
          "author_name": "dependabot[bot]",
          "author_login": "dependabot[bot]",
          "committed_at": "2026-07-17T07:03:45Z",
          "body_truncated": true,
          "is_coding_agent": false
        },
        {
          "oid": "71a543084c7efef95e9334c050a39a511e29c90e",
          "body": "Address test flakes by:\n\n* Using random names and tcp ports for instances.\n* Broadening the retry in the `echo` function.\n* Remove an incorrect `echo` call from `testInstanceRun`. The runscript\nfor the test container does not start an echo server. The `echo` call\nwas actually being performed against an echo server container\nremaining from other tests.\n* Check the correct location for a logfile in `testInstanceRun`. Need\nto look in the correct homedir for the profile used.\n\nFixes #4153",
          "is_bot": false,
          "headline": "e2e: make instance tests more robust",
          "author_name": "David Trudgian",
          "author_login": "dtrudg",
          "committed_at": "2026-07-16T13:44:17Z",
          "body_truncated": false,
          "is_coding_agent": false
        },
        {
          "oid": "11e97ee4347a23f3baccc5318248a3dfc2db1ba8",
          "body": "…inerd-1b91a3d232\n\nchore(deps): bump github.com/containerd/containerd/v2 from 2.2.5 to 2.2.6 in the containerd group across 1 directory",
          "is_bot": false,
          "headline": "Merge pull request #4217 from sylabs/dependabot/go_modules/main/conta…",
          "author_name": "Dave Trudgian",
          "author_login": "dtrudg",
          "committed_at": "2026-07-16T12:11:39Z",
          "body_truncated": false,
          "is_coding_agent": false
        },
        {
          "oid": "03e3d55b61c633affd18c1954878d310d44d4753",
          "body": "Bumps the containerd group with 1 update in the / directory: [github.com/containerd/containerd/v2](https://github.com/containerd/containerd).\n\n\nUpdates `github.com/containerd/containerd/v2` from 2.2.5 to 2.2.6\n- [Release notes](https://github.com/containerd/containerd/releases)\n- [Changelog](https:/\n[…]\nd/v2\n  dependency-version: 2.2.6\n  dependency-type: direct:production\n  update-type: version-update:semver-patch\n  dependency-group: containerd\n...\n\nSigned-off-by: dependabot[bot] <support@github.com>",
          "is_bot": true,
          "headline": "chore(deps): bump github.com/containerd/containerd/v2",
          "author_name": "dependabot[bot]",
          "author_login": "dependabot[bot]",
          "committed_at": "2026-07-16T11:59:58Z",
          "body_truncated": true,
          "is_coding_agent": false
        },
        {
          "oid": "066bc684964b0e6ad6323ffd9044d1fc5e92c933",
          "body": "…-185168c538\n\nchore(deps): bump the minor group across 1 directory with 9 updates",
          "is_bot": false,
          "headline": "Merge pull request #4224 from sylabs/dependabot/go_modules/main/minor…",
          "author_name": "Dave Trudgian",
          "author_login": "dtrudg",
          "committed_at": "2026-07-16T11:58:02Z",
          "body_truncated": false,
          "is_coding_agent": false
        },
        {
          "oid": "4bf9f0cda8a919585c70e955071cedc727a8956d",
          "body": "Bumps the minor group with 4 updates in the / directory: [github.com/pelletier/go-toml/v2](https://github.com/pelletier/go-toml), [github.com/sylabs/scs-build-client](https://github.com/sylabs/scs-build-client), [golang.org/x/crypto](https://github.com/golang/crypto) and [google.golang.org/grpc](htt\n[…]\norg/grpc\n  dependency-version: 1.82.1\n  dependency-type: direct:production\n  update-type: version-update:semver-patch\n  dependency-group: minor\n...\n\nSigned-off-by: dependabot[bot] <support@github.com>",
          "is_bot": true,
          "headline": "chore(deps): bump the minor group across 1 directory with 9 updates",
          "author_name": "dependabot[bot]",
          "author_login": "dependabot[bot]",
          "committed_at": "2026-07-16T11:47:18Z",
          "body_truncated": true,
          "is_coding_agent": false
        },
        {
          "oid": "cc95938598152acbce84c409c4b79a42ffd3a0aa",
          "body": "…ontainers-4d864958e9\n\nchore(deps): bump github.com/opencontainers/runc from 1.5.0 to 1.5.1 in the opencontainers group",
          "is_bot": false,
          "headline": "Merge pull request #4221 from sylabs/dependabot/go_modules/main/openc…",
          "author_name": "Dave Trudgian",
          "author_login": "dtrudg",
          "committed_at": "2026-07-16T11:27:56Z",
          "body_truncated": false,
          "is_coding_agent": false
        },
        {
          "oid": "e1c795400ef3b49d29e41de6e8d964b4cd18033a",
          "body": null,
          "is_bot": false,
          "headline": "e2e: update OCSP Certificates",
          "author_name": "David Trudgian",
          "author_login": "dtrudg",
          "committed_at": "2026-07-16T11:16:21Z",
          "body_truncated": false,
          "is_coding_agent": false
        },
        {
          "oid": "3cac42c0ffce4b2a21da2dd2808fb5f806abb0ff",
          "body": "Bumps the opencontainers group with 1 update: [github.com/opencontainers/runc](https://github.com/opencontainers/runc).\n\n\nUpdates `github.com/opencontainers/runc` from 1.5.0 to 1.5.1\n- [Release notes](https://github.com/opencontainers/runc/releases)\n- [Changelog](https://github.com/opencontainers/ru\n[…]\n\n  dependency-version: 1.5.1\n  dependency-type: direct:production\n  update-type: version-update:semver-patch\n  dependency-group: opencontainers\n...\n\nSigned-off-by: dependabot[bot] <support@github.com>",
          "is_bot": true,
          "headline": "chore(deps): bump github.com/opencontainers/runc",
          "author_name": "dependabot[bot]",
          "author_login": "dependabot[bot]",
          "committed_at": "2026-07-15T09:10:56Z",
          "body_truncated": true,
          "is_coding_agent": false
        },
        {
          "oid": "ebabaec7952c12038fb7e17d9422cf52c30b9643",
          "body": "…a2be455989\n\nchore(deps): bump github.com/docker/cli from 29.6.0+incompatible to 29.6.1+incompatible in the moby group",
          "is_bot": false,
          "headline": "Merge pull request #4211 from sylabs/dependabot/go_modules/main/moby-…",
          "author_name": "Dave Trudgian",
          "author_login": "dtrudg",
          "committed_at": "2026-07-01T14:16:05Z",
          "body_truncated": false,
          "is_coding_agent": false
        },
        {
          "oid": "f0405b04ef2a03a441e5b4f326bb4d330e975e9a",
          "body": "…-854c565c5f\n\nchore(deps): bump google.golang.org/grpc from 1.81.1 to 1.82.0 in the minor group",
          "is_bot": false,
          "headline": "Merge pull request #4212 from sylabs/dependabot/go_modules/main/minor…",
          "author_name": "Dave Trudgian",
          "author_login": "dtrudg",
          "committed_at": "2026-07-01T11:48:51Z",
          "body_truncated": false,
          "is_coding_agent": false
        },
        {
          "oid": "1c60bb1d1736967787473ac54d5e1077cdbde9a9",
          "body": "Bumps the minor group with 1 update: [google.golang.org/grpc](https://github.com/grpc/grpc-go).\n\n\nUpdates `google.golang.org/grpc` from 1.81.1 to 1.82.0\n- [Release notes](https://github.com/grpc/grpc-go/releases)\n- [Commits](https://github.com/grpc/grpc-go/compare/v1.81.1...v1.82.0)\n\n---\nupdated-dep\n[…]\norg/grpc\n  dependency-version: 1.82.0\n  dependency-type: direct:production\n  update-type: version-update:semver-minor\n  dependency-group: minor\n...\n\nSigned-off-by: dependabot[bot] <support@github.com>",
          "is_bot": true,
          "headline": "chore(deps): bump google.golang.org/grpc in the minor group",
          "author_name": "dependabot[bot]",
          "author_login": "dependabot[bot]",
          "committed_at": "2026-07-01T11:10:14Z",
          "body_truncated": true,
          "is_coding_agent": false
        },
        {
          "oid": "4553179cd42babb0b145dccb7fccf1360e0c8ca8",
          "body": "Bumps the moby group with 1 update: [github.com/docker/cli](https://github.com/docker/cli).\n\n\nUpdates `github.com/docker/cli` from 29.6.0+incompatible to 29.6.1+incompatible\n- [Commits](https://github.com/docker/cli/compare/v29.6.0...v29.6.1)\n\n---\nupdated-dependencies:\n- dependency-name: github.com/\n[…]\nependency-version: 29.6.1+incompatible\n  dependency-type: direct:production\n  update-type: version-update:semver-patch\n  dependency-group: moby\n...\n\nSigned-off-by: dependabot[bot] <support@github.com>",
          "is_bot": true,
          "headline": "chore(deps): bump github.com/docker/cli in the moby group",
          "author_name": "dependabot[bot]",
          "author_login": "dependabot[bot]",
          "committed_at": "2026-07-01T11:09:58Z",
          "body_truncated": true,
          "is_coding_agent": false
        },
        {
          "oid": "01adb8edc09985b548f088212746180c34218e8f",
          "body": "Fixed Debian build files (rootless mode)",
          "is_bot": false,
          "headline": "Merge pull request #4202 from peci1/patch-1",
          "author_name": "Dave Trudgian",
          "author_login": "dtrudg",
          "committed_at": "2026-06-29T14:47:56Z",
          "body_truncated": false,
          "is_coding_agent": false
        },
        {
          "oid": "af9c68020cc4d96bee7b2db14d1289edbb10c2ba",
          "body": "…6a0f41efa6\n\nchore(deps): bump the moby group across 1 directory with 2 updates",
          "is_bot": false,
          "headline": "Merge pull request #4209 from sylabs/dependabot/go_modules/main/moby-…",
          "author_name": "Dave Trudgian",
          "author_login": "dtrudg",
          "committed_at": "2026-06-29T12:34:29Z",
          "body_truncated": false,
          "is_coding_agent": false
        },
        {
          "oid": "dd81388c6605619772babc7ffcb888038f264bc8",
          "body": "Bumps the moby group with 2 updates in the / directory: [github.com/moby/buildkit](https://github.com/moby/buildkit) and [github.com/moby/sys/user](https://github.com/moby/sys).\n\n\nUpdates `github.com/moby/buildkit` from 0.31.0 to 0.31.1\n- [Release notes](https://github.com/moby/buildkit/releases)\n- \n[…]\ny/sys/user\n  dependency-version: 0.4.1\n  dependency-type: direct:production\n  update-type: version-update:semver-patch\n  dependency-group: moby\n...\n\nSigned-off-by: dependabot[bot] <support@github.com>",
          "is_bot": true,
          "headline": "chore(deps): bump the moby group across 1 directory with 2 updates",
          "author_name": "dependabot[bot]",
          "author_login": "dependabot[bot]",
          "committed_at": "2026-06-26T07:03:17Z",
          "body_truncated": true,
          "is_coding_agent": false
        },
        {
          "oid": "3c5a0b9bb4dd086f358c469e0670ea62bbfdcf44",
          "body": "chore: point dependabot at release-4.5",
          "is_bot": false,
          "headline": "Merge pull request #4203 from dtrudg/post-release-4.5",
          "author_name": "Dave Trudgian",
          "author_login": "dtrudg",
          "committed_at": "2026-06-25T14:45:13Z",
          "body_truncated": false,
          "is_coding_agent": false
        },
        {
          "oid": "bcce31cf8d311b2cea792de8c74dccf52de2cbf5",
          "body": null,
          "is_bot": false,
          "headline": "chore: point dependabot at release-4.5",
          "author_name": "David Trudgian",
          "author_login": "dtrudg",
          "committed_at": "2026-06-25T12:15:15Z",
          "body_truncated": false,
          "is_coding_agent": false
        },
        {
          "oid": "c9c04f2a497e2fc662543a1a02a5bbb887409170",
          "body": "Signed-off-by: Martin Pecka <peci1@seznam.cz>",
          "is_bot": false,
          "headline": "Add Martin Pecka to CONTRIBUTORS.md",
          "author_name": "Martin Pecka",
          "author_login": "peci1",
          "committed_at": "2026-06-25T11:35:04Z",
          "body_truncated": false,
          "is_coding_agent": false
        },
        {
          "oid": "688823868f915eb415d24abaeec639c1a2699587",
          "body": "Signed-off-by: Martin Pecka <peci1@seznam.cz>",
          "is_bot": false,
          "headline": "Fixed Debian build files (rootless mode)",
          "author_name": "Martin Pecka",
          "author_login": "peci1",
          "committed_at": "2026-06-25T11:25:05Z",
          "body_truncated": false,
          "is_coding_agent": false
        },
        {
          "oid": "4824860b79679ceb1198fcb85df5b6c436ab4cad",
          "body": "chore: prep 4.5.0 release",
          "is_bot": false,
          "headline": "Merge pull request #4200 from dtrudg/prepare-4.5.0",
          "author_name": "Dave Trudgian",
          "author_login": "dtrudg",
          "committed_at": "2026-06-25T09:33:03Z",
          "body_truncated": false,
          "is_coding_agent": false
        },
        {
          "oid": "bca02726e5ed9b3ff960ae90695a05d28c10c9c1",
          "body": null,
          "is_bot": false,
          "headline": "chore: prep 4.5.0 release",
          "author_name": "David Trudgian",
          "author_login": "dtrudg",
          "committed_at": "2026-06-24T16:52:29Z",
          "body_truncated": false,
          "is_coding_agent": false
        },
        {
          "oid": "830c485082ecc4fc5f5cd15abc28c999009c6b5d",
          "body": "…-0f556b3fe2\n\nchore(deps): bump the minor group across 1 directory with 3 updates",
          "is_bot": false,
          "headline": "Merge pull request #4197 from sylabs/dependabot/go_modules/main/minor…",
          "author_name": "Dave Trudgian",
          "author_login": "dtrudg",
          "committed_at": "2026-06-24T13:53:18Z",
          "body_truncated": false,
          "is_coding_agent": false
        },
        {
          "oid": "d70e7bed9d944e0af4eb79bbf651b1733c5bc687",
          "body": "…ontainers-4d40b05e77\n\nchore(deps): bump github.com/opencontainers/runc from 1.4.3 to 1.5.0 in the opencontainers group",
          "is_bot": false,
          "headline": "Merge pull request #4194 from sylabs/dependabot/go_modules/main/openc…",
          "author_name": "Dave Trudgian",
          "author_login": "dtrudg",
          "committed_at": "2026-06-24T13:43:55Z",
          "body_truncated": false,
          "is_coding_agent": false
        },
        {
          "oid": "4caa718a46204cf3ce4d7338c82f302b3dd600a9",
          "body": "Bumps the minor group with 3 updates in the / directory: [github.com/pelletier/go-toml/v2](https://github.com/pelletier/go-toml), [github.com/sylabs/scs-build-client](https://github.com/sylabs/scs-build-client) and [go.etcd.io/bbolt](https://github.com/etcd-io/bbolt).\n\n\nUpdates `github.com/pelletier\n[…]\n.io/bbolt\n  dependency-version: 1.5.0\n  dependency-type: direct:production\n  update-type: version-update:semver-minor\n  dependency-group: minor\n...\n\nSigned-off-by: dependabot[bot] <support@github.com>",
          "is_bot": true,
          "headline": "chore(deps): bump the minor group across 1 directory with 3 updates",
          "author_name": "dependabot[bot]",
          "author_login": "dependabot[bot]",
          "committed_at": "2026-06-24T13:35:16Z",
          "body_truncated": true,
          "is_coding_agent": false
        },
        {
          "oid": "df0d076836d82f1f84900d37bd6565de59bf8b5f",
          "body": "…ml.in/yaml/v4-4.0.0-rc.6\n\nchore(deps): bump go.yaml.in/yaml/v4 from 4.0.0-rc.5 to 4.0.0-rc.6",
          "is_bot": false,
          "headline": "Merge pull request #4198 from sylabs/dependabot/go_modules/main/go.ya…",
          "author_name": "Dave Trudgian",
          "author_login": "dtrudg",
          "committed_at": "2026-06-24T13:33:29Z",
          "body_truncated": false,
          "is_coding_agent": false
        },
        {
          "oid": "f192a6eb3774dc21606c75bb05a277c3cc1171ce",
          "body": "Bumps [go.yaml.in/yaml/v4](https://github.com/yaml/go-yaml) from 4.0.0-rc.5 to 4.0.0-rc.6.\n- [Commits](https://github.com/yaml/go-yaml/compare/v4.0.0-rc.5...v4.0.0-rc.6)\n\n---\nupdated-dependencies:\n- dependency-name: go.yaml.in/yaml/v4\n  dependency-version: 4.0.0-rc.6\n  dependency-type: direct:production\n  update-type: version-update:semver-patch\n...\n\nSigned-off-by: dependabot[bot] <support@github.com>",
          "is_bot": true,
          "headline": "chore(deps): bump go.yaml.in/yaml/v4 from 4.0.0-rc.5 to 4.0.0-rc.6",
          "author_name": "dependabot[bot]",
          "author_login": "dependabot[bot]",
          "committed_at": "2026-06-24T12:38:57Z",
          "body_truncated": false,
          "is_coding_agent": false
        },
        {
          "oid": "5d2096763455687f6f2f852051353e7542e4a298",
          "body": "Bumps the opencontainers group with 1 update: [github.com/opencontainers/runc](https://github.com/opencontainers/runc).\n\n\nUpdates `github.com/opencontainers/runc` from 1.4.3 to 1.5.0\n- [Release notes](https://github.com/opencontainers/runc/releases)\n- [Changelog](https://github.com/opencontainers/ru\n[…]\n\n  dependency-version: 1.5.0\n  dependency-type: direct:production\n  update-type: version-update:semver-minor\n  dependency-group: opencontainers\n...\n\nSigned-off-by: dependabot[bot] <support@github.com>",
          "is_bot": true,
          "headline": "chore(deps): bump github.com/opencontainers/runc",
          "author_name": "dependabot[bot]",
          "author_login": "dependabot[bot]",
          "committed_at": "2026-06-24T12:38:33Z",
          "body_truncated": true,
          "is_coding_agent": false
        },
        {
          "oid": "b9c03fb381fed2fb588870d9a2f747849bde081b",
          "body": "docs: LLM guidance r.e. security false positives",
          "is_bot": false,
          "headline": "Merge pull request #4193 from dtrudg/llm-security",
          "author_name": "Dave Trudgian",
          "author_login": "dtrudg",
          "committed_at": "2026-06-24T12:36:58Z",
          "body_truncated": false,
          "is_coding_agent": false
        },
        {
          "oid": "436202f07698a6fba58ab7b7b93f3b9d191fbc85",
          "body": null,
          "is_bot": false,
          "headline": "docs: LLM guidance r.e. security false positives",
          "author_name": "David Trudgian",
          "author_login": "dtrudg",
          "committed_at": "2026-06-24T11:59:18Z",
          "body_truncated": false,
          "is_coding_agent": false
        },
        {
          "oid": "e1a31b5c8391c057a01f783b6dc7732ad3b9f002",
          "body": "user: Add non-CGO lookups for consumers",
          "is_bot": false,
          "headline": "Merge pull request #4186 from dtrudg/issue-4185",
          "author_name": "Dave Trudgian",
          "author_login": "dtrudg",
          "committed_at": "2026-06-22T15:18:29Z",
          "body_truncated": false,
          "is_coding_agent": false
        },
        {
          "oid": "f92f926c52981930e9dd5d41767a786a6403b4fa",
          "body": "…e94e44e4c9\n\nchore(deps): bump the moby group with 2 updates",
          "is_bot": false,
          "headline": "Merge pull request #4187 from sylabs/dependabot/go_modules/main/moby-…",
          "author_name": "Dave Trudgian",
          "author_login": "dtrudg",
          "committed_at": "2026-06-22T12:12:55Z",
          "body_truncated": false,
          "is_coding_agent": false
        },
        {
          "oid": "ad90ba531fa162cc787b47214a141718b532c912",
          "body": "…-fb67620e96\n\nchore(deps): bump github.com/sylabs/scs-library-client from 1.4.14 to 1.4.15 in the minor group",
          "is_bot": false,
          "headline": "Merge pull request #4189 from sylabs/dependabot/go_modules/main/minor…",
          "author_name": "Dave Trudgian",
          "author_login": "dtrudg",
          "committed_at": "2026-06-22T12:11:13Z",
          "body_truncated": false,
          "is_coding_agent": false
        },
        {
          "oid": "24fa0784f8b25b34a27738aa6d9954afcd1a9c7a",
          "body": "…inerd-121c5c72c6\n\nchore(deps): bump github.com/containerd/containerd/v2 from 2.2.4 to 2.2.5 in the containerd group",
          "is_bot": false,
          "headline": "Merge pull request #4188 from sylabs/dependabot/go_modules/main/conta…",
          "author_name": "Dave Trudgian",
          "author_login": "dtrudg",
          "committed_at": "2026-06-22T12:11:03Z",
          "body_truncated": false,
          "is_coding_agent": false
        },
        {
          "oid": "f26ebf67c09e3af7e52ebf4a0a21e4afd2343517",
          "body": "Bumps the minor group with 1 update: [github.com/sylabs/scs-library-client](https://github.com/sylabs/scs-library-client).\n\n\nUpdates `github.com/sylabs/scs-library-client` from 1.4.14 to 1.4.15\n- [Release notes](https://github.com/sylabs/scs-library-client/releases)\n- [Commits](https://github.com/sy\n[…]\ny-client\n  dependency-version: 1.4.15\n  dependency-type: direct:production\n  update-type: version-update:semver-patch\n  dependency-group: minor\n...\n\nSigned-off-by: dependabot[bot] <support@github.com>",
          "is_bot": true,
          "headline": "chore(deps): bump github.com/sylabs/scs-library-client",
          "author_name": "dependabot[bot]",
          "author_login": "dependabot[bot]",
          "committed_at": "2026-06-19T07:03:40Z",
          "body_truncated": true,
          "is_coding_agent": false
        },
        {
          "oid": "1ee8cb1cd552048306f3362a9fe20fba8da9c63c",
          "body": "Bumps the containerd group with 1 update: [github.com/containerd/containerd/v2](https://github.com/containerd/containerd).\n\n\nUpdates `github.com/containerd/containerd/v2` from 2.2.4 to 2.2.5\n- [Release notes](https://github.com/containerd/containerd/releases)\n- [Changelog](https://github.com/contain\n[…]\nd/v2\n  dependency-version: 2.2.5\n  dependency-type: direct:production\n  update-type: version-update:semver-patch\n  dependency-group: containerd\n...\n\nSigned-off-by: dependabot[bot] <support@github.com>",
          "is_bot": true,
          "headline": "chore(deps): bump github.com/containerd/containerd/v2",
          "author_name": "dependabot[bot]",
          "author_login": "dependabot[bot]",
          "committed_at": "2026-06-19T07:03:24Z",
          "body_truncated": true,
          "is_coding_agent": false
        },
        {
          "oid": "3946b24dd59a628c851da01fdc6c2a85e9f11179",
          "body": "Bumps the moby group with 2 updates: [github.com/docker/cli](https://github.com/docker/cli) and [github.com/moby/moby/client](https://github.com/moby/moby).\n\n\nUpdates `github.com/docker/cli` from 29.5.3+incompatible to 29.6.0+incompatible\n- [Commits](https://github.com/docker/cli/compare/v29.5.3...v\n[…]\noby/client\n  dependency-version: 0.5.0\n  dependency-type: direct:production\n  update-type: version-update:semver-minor\n  dependency-group: moby\n...\n\nSigned-off-by: dependabot[bot] <support@github.com>",
          "is_bot": true,
          "headline": "chore(deps): bump the moby group with 2 updates",
          "author_name": "dependabot[bot]",
          "author_login": "dependabot[bot]",
          "committed_at": "2026-06-19T07:03:05Z",
          "body_truncated": true,
          "is_coding_agent": false
        },
        {
          "oid": "88b58ce76de82cab5a3d702b256e018269d84c06",
          "body": "…9ddb7ac366\n\nchore(deps): bump github.com/moby/buildkit from 0.30.0 to 0.31.0 in the moby group",
          "is_bot": false,
          "headline": "Merge pull request #4179 from sylabs/dependabot/go_modules/main/moby-…",
          "author_name": "Dave Trudgian",
          "author_login": "dtrudg",
          "committed_at": "2026-06-18T15:43:29Z",
          "body_truncated": false,
          "is_coding_agent": false
        },
        {
          "oid": "f8a35cfff557bd00869bfe7ade029cec9c7104f4",
          "body": null,
          "is_bot": false,
          "headline": "fix: adapt to buildkit upstream changes",
          "author_name": "David Trudgian",
          "author_login": "dtrudg",
          "committed_at": "2026-06-18T15:17:31Z",
          "body_truncated": false,
          "is_coding_agent": false
        },
        {
          "oid": "e904318fc61d06e269157f840c75c9a3e36a14e4",
          "body": "Bumps the moby group with 1 update: [github.com/moby/buildkit](https://github.com/moby/buildkit).\n\nUpdates `github.com/moby/buildkit` from 0.30.0 to 0.31.0\n- [Release notes](https://github.com/moby/buildkit/releases)\n- [Commits](https://github.com/moby/buildkit/compare/v0.30.0...v0.31.0)\n\n---\nupdate\n[…]\n/buildkit\n  dependency-version: 0.31.0\n  dependency-type: direct:production\n  update-type: version-update:semver-minor\n  dependency-group: moby\n...\n\nSigned-off-by: dependabot[bot] <support@github.com>",
          "is_bot": true,
          "headline": "chore(deps): bump github.com/moby/buildkit in the moby group",
          "author_name": "dependabot[bot]",
          "author_login": "dependabot[bot]",
          "committed_at": "2026-06-18T15:17:31Z",
          "body_truncated": true,
          "is_coding_agent": false
        },
        {
          "oid": "9ae26c25d5b5265f609cf50c3e33e29369854f2e",
          "body": "With recent changes, internal/pkg/util/user is may now be brought into\nprojects that consume public pkg/ code.\n\nPrior to this PR, the user package only compiles if CGO is\nenabled. Add non-CGO lookup functions, wrapping os.User when CGO is\ndisabled. This permits import into projects that don't build with CGO.\n\nCloses #4185",
          "is_bot": false,
          "headline": "user: Add non-CGO lookups for consumers",
          "author_name": "David Trudgian",
          "author_login": "dtrudg",
          "committed_at": "2026-06-18T15:12:56Z",
          "body_truncated": false,
          "is_coding_agent": false
        },
        {
          "oid": "39405b1e00db1f767af949b46169bb27a1de6afc",
          "body": "…-4a3ac74034\n\nchore(deps): bump the minor group with 2 updates",
          "is_bot": false,
          "headline": "Merge pull request #4183 from sylabs/dependabot/go_modules/main/minor…",
          "author_name": "Dave Trudgian",
          "author_login": "dtrudg",
          "committed_at": "2026-06-18T10:21:34Z",
          "body_truncated": false,
          "is_coding_agent": false
        },
        {
          "oid": "a18233bc2fadc544e612b43f49b0c47c3789a67a",
          "body": "…ontainers-a40e37e4c0\n\nchore(deps): bump github.com/opencontainers/runc from 1.4.2 to 1.4.3 in the opencontainers group",
          "is_bot": false,
          "headline": "Merge pull request #4181 from sylabs/dependabot/go_modules/main/openc…",
          "author_name": "Dave Trudgian",
          "author_login": "dtrudg",
          "committed_at": "2026-06-18T10:09:07Z",
          "body_truncated": false,
          "is_coding_agent": false
        },
        {
          "oid": "9bbf396cf7b875fea5e903fd9e3e044885343c11",
          "body": null,
          "is_bot": false,
          "headline": "e2e: broaden invalid_toml error message check",
          "author_name": "David Trudgian",
          "author_login": "dtrudg",
          "committed_at": "2026-06-18T10:05:22Z",
          "body_truncated": false,
          "is_coding_agent": false
        },
        {
          "oid": "7e6abc3887ab3cffb8340a23d246047055451961",
          "body": "Bumps the minor group with 2 updates: [github.com/cyphar/filepath-securejoin](https://github.com/cyphar/filepath-securejoin) and [github.com/pelletier/go-toml/v2](https://github.com/pelletier/go-toml).\n\n\nUpdates `github.com/cyphar/filepath-securejoin` from 0.6.1 to 0.7.0\n- [Release notes](https://gi\n[…]\no-toml/v2\n  dependency-version: 2.4.0\n  dependency-type: direct:production\n  update-type: version-update:semver-minor\n  dependency-group: minor\n...\n\nSigned-off-by: dependabot[bot] <support@github.com>",
          "is_bot": true,
          "headline": "chore(deps): bump the minor group with 2 updates",
          "author_name": "dependabot[bot]",
          "author_login": "dependabot[bot]",
          "committed_at": "2026-06-18T09:14:20Z",
          "body_truncated": true,
          "is_coding_agent": false
        },
        {
          "oid": "f49b7cec4168fb1b4577735893369fb626460897",
          "body": "Bumps the opencontainers group with 1 update: [github.com/opencontainers/runc](https://github.com/opencontainers/runc).\n\n\nUpdates `github.com/opencontainers/runc` from 1.4.2 to 1.4.3\n- [Release notes](https://github.com/opencontainers/runc/releases)\n- [Changelog](https://github.com/opencontainers/ru\n[…]\n\n  dependency-version: 1.4.3\n  dependency-type: direct:production\n  update-type: version-update:semver-patch\n  dependency-group: opencontainers\n...\n\nSigned-off-by: dependabot[bot] <support@github.com>",
          "is_bot": true,
          "headline": "chore(deps): bump github.com/opencontainers/runc",
          "author_name": "dependabot[bot]",
          "author_login": "dependabot[bot]",
          "committed_at": "2026-06-18T09:14:02Z",
          "body_truncated": true,
          "is_coding_agent": false
        },
        {
          "oid": "e6be4bcf614f97aa89c122caa285cb3049c9d617",
          "body": "build: use an os.Root for Mkdir / Writefile operations",
          "is_bot": false,
          "headline": "Merge pull request #4178 from dtrudg/rooted-build",
          "author_name": "Dave Trudgian",
          "author_login": "dtrudg",
          "committed_at": "2026-06-17T14:00:19Z",
          "body_truncated": false,
          "is_coding_agent": false
        },
        {
          "oid": "a9a2a8042ba570e8f7842292e4a1bad7e02fb94f",
          "body": "…ml.in/yaml/v4-4.0.0-rc.5\n\nchore(deps): bump go.yaml.in/yaml/v4 from 4.0.0-rc.4 to 4.0.0-rc.5",
          "is_bot": false,
          "headline": "Merge pull request #4173 from sylabs/dependabot/go_modules/main/go.ya…",
          "author_name": "Dave Trudgian",
          "author_login": "dtrudg",
          "committed_at": "2026-06-15T16:44:46Z",
          "body_truncated": false,
          "is_coding_agent": false
        },
        {
          "oid": "27ea39104ae02500a1b7db6c377f94b2512d8dbc",
          "body": "In builds, we frequently create directories and write files into a\nrootfs dir. We can use os.Root to better restrict these operations\nto the rootfs directory.\n\nThis code was developed out of exploratory work using Claude Code,\nthat has been manually reviewed and edited. The Co-authored-by trailer\nis added on this basis.\n\nCo-authored-by: Claude Code",
          "is_bot": false,
          "headline": "build: use an os.Root for Mkdir / Writefile operations",
          "author_name": "David Trudgian",
          "author_login": "dtrudg",
          "committed_at": "2026-06-15T16:43:47Z",
          "body_truncated": false,
          "is_coding_agent": false
        },
        {
          "oid": "5f263bd403384b865ad5bcbf30598d328f1e0693",
          "body": "fs: os.Root-ed fs.MkdirAt / fs.MkdirAll",
          "is_bot": false,
          "headline": "Merge pull request #4177 from dtrudg/mkdirat",
          "author_name": "Dave Trudgian",
          "author_login": "dtrudg",
          "committed_at": "2026-06-15T16:41:39Z",
          "body_truncated": false,
          "is_coding_agent": false
        },
        {
          "oid": "01aee05902b9a198fd6ef5bf2a20a290ed25cd42",
          "body": "Add fs.MkdirAt / fs.MkdirAll which are rooted to a specific location\nusing os.Root.\n\nUse them in place of the existing fs.Mkdir / fs.MkdirAll when\nconstructing `--workdir` locations, which shouldn't reasonably be\nsymlinked out of the specified workdir. Also for internal oci bundle\nand overlay paths.",
          "is_bot": false,
          "headline": "fs: os.Root-ed fs.MkdirAt / fs.MkdirAll",
          "author_name": "David Trudgian",
          "author_login": "dtrudg",
          "committed_at": "2026-06-15T15:40:15Z",
          "body_truncated": false,
          "is_coding_agent": false
        },
        {
          "oid": "200757bf0ee9ce7d78d8d0d6fb2e337d88ccb832",
          "body": "Bumps [go.yaml.in/yaml/v4](https://github.com/yaml/go-yaml) from 4.0.0-rc.4 to 4.0.0-rc.5.\n- [Commits](https://github.com/yaml/go-yaml/compare/v4.0.0-rc.4...v4.0.0-rc.5)\n\n---\nupdated-dependencies:\n- dependency-name: go.yaml.in/yaml/v4\n  dependency-version: 4.0.0-rc.5\n  dependency-type: direct:production\n  update-type: version-update:semver-patch\n...\n\nSigned-off-by: dependabot[bot] <support@github.com>",
          "is_bot": true,
          "headline": "chore(deps): bump go.yaml.in/yaml/v4 from 4.0.0-rc.4 to 4.0.0-rc.5",
          "author_name": "dependabot[bot]",
          "author_login": "dependabot[bot]",
          "committed_at": "2026-06-15T11:47:30Z",
          "body_truncated": false,
          "is_coding_agent": false
        },
        {
          "oid": "9fcc1d7eb01bc1426112bb119236bf7d3a2a35f9",
          "body": "…-134f60b9f7\n\nchore(deps): bump the minor group with 5 updates",
          "is_bot": false,
          "headline": "Merge pull request #4172 from sylabs/dependabot/go_modules/main/minor…",
          "author_name": "Dave Trudgian",
          "author_login": "dtrudg",
          "committed_at": "2026-06-15T11:46:04Z",
          "body_truncated": false,
          "is_coding_agent": false
        },
        {
          "oid": "d1f3c9eb54302dd4bc8f13eee596445fc2d06b79",
          "body": "hardening: Use FDs at IsOwner check locations",
          "is_bot": false,
          "headline": "Merge pull request #4169 from dtrudg/use-fds",
          "author_name": "Dave Trudgian",
          "author_login": "dtrudg",
          "committed_at": "2026-06-15T11:45:29Z",
          "body_truncated": false,
          "is_coding_agent": false
        },
        {
          "oid": "e52c3ba2082ae40394cb2b253c8bf4c6cc53fffb",
          "body": "archive: use os.Root when extracting tar files",
          "is_bot": false,
          "headline": "Merge pull request #4170 from dtrudg/archive-root",
          "author_name": "Dave Trudgian",
          "author_login": "dtrudg",
          "committed_at": "2026-06-15T11:45:17Z",
          "body_truncated": false,
          "is_coding_agent": false
        },
        {
          "oid": "bc734c2eee949f89ea02f0f09d122ee4b1ff678e",
          "body": "Bumps the minor group with 5 updates:\n\n| Package | From | To |\n| --- | --- | --- |\n| [golang.org/x/crypto](https://github.com/golang/crypto) | `0.52.0` | `0.53.0` |\n| [golang.org/x/sync](https://github.com/golang/sync) | `0.20.0` | `0.21.0` |\n| [golang.org/x/sys](https://github.com/golang/sys) | `0.\n[…]\ng/x/text\n  dependency-version: 0.38.0\n  dependency-type: direct:production\n  update-type: version-update:semver-minor\n  dependency-group: minor\n...\n\nSigned-off-by: dependabot[bot] <support@github.com>",
          "is_bot": true,
          "headline": "chore(deps): bump the minor group with 5 updates",
          "author_name": "dependabot[bot]",
          "author_login": "dependabot[bot]",
          "committed_at": "2026-06-12T07:03:41Z",
          "body_truncated": true,
          "is_coding_agent": false
        },
        {
          "oid": "b6ca266ce6cc60f0de786bef036388a71a6cdb53",
          "body": "In various places in the code, fs.IsOwner has been used to verify that\nfiles are root-owned prior to using them in setuid mode.\n\nReplace fs.IsOwner checks, which are based on a path, with\nOpenTrustedFile/Executable that perform the checks on an os.File or\nfile descriptor - returning it for subsequen\n[…]\nritable by their\nowner, not group or world writable.\n\nCodex was used to explore the code for this issue, and produce draft\nchanges that have been manually reviewed and modified.\n\nCo-authored-by: Codex",
          "is_bot": false,
          "headline": "hardening: Use FDs at IsOwner check locations",
          "author_name": "David Trudgian",
          "author_login": "dtrudg",
          "committed_at": "2026-06-11T16:50:10Z",
          "body_truncated": true,
          "is_coding_agent": false
        },
        {
          "oid": "390a5c5dde559b2cecfae1082f59b833550ff804",
          "body": "Rather than using path-based checks to prevent escape from the\ndestination / specified root, use os.Root operations whenever\npossible.\n\nLsetxattr is not supported in a root, so xattrs are still set via a\npath, though this path is previously subject to the root controls for\nthe creation of the file /\n[…]\nodebase,\nand generation of draft changes used Claude code. However, the\nchanges committed here have been re-written by hand. The\nCo-authored-by tag is added on this basis.\n\nCo-authored-by: Claude Code",
          "is_bot": false,
          "headline": "archive: use os.Root when extracting tar files",
          "author_name": "David Trudgian",
          "author_login": "dtrudg",
          "committed_at": "2026-06-11T16:36:45Z",
          "body_truncated": true,
          "is_coding_agent": false
        },
        {
          "oid": "d14743461f0972e9101bdf7d96901e696baef5cb",
          "body": "hardening: use O_NOFOLLOW widely at possible file creation points",
          "is_bot": false,
          "headline": "Merge pull request #4168 from dtrudg/nofollow",
          "author_name": "Dave Trudgian",
          "author_login": "dtrudg",
          "committed_at": "2026-06-11T16:30:11Z",
          "body_truncated": false,
          "is_coding_agent": false
        },
        {
          "oid": "91fd8fcbd676708a767d20d2e9d441e47026067b",
          "body": "We don't want to create any files across a dangling symlink, so use\nO_NOFOLLOW if we have O_CREAT without O_EXCL.\n\nThere isn't really a valid use case for various config files, at\nknown system / user locations, being re-directed by a single\nsymlink. Add O_NOFOLLOW when working with these.\n\nDrop os.Create, in favour of an os.OpenFile with O_NOFOLLOW.\n\nAdd a helper fs.WriteFileNoFollow, which is the same as os.WriteFile\nbut with O_FOLLOW specified. Switch to using this instead of\nos.WriteFile.",
          "is_bot": false,
          "headline": "hardening: use O_NOFOLLOW widely at possible file creation points",
          "author_name": "David Trudgian",
          "author_login": "dtrudg",
          "committed_at": "2026-06-11T16:15:10Z",
          "body_truncated": false,
          "is_coding_agent": false
        },
        {
          "oid": "e512455992967bd4dddb4d841d061c30d9d3b064",
          "body": "layout: ensure VFS operations are rooted in session dir",
          "is_bot": false,
          "headline": "Merge pull request #4167 from dtrudg/vfs-harden",
          "author_name": "Dave Trudgian",
          "author_login": "dtrudg",
          "committed_at": "2026-06-11T15:19:45Z",
          "body_truncated": false,
          "is_coding_agent": false
        },
        {
          "oid": "7fd29f74bc5d055ebc678898098d6a5bd3a128af",
          "body": "chore: refactor loadImages sandbox/SIF handling",
          "is_bot": false,
          "headline": "Merge pull request #4166 from dtrudg/refactor-imageload",
          "author_name": "Dave Trudgian",
          "author_login": "dtrudg",
          "committed_at": "2026-06-11T15:10:27Z",
          "body_truncated": false,
          "is_coding_agent": false
        },
        {
          "oid": "3b697c12b5c9766932d62274f706f8f50370cead",
          "body": "When a container is created using the native runtime, the structure of\nthe session dir is setup using a session manager and VFS functions. In\naddition, the VFS functions are used to create target directories or\nfiles required for nested bind mounts.\n\nPrior to this PR, the VFS operations are not root\n[…]\nd the potential issue,\nand produced draft changes. These were reviewed and modified\nextensively to ensure correct operation was preserved, and that the\ncode is easier to follow.\n\nCo-authored-by: Codex",
          "is_bot": false,
          "headline": "layout: ensure VFS operations are rooted in session dir",
          "author_name": "David Trudgian",
          "author_login": "dtrudg",
          "committed_at": "2026-06-11T14:55:56Z",
          "body_truncated": true,
          "is_coding_agent": false
        },
        {
          "oid": "bb43f85aa083c7b8c94d69234008fff502adb495",
          "body": null,
          "is_bot": false,
          "headline": "Merge pull request #4163 from dtrudg/refactor-nested-bind",
          "author_name": "Dave Trudgian",
          "author_login": "dtrudg",
          "committed_at": "2026-06-11T14:27:15Z",
          "body_truncated": false,
          "is_coding_agent": false
        },
        {
          "oid": "b98f60d05f7498bfab3fa005346d7f09496701d0",
          "body": null,
          "is_bot": false,
          "headline": "Merge pull request #4165 from dtrudg/loop-rpc-fd",
          "author_name": "Dave Trudgian",
          "author_login": "dtrudg",
          "committed_at": "2026-06-11T14:26:52Z",
          "body_truncated": false,
          "is_coding_agent": false
        },
        {
          "oid": "cfb612b1677d6c4e24d29e64856afa487e27ccee",
          "body": "Prior to this PR, the LoopDevice rpc accepted a path for the image to\nattach to a loop device. The only call is from mount_image, which\nalways passes a `/proc/self/fd/X` obtained from the relevant\n`image.Source`, resulting in an fd flow being invoked in the\nLoopDevice rpc.\n\nRemove generic path handl\n[…]\nMove the parsing of the fd value from a `/proc/self/fd/X` string up\ninto the `mountImage` code.\n\nThis simplifies the LoopDevice rpc, and ensures the source image\ncannot be swapped during the rpc call.",
          "is_bot": false,
          "headline": "rpc: only mount from fd in LoopDevice rpc",
          "author_name": "David Trudgian",
          "author_login": "dtrudg",
          "committed_at": "2026-06-11T13:50:04Z",
          "body_truncated": true,
          "is_coding_agent": false
        },
        {
          "oid": "f73b10b2677d386c9b39eb5f9f289f65427b68bb",
          "body": "Split out the sandbox and SIF checks / preparation code into separate\nfunctions, so that loadImages is easier to follow.",
          "is_bot": false,
          "headline": "chore: refactor loadImages sandbox/SIF handling",
          "author_name": "David Trudgian",
          "author_login": "dtrudg",
          "committed_at": "2026-06-11T13:46:53Z",
          "body_truncated": false,
          "is_coding_agent": false
        },
        {
          "oid": "6b4e9fb46cede8f024f593db0158b45045f83352",
          "body": "Prior to adding hardening, via rooted VFS operations, refactor the\ntracking of binds / nested bind points in the layout.Manager.\n\nWhen a bind mount is performed, it overrides a path within the session\nlayout. Prior to this PR, the Manager tracks these paths as keys in the\novDirs map, where the bind \n[…]\nto VFS hardening with Claude Code. These have been\nextracted, manually reviewed, and heavily re-written by hand for this\nPR. The Co-authored-by tag is added on this basis.\n\nCo-authored-by: Claude Code",
          "is_bot": false,
          "headline": "chore: refactor nested bind handling, add tests",
          "author_name": "David Trudgian",
          "author_login": "dtrudg",
          "committed_at": "2026-06-11T09:22:51Z",
          "body_truncated": true,
          "is_coding_agent": false
        },
        {
          "oid": "90e1da56bd9c2954888d6060345cfe28a540d987",
          "body": "chore: tidy up layout.Manager code",
          "is_bot": false,
          "headline": "Merge pull request #4162 from dtrudg/tidy-layout-manager",
          "author_name": "Dave Trudgian",
          "author_login": "dtrudg",
          "committed_at": "2026-06-08T15:30:01Z",
          "body_truncated": false,
          "is_coding_agent": false
        },
        {
          "oid": "ae77e2ad11d19e2c06e067d21ed2b002be12bc26",
          "body": null,
          "is_bot": false,
          "headline": "Merge pull request #4161 from dtrudg/root-rpc",
          "author_name": "Dave Trudgian",
          "author_login": "dtrudg",
          "committed_at": "2026-06-08T14:52:02Z",
          "body_truncated": false,
          "is_coding_agent": false
        },
        {
          "oid": "79200c63c285afa7771cc2ca6aeba800501b2334",
          "body": "util/fs: O_NOFOLLOW for EnsureFileWithPermission",
          "is_bot": false,
          "headline": "Merge pull request #4160 from dtrudg/nofollow-ensurefilewithpermission",
          "author_name": "Dave Trudgian",
          "author_login": "dtrudg",
          "committed_at": "2026-06-08T13:43:18Z",
          "body_truncated": false,
          "is_coding_agent": false
        },
        {
          "oid": "1177b49166992083600b978dffd390fd3176c4c5",
          "body": "Tidy up the layout.Manager code a bit, before we do further\nwork on it.\n\nDrop the VFS interface. We've only ever had, and will only have one\nVFS implementation.\n\nMove the VFS implementation into a separate vfs.go file.\n\nCreate a Manager via NewManager, rather than bare struct. Set the root\npath in NewManager.\n\nIn TestLayout, the session var is actually a Manager... so call it mgr\nto be less confusing!",
          "is_bot": false,
          "headline": "chore: tidy up layout.Manager code",
          "author_name": "David Trudgian",
          "author_login": "dtrudg",
          "committed_at": "2026-06-08T12:49:02Z",
          "body_truncated": false,
          "is_coding_agent": false
        },
        {
          "oid": "9cd7760b842524aa8a4f6b3be32e0028039000c3",
          "body": "The RPC Mount operation can now fail with an error from os.Root. These\nare *PathError, which can be non-exported *errors.errorString under\nthe hood. The RPC gob encoding doesn't handle this, so use a wrapper\nso that the encoding doesn't fail in this case.\n\nSince we make decisions on syscall.Exxx errors, make sure our wrapping\nsatisfies .Is comparisons on these, plus ErrNotExist/ErrPermission.",
          "is_bot": false,
          "headline": "fix:rpc: return os.Root errors properly from Mount",
          "author_name": "David Trudgian",
          "author_login": "dtrudg",
          "committed_at": "2026-06-08T12:39:52Z",
          "body_truncated": false,
          "is_coding_agent": false
        },
        {
          "oid": "5721e10e4a43822dd6c35cc130bc89db0b2ba6ab",
          "body": "Ensure that the RPC Mkdir operation doesn't create a directory outside\nof a root, which can be set to the session directory.\n\nEnsure that the RPC Mount operation doesn't mount to a target that's\noutside of a root, which can be set to the session directory.",
          "is_bot": false,
          "headline": "rpc: root the RPC server Mkdir and Mount operations",
          "author_name": "David Trudgian",
          "author_login": "dtrudg",
          "committed_at": "2026-06-08T12:39:26Z",
          "body_truncated": false,
          "is_coding_agent": false
        },
        {
          "oid": "2b6830d858556888fd1404191b533e58f2035134",
          "body": "…b8e1437d3d\n\nchore(deps): bump github.com/docker/cli from 29.5.2+incompatible to 29.5.3+incompatible in the moby group",
          "is_bot": false,
          "headline": "Merge pull request #4156 from sylabs/dependabot/go_modules/main/moby-…",
          "author_name": "Dave Trudgian",
          "author_login": "dtrudg",
          "committed_at": "2026-06-08T12:35:48Z",
          "body_truncated": false,
          "is_coding_agent": false
        },
        {
          "oid": "a470a4e5a747e39803052c8c7d00c1d44fd6ce58",
          "body": "The fs.EnsureFileWithPermission function is used to ensure that some\nfiles with sensitive content (gpg keyring, remote config) are present\nwith restrictive perms enforced.\n\nAdding O_NOFOLLOW ensures the chmod can't be redirected through a\nsymlink in the final path element. This isn't a big risk, as we are\nonly applying restrictive 0o600 perms via EnsureFilePermission, but is\nworth adding, and is something cursory LLM analysis will pick up.",
          "is_bot": false,
          "headline": "util/fs: O_NOFOLLOW for EnsureFileWithPermission",
          "author_name": "David Trudgian",
          "author_login": "dtrudg",
          "committed_at": "2026-06-08T12:25:35Z",
          "body_truncated": false,
          "is_coding_agent": false
        },
        {
          "oid": "db85ac755623bc0a9a4b36774cca59384c6b269c",
          "body": "Bumps the moby group with 1 update: [github.com/docker/cli](https://github.com/docker/cli).\n\n\nUpdates `github.com/docker/cli` from 29.5.2+incompatible to 29.5.3+incompatible\n- [Commits](https://github.com/docker/cli/compare/v29.5.2...v29.5.3)\n\n---\nupdated-dependencies:\n- dependency-name: github.com/\n[…]\nependency-version: 29.5.3+incompatible\n  dependency-type: direct:production\n  update-type: version-update:semver-patch\n  dependency-group: moby\n...\n\nSigned-off-by: dependabot[bot] <support@github.com>",
          "is_bot": true,
          "headline": "chore(deps): bump github.com/docker/cli in the moby group",
          "author_name": "dependabot[bot]",
          "author_login": "dependabot[bot]",
          "committed_at": "2026-06-05T07:03:12Z",
          "body_truncated": true,
          "is_coding_agent": false
        },
        {
          "oid": "60cfba98b39e4dc9cf6edeb2eeae642062a817c1",
          "body": "chore: merge 4.4.2 release onto main",
          "is_bot": false,
          "headline": "Merge pull request #4154 from dtrudg/merge-4.4.2",
          "author_name": "Dave Trudgian",
          "author_login": "dtrudg",
          "committed_at": "2026-06-04T16:13:16Z",
          "body_truncated": false,
          "is_coding_agent": false
        },
        {
          "oid": "edd64a8d6186d24f871b019263876b937d06bbba",
          "body": null,
          "is_bot": false,
          "headline": "chore: merge 4.4.2 release onto main",
          "author_name": "David Trudgian",
          "author_login": "dtrudg",
          "committed_at": "2026-06-04T15:58:42Z",
          "body_truncated": false,
          "is_coding_agent": false
        },
        {
          "oid": "c7a67865580c6da9c8497bd3ebd81b4c34305a24",
          "body": "fix: limit container paths using path prefix, not string prefix",
          "is_bot": false,
          "headline": "Merge commit from fork",
          "author_name": "Dave Trudgian",
          "author_login": "dtrudg",
          "committed_at": "2026-06-04T14:03:16Z",
          "body_truncated": false,
          "is_coding_agent": false
        },
        {
          "oid": "a2ece658a36c66ae085682cb7bfa11f22d1a8bd8",
          "body": "…-c96715ed81\n\nchore(deps): bump github.com/sylabs/sif/v2 from 2.24.0 to 2.24.1 in the minor group",
          "is_bot": false,
          "headline": "Merge pull request #4147 from sylabs/dependabot/go_modules/main/minor…",
          "author_name": "Dave Trudgian",
          "author_login": "dtrudg",
          "committed_at": "2026-06-03T09:50:33Z",
          "body_truncated": false,
          "is_coding_agent": false
        },
        {
          "oid": "d93368c4432ba7454ae07e95bb1a1da66f65b100",
          "body": "…ontainers-bc1720900b\n\nchore(deps): bump github.com/opencontainers/selinux from 1.15.0 to 1.15.1 in the opencontainers group",
          "is_bot": false,
          "headline": "Merge pull request #4146 from sylabs/dependabot/go_modules/main/openc…",
          "author_name": "Dave Trudgian",
          "author_login": "dtrudg",
          "committed_at": "2026-06-03T09:39:11Z",
          "body_truncated": false,
          "is_coding_agent": false
        },
        {
          "oid": "f7ed217779cf65b6a3aeabd31dda49d9b059a4a8",
          "body": null,
          "is_bot": false,
          "headline": "chore: update LICENSE_DEPENDENCIES.md",
          "author_name": "David Trudgian",
          "author_login": "dtrudg",
          "committed_at": "2026-06-03T09:38:25Z",
          "body_truncated": false,
          "is_coding_agent": false
        },
        {
          "oid": "890f16160bf8d48b1d3e8303c64e9b0ecacb7d01",
          "body": "Bumps the minor group with 1 update: [github.com/sylabs/sif/v2](https://github.com/sylabs/sif).\n\n\nUpdates `github.com/sylabs/sif/v2` from 2.24.0 to 2.24.1\n- [Release notes](https://github.com/sylabs/sif/releases)\n- [Commits](https://github.com/sylabs/sif/compare/v2.24.0...v2.24.1)\n\n---\nupdated-depen\n[…]\ns/sif/v2\n  dependency-version: 2.24.1\n  dependency-type: direct:production\n  update-type: version-update:semver-patch\n  dependency-group: minor\n...\n\nSigned-off-by: dependabot[bot] <support@github.com>",
          "is_bot": true,
          "headline": "chore(deps): bump github.com/sylabs/sif/v2 in the minor group",
          "author_name": "dependabot[bot]",
          "author_login": "dependabot[bot]",
          "committed_at": "2026-06-03T08:33:25Z",
          "body_truncated": true,
          "is_coding_agent": false
        },
        {
          "oid": "653f5d20e45152afdd183ac10644465e8843f90a",
          "body": "Bumps the opencontainers group with 1 update: [github.com/opencontainers/selinux](https://github.com/opencontainers/selinux).\n\n\nUpdates `github.com/opencontainers/selinux` from 1.15.0 to 1.15.1\n- [Release notes](https://github.com/opencontainers/selinux/releases)\n- [Commits](https://github.com/openc\n[…]\n  dependency-version: 1.15.1\n  dependency-type: direct:production\n  update-type: version-update:semver-patch\n  dependency-group: opencontainers\n...\n\nSigned-off-by: dependabot[bot] <support@github.com>",
          "is_bot": true,
          "headline": "chore(deps): bump github.com/opencontainers/selinux",
          "author_name": "dependabot[bot]",
          "author_login": "dependabot[bot]",
          "committed_at": "2026-06-03T08:33:10Z",
          "body_truncated": true,
          "is_coding_agent": false
        },
        {
          "oid": "7a7cb67290da4670e6eaa37739263c029a628540",
          "body": null,
          "is_bot": false,
          "headline": "Merge pull request #4142 from dtrudg/artifact-ggcr",
          "author_name": "Dave Trudgian",
          "author_login": "dtrudg",
          "committed_at": "2026-06-02T07:28:15Z",
          "body_truncated": false,
          "is_coding_agent": false
        },
        {
          "oid": "a281019673d75cddcb3f8d15e94ce64b9f94595a",
          "body": "ggcr now supports OCI artifacts with artifactType properly, and\noci-tools can use this support.\n\nDrop the wrapper we previously used for OCI-SIF / data container code\nhere.",
          "is_bot": false,
          "headline": "ocisif: use oci-tools / ggcr ArtifactType support",
          "author_name": "David Trudgian",
          "author_login": "dtrudg",
          "committed_at": "2026-06-01T16:15:48Z",
          "body_truncated": false,
          "is_coding_agent": false
        },
        {
          "oid": "739d9ef513c9ac0a85620d92602e873c3ceecca9",
          "body": "…-26f288ddc3\n\nchore(deps): bump the minor group with 2 updates",
          "is_bot": false,
          "headline": "Merge pull request #4139 from sylabs/dependabot/go_modules/main/minor…",
          "author_name": "Dave Trudgian",
          "author_login": "dtrudg",
          "committed_at": "2026-06-01T14:02:05Z",
          "body_truncated": false,
          "is_coding_agent": false
        },
        {
          "oid": "90b3319a0e9b4e1ef561a33849b62ff8e667c4a0",
          "body": "In google/go-containerregistry, validation of private / link-local\nauth realms now requires a host:port match with the registry.\n\nWe need to put the auth behind a mux, so it's at the same host:port\ninstead of running at a separate listener.",
          "is_bot": false,
          "headline": "fix: e2e: registry & auth on same port",
          "author_name": "David Trudgian",
          "author_login": "dtrudg",
          "committed_at": "2026-06-01T13:00:40Z",
          "body_truncated": false,
          "is_coding_agent": false
        },
        {
          "oid": "58b34c54217d4c4777b763415d66b645a6bc7854",
          "body": "Bumps the minor group with 2 updates: [github.com/ccoveille/go-safecast/v2](https://github.com/ccoveille/go-safecast) and [github.com/sylabs/oci-tools](https://github.com/sylabs/oci-tools).\n\n\nUpdates `github.com/ccoveille/go-safecast/v2` from 2.0.0 to 2.0.1\n- [Release notes](https://github.com/ccove\n[…]\nci-tools\n  dependency-version: 0.20.0\n  dependency-type: direct:production\n  update-type: version-update:semver-minor\n  dependency-group: minor\n...\n\nSigned-off-by: dependabot[bot] <support@github.com>",
          "is_bot": true,
          "headline": "chore(deps): bump the minor group with 2 updates",
          "author_name": "dependabot[bot]",
          "author_login": "dependabot[bot]",
          "committed_at": "2026-05-29T07:05:14Z",
          "body_truncated": true,
          "is_coding_agent": false
        },
        {
          "oid": "c95bfccc07541b1b8f8a327d4a50da78c908cdea",
          "body": "…/containerd/containerd/v2-2.2.4\n\nchore(deps): bump github.com/containerd/containerd/v2 from 2.2.3 to 2.2.4",
          "is_bot": false,
          "headline": "Merge pull request #4131 from sylabs/dependabot/go_modules/github.com…",
          "author_name": "Dave Trudgian",
          "author_login": "dtrudg",
          "committed_at": "2026-05-27T14:59:42Z",
          "body_truncated": false,
          "is_coding_agent": false
        },
        {
          "oid": "b9694deb2807e3bf07bcd7dcf6f644cb54016f0e",
          "body": "Bumps [github.com/containerd/containerd/v2](https://github.com/containerd/containerd) from 2.2.3 to 2.2.4.\n- [Release notes](https://github.com/containerd/containerd/releases)\n- [Changelog](https://github.com/containerd/containerd/blob/main/RELEASES.md)\n- [Commits](https://github.com/containerd/cont\n[…]\n-\nupdated-dependencies:\n- dependency-name: github.com/containerd/containerd/v2\n  dependency-version: 2.2.4\n  dependency-type: direct:production\n...\n\nSigned-off-by: dependabot[bot] <support@github.com>",
          "is_bot": true,
          "headline": "chore(deps): bump github.com/containerd/containerd/v2",
          "author_name": "dependabot[bot]",
          "author_login": "dependabot[bot]",
          "committed_at": "2026-05-27T13:58:28Z",
          "body_truncated": true,
          "is_coding_agent": false
        },
        {
          "oid": "9391a4615987d9007af16fc951f94f13d7f7f83b",
          "body": "…ontainers-0daac42226\n\nchore(deps): bump github.com/opencontainers/selinux from 1.14.1 to 1.15.0 in the opencontainers group across 1 directory",
          "is_bot": false,
          "headline": "Merge pull request #4133 from sylabs/dependabot/go_modules/main/openc…",
          "author_name": "Dave Trudgian",
          "author_login": "dtrudg",
          "committed_at": "2026-05-27T13:56:26Z",
          "body_truncated": false,
          "is_coding_agent": false
        },
        {
          "oid": "2efea9eaae62be2c3b57f41b8b5726eb2f0fb39a",
          "body": "Bumps the opencontainers group with 1 update in the / directory: [github.com/opencontainers/selinux](https://github.com/opencontainers/selinux).\n\n\nUpdates `github.com/opencontainers/selinux` from 1.14.1 to 1.15.0\n- [Release notes](https://github.com/opencontainers/selinux/releases)\n- [Commits](https\n[…]\n  dependency-version: 1.15.0\n  dependency-type: direct:production\n  update-type: version-update:semver-minor\n  dependency-group: opencontainers\n...\n\nSigned-off-by: dependabot[bot] <support@github.com>",
          "is_bot": true,
          "headline": "chore(deps): bump github.com/opencontainers/selinux",
          "author_name": "dependabot[bot]",
          "author_login": "dependabot[bot]",
          "committed_at": "2026-05-27T13:14:44Z",
          "body_truncated": true,
          "is_coding_agent": false
        },
        {
          "oid": "e2863a74227985870c380bba3c401608622473c3",
          "body": "…-d4124cc10d\n\nchore(deps): bump the minor group across 1 directory with 2 updates",
          "is_bot": false,
          "headline": "Merge pull request #4134 from sylabs/dependabot/go_modules/main/minor…",
          "author_name": "Dave Trudgian",
          "author_login": "dtrudg",
          "committed_at": "2026-05-27T13:12:58Z",
          "body_truncated": false,
          "is_coding_agent": false
        },
        {
          "oid": "74d0b8f307448884cbc315246167bb722ae5f8fc",
          "body": "Bumps the minor group with 1 update in the / directory: [golang.org/x/crypto](https://github.com/golang/crypto).\n\n\nUpdates `golang.org/x/crypto` from 0.51.0 to 0.52.0\n- [Commits](https://github.com/golang/crypto/compare/v0.51.0...v0.52.0)\n\nUpdates `golang.org/x/sys` from 0.44.0 to 0.45.0\n- [Commits]\n[…]\nrg/x/sys\n  dependency-version: 0.45.0\n  dependency-type: direct:production\n  update-type: version-update:semver-minor\n  dependency-group: minor\n...\n\nSigned-off-by: dependabot[bot] <support@github.com>",
          "is_bot": true,
          "headline": "chore(deps): bump the minor group across 1 directory with 2 updates",
          "author_name": "dependabot[bot]",
          "author_login": "dependabot[bot]",
          "committed_at": "2026-05-27T11:07:22Z",
          "body_truncated": true,
          "is_coding_agent": false
        }
      ],
      "releases_count": 68,
      "commits_last_year": 480,
      "latest_release_at": "2026-06-25T10:59:15Z",
      "latest_release_tag": "v4.5.0",
      "releases_from_tags": false,
      "days_since_last_push": 0,
      "active_weeks_last_year": 49,
      "days_since_latest_release": 28,
      "mean_days_between_releases": 41.2
    },
    "community": {
      "has_readme": true,
      "has_license": true,
      "has_description": true,
      "has_contributing": true,
      "health_percentage": 100,
      "has_issue_template": false,
      "has_code_of_conduct": true,
      "has_pull_request_template": true
    },
    "ecosystem": {
      "packages": [
        {
          "name": "github.com/sylabs/singularity/v4",
          "exists": true,
          "license": null,
          "keywords": [],
          "ecosystem": "go",
          "matches_repo": true,
          "registry_url": "https://pkg.go.dev/github.com/sylabs/singularity/v4",
          "is_deprecated": false,
          "latest_version": "v4.5.0",
          "repository_url": "https://github.com/sylabs/singularity",
          "versions_count": 30,
          "total_downloads": null,
          "dependents_count": null,
          "deprecation_note": null,
          "maintainers_count": null,
          "monthly_downloads": null,
          "first_published_at": null,
          "latest_published_at": "2026-06-25T09:33:03Z",
          "latest_version_yanked": null,
          "days_since_latest_publish": 29
        }
      ]
    },
    "popularity": {
      "forks": 119,
      "stars": 984,
      "watchers": 15,
      "fork_history": {
        "days": [
          {
            "date": "2021-05-04",
            "count": 2
          },
          {
            "date": "2021-05-11",
            "count": 1
          },
          {
            "date": "2021-05-12",
            "count": 1
          },
          {
            "date": "2021-05-14",
            "count": 1
          },
          {
            "date": "2021-05-19",
            "count": 1
          },
          {
            "date": "2021-06-08",
            "count": 1
          },
          {
            "date": "2021-06-18",
            "count": 1
          },
          {
            "date": "2021-06-21",
            "count": 1
          },
          {
            "date": "2021-06-27",
            "count": 1
          },
          {
            "date": "2021-07-23",
            "count": 1
          },
          {
            "date": "2021-08-22",
            "count": 1
          },
          {
            "date": "2021-08-26",
            "count": 1
          },
          {
            "date": "2021-08-30",
            "count": 1
          },
          {
            "date": "2021-09-02",
            "count": 1
          },
          {
            "date": "2021-09-03",
            "count": 1
          },
          {
            "date": "2021-09-14",
            "count": 1
          },
          {
            "date": "2021-10-12",
            "count": 1
          },
          {
            "date": "2021-11-25",
            "count": 1
          },
          {
            "date": "2021-12-01",
            "count": 1
          },
          {
            "date": "2021-12-07",
            "count": 1
          },
          {
            "date": "2021-12-09",
            "count": 1
          },
          {
            "date": "2022-02-20",
            "count": 1
          },
          {
            "date": "2022-02-22",
            "count": 1
          },
          {
            "date": "2022-03-17",
            "count": 2
          },
          {
            "date": "2022-03-24",
            "count": 1
          },
          {
            "date": "2022-03-26",
            "count": 1
          },
          {
            "date": "2022-03-27",
            "count": 1
          },
          {
            "date": "2022-03-31",
            "count": 1
          },
          {
            "date": "2022-04-02",
            "count": 1
          },
          {
            "date": "2022-04-07",
            "count": 1
          },
          {
            "date": "2022-04-25",
            "count": 1
          },
          {
            "date": "2022-05-16",
            "count": 1
          },
          {
            "date": "2022-06-09",
            "count": 1
          },
          {
            "date": "2022-06-14",
            "count": 1
          },
          {
            "date": "2022-06-15",
            "count": 1
          },
          {
            "date": "2022-06-16",
            "count": 1
          },
          {
            "date": "2022-06-17",
            "count": 1
          },
          {
            "date": "2022-06-22",
            "count": 1
          },
          {
            "date": "2022-08-01",
            "count": 1
          },
          {
            "date": "2022-08-21",
            "count": 1
          },
          {
            "date": "2022-09-08",
            "count": 1
          },
          {
            "date": "2022-10-05",
            "count": 1
          },
          {
            "date": "2022-11-04",
            "count": 1
          },
          {
            "date": "2022-11-29",
            "count": 1
          },
          {
            "date": "2022-12-04",
            "count": 1
          },
          {
            "date": "2022-12-18",
            "count": 1
          },
          {
            "date": "2022-12-19",
            "count": 1
          },
          {
            "date": "2023-02-09",
            "count": 1
          },
          {
            "date": "2023-02-20",
            "count": 1
          },
          {
            "date": "2023-02-22",
            "count": 2
          },
          {
            "date": "2023-02-28",
            "count": 1
          },
          {
            "date": "2023-03-01",
            "count": 1
          },
          {
            "date": "2023-03-02",
            "count": 2
          },
          {
            "date": "2023-03-29",
            "count": 1
          },
          {
            "date": "2023-04-06",
            "count": 1
          },
          {
            "date": "2023-04-11",
            "count": 1
          },
          {
            "date": "2023-04-15",
            "count": 1
          },
          {
            "date": "2023-06-21",
            "count": 1
          },
          {
            "date": "2023-07-05",
            "count": 1
          },
          {
            "date": "2023-07-07",
            "count": 1
          },
          {
            "date": "2023-08-01",
            "count": 1
          },
          {
            "date": "2023-08-15",
            "count": 1
          },
          {
            "date": "2023-08-31",
            "count": 1
          },
          {
            "date": "2023-09-15",
            "count": 1
          },
          {
            "date": "2023-09-26",
            "count": 1
          },
          {
            "date": "2023-10-23",
            "count": 2
          },
          {
            "date": "2023-10-25",
            "count": 1
          },
          {
            "date": "2023-11-03",
            "count": 1
          },
          {
            "date": "2023-11-13",
            "count": 2
          },
          {
            "date": "2023-12-09",
            "count": 1
          },
          {
            "date": "2023-12-11",
            "count": 1
          },
          {
            "date": "2023-12-23",
            "count": 1
          },
          {
            "date": "2024-02-04",
            "count": 1
          },
          {
            "date": "2024-02-12",
            "count": 1
          },
          {
            "date": "2024-02-25",
            "count": 1
          },
          {
            "date": "2024-03-25",
            "count": 1
          },
          {
            "date": "2024-03-26",
            "count": 1
          },
          {
            "date": "2024-04-23",
            "count": 1
          },
          {
            "date": "2024-05-04",
            "count": 1
          },
          {
            "date": "2024-05-26",
            "count": 1
          },
          {
            "date": "2024-06-01",
            "count": 1
          },
          {
            "date": "2024-06-15",
            "count": 1
          },
          {
            "date": "2024-07-04",
            "count": 1
          },
          {
            "date": "2024-07-06",
            "count": 1
          },
          {
            "date": "2024-07-11",
            "count": 1
          },
          {
            "date": "2024-08-05",
            "count": 1
          },
          {
            "date": "2024-08-16",
            "count": 1
          },
          {
            "date": "2024-09-05",
            "count": 1
          },
          {
            "date": "2024-09-24",
            "count": 1
          },
          {
            "date": "2024-10-05",
            "count": 1
          },
          {
            "date": "2024-12-03",
            "count": 1
          },
          {
            "date": "2024-12-06",
            "count": 1
          },
          {
            "date": "2025-02-25",
            "count": 2
          },
          {
            "date": "2025-03-12",
            "count": 1
          },
          {
            "date": "2025-03-16",
            "count": 1
          },
          {
            "date": "2025-06-17",
            "count": 1
          },
          {
            "date": "2025-07-01",
            "count": 1
          },
          {
            "date": "2025-07-07",
            "count": 1
          },
          {
            "date": "2025-07-10",
            "count": 1
          },
          {
            "date": "2025-08-28",
            "count": 1
          },
          {
            "date": "2025-09-09",
            "count": 1
          },
          {
            "date": "2025-10-25",
            "count": 1
          },
          {
            "date": "2025-10-31",
            "count": 1
          },
          {
            "date": "2025-12-05",
            "count": 1
          },
          {
            "date": "2025-12-24",
            "count": 1
          },
          {
            "date": "2026-03-18",
            "count": 1
          },
          {
            "date": "2026-03-23",
            "count": 1
          },
          {
            "date": "2026-04-05",
            "count": 1
          },
          {
            "date": "2026-06-16",
            "count": 1
          },
          {
            "date": "2026-06-21",
            "count": 1
          },
          {
            "date": "2026-06-25",
            "count": 1
          },
          {
            "date": "2026-07-05",
            "count": 1
          }
        ],
        "complete": true,
        "collected": 119,
        "total_forks": 119
      },
      "star_history": null,
      "open_issues_and_prs": 40
    },
    "ai_readiness": {
      "has_nix": false,
      "example_dirs": [
        "example",
        "examples"
      ],
      "has_llms_txt": false,
      "has_dockerfile": true,
      "has_mcp_signal": false,
      "bootstrap_files": [],
      "api_schema_files": [],
      "has_devcontainer": false,
      "typecheck_configs": [],
      "toolchain_manifests": [
        "go.mod"
      ],
      "largest_source_bytes": 90986,
      "source_files_sampled": 544,
      "oversized_source_files": 4,
      "agent_instruction_files": [
        "AGENTS.md",
        "CLAUDE.md"
      ],
      "agent_instruction_max_bytes": 6883
    },
    "dependencies": {
      "manifests": [
        "go.mod"
      ],
      "advisories": {
        "error": null,
        "scope": "repository_graph",
        "source": "osv",
        "findings": [
          {
            "name": "github.com/distribution/distribution",
            "direct": true,
            "version": "v2.8.3+incompatible",
            "severity": "high",
            "ecosystem": "go",
            "cvss_score": 7.5,
            "advisory_ids": [
              "GHSA-3p65-76g6-3w7r",
              "GHSA-6pjf-3r9x-m592",
              "GHSA-f2g3-hh2r-cwgc",
              "GO-2025-3460",
              "GO-2026-5094",
              "GO-2026-5185"
            ],
            "fixed_version": "3.1.1",
            "advisory_count": 6,
            "oldest_advisory_days": 507
          },
          {
            "name": "github.com/sylabs/singularity",
            "direct": false,
            "version": "0.0.0",
            "severity": "high",
            "ecosystem": "go",
            "cvss_score": 8.8,
            "advisory_ids": [
              "GHSA-jv9c-w74q-6762",
              "GHSA-wqcr-7rf3-f64m",
              "GO-2025-4177",
              "GO-2026-5715"
            ],
            "fixed_version": "4.4.2",
            "advisory_count": 4,
            "oldest_advisory_days": 1886
          },
          {
            "name": "github.com/ulikunitz/xz",
            "direct": false,
            "version": "v0.5.14",
            "severity": "moderate",
            "ecosystem": "go",
            "cvss_score": 5.3,
            "advisory_ids": [
              "GHSA-jc7w-c686-c4v9",
              "GO-2025-3922"
            ],
            "fixed_version": "0.5.15",
            "advisory_count": 2,
            "oldest_advisory_days": 329
          },
          {
            "name": "github.com/sigstore/cosign/v2",
            "direct": true,
            "version": "v2.6.4",
            "severity": "unknown",
            "ecosystem": "go",
            "cvss_score": null,
            "advisory_ids": [
              "GO-2026-4529"
            ],
            "fixed_version": "3.0.5",
            "advisory_count": 1,
            "oldest_advisory_days": 150
          },
          {
            "name": "golang.org/x/crypto",
            "direct": true,
            "version": "v0.54.0",
            "severity": "unknown",
            "ecosystem": "go",
            "cvss_score": null,
            "advisory_ids": [
              "GO-2026-5932"
            ],
            "fixed_version": null,
            "advisory_count": 1,
            "oldest_advisory_days": 16
          }
        ],
        "collected": true,
        "malicious": [],
        "truncated": false,
        "by_severity": {
          "high": 2,
          "unknown": 2,
          "moderate": 1
        },
        "advisory_count": 14,
        "affected_count": 5,
        "assessed_count": 282,
        "malicious_count": 0,
        "assessed_package": null,
        "unassessed_count": 0,
        "direct_affected_count": 3
      },
      "ecosystems": [
        "go"
      ],
      "dependencies": [
        {
          "name": "github.com/Netflix/go-expect",
          "manifest": "go.mod",
          "ecosystem": "go",
          "version_constraint": "v0.0.0-20220104043353-73e0943537d2"
        },
        {
          "name": "github.com/ProtonMail/go-crypto",
          "manifest": "go.mod",
          "ecosystem": "go",
          "version_constraint": "v1.4.1"
        },
        {
          "name": "github.com/adigunhammedolalekan/registry-auth",
          "manifest": "go.mod",
          "ecosystem": "go",
          "version_constraint": "v0.0.0-20200730122110-8cde180a3a60"
        },
        {
          "name": "github.com/apex/log",
          "manifest": "go.mod",
          "ecosystem": "go",
          "version_constraint": "v1.9.0"
        },
        {
          "name": "github.com/astromechza/etcpwdparse",
          "manifest": "go.mod",
          "ecosystem": "go",
          "version_constraint": "v0.0.0-20170319193008-f0e5f0779716"
        },
        {
          "name": "github.com/blang/semver/v4",
          "manifest": "go.mod",
          "ecosystem": "go",
          "version_constraint": "v4.0.0"
        },
        {
          "name": "github.com/buger/goterm",
          "manifest": "go.mod",
          "ecosystem": "go",
          "version_constraint": "v1.0.4"
        },
        {
          "name": "github.com/buger/jsonparser",
          "manifest": "go.mod",
          "ecosystem": "go",
          "version_constraint": "v1.2.0"
        },
        {
          "name": "github.com/ccoveille/go-safecast/v2",
          "manifest": "go.mod",
          "ecosystem": "go",
          "version_constraint": "v2.0.1"
        },
        {
          "name": "github.com/containerd/containerd/v2",
          "manifest": "go.mod",
          "ecosystem": "go",
          "version_constraint": "v2.2.6"
        },
        {
          "name": "github.com/containerd/go-runc",
          "manifest": "go.mod",
          "ecosystem": "go",
          "version_constraint": "v1.1.0"
        },
        {
          "name": "github.com/containerd/platforms",
          "manifest": "go.mod",
          "ecosystem": "go",
          "version_constraint": "v1.0.0-rc.4"
        },
        {
          "name": "github.com/containernetworking/cni",
          "manifest": "go.mod",
          "ecosystem": "go",
          "version_constraint": "v1.3.0"
        },
        {
          "name": "github.com/containernetworking/plugins",
          "manifest": "go.mod",
          "ecosystem": "go",
          "version_constraint": "v1.9.1"
        },
        {
          "name": "github.com/containers/image/v5",
          "manifest": "go.mod",
          "ecosystem": "go",
          "version_constraint": "v5.36.2"
        },
        {
          "name": "github.com/coreos/go-systemd/v22",
          "manifest": "go.mod",
          "ecosystem": "go",
          "version_constraint": "v22.7.0"
        },
        {
          "name": "github.com/cyphar/filepath-securejoin",
          "manifest": "go.mod",
          "ecosystem": "go",
          "version_constraint": "v0.7.0"
        },
        {
          "name": "github.com/distribution/distribution",
          "manifest": "go.mod",
          "ecosystem": "go",
          "version_constraint": "v2.8.3+incompatible"
        },
        {
          "name": "github.com/docker/cli",
          "manifest": "go.mod",
          "ecosystem": "go",
          "version_constraint": "v29.6.2+incompatible"
        },
        {
          "name": "github.com/docker/distribution",
          "manifest": "go.mod",
          "ecosystem": "go",
          "version_constraint": "v2.8.3+incompatible"
        },
        {
          "name": "github.com/docker/go-units",
          "manifest": "go.mod",
          "ecosystem": "go",
          "version_constraint": "v0.5.0"
        },
        {
          "name": "github.com/fatih/color",
          "manifest": "go.mod",
          "ecosystem": "go",
          "version_constraint": "v1.19.0"
        },
        {
          "name": "github.com/go-log/log",
          "manifest": "go.mod",
          "ecosystem": "go",
          "version_constraint": "v0.2.0"
        },
        {
          "name": "github.com/gofrs/flock",
          "manifest": "go.mod",
          "ecosystem": "go",
          "version_constraint": "v0.13.0"
        },
        {
          "name": "github.com/google/go-containerregistry",
          "manifest": "go.mod",
          "ecosystem": "go",
          "version_constraint": "v0.21.6"
        },
        {
          "name": "github.com/google/uuid",
          "manifest": "go.mod",
          "ecosystem": "go",
          "version_constraint": "v1.6.0"
        },
        {
          "name": "github.com/gorilla/mux",
          "manifest": "go.mod",
          "ecosystem": "go",
          "version_constraint": "v1.8.1"
        },
        {
          "name": "github.com/gosimple/slug",
          "manifest": "go.mod",
          "ecosystem": "go",
          "version_constraint": "v1.15.0"
        },
        {
          "name": "github.com/moby/buildkit",
          "manifest": "go.mod",
          "ecosystem": "go",
          "version_constraint": "v0.31.2"
        },
        {
          "name": "github.com/moby/go-archive",
          "manifest": "go.mod",
          "ecosystem": "go",
          "version_constraint": "v0.2.0"
        },
        {
          "name": "github.com/moby/moby/client",
          "manifest": "go.mod",
          "ecosystem": "go",
          "version_constraint": "v0.5.0"
        },
        {
          "name": "github.com/moby/profiles/seccomp",
          "manifest": "go.mod",
          "ecosystem": "go",
          "version_constraint": "v0.2.3"
        },
        {
          "name": "github.com/moby/sys/user",
          "manifest": "go.mod",
          "ecosystem": "go",
          "version_constraint": "v0.4.1"
        },
        {
          "name": "github.com/moby/sys/userns",
          "manifest": "go.mod",
          "ecosystem": "go",
          "version_constraint": "v0.1.0"
        },
        {
          "name": "github.com/moby/term",
          "manifest": "go.mod",
          "ecosystem": "go",
          "version_constraint": "v0.5.2"
        },
        {
          "name": "github.com/opencontainers/cgroups",
          "manifest": "go.mod",
          "ecosystem": "go",
          "version_constraint": "v0.0.6"
        },
        {
          "name": "github.com/opencontainers/image-spec",
          "manifest": "go.mod",
          "ecosystem": "go",
          "version_constraint": "v1.1.1"
        },
        {
          "name": "github.com/opencontainers/runc",
          "manifest": "go.mod",
          "ecosystem": "go",
          "version_constraint": "v1.5.1"
        },
        {
          "name": "github.com/opencontainers/runtime-spec",
          "manifest": "go.mod",
          "ecosystem": "go",
          "version_constraint": "v1.3.0"
        },
        {
          "name": "github.com/opencontainers/runtime-tools",
          "manifest": "go.mod",
          "ecosystem": "go",
          "version_constraint": "v0.9.1-0.20251205004911-5e639034dcdc"
        },
        {
          "name": "github.com/opencontainers/selinux",
          "manifest": "go.mod",
          "ecosystem": "go",
          "version_constraint": "v1.15.1"
        },
        {
          "name": "github.com/opencontainers/umoci",
          "manifest": "go.mod",
          "ecosystem": "go",
          "version_constraint": "v0.6.0"
        },
        {
          "name": "github.com/pelletier/go-toml/v2",
          "manifest": "go.mod",
          "ecosystem": "go",
          "version_constraint": "v2.4.3"
        },
        {
          "name": "github.com/samber/lo",
          "manifest": "go.mod",
          "ecosystem": "go",
          "version_constraint": "v1.53.0"
        },
        {
          "name": "github.com/sebdah/goldie/v2",
          "manifest": "go.mod",
          "ecosystem": "go",
          "version_constraint": "v2.8.0"
        },
        {
          "name": "github.com/seccomp/libseccomp-golang",
          "manifest": "go.mod",
          "ecosystem": "go",
          "version_constraint": "v0.11.1"
        },
        {
          "name": "github.com/shopspring/decimal",
          "manifest": "go.mod",
          "ecosystem": "go",
          "version_constraint": "v1.4.0"
        },
        {
          "name": "github.com/sigstore/cosign/v2",
          "manifest": "go.mod",
          "ecosystem": "go",
          "version_constraint": "v2.6.4"
        },
        {
          "name": "github.com/sigstore/sigstore",
          "manifest": "go.mod",
          "ecosystem": "go",
          "version_constraint": "v1.10.8"
        },
        {
          "name": "github.com/sirupsen/logrus",
          "manifest": "go.mod",
          "ecosystem": "go",
          "version_constraint": "v1.9.4"
        },
        {
          "name": "github.com/spf13/cobra",
          "manifest": "go.mod",
          "ecosystem": "go",
          "version_constraint": "v1.10.2"
        },
        {
          "name": "github.com/spf13/pflag",
          "manifest": "go.mod",
          "ecosystem": "go",
          "version_constraint": "v1.0.10"
        },
        {
          "name": "github.com/stretchr/testify",
          "manifest": "go.mod",
          "ecosystem": "go",
          "version_constraint": "v1.11.1"
        },
        {
          "name": "github.com/sylabs/json-resp",
          "manifest": "go.mod",
          "ecosystem": "go",
          "version_constraint": "v0.9.5"
        },
        {
          "name": "github.com/sylabs/oci-tools",
          "manifest": "go.mod",
          "ecosystem": "go",
          "version_constraint": "v0.20.0"
        },
        {
          "name": "github.com/sylabs/scs-build-client",
          "manifest": "go.mod",
          "ecosystem": "go",
          "version_constraint": "v0.9.22"
        },
        {
          "name": "github.com/sylabs/scs-key-client",
          "manifest": "go.mod",
          "ecosystem": "go",
          "version_constraint": "v0.7.9"
        },
        {
          "name": "github.com/sylabs/scs-library-client",
          "manifest": "go.mod",
          "ecosystem": "go",
          "version_constraint": "v1.4.16"
        },
        {
          "name": "github.com/sylabs/sif/v2",
          "manifest": "go.mod",
          "ecosystem": "go",
          "version_constraint": "v2.24.1"
        },
        {
          "name": "github.com/sylabs/squashfs",
          "manifest": "go.mod",
          "ecosystem": "go",
          "version_constraint": "v1.0.6"
        },
        {
          "name": "github.com/tonistiigi/fsutil",
          "manifest": "go.mod",
          "ecosystem": "go",
          "version_constraint": "v0.0.0-20260716115106-30cd4fc5d911"
        },
        {
          "name": "github.com/vbauerster/mpb/v8",
          "manifest": "go.mod",
          "ecosystem": "go",
          "version_constraint": "v8.13.0"
        },
        {
          "name": "go.etcd.io/bbolt",
          "manifest": "go.mod",
          "ecosystem": "go",
          "version_constraint": "v1.5.0"
        },
        {
          "name": "go.yaml.in/yaml/v4",
          "manifest": "go.mod",
          "ecosystem": "go",
          "version_constraint": "v4.0.0-rc.6"
        },
        {
          "name": "golang.org/x/crypto",
          "manifest": "go.mod",
          "ecosystem": "go",
          "version_constraint": "v0.54.0"
        },
        {
          "name": "golang.org/x/sync",
          "manifest": "go.mod",
          "ecosystem": "go",
          "version_constraint": "v0.22.0"
        },
        {
          "name": "golang.org/x/sys",
          "manifest": "go.mod",
          "ecosystem": "go",
          "version_constraint": "v0.47.0"
        },
        {
          "name": "golang.org/x/term",
          "manifest": "go.mod",
          "ecosystem": "go",
          "version_constraint": "v0.45.0"
        },
        {
          "name": "golang.org/x/text",
          "manifest": "go.mod",
          "ecosystem": "go",
          "version_constraint": "v0.40.0"
        },
        {
          "name": "google.golang.org/grpc",
          "manifest": "go.mod",
          "ecosystem": "go",
          "version_constraint": "v1.82.1"
        },
        {
          "name": "mvdan.cc/sh/v3",
          "manifest": "go.mod",
          "ecosystem": "go",
          "version_constraint": "v3.13.0"
        },
        {
          "name": "tags.cncf.io/container-device-interface",
          "manifest": "go.mod",
          "ecosystem": "go",
          "version_constraint": "v1.1.0"
        },
        {
          "name": "tags.cncf.io/container-device-interface/specs-go",
          "manifest": "go.mod",
          "ecosystem": "go",
          "version_constraint": "v1.1.0"
        }
      ],
      "all_dependencies": {
        "error": null,
        "source": "github-sbom",
        "packages": [
          {
            "name": "github.com/adigunhammedolalekan/registry-auth",
            "direct": true,
            "version": "v0.0.0-20200730122110-8cde180a3a60",
            "ecosystem": "go"
          },
          {
            "name": "github.com/apex/log",
            "direct": true,
            "version": "v1.9.0",
            "ecosystem": "go"
          },
          {
            "name": "github.com/astromechza/etcpwdparse",
            "direct": true,
            "version": "v0.0.0-20170319193008-f0e5f0779716",
            "ecosystem": "go"
          },
          {
            "name": "github.com/blang/semver/v4",
            "direct": true,
            "version": "v4.0.0",
            "ecosystem": "go"
          },
          {
            "name": "github.com/buger/goterm",
            "direct": true,
            "version": "v1.0.4",
            "ecosystem": "go"
          },
          {
            "name": "github.com/buger/jsonparser",
            "direct": true,
            "version": "v1.2.0",
            "ecosystem": "go"
          },
          {
            "name": "github.com/ccoveille/go-safecast/v2",
            "direct": true,
            "version": "v2.0.1",
            "ecosystem": "go"
          },
          {
            "name": "github.com/containerd/containerd/v2",
            "direct": true,
            "version": "v2.2.6",
            "ecosystem": "go"
          },
          {
            "name": "github.com/containerd/go-runc",
            "direct": true,
            "version": "v1.1.0",
            "ecosystem": "go"
          },
          {
            "name": "github.com/containerd/platforms",
            "direct": true,
            "version": "v1.0.0-rc.4",
            "ecosystem": "go"
          },
          {
            "name": "github.com/containernetworking/cni",
            "direct": true,
            "version": "v1.3.0",
            "ecosystem": "go"
          },
          {
            "name": "github.com/containernetworking/plugins",
            "direct": true,
            "version": "v1.9.1",
            "ecosystem": "go"
          },
          {
            "name": "github.com/containers/image/v5",
            "direct": true,
            "version": "v5.36.2",
            "ecosystem": "go"
          },
          {
            "name": "github.com/coreos/go-systemd/v22",
            "direct": true,
            "version": "v22.7.0",
            "ecosystem": "go"
          },
          {
            "name": "github.com/cyphar/filepath-securejoin",
            "direct": true,
            "version": "v0.7.0",
            "ecosystem": "go"
          },
          {
            "name": "github.com/distribution/distribution",
            "direct": true,
            "version": "v2.8.3+incompatible",
            "ecosystem": "go"
          },
          {
            "name": "github.com/docker/cli",
            "direct": true,
            "version": "v29.6.2+incompatible",
            "ecosystem": "go"
          },
          {
            "name": "github.com/docker/distribution",
            "direct": true,
            "version": "v2.8.3+incompatible",
            "ecosystem": "go"
          },
          {
            "name": "github.com/docker/go-units",
            "direct": true,
            "version": "v0.5.0",
            "ecosystem": "go"
          },
          {
            "name": "github.com/fatih/color",
            "direct": true,
            "version": "v1.19.0",
            "ecosystem": "go"
          },
          {
            "name": "github.com/go-log/log",
            "direct": true,
            "version": "v0.2.0",
            "ecosystem": "go"
          },
          {
            "name": "github.com/gofrs/flock",
            "direct": true,
            "version": "v0.13.0",
            "ecosystem": "go"
          },
          {
            "name": "github.com/google/go-containerregistry",
            "direct": true,
            "version": "v0.21.6",
            "ecosystem": "go"
          },
          {
            "name": "github.com/google/uuid",
            "direct": true,
            "version": "v1.6.0",
            "ecosystem": "go"
          },
          {
            "name": "github.com/gorilla/mux",
            "direct": true,
            "version": "v1.8.1",
            "ecosystem": "go"
          },
          {
            "name": "github.com/gosimple/slug",
            "direct": true,
            "version": "v1.15.0",
            "ecosystem": "go"
          },
          {
            "name": "github.com/moby/buildkit",
            "direct": true,
            "version": "v0.31.2",
            "ecosystem": "go"
          },
          {
            "name": "github.com/moby/go-archive",
            "direct": true,
            "version": "v0.2.0",
            "ecosystem": "go"
          },
          {
            "name": "github.com/moby/moby/client",
            "direct": true,
            "version": "v0.5.0",
            "ecosystem": "go"
          },
          {
            "name": "github.com/moby/profiles/seccomp",
            "direct": true,
            "version": "v0.2.3",
            "ecosystem": "go"
          },
          {
            "name": "github.com/moby/sys/user",
            "direct": true,
            "version": "v0.4.1",
            "ecosystem": "go"
          },
          {
            "name": "github.com/moby/sys/userns",
            "direct": true,
            "version": "v0.1.0",
            "ecosystem": "go"
          },
          {
            "name": "github.com/moby/term",
            "direct": true,
            "version": "v0.5.2",
            "ecosystem": "go"
          },
          {
            "name": "github.com/netflix/go-expect",
            "direct": true,
            "version": "v0.0.0-20220104043353-73e0943537d2",
            "ecosystem": "go"
          },
          {
            "name": "github.com/opencontainers/cgroups",
            "direct": true,
            "version": "v0.0.6",
            "ecosystem": "go"
          },
          {
            "name": "github.com/opencontainers/image-spec",
            "direct": true,
            "version": "v1.1.1",
            "ecosystem": "go"
          },
          {
            "name": "github.com/opencontainers/runc",
            "direct": true,
            "version": "v1.5.1",
            "ecosystem": "go"
          },
          {
            "name": "github.com/opencontainers/runtime-spec",
            "direct": true,
            "version": "v1.3.0",
            "ecosystem": "go"
          },
          {
            "name": "github.com/opencontainers/runtime-tools",
            "direct": true,
            "version": "v0.9.1-0.20251205004911-5e639034dcdc",
            "ecosystem": "go"
          },
          {
            "name": "github.com/opencontainers/selinux",
            "direct": true,
            "version": "v1.15.1",
            "ecosystem": "go"
          },
          {
            "name": "github.com/opencontainers/umoci",
            "direct": true,
            "version": "v0.6.0",
            "ecosystem": "go"
          },
          {
            "name": "github.com/pelletier/go-toml/v2",
            "direct": true,
            "version": "v2.4.3",
            "ecosystem": "go"
          },
          {
            "name": "github.com/protonmail/go-crypto",
            "direct": true,
            "version": "v1.4.1",
            "ecosystem": "go"
          },
          {
            "name": "github.com/samber/lo",
            "direct": true,
            "version": "v1.53.0",
            "ecosystem": "go"
          },
          {
            "name": "github.com/sebdah/goldie/v2",
            "direct": true,
            "version": "v2.8.0",
            "ecosystem": "go"
          },
          {
            "name": "github.com/seccomp/libseccomp-golang",
            "direct": true,
            "version": "v0.11.1",
            "ecosystem": "go"
          },
          {
            "name": "github.com/shopspring/decimal",
            "direct": true,
            "version": "v1.4.0",
            "ecosystem": "go"
          },
          {
            "name": "github.com/sigstore/cosign/v2",
            "direct": true,
            "version": "v2.6.4",
            "ecosystem": "go"
          },
          {
            "name": "github.com/sigstore/sigstore",
            "direct": true,
            "version": "v1.10.8",
            "ecosystem": "go"
          },
          {
            "name": "github.com/sirupsen/logrus",
            "direct": true,
            "version": "v1.9.4",
            "ecosystem": "go"
          },
          {
            "name": "github.com/spf13/cobra",
            "direct": true,
            "version": "1.1.3",
            "ecosystem": "go"
          },
          {
            "name": "github.com/spf13/cobra",
            "direct": true,
            "version": "v1.10.2",
            "ecosystem": "go"
          },
          {
            "name": "github.com/spf13/pflag",
            "direct": true,
            "version": "v1.0.10",
            "ecosystem": "go"
          },
          {
            "name": "github.com/stretchr/testify",
            "direct": true,
            "version": "v1.11.1",
            "ecosystem": "go"
          },
          {
            "name": "github.com/sylabs/json-resp",
            "direct": true,
            "version": "v0.9.5",
            "ecosystem": "go"
          },
          {
            "name": "github.com/sylabs/oci-tools",
            "direct": true,
            "version": "v0.20.0",
            "ecosystem": "go"
          },
          {
            "name": "github.com/sylabs/scs-build-client",
            "direct": true,
            "version": "v0.9.22",
            "ecosystem": "go"
          },
          {
            "name": "github.com/sylabs/scs-key-client",
            "direct": true,
            "version": "v0.7.9",
            "ecosystem": "go"
          },
          {
            "name": "github.com/sylabs/scs-library-client",
            "direct": true,
            "version": "v1.4.16",
            "ecosystem": "go"
          },
          {
            "name": "github.com/sylabs/sif/v2",
            "direct": true,
            "version": "v2.24.1",
            "ecosystem": "go"
          },
          {
            "name": "github.com/sylabs/squashfs",
            "direct": true,
            "version": "v1.0.6",
            "ecosystem": "go"
          },
          {
            "name": "github.com/tonistiigi/fsutil",
            "direct": true,
            "version": "v0.0.0-20260716115106-30cd4fc5d911",
            "ecosystem": "go"
          },
          {
            "name": "github.com/vbauerster/mpb/v8",
            "direct": true,
            "version": "v8.13.0",
            "ecosystem": "go"
          },
          {
            "name": "go.etcd.io/bbolt",
            "direct": true,
            "version": "v1.5.0",
            "ecosystem": "go"
          },
          {
            "name": "go.yaml.in/yaml/v4",
            "direct": true,
            "version": "v4.0.0-rc.6",
            "ecosystem": "go"
          },
          {
            "name": "golang.org/x/crypto",
            "direct": true,
            "version": "v0.54.0",
            "ecosystem": "go"
          },
          {
            "name": "golang.org/x/sync",
            "direct": true,
            "version": "v0.22.0",
            "ecosystem": "go"
          },
          {
            "name": "golang.org/x/sys",
            "direct": true,
            "version": "v0.47.0",
            "ecosystem": "go"
          },
          {
            "name": "golang.org/x/term",
            "direct": true,
            "version": "v0.45.0",
            "ecosystem": "go"
          },
          {
            "name": "golang.org/x/text",
            "direct": true,
            "version": "v0.40.0",
            "ecosystem": "go"
          },
          {
            "name": "google.golang.org/grpc",
            "direct": true,
            "version": "v1.82.1",
            "ecosystem": "go"
          },
          {
            "name": "mvdan.cc/sh/v3",
            "direct": true,
            "version": "v3.13.0",
            "ecosystem": "go"
          },
          {
            "name": "tags.cncf.io/container-device-interface",
            "direct": true,
            "version": "v1.1.0",
            "ecosystem": "go"
          },
          {
            "name": "tags.cncf.io/container-device-interface/specs-go",
            "direct": true,
            "version": "v1.1.0",
            "ecosystem": "go"
          },
          {
            "name": "cyphar.com/go-pathrs",
            "direct": false,
            "version": "v0.2.5",
            "ecosystem": "go"
          },
          {
            "name": "github.com/acarl005/stripansi",
            "direct": false,
            "version": "v0.0.0-20180116102854-5a71ef0e047d",
            "ecosystem": "go"
          },
          {
            "name": "github.com/adalogics/go-fuzz-headers",
            "direct": false,
            "version": "v0.0.0-20240806141605-e8a1dd7889d6",
            "ecosystem": "go"
          },
          {
            "name": "github.com/agext/levenshtein",
            "direct": false,
            "version": "v1.2.3",
            "ecosystem": "go"
          },
          {
            "name": "github.com/alexflint/go-filemutex",
            "direct": false,
            "version": "v1.3.0",
            "ecosystem": "go"
          },
          {
            "name": "github.com/anchore/go-struct-converter",
            "direct": false,
            "version": "v0.1.0",
            "ecosystem": "go"
          },
          {
            "name": "github.com/armon/circbuf",
            "direct": false,
            "version": "v0.0.0-20190214190532-5111143e8da2",
            "ecosystem": "go"
          },
          {
            "name": "github.com/asaskevich/govalidator",
            "direct": false,
            "version": "v0.0.0-20230301143203-a9d515a09cc2",
            "ecosystem": "go"
          },
          {
            "name": "github.com/azure/go-ansiterm",
            "direct": false,
            "version": "v0.0.0-20250102033503-faa5f7b0171c",
            "ecosystem": "go"
          },
          {
            "name": "github.com/beorn7/perks",
            "direct": false,
            "version": "v1.0.1",
            "ecosystem": "go"
          },
          {
            "name": "github.com/blang/semver",
            "direct": false,
            "version": "v3.5.1+incompatible",
            "ecosystem": "go"
          },
          {
            "name": "github.com/cenkalti/backoff/v5",
            "direct": false,
            "version": "v5.0.3",
            "ecosystem": "go"
          },
          {
            "name": "github.com/cespare/xxhash/v2",
            "direct": false,
            "version": "v2.3.0",
            "ecosystem": "go"
          },
          {
            "name": "github.com/cilium/ebpf",
            "direct": false,
            "version": "v0.17.3",
            "ecosystem": "go"
          },
          {
            "name": "github.com/clipperhouse/uax29/v2",
            "direct": false,
            "version": "v2.7.0",
            "ecosystem": "go"
          },
          {
            "name": "github.com/cloudflare/circl",
            "direct": false,
            "version": "v1.6.3",
            "ecosystem": "go"
          },
          {
            "name": "github.com/containerd/accelerated-container-image",
            "direct": false,
            "version": "v1.3.0",
            "ecosystem": "go"
          },
          {
            "name": "github.com/containerd/cgroups/v3",
            "direct": false,
            "version": "v3.1.3",
            "ecosystem": "go"
          },
          {
            "name": "github.com/containerd/console",
            "direct": false,
            "version": "v1.0.5",
            "ecosystem": "go"
          },
          {
            "name": "github.com/containerd/containerd/api",
            "direct": false,
            "version": "v1.10.0",
            "ecosystem": "go"
          },
          {
            "name": "github.com/containerd/continuity",
            "direct": false,
            "version": "v0.5.0",
            "ecosystem": "go"
          },
          {
            "name": "github.com/containerd/errdefs",
            "direct": false,
            "version": "v1.0.0",
            "ecosystem": "go"
          },
          {
            "name": "github.com/containerd/errdefs/pkg",
            "direct": false,
            "version": "v0.3.0",
            "ecosystem": "go"
          },
          {
            "name": "github.com/containerd/fifo",
            "direct": false,
            "version": "v1.1.0",
            "ecosystem": "go"
          },
          {
            "name": "github.com/containerd/go-cni",
            "direct": false,
            "version": "v1.1.13",
            "ecosystem": "go"
          },
          {
            "name": "github.com/containerd/log",
            "direct": false,
            "version": "v0.1.0",
            "ecosystem": "go"
          },
          {
            "name": "github.com/containerd/nydus-snapshotter",
            "direct": false,
            "version": "v0.15.15",
            "ecosystem": "go"
          },
          {
            "name": "github.com/containerd/stargz-snapshotter/estargz",
            "direct": false,
            "version": "v0.18.2",
            "ecosystem": "go"
          },
          {
            "name": "github.com/containerd/ttrpc",
            "direct": false,
            "version": "v1.2.8",
            "ecosystem": "go"
          },
          {
            "name": "github.com/containerd/typeurl/v2",
            "direct": false,
            "version": "v2.3.0",
            "ecosystem": "go"
          },
          {
            "name": "github.com/containers/storage",
            "direct": false,
            "version": "v1.59.1",
            "ecosystem": "go"
          },
          {
            "name": "github.com/coreos/go-iptables",
            "direct": false,
            "version": "v0.8.0",
            "ecosystem": "go"
          },
          {
            "name": "github.com/coreos/go-oidc/v3",
            "direct": false,
            "version": "v3.17.0",
            "ecosystem": "go"
          },
          {
            "name": "github.com/cpuguy83/go-md2man/v2",
            "direct": false,
            "version": "v2.0.7",
            "ecosystem": "go"
          },
          {
            "name": "github.com/creack/pty",
            "direct": false,
            "version": "v1.1.24",
            "ecosystem": "go"
          },
          {
            "name": "github.com/cyberphone/json-canonicalization",
            "direct": false,
            "version": "v0.0.0-20241213102144-19d51d7fe467",
            "ecosystem": "go"
          },
          {
            "name": "github.com/davecgh/go-spew",
            "direct": false,
            "version": "v1.1.2-0.20180830191138-d8f796af33cc",
            "ecosystem": "go"
          },
          {
            "name": "github.com/digitorus/pkcs7",
            "direct": false,
            "version": "v0.0.0-20250730155240-ffadbf3f398c",
            "ecosystem": "go"
          },
          {
            "name": "github.com/digitorus/timestamp",
            "direct": false,
            "version": "v0.0.0-20250524132541-c45532741eea",
            "ecosystem": "go"
          },
          {
            "name": "github.com/distribution/reference",
            "direct": false,
            "version": "v0.6.0",
            "ecosystem": "go"
          },
          {
            "name": "github.com/docker/docker-credential-helpers",
            "direct": false,
            "version": "v0.9.8",
            "ecosystem": "go"
          },
          {
            "name": "github.com/docker/go-connections",
            "direct": false,
            "version": "v0.7.0",
            "ecosystem": "go"
          },
          {
            "name": "github.com/docker/go-metrics",
            "direct": false,
            "version": "v0.0.1",
            "ecosystem": "go"
          },
          {
            "name": "github.com/docker/libtrust",
            "direct": false,
            "version": "v0.0.0-20160708172513-aabc10ec26b7",
            "ecosystem": "go"
          },
          {
            "name": "github.com/dustin/go-humanize",
            "direct": false,
            "version": "v1.0.1",
            "ecosystem": "go"
          },
          {
            "name": "github.com/felixge/httpsnoop",
            "direct": false,
            "version": "v1.0.4",
            "ecosystem": "go"
          },
          {
            "name": "github.com/fsnotify/fsnotify",
            "direct": false,
            "version": "v1.9.0",
            "ecosystem": "go"
          },
          {
            "name": "github.com/garyburd/redigo",
            "direct": false,
            "version": "v1.6.4",
            "ecosystem": "go"
          },
          {
            "name": "github.com/go-chi/chi/v5",
            "direct": false,
            "version": "v5.3.0",
            "ecosystem": "go"
          },
          {
            "name": "github.com/go-jose/go-jose/v4",
            "direct": false,
            "version": "v4.1.4",
            "ecosystem": "go"
          },
          {
            "name": "github.com/go-logr/logr",
            "direct": false,
            "version": "v1.4.3",
            "ecosystem": "go"
          },
          {
            "name": "github.com/go-logr/stdr",
            "direct": false,
            "version": "v1.2.2",
            "ecosystem": "go"
          },
          {
            "name": "github.com/go-openapi/analysis",
            "direct": false,
            "version": "v0.25.2",
            "ecosystem": "go"
          },
          {
            "name": "github.com/go-openapi/errors",
            "direct": false,
            "version": "v0.22.7",
            "ecosystem": "go"
          },
          {
            "name": "github.com/go-openapi/jsonpointer",
            "direct": false,
            "version": "v0.23.1",
            "ecosystem": "go"
          },
          {
            "name": "github.com/go-openapi/jsonreference",
            "direct": false,
            "version": "v0.21.6",
            "ecosystem": "go"
          },
          {
            "name": "github.com/go-openapi/loads",
            "direct": false,
            "version": "v0.23.3",
            "ecosystem": "go"
          },
          {
            "name": "github.com/go-openapi/runtime",
            "direct": false,
            "version": "v0.32.3",
            "ecosystem": "go"
          },
          {
            "name": "github.com/go-openapi/runtime/server-middleware",
            "direct": false,
            "version": "v0.30.0",
            "ecosystem": "go"
          },
          {
            "name": "github.com/go-openapi/spec",
            "direct": false,
            "version": "v0.22.5",
            "ecosystem": "go"
          },
          {
            "name": "github.com/go-openapi/strfmt",
            "direct": false,
            "version": "v0.26.3",
            "ecosystem": "go"
          },
          {
            "name": "github.com/go-openapi/swag",
            "direct": false,
            "version": "v0.26.0",
            "ecosystem": "go"
          },
          {
            "name": "github.com/go-openapi/swag/cmdutils",
            "direct": false,
            "version": "v0.26.0",
            "ecosystem": "go"
          },
          {
            "name": "github.com/go-openapi/swag/conv",
            "direct": false,
            "version": "v0.26.0",
            "ecosystem": "go"
          },
          {
            "name": "github.com/go-openapi/swag/fileutils",
            "direct": false,
            "version": "v0.26.0",
            "ecosystem": "go"
          },
          {
            "name": "github.com/go-openapi/swag/jsonname",
            "direct": false,
            "version": "v0.26.0",
            "ecosystem": "go"
          },
          {
            "name": "github.com/go-openapi/swag/jsonutils",
            "direct": false,
            "version": "v0.26.0",
            "ecosystem": "go"
          },
          {
            "name": "github.com/go-openapi/swag/loading",
            "direct": false,
            "version": "v0.26.0",
            "ecosystem": "go"
          },
          {
            "name": "github.com/go-openapi/swag/mangling",
            "direct": false,
            "version": "v0.26.0",
            "ecosystem": "go"
          },
          {
            "name": "github.com/go-openapi/swag/netutils",
            "direct": false,
            "version": "v0.26.0",
            "ecosystem": "go"
          },
          {
            "name": "github.com/go-openapi/swag/stringutils",
            "direct": false,
            "version": "v0.26.0",
            "ecosystem": "go"
          },
          {
            "name": "github.com/go-openapi/swag/typeutils",
            "direct": false,
            "version": "v0.26.0",
            "ecosystem": "go"
          },
          {
            "name": "github.com/go-openapi/swag/yamlutils",
            "direct": false,
            "version": "v0.26.0",
            "ecosystem": "go"
          },
          {
            "name": "github.com/go-openapi/validate",
            "direct": false,
            "version": "v0.25.3",
            "ecosystem": "go"
          },
          {
            "name": "github.com/go-viper/mapstructure/v2",
            "direct": false,
            "version": "v2.5.0",
            "ecosystem": "go"
          },
          {
            "name": "github.com/godbus/dbus/v5",
            "direct": false,
            "version": "v5.2.2",
            "ecosystem": "go"
          },
          {
            "name": "github.com/golang/groupcache",
            "direct": false,
            "version": "v0.0.0-20241129210726-2c02b8208cf8",
            "ecosystem": "go"
          },
          {
            "name": "github.com/golang/snappy",
            "direct": false,
            "version": "v1.0.0",
            "ecosystem": "go"
          },
          {
            "name": "github.com/google/certificate-transparency-go",
            "direct": false,
            "version": "v1.3.3",
            "ecosystem": "go"
          },
          {
            "name": "github.com/google/go-cmp",
            "direct": false,
            "version": "v0.7.0",
            "ecosystem": "go"
          },
          {
            "name": "github.com/google/shlex",
            "direct": false,
            "version": "v0.0.0-20191202100458-e7afc7fbc510",
            "ecosystem": "go"
          },
          {
            "name": "github.com/gorilla/handlers",
            "direct": false,
            "version": "v1.5.2",
            "ecosystem": "go"
          },
          {
            "name": "github.com/gorilla/websocket",
            "direct": false,
            "version": "v1.5.4-0.20250319132907-e064f32e3674",
            "ecosystem": "go"
          },
          {
            "name": "github.com/gosimple/unidecode",
            "direct": false,
            "version": "v1.0.1",
            "ecosystem": "go"
          },
          {
            "name": "github.com/grpc-ecosystem/grpc-gateway/v2",
            "direct": false,
            "version": "v2.29.0",
            "ecosystem": "go"
          },
          {
            "name": "github.com/hashicorp/errwrap",
            "direct": false,
            "version": "v1.1.0",
            "ecosystem": "go"
          },
          {
            "name": "github.com/hashicorp/go-cleanhttp",
            "direct": false,
            "version": "v0.5.2",
            "ecosystem": "go"
          },
          {
            "name": "github.com/hashicorp/go-immutable-radix/v2",
            "direct": false,
            "version": "v2.1.0",
            "ecosystem": "go"
          },
          {
            "name": "github.com/hashicorp/go-multierror",
            "direct": false,
            "version": "v1.1.1",
            "ecosystem": "go"
          },
          {
            "name": "github.com/hashicorp/go-retryablehttp",
            "direct": false,
            "version": "v0.7.8",
            "ecosystem": "go"
          },
          {
            "name": "github.com/hashicorp/golang-lru/v2",
            "direct": false,
            "version": "v2.0.7",
            "ecosystem": "go"
          },
          {
            "name": "github.com/hiddeco/sshsig",
            "direct": false,
            "version": "v0.2.0",
            "ecosystem": "go"
          },
          {
            "name": "github.com/in-toto/attestation",
            "direct": false,
            "version": "v1.2.0",
            "ecosystem": "go"
          },
          {
            "name": "github.com/in-toto/in-toto-golang",
            "direct": false,
            "version": "v0.11.0",
            "ecosystem": "go"
          },
          {
            "name": "github.com/inconshreveable/mousetrap",
            "direct": false,
            "version": "v1.1.0",
            "ecosystem": "go"
          },
          {
            "name": "github.com/insomniacslk/dhcp",
            "direct": false,
            "version": "v0.0.0-20250417080101-5f8cf70e8c5f",
            "ecosystem": "go"
          },
          {
            "name": "github.com/jedisct1/go-minisign",
            "direct": false,
            "version": "v0.0.0-20241212093149-d2f9f49435c7",
            "ecosystem": "go"
          },
          {
            "name": "github.com/josharian/native",
            "direct": false,
            "version": "v1.1.0",
            "ecosystem": "go"
          },
          {
            "name": "github.com/klauspost/compress",
            "direct": false,
            "version": "v1.18.6",
            "ecosystem": "go"
          },
          {
            "name": "github.com/klauspost/pgzip",
            "direct": false,
            "version": "v1.2.6",
            "ecosystem": "go"
          },
          {
            "name": "github.com/letsencrypt/boulder",
            "direct": false,
            "version": "v0.20260309.0",
            "ecosystem": "go"
          },
          {
            "name": "github.com/mattn/go-colorable",
            "direct": false,
            "version": "v0.1.14",
            "ecosystem": "go"
          },
          {
            "name": "github.com/mattn/go-isatty",
            "direct": false,
            "version": "v0.0.20",
            "ecosystem": "go"
          },
          {
            "name": "github.com/mattn/go-runewidth",
            "direct": false,
            "version": "v0.0.24",
            "ecosystem": "go"
          },
          {
            "name": "github.com/mattn/go-shellwords",
            "direct": false,
            "version": "v1.0.12",
            "ecosystem": "go"
          },
          {
            "name": "github.com/mdlayher/packet",
            "direct": false,
            "version": "v1.1.2",
            "ecosystem": "go"
          },
          {
            "name": "github.com/mdlayher/socket",
            "direct": false,
            "version": "v0.5.1",
            "ecosystem": "go"
          },
          {
            "name": "github.com/microsoft/go-winio",
            "direct": false,
            "version": "v0.6.2",
            "ecosystem": "go"
          },
          {
            "name": "github.com/microsoft/hcsshim",
            "direct": false,
            "version": "v0.14.1",
            "ecosystem": "go"
          },
          {
            "name": "github.com/mitchellh/hashstructure/v2",
            "direct": false,
            "version": "v2.0.2",
            "ecosystem": "go"
          },
          {
            "name": "github.com/moby/docker-image-spec",
            "direct": false,
            "version": "v1.3.1",
            "ecosystem": "go"
          },
          {
            "name": "github.com/moby/locker",
            "direct": false,
            "version": "v1.0.1",
            "ecosystem": "go"
          },
          {
            "name": "github.com/moby/moby/api",
            "direct": false,
            "version": "v1.55.0",
            "ecosystem": "go"
          },
          {
            "name": "github.com/moby/patternmatcher",
            "direct": false,
            "version": "v0.6.1",
            "ecosystem": "go"
          },
          {
            "name": "github.com/moby/policy-helpers",
            "direct": false,
            "version": "v0.0.0-20260612073044-d5411a945cfc",
            "ecosystem": "go"
          },
          {
            "name": "github.com/moby/sys/capability",
            "direct": false,
            "version": "v0.4.0",
            "ecosystem": "go"
          },
          {
            "name": "github.com/moby/sys/mount",
            "direct": false,
            "version": "v0.3.5-0.20260529155943-fc52b7222d0b",
            "ecosystem": "go"
          },
          {
            "name": "github.com/moby/sys/mountinfo",
            "direct": false,
            "version": "v0.7.2",
            "ecosystem": "go"
          },
          {
            "name": "github.com/moby/sys/reexec",
            "direct": false,
            "version": "v0.1.0",
            "ecosystem": "go"
          },
          {
            "name": "github.com/moby/sys/sequential",
            "direct": false,
            "version": "v0.7.0",
            "ecosystem": "go"
          },
          {
            "name": "github.com/moby/sys/signal",
            "direct": false,
            "version": "v0.7.1",
            "ecosystem": "go"
          },
          {
            "name": "github.com/morikuni/aec",
            "direct": false,
            "version": "v1.1.0",
            "ecosystem": "go"
          },
          {
            "name": "github.com/munnerz/goautoneg",
            "direct": false,
            "version": "v0.0.0-20191010083416-a7dc8b61c822",
            "ecosystem": "go"
          },
          {
            "name": "github.com/networkplumbing/go-nft",
            "direct": false,
            "version": "v0.4.0",
            "ecosystem": "go"
          },
          {
            "name": "github.com/nozzle/throttler",
            "direct": false,
            "version": "v0.0.0-20180817012639-2ea982251481",
            "ecosystem": "go"
          },
          {
            "name": "github.com/oklog/ulid/v2",
            "direct": false,
            "version": "v2.1.1",
            "ecosystem": "go"
          },
          {
            "name": "github.com/opencontainers/go-digest",
            "direct": false,
            "version": "v1.0.0",
            "ecosystem": "go"
          },
          {
            "name": "github.com/package-url/packageurl-go",
            "direct": false,
            "version": "v0.1.3",
            "ecosystem": "go"
          },
          {
            "name": "github.com/petermattis/goid",
            "direct": false,
            "version": "v0.0.0-20250721140440-ea1c0173183e",
            "ecosystem": "go"
          },
          {
            "name": "github.com/pierrec/lz4/v4",
            "direct": false,
            "version": "v4.1.22",
            "ecosystem": "go"
          },
          {
            "name": "github.com/pkg/browser",
            "direct": false,
            "version": "v0.0.0-20240102092130-5ac0b6a4141c",
            "ecosystem": "go"
          },
          {
            "name": "github.com/pkg/errors",
            "direct": false,
            "version": "v0.9.1",
            "ecosystem": "go"
          },
          {
            "name": "github.com/planetscale/vtprotobuf",
            "direct": false,
            "version": "v0.6.1-0.20240319094008-0393e58bdf10",
            "ecosystem": "go"
          },
          {
            "name": "github.com/pmezard/go-difflib",
            "direct": false,
            "version": "v1.0.1-0.20181226105442-5d4384ee4fb2",
            "ecosystem": "go"
          },
          {
            "name": "github.com/prometheus/client_golang",
            "direct": false,
            "version": "v1.23.2",
            "ecosystem": "go"
          },
          {
            "name": "github.com/prometheus/client_model",
            "direct": false,
            "version": "v0.6.2",
            "ecosystem": "go"
          },
          {
            "name": "github.com/prometheus/common",
            "direct": false,
            "version": "v0.67.5",
            "ecosystem": "go"
          },
          {
            "name": "github.com/prometheus/procfs",
            "direct": false,
            "version": "v0.20.1",
            "ecosystem": "go"
          },
          {
            "name": "github.com/rootless-containers/proto/go-proto",
            "direct": false,
            "version": "v0.0.0-20230421021042-4cd87ebadd67",
            "ecosystem": "go"
          },
          {
            "name": "github.com/russross/blackfriday/v2",
            "direct": false,
            "version": "v2.1.0",
            "ecosystem": "go"
          },
          {
            "name": "github.com/safchain/ethtool",
            "direct": false,
            "version": "v0.6.2",
            "ecosystem": "go"
          },
          {
            "name": "github.com/sasha-s/go-deadlock",
            "direct": false,
            "version": "v0.3.5",
            "ecosystem": "go"
          },
          {
            "name": "github.com/sassoftware/relic",
            "direct": false,
            "version": "v7.2.1+incompatible",
            "ecosystem": "go"
          },
          {
            "name": "github.com/secure-systems-lab/go-securesystemslib",
            "direct": false,
            "version": "v0.11.0",
            "ecosystem": "go"
          },
          {
            "name": "github.com/sergi/go-diff",
            "direct": false,
            "version": "v1.4.0",
            "ecosystem": "go"
          },
          {
            "name": "github.com/shibumi/go-pathspec",
            "direct": false,
            "version": "v1.3.0",
            "ecosystem": "go"
          },
          {
            "name": "github.com/sigstore/protobuf-specs",
            "direct": false,
            "version": "v0.5.1",
            "ecosystem": "go"
          },
          {
            "name": "github.com/sigstore/rekor",
            "direct": false,
            "version": "v1.5.2",
            "ecosystem": "go"
          },
          {
            "name": "github.com/sigstore/rekor-tiles/v2",
            "direct": false,
            "version": "v2.2.2-0.20260601073857-5d098a2b6443",
            "ecosystem": "go"
          },
          {
            "name": "github.com/sigstore/sigstore-go",
            "direct": false,
            "version": "v1.2.1",
            "ecosystem": "go"
          },
          {
            "name": "github.com/sigstore/timestamp-authority/v2",
            "direct": false,
            "version": "v2.1.2",
            "ecosystem": "go"
          },
          {
            "name": "github.com/spdx/tools-golang",
            "direct": false,
            "version": "v0.5.7",
            "ecosystem": "go"
          },
          {
            "name": "github.com/sylabs/singularity",
            "direct": false,
            "version": "0.0.0",
            "ecosystem": "go"
          },
          {
            "name": "github.com/syndtr/goleveldb",
            "direct": false,
            "version": "v1.0.1-0.20220721030215-126854af5e6d",
            "ecosystem": "go"
          },
          {
            "name": "github.com/therootcompany/xz",
            "direct": false,
            "version": "v1.0.1",
            "ecosystem": "go"
          },
          {
            "name": "github.com/theupdateframework/go-tuf",
            "direct": false,
            "version": "v0.7.0",
            "ecosystem": "go"
          },
          {
            "name": "github.com/theupdateframework/go-tuf/v2",
            "direct": false,
            "version": "v2.4.2",
            "ecosystem": "go"
          },
          {
            "name": "github.com/titanous/rocacheck",
            "direct": false,
            "version": "v0.0.0-20171023193734-afe73141d399",
            "ecosystem": "go"
          },
          {
            "name": "github.com/tonistiigi/dchapes-mode",
            "direct": false,
            "version": "v0.0.0-20250318174251-73d941a28323",
            "ecosystem": "go"
          },
          {
            "name": "github.com/tonistiigi/go-archvariant",
            "direct": false,
            "version": "v1.0.0",
            "ecosystem": "go"
          },
          {
            "name": "github.com/tonistiigi/go-csvvalue",
            "direct": false,
            "version": "v0.0.0-20240814133006-030d3b2625d0",
            "ecosystem": "go"
          },
          {
            "name": "github.com/tonistiigi/units",
            "direct": false,
            "version": "v0.0.0-20180711220420-6950e57a87ea",
            "ecosystem": "go"
          },
          {
            "name": "github.com/tonistiigi/vt100",
            "direct": false,
            "version": "v0.0.0-20240514184818-90bafcd6abab",
            "ecosystem": "go"
          },
          {
            "name": "github.com/transparency-dev/formats",
            "direct": false,
            "version": "v0.1.1",
            "ecosystem": "go"
          },
          {
            "name": "github.com/transparency-dev/merkle",
            "direct": false,
            "version": "v0.0.2",
            "ecosystem": "go"
          },
          {
            "name": "github.com/u-root/uio",
            "direct": false,
            "version": "v0.0.0-20240224005618-d2acac8f3701",
            "ecosystem": "go"
          },
          {
            "name": "github.com/ulikunitz/xz",
            "direct": false,
            "version": "v0.5.14",
            "ecosystem": "go"
          },
          {
            "name": "github.com/vbatts/go-mtree",
            "direct": false,
            "version": "v0.6.1-0.20250911112631-8307d76bc1b9",
            "ecosystem": "go"
          },
          {
            "name": "github.com/vbatts/tar-split",
            "direct": false,
            "version": "v0.12.3",
            "ecosystem": "go"
          },
          {
            "name": "github.com/vishvananda/netlink",
            "direct": false,
            "version": "v1.3.1",
            "ecosystem": "go"
          },
          {
            "name": "github.com/vishvananda/netns",
            "direct": false,
            "version": "v0.0.5",
            "ecosystem": "go"
          },
          {
            "name": "github.com/vividcortex/ewma",
            "direct": false,
            "version": "v1.2.0",
            "ecosystem": "go"
          },
          {
            "name": "github.com/xeipuuv/gojsonpointer",
            "direct": false,
            "version": "v0.0.0-20190905194746-02993c407bfb",
            "ecosystem": "go"
          },
          {
            "name": "github.com/xeipuuv/gojsonreference",
            "direct": false,
            "version": "v0.0.0-20180127040603-bd5ef7bd5415",
            "ecosystem": "go"
          },
          {
            "name": "github.com/xeipuuv/gojsonschema",
            "direct": false,
            "version": "v1.2.0",
            "ecosystem": "go"
          },
          {
            "name": "github.com/youmark/pkcs8",
            "direct": false,
            "version": "v0.0.0-20240726163527-a2c0da244d78",
            "ecosystem": "go"
          },
          {
            "name": "go.opencensus.io",
            "direct": false,
            "version": "v0.24.0",
            "ecosystem": "go"
          },
          {
            "name": "go.opentelemetry.io/auto/sdk",
            "direct": false,
            "version": "v1.2.1",
            "ecosystem": "go"
          },
          {
            "name": "go.opentelemetry.io/contrib/instrumentation/google.golang.org/grpc/otelgrpc",
            "direct": false,
            "version": "v0.69.0",
            "ecosystem": "go"
          },
          {
            "name": "go.opentelemetry.io/contrib/instrumentation/net/http/httptrace/otelhttptrace",
            "direct": false,
            "version": "v0.69.0",
            "ecosystem": "go"
          },
          {
            "name": "go.opentelemetry.io/contrib/instrumentation/net/http/otelhttp",
            "direct": false,
            "version": "v0.69.0",
            "ecosystem": "go"
          },
          {
            "name": "go.opentelemetry.io/otel",
            "direct": false,
            "version": "v1.44.0",
            "ecosystem": "go"
          },
          {
            "name": "go.opentelemetry.io/otel/exporters/otlp/otlpmetric/otlpmetricgrpc",
            "direct": false,
            "version": "v1.44.0",
            "ecosystem": "go"
          },
          {
            "name": "go.opentelemetry.io/otel/exporters/otlp/otlpmetric/otlpmetrichttp",
            "direct": false,
            "version": "v1.44.0",
            "ecosystem": "go"
          },
          {
            "name": "go.opentelemetry.io/otel/exporters/otlp/otlptrace",
            "direct": false,
            "version": "v1.44.0",
            "ecosystem": "go"
          },
          {
            "name": "go.opentelemetry.io/otel/exporters/otlp/otlptrace/otlptracegrpc",
            "direct": false,
            "version": "v1.44.0",
            "ecosystem": "go"
          },
          {
            "name": "go.opentelemetry.io/otel/exporters/otlp/otlptrace/otlptracehttp",
            "direct": false,
            "version": "v1.44.0",
            "ecosystem": "go"
          },
          {
            "name": "go.opentelemetry.io/otel/metric",
            "direct": false,
            "version": "v1.44.0",
            "ecosystem": "go"
          },
          {
            "name": "go.opentelemetry.io/otel/sdk",
            "direct": false,
            "version": "v1.44.0",
            "ecosystem": "go"
          },
          {
            "name": "go.opentelemetry.io/otel/sdk/metric",
            "direct": false,
            "version": "v1.44.0",
            "ecosystem": "go"
          },
          {
            "name": "go.opentelemetry.io/otel/trace",
            "direct": false,
            "version": "v1.44.0",
            "ecosystem": "go"
          },
          {
            "name": "go.opentelemetry.io/proto/otlp",
            "direct": false,
            "version": "v1.10.0",
            "ecosystem": "go"
          },
          {
            "name": "go.uber.org/multierr",
            "direct": false,
            "version": "v1.11.0",
            "ecosystem": "go"
          },
          {
            "name": "go.uber.org/zap",
            "direct": false,
            "version": "v1.28.0",
            "ecosystem": "go"
          },
          {
            "name": "go.yaml.in/yaml/v2",
            "direct": false,
            "version": "v2.4.4",
            "ecosystem": "go"
          },
          {
            "name": "go.yaml.in/yaml/v3",
            "direct": false,
            "version": "v3.0.4",
            "ecosystem": "go"
          },
          {
            "name": "golang.org/x/mod",
            "direct": false,
            "version": "v0.37.0",
            "ecosystem": "go"
          },
          {
            "name": "golang.org/x/net",
            "direct": false,
            "version": "v0.56.0",
            "ecosystem": "go"
          },
          {
            "name": "golang.org/x/oauth2",
            "direct": false,
            "version": "v0.36.0",
            "ecosystem": "go"
          },
          {
            "name": "golang.org/x/time",
            "direct": false,
            "version": "v0.15.0",
            "ecosystem": "go"
          },
          {
            "name": "google.golang.org/genproto/googleapis/api",
            "direct": false,
            "version": "v0.0.0-20260526163538-3dc84a4a5aaa",
            "ecosystem": "go"
          },
          {
            "name": "google.golang.org/genproto/googleapis/rpc",
            "direct": false,
            "version": "v0.0.0-20260526163538-3dc84a4a5aaa",
            "ecosystem": "go"
          },
          {
            "name": "google.golang.org/protobuf",
            "direct": false,
            "version": "v1.36.11",
            "ecosystem": "go"
          },
          {
            "name": "gopkg.in/yaml.v2",
            "direct": false,
            "version": "v2.4.0",
            "ecosystem": "go"
          },
          {
            "name": "gopkg.in/yaml.v3",
            "direct": false,
            "version": "v3.0.1",
            "ecosystem": "go"
          },
          {
            "name": "k8s.io/klog/v2",
            "direct": false,
            "version": "v2.140.0",
            "ecosystem": "go"
          },
          {
            "name": "sigs.k8s.io/knftables",
            "direct": false,
            "version": "v0.0.18",
            "ecosystem": "go"
          },
          {
            "name": "sigs.k8s.io/yaml",
            "direct": false,
            "version": "v1.6.0",
            "ecosystem": "go"
          }
        ],
        "collected": true,
        "truncated": false,
        "total_count": 282,
        "direct_count": 74,
        "indirect_count": 208
      }
    },
    "maintainership": {
      "issues": {
        "open_prs": 3,
        "merged_prs": 2809,
        "open_issues": 37,
        "closed_ratio": 0.957,
        "closed_issues": 831,
        "closed_unmerged_prs": 423
      },
      "bus_factor": 3,
      "bot_contributors": 2,
      "top_contributors": [
        {
          "type": "User",
          "login": "dtrudg",
          "commits": 3232,
          "avatar_url": "https://avatars.githubusercontent.com/u/4522799?v=4"
        },
        {
          "type": "User",
          "login": "gmkurtzer",
          "commits": 2526,
          "avatar_url": "https://avatars.githubusercontent.com/u/13984965?v=4"
        },
        {
          "type": "User",
          "login": "cclerget",
          "commits": 1924,
          "avatar_url": "https://avatars.githubusercontent.com/u/3274134?v=4"
        },
        {
          "type": "User",
          "login": "bauerm97",
          "commits": 939,
          "avatar_url": "https://avatars.githubusercontent.com/u/14863407?v=4"
        },
        {
          "type": "User",
          "login": "ikaneshiro",
          "commits": 841,
          "avatar_url": "https://avatars.githubusercontent.com/u/15389064?v=4"
        },
        {
          "type": "User",
          "login": "GodloveD",
          "commits": 704,
          "avatar_url": "https://avatars.githubusercontent.com/u/7672924?v=4"
        },
        {
          "type": "User",
          "login": "vsoch",
          "commits": 702,
          "avatar_url": "https://avatars.githubusercontent.com/u/814322?v=4"
        },
        {
          "type": "User",
          "login": "yhcote",
          "commits": 569,
          "avatar_url": "https://avatars.githubusercontent.com/u/13560291?v=4"
        },
        {
          "type": "User",
          "login": "ArangoGutierrez",
          "commits": 568,
          "avatar_url": "https://avatars.githubusercontent.com/u/15933089?v=4"
        },
        {
          "type": "User",
          "login": "gvallee",
          "commits": 363,
          "avatar_url": "https://avatars.githubusercontent.com/u/419592?v=4"
        }
      ],
      "contributors_sampled": 98,
      "top_contributor_share": 0.23
    },
    "quality_signals": {
      "has_ci": false,
      "has_tests": true,
      "ci_workflows": [],
      "has_docs_dir": true,
      "linter_configs": [
        ".golangci.yml"
      ],
      "has_editorconfig": false,
      "has_linter_config": true,
      "has_precommit_config": false
    },
    "security_signals": {
      "lockfiles": [
        "go.sum"
      ],
      "scorecard": {
        "checks": [
          {
            "name": "Binary-Artifacts",
            "score": 10,
            "reason": "no binaries found in the repo",
            "documentation_url": "https://github.com/ossf/scorecard/blob/c395761df6afe1a69e476bc60a013a94bcbc153f/docs/checks.md#binary-artifacts"
          },
          {
            "name": "Branch-Protection",
            "score": null,
            "reason": "internal error: error during branchesHandler.setup: internal error: some github tokens can't read classic branch protection rules: https://github.com/ossf/scorecard-action/blob/main/docs/authentication/fine-grained-auth-token.md",
            "documentation_url": "https://github.com/ossf/scorecard/blob/c395761df6afe1a69e476bc60a013a94bcbc153f/docs/checks.md#branch-protection"
          },
          {
            "name": "CI-Tests",
            "score": 10,
            "reason": "15 out of 15 merged PRs checked by a CI test -- score normalized to 10",
            "documentation_url": "https://github.com/ossf/scorecard/blob/c395761df6afe1a69e476bc60a013a94bcbc153f/docs/checks.md#ci-tests"
          },
          {
            "name": "CII-Best-Practices",
            "score": 0,
            "reason": "no effort to earn an OpenSSF best practices badge detected",
            "documentation_url": "https://github.com/ossf/scorecard/blob/c395761df6afe1a69e476bc60a013a94bcbc153f/docs/checks.md#cii-best-practices"
          },
          {
            "name": "Code-Review",
            "score": 10,
            "reason": "all changesets reviewed",
            "documentation_url": "https://github.com/ossf/scorecard/blob/c395761df6afe1a69e476bc60a013a94bcbc153f/docs/checks.md#code-review"
          },
          {
            "name": "Contributors",
            "score": 10,
            "reason": "project has 78 contributing companies or organizations",
            "documentation_url": "https://github.com/ossf/scorecard/blob/c395761df6afe1a69e476bc60a013a94bcbc153f/docs/checks.md#contributors"
          },
          {
            "name": "Dangerous-Workflow",
            "score": null,
            "reason": "no workflows found",
            "documentation_url": "https://github.com/ossf/scorecard/blob/c395761df6afe1a69e476bc60a013a94bcbc153f/docs/checks.md#dangerous-workflow"
          },
          {
            "name": "Dependency-Update-Tool",
            "score": 10,
            "reason": "update tool detected",
            "documentation_url": "https://github.com/ossf/scorecard/blob/c395761df6afe1a69e476bc60a013a94bcbc153f/docs/checks.md#dependency-update-tool"
          },
          {
            "name": "Fuzzing",
            "score": 0,
            "reason": "project is not fuzzed",
            "documentation_url": "https://github.com/ossf/scorecard/blob/c395761df6afe1a69e476bc60a013a94bcbc153f/docs/checks.md#fuzzing"
          },
          {
            "name": "License",
            "score": 9,
            "reason": "license file detected",
            "documentation_url": "https://github.com/ossf/scorecard/blob/c395761df6afe1a69e476bc60a013a94bcbc153f/docs/checks.md#license"
          },
          {
            "name": "Maintained",
            "score": 10,
            "reason": "30 commit(s) and 2 issue activity found in the last 90 days -- score normalized to 10",
            "documentation_url": "https://github.com/ossf/scorecard/blob/c395761df6afe1a69e476bc60a013a94bcbc153f/docs/checks.md#maintained"
          },
          {
            "name": "Packaging",
            "score": null,
            "reason": "packaging workflow not detected",
            "documentation_url": "https://github.com/ossf/scorecard/blob/c395761df6afe1a69e476bc60a013a94bcbc153f/docs/checks.md#packaging"
          },
          {
            "name": "Pinned-Dependencies",
            "score": 0,
            "reason": "dependency not pinned by hash detected -- score normalized to 0",
            "documentation_url": "https://github.com/ossf/scorecard/blob/c395761df6afe1a69e476bc60a013a94bcbc153f/docs/checks.md#pinned-dependencies"
          },
          {
            "name": "SAST",
            "score": 0,
            "reason": "SAST tool is not run on all commits -- score normalized to 0",
            "documentation_url": "https://github.com/ossf/scorecard/blob/c395761df6afe1a69e476bc60a013a94bcbc153f/docs/checks.md#sast"
          },
          {
            "name": "Security-Policy",
            "score": 10,
            "reason": "security policy file detected",
            "documentation_url": "https://github.com/ossf/scorecard/blob/c395761df6afe1a69e476bc60a013a94bcbc153f/docs/checks.md#security-policy"
          },
          {
            "name": "Signed-Releases",
            "score": 0,
            "reason": "Project has not signed or included provenance with any releases.",
            "documentation_url": "https://github.com/ossf/scorecard/blob/c395761df6afe1a69e476bc60a013a94bcbc153f/docs/checks.md#signed-releases"
          },
          {
            "name": "Token-Permissions",
            "score": null,
            "reason": "No tokens found",
            "documentation_url": "https://github.com/ossf/scorecard/blob/c395761df6afe1a69e476bc60a013a94bcbc153f/docs/checks.md#token-permissions"
          },
          {
            "name": "Vulnerabilities",
            "score": 3,
            "reason": "7 existing vulnerabilities detected",
            "documentation_url": "https://github.com/ossf/scorecard/blob/c395761df6afe1a69e476bc60a013a94bcbc153f/docs/checks.md#vulnerabilities"
          }
        ],
        "commit": "6e4f96121cbe440600c9246136d8e66173a5eaaa",
        "ran_at": "2026-07-24T10:31:19Z",
        "aggregate_score": 5.9,
        "scorecard_version": "v5.5.0"
      },
      "has_codeql_workflow": false,
      "has_security_policy": true,
      "has_dependabot_config": true
    },
    "contribution_flow": {
      "collected": true,
      "ci_last_run_at": "2026-07-24T07:03:38Z",
      "oldest_open_prs": [
        {
          "number": 4234,
          "created_at": "2026-07-24T07:03:10Z",
          "last_comment_at": null,
          "last_comment_author": null
        },
        {
          "number": 4235,
          "created_at": "2026-07-24T08:08:56Z",
          "last_comment_at": null,
          "last_comment_author": null
        },
        {
          "number": 4236,
          "created_at": "2026-07-24T08:09:13Z",
          "last_comment_at": null,
          "last_comment_author": null
        }
      ],
      "last_merged_pr_at": "2026-07-22T13:34:21Z",
      "ci_last_conclusion": "SUCCESS",
      "oldest_open_issues": [
        {
          "number": 76,
          "created_at": "2021-06-03T20:13:11Z",
          "last_comment_at": "2022-06-22T14:48:32Z",
          "last_comment_author": "marcodelapierre"
        },
        {
          "number": 84,
          "created_at": "2021-06-03T20:24:42Z",
          "last_comment_at": "2026-02-20T12:50:35Z",
          "last_comment_author": "dtrudg"
        },
        {
          "number": 212,
          "created_at": "2021-08-04T16:22:33Z",
          "last_comment_at": "2021-08-17T14:19:57Z",
          "last_comment_author": "dtrudg"
        },
        {
          "number": 353,
          "created_at": "2021-10-06T22:49:36Z",
          "last_comment_at": "2025-09-07T03:26:39Z",
          "last_comment_author": "Likqez"
        },
        {
          "number": 439,
          "created_at": "2021-11-19T17:20:50Z",
          "last_comment_at": null,
          "last_comment_author": null
        },
        {
          "number": 514,
          "created_at": "2022-01-18T15:09:27Z",
          "last_comment_at": "2022-01-20T14:58:35Z",
          "last_comment_author": "dtrudg"
        },
        {
          "number": 526,
          "created_at": "2022-01-24T23:19:35Z",
          "last_comment_at": "2022-03-30T17:14:36Z",
          "last_comment_author": "olifre"
        },
        {
          "number": 607,
          "created_at": "2022-02-26T17:55:42Z",
          "last_comment_at": "2022-04-04T16:53:05Z",
          "last_comment_author": "dtrudg"
        },
        {
          "number": 683,
          "created_at": "2022-04-01T14:24:37Z",
          "last_comment_at": "2022-04-04T14:26:33Z",
          "last_comment_author": "tri-adam"
        },
        {
          "number": 815,
          "created_at": "2022-05-18T21:32:55Z",
          "last_comment_at": null,
          "last_comment_author": null
        },
        {
          "number": 947,
          "created_at": "2022-08-24T08:22:14Z",
          "last_comment_at": "2022-08-24T13:35:44Z",
          "last_comment_author": "wobito"
        },
        {
          "number": 1150,
          "created_at": "2022-11-29T15:49:29Z",
          "last_comment_at": "2022-12-02T17:27:02Z",
          "last_comment_author": "tri-adam"
        },
        {
          "number": 1153,
          "created_at": "2022-11-29T19:37:15Z",
          "last_comment_at": null,
          "last_comment_author": null
        },
        {
          "number": 1188,
          "created_at": "2022-12-09T15:43:56Z",
          "last_comment_at": null,
          "last_comment_author": null
        },
        {
          "number": 1210,
          "created_at": "2022-12-22T13:10:07Z",
          "last_comment_at": "2023-07-31T09:00:41Z",
          "last_comment_author": "dtrudg"
        },
        {
          "number": 1240,
          "created_at": "2023-01-11T10:19:31Z",
          "last_comment_at": "2024-10-22T13:30:47Z",
          "last_comment_author": "EmmEff"
        },
        {
          "number": 1395,
          "created_at": "2023-03-01T10:39:22Z",
          "last_comment_at": "2023-03-01T13:08:06Z",
          "last_comment_author": "ArangoGutierrez"
        },
        {
          "number": 1476,
          "created_at": "2023-03-24T12:38:41Z",
          "last_comment_at": null,
          "last_comment_author": null
        },
        {
          "number": 1948,
          "created_at": "2023-07-26T19:32:40Z",
          "last_comment_at": null,
          "last_comment_author": null
        },
        {
          "number": 2127,
          "created_at": "2023-08-29T11:43:53Z",
          "last_comment_at": "2024-08-12T15:18:22Z",
          "last_comment_author": "dtrudg"
        }
      ]
    }
  },
  "config": {
    "disabled_metrics": [],
    "disabled_categories": [],
    "disabled_components": {}
  },
  "source": {
    "url": "https://github.com/sylabs/singularity",
    "host": "github.com",
    "name": "singularity",
    "owner": "sylabs"
  },
  "metrics": {
    "overall": {
      "key": "overall",
      "band": "good",
      "name": "Overall health",
      "note": null,
      "notes": [],
      "value": 80,
      "inputs": {
        "security": 59,
        "vitality": 95,
        "community": 79,
        "governance": 83,
        "engineering": 76
      },
      "components": []
    },
    "categories": [
      {
        "key": "vitality",
        "band": "excellent",
        "name": "Vitality",
        "value": 95,
        "weight": 0.22,
        "metrics": [
          {
            "key": "development_activity",
            "band": "excellent",
            "name": "Development activity",
            "note": null,
            "notes": [],
            "value": 98,
            "inputs": {
              "commits_last_year": 480,
              "human_commit_share": 0.74,
              "days_since_last_push": 0,
              "active_weeks_last_year": 49
            },
            "components": [
              {
                "key": "push_recency",
                "name": "Push recency",
                "detail": "last push 0 days ago",
                "points": 36,
                "status": "met",
                "details": [
                  {
                    "code": "push_recency",
                    "params": {
                      "days": 0
                    }
                  }
                ],
                "max_points": 36
              },
              {
                "key": "commit_cadence",
                "name": "Commit cadence",
                "detail": "49/52 weeks with commits",
                "points": 33.9,
                "status": "partial",
                "details": [
                  {
                    "code": "commit_cadence_weeks",
                    "params": {
                      "weeks": 49
                    }
                  }
                ],
                "max_points": 36
              },
              {
                "key": "commit_volume",
                "name": "Commit volume",
                "detail": "480 commits in the last year",
                "points": 18,
                "status": "met",
                "details": [
                  {
                    "code": "commits_last_year",
                    "params": {
                      "count": 480
                    }
                  }
                ],
                "max_points": 18
              },
              {
                "key": "openssf_scorecard_maintained",
                "name": "OpenSSF Scorecard: Maintained",
                "detail": "30 commit(s) and 2 issue activity found in the last 90 days -- score normalized to 10",
                "points": 10,
                "status": "met",
                "details": [],
                "max_points": 10
              }
            ]
          },
          {
            "key": "release_discipline",
            "band": "excellent",
            "name": "Release discipline",
            "note": null,
            "notes": [],
            "value": 90,
            "inputs": {
              "releases_count": 68,
              "latest_release_tag": "v4.5.0",
              "releases_from_tags": false,
              "days_since_latest_release": 28,
              "mean_days_between_releases": 41.2
            },
            "components": [
              {
                "key": "ships_releases",
                "name": "Ships releases",
                "detail": "68 releases published",
                "points": 27,
                "status": "met",
                "details": [
                  {
                    "code": "releases_published",
                    "params": {
                      "count": 68
                    }
                  }
                ],
                "max_points": 27
              },
              {
                "key": "release_recency",
                "name": "Release recency",
                "detail": "latest release 28 days ago",
                "points": 36,
                "status": "met",
                "details": [
                  {
                    "code": "release_recency",
                    "params": {
                      "days": 28
                    }
                  }
                ],
                "max_points": 36
              },
              {
                "key": "release_cadence",
                "name": "Release cadence",
                "detail": "a release every ~41.2 days",
                "points": 27,
                "status": "met",
                "details": [
                  {
                    "code": "release_cadence",
                    "params": {
                      "gap": 41.2
                    }
                  }
                ],
                "max_points": 27
              },
              {
                "key": "openssf_scorecard_signed_releases",
                "name": "OpenSSF Scorecard: Signed-Releases",
                "detail": "Project has not signed or included provenance with any releases.",
                "points": 0,
                "status": "missed",
                "details": [],
                "max_points": 10
              }
            ]
          },
          {
            "key": "abandonment",
            "band": "excellent",
            "name": "Abandonment",
            "note": null,
            "notes": [],
            "value": 100,
            "inputs": {
              "cap": null,
              "state": "maintained",
              "guards": [],
              "signals": [],
              "red_flag": false,
              "multiplier_pct": 100,
              "declared_reason": null,
              "unverified_reason": null,
              "unanswered_open_prs": null,
              "unanswered_open_issues": null,
              "days_since_last_merged_pr": null,
              "days_since_last_human_commit": 1,
              "days_since_last_human_commit_is_floor": false
            },
            "components": [
              {
                "key": "project_is_still_maintained",
                "name": "Project is still maintained",
                "detail": "last human commit 1 days ago",
                "points": 100,
                "status": "met",
                "details": [
                  {
                    "code": "abandonment_maintained",
                    "params": {
                      "days": 1
                    }
                  }
                ],
                "max_points": 100
              }
            ]
          }
        ],
        "description": "Is the project alive — is code being written and are releases shipping?"
      },
      {
        "key": "community",
        "band": "good",
        "name": "Community & Adoption",
        "value": 79,
        "weight": 0.18,
        "metrics": [
          {
            "key": "popularity",
            "band": "good",
            "name": "Popularity & adoption",
            "note": null,
            "notes": [],
            "value": 72,
            "inputs": {
              "forks": 119,
              "stars": 984,
              "watchers": 15,
              "growth_state": "unverified",
              "growth_factor_pct": 100,
              "growth_unverified_reason": "no_history"
            },
            "components": [
              {
                "key": "stars",
                "name": "Stars",
                "detail": "984 stars",
                "points": 48.5,
                "status": "partial",
                "details": [
                  {
                    "code": "stars",
                    "params": {
                      "count": 984
                    }
                  }
                ],
                "max_points": 60
              },
              {
                "key": "forks",
                "name": "Forks",
                "detail": "119 forks",
                "points": 17.3,
                "status": "partial",
                "details": [
                  {
                    "code": "forks",
                    "params": {
                      "count": 119
                    }
                  }
                ],
                "max_points": 25
              },
              {
                "key": "watchers",
                "name": "Watchers",
                "detail": "15 watchers",
                "points": 6.4,
                "status": "partial",
                "details": [
                  {
                    "code": "watchers",
                    "params": {
                      "count": 15
                    }
                  }
                ],
                "max_points": 15
              }
            ]
          },
          {
            "key": "community_health",
            "band": "excellent",
            "name": "Community health",
            "note": null,
            "notes": [],
            "value": 86,
            "inputs": {
              "has_readme": true,
              "has_license": true,
              "has_contributing": true,
              "has_issue_template": false,
              "has_code_of_conduct": true,
              "has_pull_request_template": true
            },
            "components": [
              {
                "key": "readme",
                "name": "README",
                "detail": null,
                "points": 22.5,
                "status": "met",
                "details": [],
                "max_points": 22.5
              },
              {
                "key": "license",
                "name": "License",
                "detail": "license file present, not a recognized license",
                "points": 16.9,
                "status": "partial",
                "details": [
                  {
                    "code": "license_custom",
                    "params": {}
                  }
                ],
                "max_points": 22.5
              },
              {
                "key": "contributing_guide",
                "name": "CONTRIBUTING guide",
                "detail": null,
                "points": 18,
                "status": "met",
                "details": [],
                "max_points": 18
              },
              {
                "key": "code_of_conduct",
                "name": "Code of conduct",
                "detail": null,
                "points": 13.5,
                "status": "met",
                "details": [],
                "max_points": 13.5
              },
              {
                "key": "issue_template",
                "name": "Issue template",
                "detail": null,
                "points": 0,
                "status": "missed",
                "details": [],
                "max_points": 7.2
              },
              {
                "key": "pr_template",
                "name": "PR template",
                "detail": null,
                "points": 6.3,
                "status": "met",
                "details": [],
                "max_points": 6.3
              }
            ]
          }
        ],
        "description": "Does the project have users, downloads, attention, and a welcoming setup for contributors?"
      },
      {
        "key": "governance",
        "band": "good",
        "name": "Sustainability & Governance",
        "value": 83,
        "weight": 0.24,
        "metrics": [
          {
            "key": "maintainer_resilience",
            "band": "good",
            "name": "Maintainer resilience (bus factor)",
            "note": null,
            "notes": [],
            "value": 77,
            "inputs": {
              "bus_factor": 3,
              "contributors_sampled": 98,
              "top_contributor_share": 0.23
            },
            "components": [
              {
                "key": "bus_factor",
                "name": "Bus factor",
                "detail": "3 contributor(s) cover half of all commits",
                "points": 36,
                "status": "partial",
                "details": [
                  {
                    "code": "bus_factor",
                    "params": {
                      "count": 3
                    }
                  }
                ],
                "max_points": 54
              },
              {
                "key": "commit_distribution",
                "name": "Commit distribution",
                "detail": "top contributor authored 23% of commits",
                "points": 17.3,
                "status": "partial",
                "details": [
                  {
                    "code": "top_contributor_share",
                    "params": {
                      "share": 23
                    }
                  }
                ],
                "max_points": 22.5
              },
              {
                "key": "contributor_breadth",
                "name": "Contributor breadth",
                "detail": "98 contributors",
                "points": 13.5,
                "status": "met",
                "details": [
                  {
                    "code": "contributors_sampled",
                    "params": {
                      "count": 98
                    }
                  }
                ],
                "max_points": 13.5
              },
              {
                "key": "openssf_scorecard_contributors",
                "name": "OpenSSF Scorecard: Contributors",
                "detail": "project has 78 contributing companies or organizations",
                "points": 10,
                "status": "met",
                "details": [],
                "max_points": 10
              }
            ]
          },
          {
            "key": "responsiveness",
            "band": "excellent",
            "name": "Issue & PR responsiveness",
            "note": null,
            "notes": [],
            "value": 93,
            "inputs": {
              "merged_prs": 2809,
              "open_issues": 37,
              "closed_issues": 831,
              "issue_closed_ratio": 0.957,
              "closed_unmerged_prs": 423
            },
            "components": [
              {
                "key": "issue_resolution",
                "name": "Issue resolution",
                "detail": "96% of issues closed",
                "points": 44.7,
                "status": "partial",
                "details": [
                  {
                    "code": "issues_closed_share",
                    "params": {
                      "share": 96
                    }
                  }
                ],
                "max_points": 46.75
              },
              {
                "key": "pr_acceptance",
                "name": "PR acceptance",
                "detail": "2809/3232 decided PRs merged",
                "points": 33.2,
                "status": "partial",
                "details": [
                  {
                    "code": "decided_prs_merged",
                    "params": {
                      "merged": 2809,
                      "decided": 3232
                    }
                  }
                ],
                "max_points": 38.25
              },
              {
                "key": "openssf_scorecard_code_review",
                "name": "OpenSSF Scorecard: Code-Review",
                "detail": "all changesets reviewed",
                "points": 15,
                "status": "met",
                "details": [],
                "max_points": 15
              }
            ]
          },
          {
            "key": "stewardship",
            "band": "moderate",
            "name": "Ownership & stewardship",
            "note": null,
            "notes": [],
            "value": 68,
            "inputs": {
              "followers": 101,
              "owner_type": "Organization",
              "is_verified": null,
              "owner_login": "sylabs",
              "public_repos": 35,
              "account_age_days": 3219
            },
            "components": [
              {
                "key": "ownership_backing",
                "name": "Ownership backing",
                "detail": "organization-owned",
                "points": 30,
                "status": "met",
                "details": [
                  {
                    "code": "owner_organization",
                    "params": {}
                  }
                ],
                "max_points": 30
              },
              {
                "key": "verified_domain",
                "name": "Verified domain",
                "detail": null,
                "points": 0,
                "status": "missed",
                "details": [],
                "max_points": 20
              },
              {
                "key": "owner_reach",
                "name": "Owner reach",
                "detail": "101 followers of sylabs",
                "points": 14.4,
                "status": "partial",
                "details": [
                  {
                    "code": "owner_followers",
                    "params": {
                      "count": 101,
                      "login": "sylabs"
                    }
                  }
                ],
                "max_points": 25
              },
              {
                "key": "track_record",
                "name": "Track record",
                "detail": "35 public repos, account ~8 yr old",
                "points": 23.3,
                "status": "partial",
                "details": [
                  {
                    "code": "public_repos",
                    "params": {
                      "count": 35
                    }
                  },
                  {
                    "code": "account_age_years",
                    "params": {
                      "years": 8
                    }
                  }
                ],
                "max_points": 25
              }
            ]
          },
          {
            "key": "package_maintenance",
            "band": "excellent",
            "name": "Package maintenance",
            "note": null,
            "notes": [],
            "value": 100,
            "inputs": {
              "packages": [
                "github.com/sylabs/singularity/v4"
              ],
              "ecosystems": "go",
              "any_deprecated": false,
              "min_days_since_publish": 29
            },
            "components": [
              {
                "key": "published_resolvable",
                "name": "Published & resolvable",
                "detail": "1 package(s) on go",
                "points": 25,
                "status": "met",
                "details": [
                  {
                    "code": "packages_published",
                    "params": {
                      "count": 1,
                      "ecosystems": "go"
                    }
                  }
                ],
                "max_points": 25
              },
              {
                "key": "publish_recency",
                "name": "Publish recency",
                "detail": "latest publish 29 days ago",
                "points": 35,
                "status": "met",
                "details": [
                  {
                    "code": "publish_recency",
                    "params": {
                      "days": 29
                    }
                  }
                ],
                "max_points": 35
              },
              {
                "key": "version_history",
                "name": "Version history",
                "detail": "30 published versions",
                "points": 20,
                "status": "met",
                "details": [
                  {
                    "code": "published_versions",
                    "params": {
                      "count": 30
                    }
                  }
                ],
                "max_points": 20
              },
              {
                "key": "not_deprecated",
                "name": "Not deprecated",
                "detail": "active, not deprecated or yanked",
                "points": 20,
                "status": "met",
                "details": [
                  {
                    "code": "package_not_deprecated",
                    "params": {}
                  }
                ],
                "max_points": 20
              }
            ]
          }
        ],
        "description": "Will the project survive its people — bus factor, responsiveness, who backs it, and package upkeep?"
      },
      {
        "key": "engineering",
        "band": "good",
        "name": "Engineering Quality",
        "value": 76,
        "weight": 0.2,
        "metrics": [
          {
            "key": "engineering_practices",
            "band": "moderate",
            "name": "Engineering practices",
            "note": null,
            "notes": [],
            "value": 60,
            "inputs": {
              "has_ci": false,
              "has_tests": true,
              "has_editorconfig": false,
              "has_linter_config": true,
              "has_precommit_config": false
            },
            "components": [
              {
                "key": "ci_workflows",
                "name": "CI workflows",
                "detail": null,
                "points": 0,
                "status": "missed",
                "details": [],
                "max_points": 24
              },
              {
                "key": "tests_present",
                "name": "Tests present",
                "detail": null,
                "points": 24,
                "status": "met",
                "details": [],
                "max_points": 24
              },
              {
                "key": "linter_config",
                "name": "Linter config",
                "detail": ".golangci.yml",
                "points": 16,
                "status": "met",
                "details": [
                  {
                    "code": "file_list",
                    "params": {
                      "files": ".golangci.yml"
                    }
                  }
                ],
                "max_points": 16
              },
              {
                "key": "pre_commit_hooks",
                "name": "Pre-commit hooks",
                "detail": null,
                "points": 0,
                "status": "missed",
                "details": [],
                "max_points": 9.6
              },
              {
                "key": "editorconfig",
                "name": ".editorconfig",
                "detail": null,
                "points": 0,
                "status": "missed",
                "details": [],
                "max_points": 6.4
              },
              {
                "key": "openssf_scorecard_ci_tests",
                "name": "OpenSSF Scorecard: CI-Tests",
                "detail": "15 out of 15 merged PRs checked by a CI test -- score normalized to 10",
                "points": 20,
                "status": "met",
                "details": [],
                "max_points": 20
              }
            ]
          },
          {
            "key": "documentation",
            "band": "excellent",
            "name": "Documentation",
            "note": null,
            "notes": [],
            "value": 100,
            "inputs": {
              "topics": [
                "containers",
                "hpc",
                "linux"
              ],
              "has_wiki": true,
              "homepage": "https://sylabs.io/docs/",
              "has_readme": true,
              "has_docs_dir": true,
              "has_description": true
            },
            "components": [
              {
                "key": "readme",
                "name": "README",
                "detail": null,
                "points": 30,
                "status": "met",
                "details": [],
                "max_points": 30
              },
              {
                "key": "documentation_directory",
                "name": "Documentation directory",
                "detail": null,
                "points": 25,
                "status": "met",
                "details": [],
                "max_points": 25
              },
              {
                "key": "documentation_homepage_site",
                "name": "Documentation / homepage site",
                "detail": "https://sylabs.io/docs/",
                "points": 15,
                "status": "met",
                "details": [],
                "max_points": 15
              },
              {
                "key": "repository_description",
                "name": "Repository description",
                "detail": null,
                "points": 10,
                "status": "met",
                "details": [],
                "max_points": 10
              },
              {
                "key": "topics",
                "name": "Topics",
                "detail": "3 topics",
                "points": 10,
                "status": "met",
                "details": [
                  {
                    "code": "topics_count",
                    "params": {
                      "count": 3
                    }
                  }
                ],
                "max_points": 10
              },
              {
                "key": "wiki",
                "name": "Wiki",
                "detail": null,
                "points": 10,
                "status": "met",
                "details": [],
                "max_points": 10
              }
            ]
          }
        ],
        "description": "Are baseline engineering and documentation practices in place?"
      },
      {
        "key": "security",
        "band": "moderate",
        "name": "Security",
        "value": 59,
        "weight": 0.16,
        "metrics": [
          {
            "key": "security_posture",
            "band": "moderate",
            "name": "Security posture",
            "note": "Excluded from scoring (no data or not applicable): Branch-Protection, Dangerous-Workflow, Packaging, Token-Permissions. Remaining weights renormalized.",
            "notes": [
              {
                "code": "excluded_no_data",
                "params": {
                  "components": [
                    "branch_protection",
                    "dangerous_workflow",
                    "packaging",
                    "token_permissions"
                  ]
                }
              },
              {
                "code": "weights_renormalized",
                "params": {}
              }
            ],
            "value": 59,
            "inputs": {
              "source": "openssf_scorecard",
              "checks_evaluated": 14,
              "scorecard_version": "v5.5.0",
              "checks_inconclusive": 4,
              "scorecard_aggregate": 5.9
            },
            "components": [
              {
                "key": "binary_artifacts",
                "name": "Binary-Artifacts",
                "detail": "no binaries found in the repo",
                "points": 7.5,
                "status": "met",
                "details": [],
                "max_points": 7.5
              },
              {
                "key": "branch_protection",
                "name": "Branch-Protection",
                "detail": "internal error: error during branchesHandler.setup: internal error: some github tokens can't read classic branch protection rules: https://github.com/ossf/scorecard-action/blob/main/docs/authentication/fine-grained-auth-token.md",
                "points": 0,
                "status": "excluded",
                "details": [
                  {
                    "code": "no_data",
                    "params": {}
                  }
                ],
                "max_points": 7.5
              },
              {
                "key": "ci_tests",
                "name": "CI-Tests",
                "detail": "15 out of 15 merged PRs checked by a CI test -- score normalized to 10",
                "points": 2.5,
                "status": "met",
                "details": [],
                "max_points": 2.5
              },
              {
                "key": "cii_best_practices",
                "name": "CII-Best-Practices",
                "detail": "no effort to earn an OpenSSF best practices badge detected",
                "points": 0,
                "status": "missed",
                "details": [],
                "max_points": 2.5
              },
              {
                "key": "code_review",
                "name": "Code-Review",
                "detail": "all changesets reviewed",
                "points": 7.5,
                "status": "met",
                "details": [],
                "max_points": 7.5
              },
              {
                "key": "contributors",
                "name": "Contributors",
                "detail": "project has 78 contributing companies or organizations",
                "points": 2.5,
                "status": "met",
                "details": [],
                "max_points": 2.5
              },
              {
                "key": "dangerous_workflow",
                "name": "Dangerous-Workflow",
                "detail": "no workflows found",
                "points": 0,
                "status": "excluded",
                "details": [
                  {
                    "code": "no_data",
                    "params": {}
                  }
                ],
                "max_points": 10
              },
              {
                "key": "dependency_update_tool",
                "name": "Dependency-Update-Tool",
                "detail": "update tool detected",
                "points": 7.5,
                "status": "met",
                "details": [],
                "max_points": 7.5
              },
              {
                "key": "fuzzing",
                "name": "Fuzzing",
                "detail": "project is not fuzzed",
                "points": 0,
                "status": "missed",
                "details": [],
                "max_points": 5
              },
              {
                "key": "license",
                "name": "License",
                "detail": "license file detected",
                "points": 2.2,
                "status": "partial",
                "details": [],
                "max_points": 2.5
              },
              {
                "key": "maintained",
                "name": "Maintained",
                "detail": "30 commit(s) and 2 issue activity found in the last 90 days -- score normalized to 10",
                "points": 7.5,
                "status": "met",
                "details": [],
                "max_points": 7.5
              },
              {
                "key": "packaging",
                "name": "Packaging",
                "detail": "packaging workflow not detected",
                "points": 0,
                "status": "excluded",
                "details": [
                  {
                    "code": "no_data",
                    "params": {}
                  }
                ],
                "max_points": 5
              },
              {
                "key": "pinned_dependencies",
                "name": "Pinned-Dependencies",
                "detail": "dependency not pinned by hash detected -- score normalized to 0",
                "points": 0,
                "status": "missed",
                "details": [],
                "max_points": 5
              },
              {
                "key": "sast",
                "name": "SAST",
                "detail": "SAST tool is not run on all commits -- score normalized to 0",
                "points": 0,
                "status": "missed",
                "details": [],
                "max_points": 5
              },
              {
                "key": "security_policy",
                "name": "Security-Policy",
                "detail": "security policy file detected",
                "points": 5,
                "status": "met",
                "details": [],
                "max_points": 5
              },
              {
                "key": "signed_releases",
                "name": "Signed-Releases",
                "detail": "Project has not signed or included provenance with any releases.",
                "points": 0,
                "status": "missed",
                "details": [],
                "max_points": 7.5
              },
              {
                "key": "token_permissions",
                "name": "Token-Permissions",
                "detail": "No tokens found",
                "points": 0,
                "status": "excluded",
                "details": [
                  {
                    "code": "no_data",
                    "params": {}
                  }
                ],
                "max_points": 7.5
              },
              {
                "key": "vulnerabilities",
                "name": "Vulnerabilities",
                "detail": "7 existing vulnerabilities detected",
                "points": 2.2,
                "status": "partial",
                "details": [],
                "max_points": 7.5
              }
            ]
          },
          {
            "key": "dependency_advisories",
            "band": "moderate",
            "name": "Dependency advisories",
            "note": "Excluded from scoring (no data or not applicable): Indirect dependencies free of known advisories. Remaining weights renormalized. Matched 282 resolved dependencies against OSV. This repository publishes no package the index resolves, so the repository dependency graph was assessed instead. That graph mixes development and test pins with shipped dependencies, so only the declared runtime dependencies are scored; transitive findings are reported as context and excluded from the score. Reachability is not analyzed.",
            "notes": [
              {
                "code": "excluded_no_data",
                "params": {
                  "components": [
                    "indirect_dependencies_free_of_known_advisories"
                  ]
                }
              },
              {
                "code": "weights_renormalized",
                "params": {}
              },
              {
                "code": "advisories_scope_repository",
                "params": {
                  "assessed": 282
                }
              },
              {
                "code": "advisories_repo_graph_caveat",
                "params": {}
              },
              {
                "code": "advisories_reachability",
                "params": {}
              }
            ],
            "value": 59,
            "inputs": {
              "source": "osv",
              "advisories": 14,
              "affected_packages": 5,
              "assessed_packages": 282,
              "unassessed_packages": 0,
              "affected_by_severity": "high 2, moderate 1, unknown 2",
              "direct_affected_packages": 3
            },
            "components": [
              {
                "key": "direct_dependencies_free_of_known_advisories",
                "name": "Direct dependencies free of known advisories",
                "detail": "3 affected: github.com/distribution/distribution v2.8.3+incompatible (high 7.5), github.com/sigstore/cosign/v2 v2.6.4 (unknown), golang.org/x/crypto v0.54.0 (unknown)",
                "points": 12.2,
                "status": "partial",
                "details": [
                  {
                    "code": "advisories_affected",
                    "params": {
                      "count": 3,
                      "packages": "github.com/distribution/distribution v2.8.3+incompatible (high 7.5), github.com/sigstore/cosign/v2 v2.6.4 (unknown), golang.org/x/crypto v0.54.0 (unknown)"
                    }
                  }
                ],
                "max_points": 35
              },
              {
                "key": "indirect_dependencies_free_of_known_advisories",
                "name": "Indirect dependencies free of known advisories",
                "detail": "transitive set not separable from development and test dependencies in this scope",
                "points": 0,
                "status": "excluded",
                "details": [
                  {
                    "code": "advisories_scope_not_separable",
                    "params": {}
                  }
                ],
                "max_points": 25
              },
              {
                "key": "no_advisories_left_outstanding",
                "name": "No advisories left outstanding",
                "detail": "2 advisory-carrying package(s) unaddressed past 90 days; oldest published 507 days ago",
                "points": 31.7,
                "status": "partial",
                "details": [
                  {
                    "code": "advisories_stale",
                    "params": {
                      "days": 90,
                      "count": 2,
                      "oldest": 507
                    }
                  }
                ],
                "max_points": 40
              }
            ]
          },
          {
            "key": "malicious_dependencies",
            "band": "excellent",
            "name": "Malicious dependencies",
            "note": null,
            "notes": [],
            "value": 100,
            "inputs": {
              "source": "osv",
              "meaning": "reported as a malicious package by the OpenSSF corpus; the remedy is removal or moving off the compromised name, never an upgrade of the same artifact. Versions the registry has since pulled are listed but not scored",
              "packages": [],
              "red_flag": false,
              "assessed_packages": 282,
              "malicious_packages": 0,
              "direct_malicious_packages": 0,
              "withdrawn_malicious_packages": 0,
              "installable_malicious_packages": 0
            },
            "components": [
              {
                "key": "no_dependency_reported_as_a_malicious_package",
                "name": "No dependency reported as a malicious package",
                "detail": "no dependency is reported as a malicious package",
                "points": 100,
                "status": "met",
                "details": [
                  {
                    "code": "no_malicious_dependencies",
                    "params": {}
                  }
                ],
                "max_points": 100
              }
            ]
          },
          {
            "key": "high_risk_jurisdiction_exposure",
            "band": "excellent",
            "name": "High-Risk Jurisdiction Exposure",
            "note": "Only high-confidence self-published location evidence affects this multiplier. Ambiguous matches are review-only; country evidence is not proof of nationality, citizenship, legal registration, malicious intent, or sanctions status.",
            "notes": [
              {
                "code": "jurisdiction_evidence_limits",
                "params": {}
              }
            ],
            "value": 100,
            "inputs": {
              "meaning": "self-published location evidence; not nationality or citizenship",
              "red_flag": false,
              "exposures": [],
              "policy_countries": [
                "Russia",
                "Iran",
                "North Korea"
              ],
              "review_only_matches": 0,
              "assessed_self_published_locations": 13
            },
            "components": [
              {
                "key": "policy_exposure_multiplier",
                "name": "Policy exposure multiplier",
                "detail": "no confirmed policy-scope location match",
                "points": 100,
                "status": "met",
                "details": [
                  {
                    "code": "jurisdiction_no_match",
                    "params": {}
                  }
                ],
                "max_points": 100
              }
            ]
          }
        ],
        "description": "Are visible security and supply-chain practices strong, with no malicious dependency and no unresolved high-risk jurisdiction exposure?"
      },
      {
        "key": "ai_readiness",
        "band": "good",
        "name": "AI Readiness",
        "value": 76,
        "weight": 0,
        "metrics": [
          {
            "key": "ai_agent_context",
            "band": "excellent",
            "name": "Agent context & guidance",
            "note": null,
            "notes": [],
            "value": 85,
            "inputs": {
              "has_llms_txt": false,
              "legible_history_share": 0.932,
              "agent_instruction_files": [
                "AGENTS.md",
                "CLAUDE.md"
              ],
              "agent_instruction_max_bytes": 6883
            },
            "components": [
              {
                "key": "agent_instructions",
                "name": "Agent instructions",
                "detail": "AGENTS.md, CLAUDE.md",
                "points": 45,
                "status": "met",
                "details": [
                  {
                    "code": "file_list",
                    "params": {
                      "files": "AGENTS.md, CLAUDE.md"
                    }
                  }
                ],
                "max_points": 45
              },
              {
                "key": "machine_readable_docs_llms_txt",
                "name": "Machine-readable docs (llms.txt)",
                "detail": null,
                "points": 0,
                "status": "missed",
                "details": [],
                "max_points": 15
              },
              {
                "key": "legible_commit_history",
                "name": "Legible commit history",
                "detail": "69 of 74 human commits state their intent (structured subject or explanatory body)",
                "points": 40,
                "status": "met",
                "details": [
                  {
                    "code": "legible_history",
                    "params": {
                      "legible": 69,
                      "sampled": 74
                    }
                  }
                ],
                "max_points": 40
              }
            ]
          },
          {
            "key": "ai_verify_loop",
            "band": "good",
            "name": "Verify loop (build / test / typecheck)",
            "note": null,
            "notes": [],
            "value": 75,
            "inputs": {
              "has_nix": false,
              "has_tests": true,
              "lockfiles": [
                "go.sum"
              ],
              "has_dockerfile": true,
              "typed_language": true,
              "bootstrap_files": [],
              "has_devcontainer": false,
              "has_linter_config": true,
              "typecheck_configs": [],
              "agent_commit_share": 0,
              "toolchain_manifests": [
                "go.mod"
              ],
              "dependency_bot_commit_share": 0.26
            },
            "components": [
              {
                "key": "one_command_bootstrap",
                "name": "One-command bootstrap",
                "detail": "go.mod (toolchain convention, no task runner)",
                "points": 12.6,
                "status": "partial",
                "details": [
                  {
                    "code": "toolchain_convention",
                    "params": {
                      "files": "go.mod"
                    }
                  }
                ],
                "max_points": 18
              },
              {
                "key": "automated_tests",
                "name": "Automated tests",
                "detail": null,
                "points": 22,
                "status": "met",
                "details": [],
                "max_points": 22
              },
              {
                "key": "lint_format_config",
                "name": "Lint / format config",
                "detail": ".golangci.yml",
                "points": 11,
                "status": "met",
                "details": [
                  {
                    "code": "file_list",
                    "params": {
                      "files": ".golangci.yml"
                    }
                  }
                ],
                "max_points": 11
              },
              {
                "key": "static_type_checking",
                "name": "Static type checking",
                "detail": "Go (statically typed)",
                "points": 11,
                "status": "met",
                "details": [
                  {
                    "code": "statically_typed_language",
                    "params": {
                      "language": "Go"
                    }
                  }
                ],
                "max_points": 11
              },
              {
                "key": "reproducible_environment",
                "name": "Reproducible environment",
                "detail": "Dockerfile, lockfile",
                "points": 10,
                "status": "met",
                "details": [
                  {
                    "code": "file_list",
                    "params": {
                      "files": "Dockerfile, lockfile"
                    }
                  }
                ],
                "max_points": 10
              },
              {
                "key": "demonstrated_agent_practice",
                "name": "Demonstrated agent practice",
                "detail": "no agent-authored commits among the last 100",
                "points": 0,
                "status": "missed",
                "details": [
                  {
                    "code": "no_agent_authored_commits",
                    "params": {
                      "sampled": 100
                    }
                  }
                ],
                "max_points": 10
              },
              {
                "key": "automated_maintenance",
                "name": "Automated maintenance",
                "detail": "26 of the last 100 commits are automated dependency updates",
                "points": 8,
                "status": "met",
                "details": [
                  {
                    "code": "dependency_bot_commits",
                    "params": {
                      "count": 26,
                      "sampled": 100
                    }
                  }
                ],
                "max_points": 8
              },
              {
                "key": "openssf_scorecard_pinned_dependencies",
                "name": "OpenSSF Scorecard: Pinned-Dependencies",
                "detail": "dependency not pinned by hash detected -- score normalized to 0",
                "points": 0,
                "status": "missed",
                "details": [],
                "max_points": 10
              }
            ]
          },
          {
            "key": "ai_code_legibility",
            "band": "excellent",
            "name": "Code legibility for models",
            "note": null,
            "notes": [],
            "value": 100,
            "inputs": {
              "primary_language": "Go",
              "largest_source_bytes": 90986,
              "source_files_sampled": 544,
              "oversized_source_files": 4
            },
            "components": [
              {
                "key": "type_checkable_code",
                "name": "Type-checkable code",
                "detail": "Go (statically typed)",
                "points": 45,
                "status": "met",
                "details": [
                  {
                    "code": "statically_typed_language",
                    "params": {
                      "language": "Go"
                    }
                  }
                ],
                "max_points": 45
              },
              {
                "key": "manageable_file_sizes",
                "name": "Manageable file sizes",
                "detail": "4/544 source files over 60KB",
                "points": 54.6,
                "status": "partial",
                "details": [
                  {
                    "code": "oversized_source_files",
                    "params": {
                      "kb": 60,
                      "sampled": 544,
                      "oversized": 4
                    }
                  }
                ],
                "max_points": 55
              }
            ]
          },
          {
            "key": "ai_interfaces",
            "band": "at_risk",
            "name": "Machine-readable interfaces",
            "note": null,
            "notes": [],
            "value": 40,
            "inputs": {
              "example_dirs": [
                "example",
                "examples"
              ],
              "has_mcp_signal": false,
              "api_schema_files": []
            },
            "components": [
              {
                "key": "api_schema_openapi_graphql_proto",
                "name": "API schema (OpenAPI/GraphQL/proto)",
                "detail": null,
                "points": 0,
                "status": "missed",
                "details": [],
                "max_points": 40
              },
              {
                "key": "mcp_server",
                "name": "MCP server",
                "detail": null,
                "points": 0,
                "status": "missed",
                "details": [],
                "max_points": 20
              },
              {
                "key": "runnable_examples",
                "name": "Runnable examples",
                "detail": "example, examples",
                "points": 40,
                "status": "met",
                "details": [
                  {
                    "code": "file_list",
                    "params": {
                      "files": "example, examples"
                    }
                  }
                ],
                "max_points": 40
              }
            ]
          }
        ],
        "description": "How well is the repo equipped to be developed and maintained with AI coding agents? An independent, experimental badge — weight 0.0, so it is surfaced on its own and does not affect the overall health score."
      }
    ],
    "metrics_version": "1.13.0"
  },
  "warnings": [
    "Star history unavailable: GitHub GraphQL error: Resource not accessible by personal access token"
  ],
  "report_type": "repository",
  "generated_at": "2026-07-24T10:31:45.748814Z",
  "schema_version": "0.27.0",
  "badge_url": "https://raw.githubusercontent.com/inspect-software/badges/main/v1/s/sylabs/singularity.svg",
  "full_name": "sylabs/singularity",
  "license_state": "custom",
  "license_spdx": null
}