Informe JSON sin procesar legible por máquina
{
"data": {
"repo": {
"topics": [
"containers",
"hpc",
"linux"
],
"is_fork": false,
"size_kb": 49514,
"has_wiki": true,
"homepage": "https://sylabs.io/docs/",
"languages": {
"C": 84910,
"Go": 3604909,
"Awk": 15526,
"Shell": 69370,
"Python": 4511,
"Makefile": 15906,
"Go Template": 2417
},
"pushed_at": "2026-07-24T08:09:13Z",
"created_at": "2021-05-04T13:40:42Z",
"owner_type": "Organization",
"updated_at": "2026-07-23T06:55:57Z",
"description": "SingularityCE is the Community Edition of Singularity, an open source container platform designed to be simple, fast, and secure.",
"is_archived": false,
"is_disabled": false,
"license_spdx": null,
"default_branch": "main",
"license_spdx_raw": "NOASSERTION",
"primary_language": "Go",
"significant_languages": [
"Go"
]
},
"owner": {
"blog": "https://www.sylabs.io/",
"name": "Sylabs Inc.",
"type": "Organization",
"login": "sylabs",
"company": null,
"location": null,
"followers": 101,
"avatar_url": "https://avatars.githubusercontent.com/u/32401844?v=4",
"created_at": "2017-09-29T20:47:51Z",
"is_verified": null,
"public_repos": 35,
"account_age_days": 3219
},
"license": {
"state": "custom",
"spdx_id": null,
"raw_spdx": "NOASSERTION",
"file_present": true,
"scorecard_found": true,
"profile_has_license": true
},
"activity": {
"releases": [
{
"tag": "v4.5.0",
"kind": "minor",
"published_at": "2026-06-25T10:59:15Z"
},
{
"tag": "v4.4.2",
"kind": "patch",
"published_at": "2026-06-04T16:07:31Z"
},
{
"tag": "v4.4.1",
"kind": "patch",
"published_at": "2026-03-23T15:46:01Z"
},
{
"tag": "v4.4.0",
"kind": "minor",
"published_at": "2026-02-26T17:39:03Z"
},
{
"tag": "v4.3.7",
"kind": "patch",
"published_at": "2026-01-16T14:56:07Z"
},
{
"tag": "v4.3.6",
"kind": "patch",
"published_at": "2025-12-16T15:25:05Z"
},
{
"tag": "v4.3.5",
"kind": "patch",
"published_at": "2025-12-02T17:28:30Z"
},
{
"tag": "v4.3.4",
"kind": "patch",
"published_at": "2025-10-14T10:49:50Z"
},
{
"tag": "v4.3.3",
"kind": "patch",
"published_at": "2025-08-20T08:32:22Z"
},
{
"tag": "v4.3.2",
"kind": "patch",
"published_at": "2025-06-19T10:30:10Z"
},
{
"tag": "v4.3.1",
"kind": "patch",
"published_at": "2025-04-11T12:36:38Z"
},
{
"tag": "v4.3.0",
"kind": "minor",
"published_at": "2025-03-13T14:07:53Z"
},
{
"tag": "v4.3.0-rc.1",
"kind": "prerelease",
"published_at": "2025-03-04T16:19:41Z"
},
{
"tag": "v4.2.2",
"kind": "patch",
"published_at": "2024-12-20T15:48:44Z"
},
{
"tag": "v4.2.1",
"kind": "patch",
"published_at": "2024-09-13T15:57:50Z"
},
{
"tag": "v4.2.0",
"kind": "minor",
"published_at": "2024-09-04T14:59:20Z"
},
{
"tag": "v4.1.5",
"kind": "patch",
"published_at": "2024-08-14T15:02:17Z"
},
{
"tag": "v4.2.0-rc.1",
"kind": "prerelease",
"published_at": "2024-08-13T09:39:47Z"
},
{
"tag": "v4.1.4",
"kind": "patch",
"published_at": "2024-06-28T15:48:40Z"
},
{
"tag": "v4.1.3",
"kind": "patch",
"published_at": "2024-05-08T13:52:58Z"
},
{
"tag": "v4.1.2",
"kind": "patch",
"published_at": "2024-03-05T16:15:58Z"
},
{
"tag": "v4.1.1",
"kind": "patch",
"published_at": "2024-02-01T11:42:58Z"
},
{
"tag": "v4.1.0",
"kind": "minor",
"published_at": "2024-01-25T13:50:40Z"
},
{
"tag": "v4.1.0-rc.1",
"kind": "prerelease",
"published_at": "2024-01-12T11:27:36Z"
},
{
"tag": "v4.0.3",
"kind": "patch",
"published_at": "2024-01-11T10:26:10Z"
},
{
"tag": "v4.0.2",
"kind": "patch",
"published_at": "2023-11-16T15:14:05Z"
},
{
"tag": "v4.0.1",
"kind": "patch",
"published_at": "2023-10-13T15:10:41Z"
},
{
"tag": "v4.0.0",
"kind": "major",
"published_at": "2023-09-19T14:25:00Z"
},
{
"tag": "v3.11.5",
"kind": "patch",
"published_at": "2023-09-15T13:58:58Z"
},
{
"tag": "v4.0.0-rc.2",
"kind": "prerelease",
"published_at": "2023-09-05T14:54:01Z"
},
{
"tag": "v4.0.0-rc.1",
"kind": "prerelease",
"published_at": "2023-08-17T14:57:38Z"
},
{
"tag": "v3.11.4",
"kind": "patch",
"published_at": "2023-06-22T13:16:41Z"
},
{
"tag": "v3.11.3",
"kind": "patch",
"published_at": "2023-05-04T17:07:14Z"
},
{
"tag": "v3.11.2",
"kind": "patch",
"published_at": "2023-04-27T13:32:01Z"
},
{
"tag": "v3.11.1",
"kind": "patch",
"published_at": "2023-03-14T16:28:47Z"
},
{
"tag": "v3.11.0",
"kind": "minor",
"published_at": "2023-02-10T12:39:32Z"
},
{
"tag": "v3.11.0-rc.2",
"kind": "prerelease",
"published_at": "2023-02-03T16:02:51Z"
},
{
"tag": "v3.10.5",
"kind": "patch",
"published_at": "2023-01-17T14:53:29Z"
},
{
"tag": "v3.11.0-rc.1",
"kind": "prerelease",
"published_at": "2023-01-11T15:26:18Z"
},
{
"tag": "v3.10.4",
"kind": "patch",
"published_at": "2022-11-10T15:20:16Z"
},
{
"tag": "v3.10.3",
"kind": "patch",
"published_at": "2022-10-06T13:00:48Z"
},
{
"tag": "v3.10.2",
"kind": "patch",
"published_at": "2022-07-25T21:07:44Z"
},
{
"tag": "v3.10.1",
"kind": "patch",
"published_at": "2022-07-18T18:50:31Z"
},
{
"tag": "v3.10.0",
"kind": "minor",
"published_at": "2022-05-17T19:17:14Z"
},
{
"tag": "v3.10.0-rc.2",
"kind": "prerelease",
"published_at": "2022-05-11T21:33:20Z"
},
{
"tag": "v3.10.0-rc.1",
"kind": "prerelease",
"published_at": "2022-05-04T19:20:54Z"
},
{
"tag": "v3.9.9",
"kind": "patch",
"published_at": "2022-04-22T20:28:22Z"
},
{
"tag": "v3.9.8",
"kind": "patch",
"published_at": "2022-04-07T21:06:17Z"
},
{
"tag": "v3.9.7",
"kind": "patch",
"published_at": "2022-03-23T15:40:12Z"
},
{
"tag": "v3.9.6",
"kind": "patch",
"published_at": "2022-03-10T21:39:35Z"
},
{
"tag": "v3.9.5",
"kind": "patch",
"published_at": "2022-02-04T18:00:24Z"
},
{
"tag": "v3.9.4",
"kind": "patch",
"published_at": "2022-01-19T22:05:17Z"
},
{
"tag": "v3.9.3",
"kind": "patch",
"published_at": "2022-01-11T19:43:05Z"
},
{
"tag": "v3.9.2",
"kind": "patch",
"published_at": "2021-12-10T20:33:53Z"
},
{
"tag": "v3.9.1",
"kind": "patch",
"published_at": "2021-11-22T17:37:59Z"
},
{
"tag": "v3.9.0",
"kind": "minor",
"published_at": "2021-11-16T15:07:07Z"
},
{
"tag": "v3.9.0-rc.3",
"kind": "prerelease",
"published_at": "2021-11-05T20:06:44Z"
},
{
"tag": "v3.8.4",
"kind": "patch",
"published_at": "2021-10-28T17:04:39Z"
},
{
"tag": "v3.9.0-rc.2",
"kind": "prerelease",
"published_at": "2021-10-28T16:00:57Z"
},
{
"tag": "v3.9.0-rc.1",
"kind": "prerelease",
"published_at": "2021-10-14T19:29:21Z"
},
{
"tag": "v3.8.3",
"kind": "patch",
"published_at": "2021-09-01T17:25:19Z"
},
{
"tag": "v3.8.2",
"kind": "patch",
"published_at": "2021-08-19T15:31:57Z"
},
{
"tag": "v3.8.1",
"kind": "patch",
"published_at": "2021-07-20T18:48:58Z"
},
{
"tag": "v3.8.0",
"kind": "minor",
"published_at": "2021-05-26T19:18:02Z"
},
{
"tag": "v3.7.4",
"kind": "patch",
"published_at": "2021-05-26T17:44:32Z"
},
{
"tag": "v3.8.0-rc.2",
"kind": "prerelease",
"published_at": "2021-05-18T22:30:43Z"
},
{
"tag": "v3.8.0-rc.1",
"kind": "prerelease",
"published_at": "2021-05-18T22:32:10Z"
},
{
"tag": "v3.7.3",
"kind": "patch",
"published_at": "2021-05-10T15:31:57Z"
}
],
"recent_commits": [
{
"oid": "6e4f96121cbe440600c9246136d8e66173a5eaaa",
"body": "…-c3db7d4c44\n\nchore(deps): bump the minor group with 2 updates",
"is_bot": false,
"headline": "Merge pull request #4232 from sylabs/dependabot/go_modules/main/minor…",
"author_name": "Dave Trudgian",
"author_login": "dtrudg",
"committed_at": "2026-07-22T13:33:11Z",
"body_truncated": false,
"is_coding_agent": false
},
{
"oid": "4a29022629ee6f73ee826af3b5d2ef27fc4a585f",
"body": "Bumps the minor group with 2 updates: [github.com/sigstore/cosign/v2](https://github.com/sigstore/cosign) and [github.com/vbauerster/mpb/v8](https://github.com/vbauerster/mpb).\n\n\nUpdates `github.com/sigstore/cosign/v2` from 2.6.3 to 2.6.4\n- [Release notes](https://github.com/sigstore/cosign/releases\n[…]\nr/mpb/v8\n dependency-version: 8.13.0\n dependency-type: direct:production\n update-type: version-update:semver-minor\n dependency-group: minor\n...\n\nSigned-off-by: dependabot[bot] <support@github.com>",
"is_bot": true,
"headline": "chore(deps): bump the minor group with 2 updates",
"author_name": "dependabot[bot]",
"author_login": "dependabot[bot]",
"committed_at": "2026-07-22T13:18:01Z",
"body_truncated": true,
"is_coding_agent": false
},
{
"oid": "3ff676c8f5648acfe8149530e9f66f4643043c3c",
"body": "e2e: make instance tests more robust",
"is_bot": false,
"headline": "Merge pull request #4226 from dtrudg/instance-flakes",
"author_name": "Dave Trudgian",
"author_login": "dtrudg",
"committed_at": "2026-07-20T12:37:21Z",
"body_truncated": false,
"is_coding_agent": false
},
{
"oid": "790df90d09382c59ceecf118d5dbb4c8abf74273",
"body": "…cf500c25f7\n\nchore(deps): bump the moby group with 2 updates",
"is_bot": false,
"headline": "Merge pull request #4227 from sylabs/dependabot/go_modules/main/moby-…",
"author_name": "Dave Trudgian",
"author_login": "dtrudg",
"committed_at": "2026-07-20T12:19:39Z",
"body_truncated": false,
"is_coding_agent": false
},
{
"oid": "89ca0d79938c6c710485aa5602665f875c4fc20b",
"body": "Bumps the moby group with 2 updates: [github.com/docker/cli](https://github.com/docker/cli) and [github.com/moby/buildkit](https://github.com/moby/buildkit).\n\n\nUpdates `github.com/docker/cli` from 29.6.1+incompatible to 29.6.2+incompatible\n- [Commits](https://github.com/docker/cli/compare/v29.6.1...\n[…]\n/buildkit\n dependency-version: 0.31.2\n dependency-type: direct:production\n update-type: version-update:semver-patch\n dependency-group: moby\n...\n\nSigned-off-by: dependabot[bot] <support@github.com>",
"is_bot": true,
"headline": "chore(deps): bump the moby group with 2 updates",
"author_name": "dependabot[bot]",
"author_login": "dependabot[bot]",
"committed_at": "2026-07-17T07:03:45Z",
"body_truncated": true,
"is_coding_agent": false
},
{
"oid": "71a543084c7efef95e9334c050a39a511e29c90e",
"body": "Address test flakes by:\n\n* Using random names and tcp ports for instances.\n* Broadening the retry in the `echo` function.\n* Remove an incorrect `echo` call from `testInstanceRun`. The runscript\nfor the test container does not start an echo server. The `echo` call\nwas actually being performed against an echo server container\nremaining from other tests.\n* Check the correct location for a logfile in `testInstanceRun`. Need\nto look in the correct homedir for the profile used.\n\nFixes #4153",
"is_bot": false,
"headline": "e2e: make instance tests more robust",
"author_name": "David Trudgian",
"author_login": "dtrudg",
"committed_at": "2026-07-16T13:44:17Z",
"body_truncated": false,
"is_coding_agent": false
},
{
"oid": "11e97ee4347a23f3baccc5318248a3dfc2db1ba8",
"body": "…inerd-1b91a3d232\n\nchore(deps): bump github.com/containerd/containerd/v2 from 2.2.5 to 2.2.6 in the containerd group across 1 directory",
"is_bot": false,
"headline": "Merge pull request #4217 from sylabs/dependabot/go_modules/main/conta…",
"author_name": "Dave Trudgian",
"author_login": "dtrudg",
"committed_at": "2026-07-16T12:11:39Z",
"body_truncated": false,
"is_coding_agent": false
},
{
"oid": "03e3d55b61c633affd18c1954878d310d44d4753",
"body": "Bumps the containerd group with 1 update in the / directory: [github.com/containerd/containerd/v2](https://github.com/containerd/containerd).\n\n\nUpdates `github.com/containerd/containerd/v2` from 2.2.5 to 2.2.6\n- [Release notes](https://github.com/containerd/containerd/releases)\n- [Changelog](https:/\n[…]\nd/v2\n dependency-version: 2.2.6\n dependency-type: direct:production\n update-type: version-update:semver-patch\n dependency-group: containerd\n...\n\nSigned-off-by: dependabot[bot] <support@github.com>",
"is_bot": true,
"headline": "chore(deps): bump github.com/containerd/containerd/v2",
"author_name": "dependabot[bot]",
"author_login": "dependabot[bot]",
"committed_at": "2026-07-16T11:59:58Z",
"body_truncated": true,
"is_coding_agent": false
},
{
"oid": "066bc684964b0e6ad6323ffd9044d1fc5e92c933",
"body": "…-185168c538\n\nchore(deps): bump the minor group across 1 directory with 9 updates",
"is_bot": false,
"headline": "Merge pull request #4224 from sylabs/dependabot/go_modules/main/minor…",
"author_name": "Dave Trudgian",
"author_login": "dtrudg",
"committed_at": "2026-07-16T11:58:02Z",
"body_truncated": false,
"is_coding_agent": false
},
{
"oid": "4bf9f0cda8a919585c70e955071cedc727a8956d",
"body": "Bumps the minor group with 4 updates in the / directory: [github.com/pelletier/go-toml/v2](https://github.com/pelletier/go-toml), [github.com/sylabs/scs-build-client](https://github.com/sylabs/scs-build-client), [golang.org/x/crypto](https://github.com/golang/crypto) and [google.golang.org/grpc](htt\n[…]\norg/grpc\n dependency-version: 1.82.1\n dependency-type: direct:production\n update-type: version-update:semver-patch\n dependency-group: minor\n...\n\nSigned-off-by: dependabot[bot] <support@github.com>",
"is_bot": true,
"headline": "chore(deps): bump the minor group across 1 directory with 9 updates",
"author_name": "dependabot[bot]",
"author_login": "dependabot[bot]",
"committed_at": "2026-07-16T11:47:18Z",
"body_truncated": true,
"is_coding_agent": false
},
{
"oid": "cc95938598152acbce84c409c4b79a42ffd3a0aa",
"body": "…ontainers-4d864958e9\n\nchore(deps): bump github.com/opencontainers/runc from 1.5.0 to 1.5.1 in the opencontainers group",
"is_bot": false,
"headline": "Merge pull request #4221 from sylabs/dependabot/go_modules/main/openc…",
"author_name": "Dave Trudgian",
"author_login": "dtrudg",
"committed_at": "2026-07-16T11:27:56Z",
"body_truncated": false,
"is_coding_agent": false
},
{
"oid": "e1c795400ef3b49d29e41de6e8d964b4cd18033a",
"body": null,
"is_bot": false,
"headline": "e2e: update OCSP Certificates",
"author_name": "David Trudgian",
"author_login": "dtrudg",
"committed_at": "2026-07-16T11:16:21Z",
"body_truncated": false,
"is_coding_agent": false
},
{
"oid": "3cac42c0ffce4b2a21da2dd2808fb5f806abb0ff",
"body": "Bumps the opencontainers group with 1 update: [github.com/opencontainers/runc](https://github.com/opencontainers/runc).\n\n\nUpdates `github.com/opencontainers/runc` from 1.5.0 to 1.5.1\n- [Release notes](https://github.com/opencontainers/runc/releases)\n- [Changelog](https://github.com/opencontainers/ru\n[…]\n\n dependency-version: 1.5.1\n dependency-type: direct:production\n update-type: version-update:semver-patch\n dependency-group: opencontainers\n...\n\nSigned-off-by: dependabot[bot] <support@github.com>",
"is_bot": true,
"headline": "chore(deps): bump github.com/opencontainers/runc",
"author_name": "dependabot[bot]",
"author_login": "dependabot[bot]",
"committed_at": "2026-07-15T09:10:56Z",
"body_truncated": true,
"is_coding_agent": false
},
{
"oid": "ebabaec7952c12038fb7e17d9422cf52c30b9643",
"body": "…a2be455989\n\nchore(deps): bump github.com/docker/cli from 29.6.0+incompatible to 29.6.1+incompatible in the moby group",
"is_bot": false,
"headline": "Merge pull request #4211 from sylabs/dependabot/go_modules/main/moby-…",
"author_name": "Dave Trudgian",
"author_login": "dtrudg",
"committed_at": "2026-07-01T14:16:05Z",
"body_truncated": false,
"is_coding_agent": false
},
{
"oid": "f0405b04ef2a03a441e5b4f326bb4d330e975e9a",
"body": "…-854c565c5f\n\nchore(deps): bump google.golang.org/grpc from 1.81.1 to 1.82.0 in the minor group",
"is_bot": false,
"headline": "Merge pull request #4212 from sylabs/dependabot/go_modules/main/minor…",
"author_name": "Dave Trudgian",
"author_login": "dtrudg",
"committed_at": "2026-07-01T11:48:51Z",
"body_truncated": false,
"is_coding_agent": false
},
{
"oid": "1c60bb1d1736967787473ac54d5e1077cdbde9a9",
"body": "Bumps the minor group with 1 update: [google.golang.org/grpc](https://github.com/grpc/grpc-go).\n\n\nUpdates `google.golang.org/grpc` from 1.81.1 to 1.82.0\n- [Release notes](https://github.com/grpc/grpc-go/releases)\n- [Commits](https://github.com/grpc/grpc-go/compare/v1.81.1...v1.82.0)\n\n---\nupdated-dep\n[…]\norg/grpc\n dependency-version: 1.82.0\n dependency-type: direct:production\n update-type: version-update:semver-minor\n dependency-group: minor\n...\n\nSigned-off-by: dependabot[bot] <support@github.com>",
"is_bot": true,
"headline": "chore(deps): bump google.golang.org/grpc in the minor group",
"author_name": "dependabot[bot]",
"author_login": "dependabot[bot]",
"committed_at": "2026-07-01T11:10:14Z",
"body_truncated": true,
"is_coding_agent": false
},
{
"oid": "4553179cd42babb0b145dccb7fccf1360e0c8ca8",
"body": "Bumps the moby group with 1 update: [github.com/docker/cli](https://github.com/docker/cli).\n\n\nUpdates `github.com/docker/cli` from 29.6.0+incompatible to 29.6.1+incompatible\n- [Commits](https://github.com/docker/cli/compare/v29.6.0...v29.6.1)\n\n---\nupdated-dependencies:\n- dependency-name: github.com/\n[…]\nependency-version: 29.6.1+incompatible\n dependency-type: direct:production\n update-type: version-update:semver-patch\n dependency-group: moby\n...\n\nSigned-off-by: dependabot[bot] <support@github.com>",
"is_bot": true,
"headline": "chore(deps): bump github.com/docker/cli in the moby group",
"author_name": "dependabot[bot]",
"author_login": "dependabot[bot]",
"committed_at": "2026-07-01T11:09:58Z",
"body_truncated": true,
"is_coding_agent": false
},
{
"oid": "01adb8edc09985b548f088212746180c34218e8f",
"body": "Fixed Debian build files (rootless mode)",
"is_bot": false,
"headline": "Merge pull request #4202 from peci1/patch-1",
"author_name": "Dave Trudgian",
"author_login": "dtrudg",
"committed_at": "2026-06-29T14:47:56Z",
"body_truncated": false,
"is_coding_agent": false
},
{
"oid": "af9c68020cc4d96bee7b2db14d1289edbb10c2ba",
"body": "…6a0f41efa6\n\nchore(deps): bump the moby group across 1 directory with 2 updates",
"is_bot": false,
"headline": "Merge pull request #4209 from sylabs/dependabot/go_modules/main/moby-…",
"author_name": "Dave Trudgian",
"author_login": "dtrudg",
"committed_at": "2026-06-29T12:34:29Z",
"body_truncated": false,
"is_coding_agent": false
},
{
"oid": "dd81388c6605619772babc7ffcb888038f264bc8",
"body": "Bumps the moby group with 2 updates in the / directory: [github.com/moby/buildkit](https://github.com/moby/buildkit) and [github.com/moby/sys/user](https://github.com/moby/sys).\n\n\nUpdates `github.com/moby/buildkit` from 0.31.0 to 0.31.1\n- [Release notes](https://github.com/moby/buildkit/releases)\n- \n[…]\ny/sys/user\n dependency-version: 0.4.1\n dependency-type: direct:production\n update-type: version-update:semver-patch\n dependency-group: moby\n...\n\nSigned-off-by: dependabot[bot] <support@github.com>",
"is_bot": true,
"headline": "chore(deps): bump the moby group across 1 directory with 2 updates",
"author_name": "dependabot[bot]",
"author_login": "dependabot[bot]",
"committed_at": "2026-06-26T07:03:17Z",
"body_truncated": true,
"is_coding_agent": false
},
{
"oid": "3c5a0b9bb4dd086f358c469e0670ea62bbfdcf44",
"body": "chore: point dependabot at release-4.5",
"is_bot": false,
"headline": "Merge pull request #4203 from dtrudg/post-release-4.5",
"author_name": "Dave Trudgian",
"author_login": "dtrudg",
"committed_at": "2026-06-25T14:45:13Z",
"body_truncated": false,
"is_coding_agent": false
},
{
"oid": "bcce31cf8d311b2cea792de8c74dccf52de2cbf5",
"body": null,
"is_bot": false,
"headline": "chore: point dependabot at release-4.5",
"author_name": "David Trudgian",
"author_login": "dtrudg",
"committed_at": "2026-06-25T12:15:15Z",
"body_truncated": false,
"is_coding_agent": false
},
{
"oid": "c9c04f2a497e2fc662543a1a02a5bbb887409170",
"body": "Signed-off-by: Martin Pecka <peci1@seznam.cz>",
"is_bot": false,
"headline": "Add Martin Pecka to CONTRIBUTORS.md",
"author_name": "Martin Pecka",
"author_login": "peci1",
"committed_at": "2026-06-25T11:35:04Z",
"body_truncated": false,
"is_coding_agent": false
},
{
"oid": "688823868f915eb415d24abaeec639c1a2699587",
"body": "Signed-off-by: Martin Pecka <peci1@seznam.cz>",
"is_bot": false,
"headline": "Fixed Debian build files (rootless mode)",
"author_name": "Martin Pecka",
"author_login": "peci1",
"committed_at": "2026-06-25T11:25:05Z",
"body_truncated": false,
"is_coding_agent": false
},
{
"oid": "4824860b79679ceb1198fcb85df5b6c436ab4cad",
"body": "chore: prep 4.5.0 release",
"is_bot": false,
"headline": "Merge pull request #4200 from dtrudg/prepare-4.5.0",
"author_name": "Dave Trudgian",
"author_login": "dtrudg",
"committed_at": "2026-06-25T09:33:03Z",
"body_truncated": false,
"is_coding_agent": false
},
{
"oid": "bca02726e5ed9b3ff960ae90695a05d28c10c9c1",
"body": null,
"is_bot": false,
"headline": "chore: prep 4.5.0 release",
"author_name": "David Trudgian",
"author_login": "dtrudg",
"committed_at": "2026-06-24T16:52:29Z",
"body_truncated": false,
"is_coding_agent": false
},
{
"oid": "830c485082ecc4fc5f5cd15abc28c999009c6b5d",
"body": "…-0f556b3fe2\n\nchore(deps): bump the minor group across 1 directory with 3 updates",
"is_bot": false,
"headline": "Merge pull request #4197 from sylabs/dependabot/go_modules/main/minor…",
"author_name": "Dave Trudgian",
"author_login": "dtrudg",
"committed_at": "2026-06-24T13:53:18Z",
"body_truncated": false,
"is_coding_agent": false
},
{
"oid": "d70e7bed9d944e0af4eb79bbf651b1733c5bc687",
"body": "…ontainers-4d40b05e77\n\nchore(deps): bump github.com/opencontainers/runc from 1.4.3 to 1.5.0 in the opencontainers group",
"is_bot": false,
"headline": "Merge pull request #4194 from sylabs/dependabot/go_modules/main/openc…",
"author_name": "Dave Trudgian",
"author_login": "dtrudg",
"committed_at": "2026-06-24T13:43:55Z",
"body_truncated": false,
"is_coding_agent": false
},
{
"oid": "4caa718a46204cf3ce4d7338c82f302b3dd600a9",
"body": "Bumps the minor group with 3 updates in the / directory: [github.com/pelletier/go-toml/v2](https://github.com/pelletier/go-toml), [github.com/sylabs/scs-build-client](https://github.com/sylabs/scs-build-client) and [go.etcd.io/bbolt](https://github.com/etcd-io/bbolt).\n\n\nUpdates `github.com/pelletier\n[…]\n.io/bbolt\n dependency-version: 1.5.0\n dependency-type: direct:production\n update-type: version-update:semver-minor\n dependency-group: minor\n...\n\nSigned-off-by: dependabot[bot] <support@github.com>",
"is_bot": true,
"headline": "chore(deps): bump the minor group across 1 directory with 3 updates",
"author_name": "dependabot[bot]",
"author_login": "dependabot[bot]",
"committed_at": "2026-06-24T13:35:16Z",
"body_truncated": true,
"is_coding_agent": false
},
{
"oid": "df0d076836d82f1f84900d37bd6565de59bf8b5f",
"body": "…ml.in/yaml/v4-4.0.0-rc.6\n\nchore(deps): bump go.yaml.in/yaml/v4 from 4.0.0-rc.5 to 4.0.0-rc.6",
"is_bot": false,
"headline": "Merge pull request #4198 from sylabs/dependabot/go_modules/main/go.ya…",
"author_name": "Dave Trudgian",
"author_login": "dtrudg",
"committed_at": "2026-06-24T13:33:29Z",
"body_truncated": false,
"is_coding_agent": false
},
{
"oid": "f192a6eb3774dc21606c75bb05a277c3cc1171ce",
"body": "Bumps [go.yaml.in/yaml/v4](https://github.com/yaml/go-yaml) from 4.0.0-rc.5 to 4.0.0-rc.6.\n- [Commits](https://github.com/yaml/go-yaml/compare/v4.0.0-rc.5...v4.0.0-rc.6)\n\n---\nupdated-dependencies:\n- dependency-name: go.yaml.in/yaml/v4\n dependency-version: 4.0.0-rc.6\n dependency-type: direct:production\n update-type: version-update:semver-patch\n...\n\nSigned-off-by: dependabot[bot] <support@github.com>",
"is_bot": true,
"headline": "chore(deps): bump go.yaml.in/yaml/v4 from 4.0.0-rc.5 to 4.0.0-rc.6",
"author_name": "dependabot[bot]",
"author_login": "dependabot[bot]",
"committed_at": "2026-06-24T12:38:57Z",
"body_truncated": false,
"is_coding_agent": false
},
{
"oid": "5d2096763455687f6f2f852051353e7542e4a298",
"body": "Bumps the opencontainers group with 1 update: [github.com/opencontainers/runc](https://github.com/opencontainers/runc).\n\n\nUpdates `github.com/opencontainers/runc` from 1.4.3 to 1.5.0\n- [Release notes](https://github.com/opencontainers/runc/releases)\n- [Changelog](https://github.com/opencontainers/ru\n[…]\n\n dependency-version: 1.5.0\n dependency-type: direct:production\n update-type: version-update:semver-minor\n dependency-group: opencontainers\n...\n\nSigned-off-by: dependabot[bot] <support@github.com>",
"is_bot": true,
"headline": "chore(deps): bump github.com/opencontainers/runc",
"author_name": "dependabot[bot]",
"author_login": "dependabot[bot]",
"committed_at": "2026-06-24T12:38:33Z",
"body_truncated": true,
"is_coding_agent": false
},
{
"oid": "b9c03fb381fed2fb588870d9a2f747849bde081b",
"body": "docs: LLM guidance r.e. security false positives",
"is_bot": false,
"headline": "Merge pull request #4193 from dtrudg/llm-security",
"author_name": "Dave Trudgian",
"author_login": "dtrudg",
"committed_at": "2026-06-24T12:36:58Z",
"body_truncated": false,
"is_coding_agent": false
},
{
"oid": "436202f07698a6fba58ab7b7b93f3b9d191fbc85",
"body": null,
"is_bot": false,
"headline": "docs: LLM guidance r.e. security false positives",
"author_name": "David Trudgian",
"author_login": "dtrudg",
"committed_at": "2026-06-24T11:59:18Z",
"body_truncated": false,
"is_coding_agent": false
},
{
"oid": "e1a31b5c8391c057a01f783b6dc7732ad3b9f002",
"body": "user: Add non-CGO lookups for consumers",
"is_bot": false,
"headline": "Merge pull request #4186 from dtrudg/issue-4185",
"author_name": "Dave Trudgian",
"author_login": "dtrudg",
"committed_at": "2026-06-22T15:18:29Z",
"body_truncated": false,
"is_coding_agent": false
},
{
"oid": "f92f926c52981930e9dd5d41767a786a6403b4fa",
"body": "…e94e44e4c9\n\nchore(deps): bump the moby group with 2 updates",
"is_bot": false,
"headline": "Merge pull request #4187 from sylabs/dependabot/go_modules/main/moby-…",
"author_name": "Dave Trudgian",
"author_login": "dtrudg",
"committed_at": "2026-06-22T12:12:55Z",
"body_truncated": false,
"is_coding_agent": false
},
{
"oid": "ad90ba531fa162cc787b47214a141718b532c912",
"body": "…-fb67620e96\n\nchore(deps): bump github.com/sylabs/scs-library-client from 1.4.14 to 1.4.15 in the minor group",
"is_bot": false,
"headline": "Merge pull request #4189 from sylabs/dependabot/go_modules/main/minor…",
"author_name": "Dave Trudgian",
"author_login": "dtrudg",
"committed_at": "2026-06-22T12:11:13Z",
"body_truncated": false,
"is_coding_agent": false
},
{
"oid": "24fa0784f8b25b34a27738aa6d9954afcd1a9c7a",
"body": "…inerd-121c5c72c6\n\nchore(deps): bump github.com/containerd/containerd/v2 from 2.2.4 to 2.2.5 in the containerd group",
"is_bot": false,
"headline": "Merge pull request #4188 from sylabs/dependabot/go_modules/main/conta…",
"author_name": "Dave Trudgian",
"author_login": "dtrudg",
"committed_at": "2026-06-22T12:11:03Z",
"body_truncated": false,
"is_coding_agent": false
},
{
"oid": "f26ebf67c09e3af7e52ebf4a0a21e4afd2343517",
"body": "Bumps the minor group with 1 update: [github.com/sylabs/scs-library-client](https://github.com/sylabs/scs-library-client).\n\n\nUpdates `github.com/sylabs/scs-library-client` from 1.4.14 to 1.4.15\n- [Release notes](https://github.com/sylabs/scs-library-client/releases)\n- [Commits](https://github.com/sy\n[…]\ny-client\n dependency-version: 1.4.15\n dependency-type: direct:production\n update-type: version-update:semver-patch\n dependency-group: minor\n...\n\nSigned-off-by: dependabot[bot] <support@github.com>",
"is_bot": true,
"headline": "chore(deps): bump github.com/sylabs/scs-library-client",
"author_name": "dependabot[bot]",
"author_login": "dependabot[bot]",
"committed_at": "2026-06-19T07:03:40Z",
"body_truncated": true,
"is_coding_agent": false
},
{
"oid": "1ee8cb1cd552048306f3362a9fe20fba8da9c63c",
"body": "Bumps the containerd group with 1 update: [github.com/containerd/containerd/v2](https://github.com/containerd/containerd).\n\n\nUpdates `github.com/containerd/containerd/v2` from 2.2.4 to 2.2.5\n- [Release notes](https://github.com/containerd/containerd/releases)\n- [Changelog](https://github.com/contain\n[…]\nd/v2\n dependency-version: 2.2.5\n dependency-type: direct:production\n update-type: version-update:semver-patch\n dependency-group: containerd\n...\n\nSigned-off-by: dependabot[bot] <support@github.com>",
"is_bot": true,
"headline": "chore(deps): bump github.com/containerd/containerd/v2",
"author_name": "dependabot[bot]",
"author_login": "dependabot[bot]",
"committed_at": "2026-06-19T07:03:24Z",
"body_truncated": true,
"is_coding_agent": false
},
{
"oid": "3946b24dd59a628c851da01fdc6c2a85e9f11179",
"body": "Bumps the moby group with 2 updates: [github.com/docker/cli](https://github.com/docker/cli) and [github.com/moby/moby/client](https://github.com/moby/moby).\n\n\nUpdates `github.com/docker/cli` from 29.5.3+incompatible to 29.6.0+incompatible\n- [Commits](https://github.com/docker/cli/compare/v29.5.3...v\n[…]\noby/client\n dependency-version: 0.5.0\n dependency-type: direct:production\n update-type: version-update:semver-minor\n dependency-group: moby\n...\n\nSigned-off-by: dependabot[bot] <support@github.com>",
"is_bot": true,
"headline": "chore(deps): bump the moby group with 2 updates",
"author_name": "dependabot[bot]",
"author_login": "dependabot[bot]",
"committed_at": "2026-06-19T07:03:05Z",
"body_truncated": true,
"is_coding_agent": false
},
{
"oid": "88b58ce76de82cab5a3d702b256e018269d84c06",
"body": "…9ddb7ac366\n\nchore(deps): bump github.com/moby/buildkit from 0.30.0 to 0.31.0 in the moby group",
"is_bot": false,
"headline": "Merge pull request #4179 from sylabs/dependabot/go_modules/main/moby-…",
"author_name": "Dave Trudgian",
"author_login": "dtrudg",
"committed_at": "2026-06-18T15:43:29Z",
"body_truncated": false,
"is_coding_agent": false
},
{
"oid": "f8a35cfff557bd00869bfe7ade029cec9c7104f4",
"body": null,
"is_bot": false,
"headline": "fix: adapt to buildkit upstream changes",
"author_name": "David Trudgian",
"author_login": "dtrudg",
"committed_at": "2026-06-18T15:17:31Z",
"body_truncated": false,
"is_coding_agent": false
},
{
"oid": "e904318fc61d06e269157f840c75c9a3e36a14e4",
"body": "Bumps the moby group with 1 update: [github.com/moby/buildkit](https://github.com/moby/buildkit).\n\nUpdates `github.com/moby/buildkit` from 0.30.0 to 0.31.0\n- [Release notes](https://github.com/moby/buildkit/releases)\n- [Commits](https://github.com/moby/buildkit/compare/v0.30.0...v0.31.0)\n\n---\nupdate\n[…]\n/buildkit\n dependency-version: 0.31.0\n dependency-type: direct:production\n update-type: version-update:semver-minor\n dependency-group: moby\n...\n\nSigned-off-by: dependabot[bot] <support@github.com>",
"is_bot": true,
"headline": "chore(deps): bump github.com/moby/buildkit in the moby group",
"author_name": "dependabot[bot]",
"author_login": "dependabot[bot]",
"committed_at": "2026-06-18T15:17:31Z",
"body_truncated": true,
"is_coding_agent": false
},
{
"oid": "9ae26c25d5b5265f609cf50c3e33e29369854f2e",
"body": "With recent changes, internal/pkg/util/user is may now be brought into\nprojects that consume public pkg/ code.\n\nPrior to this PR, the user package only compiles if CGO is\nenabled. Add non-CGO lookup functions, wrapping os.User when CGO is\ndisabled. This permits import into projects that don't build with CGO.\n\nCloses #4185",
"is_bot": false,
"headline": "user: Add non-CGO lookups for consumers",
"author_name": "David Trudgian",
"author_login": "dtrudg",
"committed_at": "2026-06-18T15:12:56Z",
"body_truncated": false,
"is_coding_agent": false
},
{
"oid": "39405b1e00db1f767af949b46169bb27a1de6afc",
"body": "…-4a3ac74034\n\nchore(deps): bump the minor group with 2 updates",
"is_bot": false,
"headline": "Merge pull request #4183 from sylabs/dependabot/go_modules/main/minor…",
"author_name": "Dave Trudgian",
"author_login": "dtrudg",
"committed_at": "2026-06-18T10:21:34Z",
"body_truncated": false,
"is_coding_agent": false
},
{
"oid": "a18233bc2fadc544e612b43f49b0c47c3789a67a",
"body": "…ontainers-a40e37e4c0\n\nchore(deps): bump github.com/opencontainers/runc from 1.4.2 to 1.4.3 in the opencontainers group",
"is_bot": false,
"headline": "Merge pull request #4181 from sylabs/dependabot/go_modules/main/openc…",
"author_name": "Dave Trudgian",
"author_login": "dtrudg",
"committed_at": "2026-06-18T10:09:07Z",
"body_truncated": false,
"is_coding_agent": false
},
{
"oid": "9bbf396cf7b875fea5e903fd9e3e044885343c11",
"body": null,
"is_bot": false,
"headline": "e2e: broaden invalid_toml error message check",
"author_name": "David Trudgian",
"author_login": "dtrudg",
"committed_at": "2026-06-18T10:05:22Z",
"body_truncated": false,
"is_coding_agent": false
},
{
"oid": "7e6abc3887ab3cffb8340a23d246047055451961",
"body": "Bumps the minor group with 2 updates: [github.com/cyphar/filepath-securejoin](https://github.com/cyphar/filepath-securejoin) and [github.com/pelletier/go-toml/v2](https://github.com/pelletier/go-toml).\n\n\nUpdates `github.com/cyphar/filepath-securejoin` from 0.6.1 to 0.7.0\n- [Release notes](https://gi\n[…]\no-toml/v2\n dependency-version: 2.4.0\n dependency-type: direct:production\n update-type: version-update:semver-minor\n dependency-group: minor\n...\n\nSigned-off-by: dependabot[bot] <support@github.com>",
"is_bot": true,
"headline": "chore(deps): bump the minor group with 2 updates",
"author_name": "dependabot[bot]",
"author_login": "dependabot[bot]",
"committed_at": "2026-06-18T09:14:20Z",
"body_truncated": true,
"is_coding_agent": false
},
{
"oid": "f49b7cec4168fb1b4577735893369fb626460897",
"body": "Bumps the opencontainers group with 1 update: [github.com/opencontainers/runc](https://github.com/opencontainers/runc).\n\n\nUpdates `github.com/opencontainers/runc` from 1.4.2 to 1.4.3\n- [Release notes](https://github.com/opencontainers/runc/releases)\n- [Changelog](https://github.com/opencontainers/ru\n[…]\n\n dependency-version: 1.4.3\n dependency-type: direct:production\n update-type: version-update:semver-patch\n dependency-group: opencontainers\n...\n\nSigned-off-by: dependabot[bot] <support@github.com>",
"is_bot": true,
"headline": "chore(deps): bump github.com/opencontainers/runc",
"author_name": "dependabot[bot]",
"author_login": "dependabot[bot]",
"committed_at": "2026-06-18T09:14:02Z",
"body_truncated": true,
"is_coding_agent": false
},
{
"oid": "e6be4bcf614f97aa89c122caa285cb3049c9d617",
"body": "build: use an os.Root for Mkdir / Writefile operations",
"is_bot": false,
"headline": "Merge pull request #4178 from dtrudg/rooted-build",
"author_name": "Dave Trudgian",
"author_login": "dtrudg",
"committed_at": "2026-06-17T14:00:19Z",
"body_truncated": false,
"is_coding_agent": false
},
{
"oid": "a9a2a8042ba570e8f7842292e4a1bad7e02fb94f",
"body": "…ml.in/yaml/v4-4.0.0-rc.5\n\nchore(deps): bump go.yaml.in/yaml/v4 from 4.0.0-rc.4 to 4.0.0-rc.5",
"is_bot": false,
"headline": "Merge pull request #4173 from sylabs/dependabot/go_modules/main/go.ya…",
"author_name": "Dave Trudgian",
"author_login": "dtrudg",
"committed_at": "2026-06-15T16:44:46Z",
"body_truncated": false,
"is_coding_agent": false
},
{
"oid": "27ea39104ae02500a1b7db6c377f94b2512d8dbc",
"body": "In builds, we frequently create directories and write files into a\nrootfs dir. We can use os.Root to better restrict these operations\nto the rootfs directory.\n\nThis code was developed out of exploratory work using Claude Code,\nthat has been manually reviewed and edited. The Co-authored-by trailer\nis added on this basis.\n\nCo-authored-by: Claude Code",
"is_bot": false,
"headline": "build: use an os.Root for Mkdir / Writefile operations",
"author_name": "David Trudgian",
"author_login": "dtrudg",
"committed_at": "2026-06-15T16:43:47Z",
"body_truncated": false,
"is_coding_agent": false
},
{
"oid": "5f263bd403384b865ad5bcbf30598d328f1e0693",
"body": "fs: os.Root-ed fs.MkdirAt / fs.MkdirAll",
"is_bot": false,
"headline": "Merge pull request #4177 from dtrudg/mkdirat",
"author_name": "Dave Trudgian",
"author_login": "dtrudg",
"committed_at": "2026-06-15T16:41:39Z",
"body_truncated": false,
"is_coding_agent": false
},
{
"oid": "01aee05902b9a198fd6ef5bf2a20a290ed25cd42",
"body": "Add fs.MkdirAt / fs.MkdirAll which are rooted to a specific location\nusing os.Root.\n\nUse them in place of the existing fs.Mkdir / fs.MkdirAll when\nconstructing `--workdir` locations, which shouldn't reasonably be\nsymlinked out of the specified workdir. Also for internal oci bundle\nand overlay paths.",
"is_bot": false,
"headline": "fs: os.Root-ed fs.MkdirAt / fs.MkdirAll",
"author_name": "David Trudgian",
"author_login": "dtrudg",
"committed_at": "2026-06-15T15:40:15Z",
"body_truncated": false,
"is_coding_agent": false
},
{
"oid": "200757bf0ee9ce7d78d8d0d6fb2e337d88ccb832",
"body": "Bumps [go.yaml.in/yaml/v4](https://github.com/yaml/go-yaml) from 4.0.0-rc.4 to 4.0.0-rc.5.\n- [Commits](https://github.com/yaml/go-yaml/compare/v4.0.0-rc.4...v4.0.0-rc.5)\n\n---\nupdated-dependencies:\n- dependency-name: go.yaml.in/yaml/v4\n dependency-version: 4.0.0-rc.5\n dependency-type: direct:production\n update-type: version-update:semver-patch\n...\n\nSigned-off-by: dependabot[bot] <support@github.com>",
"is_bot": true,
"headline": "chore(deps): bump go.yaml.in/yaml/v4 from 4.0.0-rc.4 to 4.0.0-rc.5",
"author_name": "dependabot[bot]",
"author_login": "dependabot[bot]",
"committed_at": "2026-06-15T11:47:30Z",
"body_truncated": false,
"is_coding_agent": false
},
{
"oid": "9fcc1d7eb01bc1426112bb119236bf7d3a2a35f9",
"body": "…-134f60b9f7\n\nchore(deps): bump the minor group with 5 updates",
"is_bot": false,
"headline": "Merge pull request #4172 from sylabs/dependabot/go_modules/main/minor…",
"author_name": "Dave Trudgian",
"author_login": "dtrudg",
"committed_at": "2026-06-15T11:46:04Z",
"body_truncated": false,
"is_coding_agent": false
},
{
"oid": "d1f3c9eb54302dd4bc8f13eee596445fc2d06b79",
"body": "hardening: Use FDs at IsOwner check locations",
"is_bot": false,
"headline": "Merge pull request #4169 from dtrudg/use-fds",
"author_name": "Dave Trudgian",
"author_login": "dtrudg",
"committed_at": "2026-06-15T11:45:29Z",
"body_truncated": false,
"is_coding_agent": false
},
{
"oid": "e52c3ba2082ae40394cb2b253c8bf4c6cc53fffb",
"body": "archive: use os.Root when extracting tar files",
"is_bot": false,
"headline": "Merge pull request #4170 from dtrudg/archive-root",
"author_name": "Dave Trudgian",
"author_login": "dtrudg",
"committed_at": "2026-06-15T11:45:17Z",
"body_truncated": false,
"is_coding_agent": false
},
{
"oid": "bc734c2eee949f89ea02f0f09d122ee4b1ff678e",
"body": "Bumps the minor group with 5 updates:\n\n| Package | From | To |\n| --- | --- | --- |\n| [golang.org/x/crypto](https://github.com/golang/crypto) | `0.52.0` | `0.53.0` |\n| [golang.org/x/sync](https://github.com/golang/sync) | `0.20.0` | `0.21.0` |\n| [golang.org/x/sys](https://github.com/golang/sys) | `0.\n[…]\ng/x/text\n dependency-version: 0.38.0\n dependency-type: direct:production\n update-type: version-update:semver-minor\n dependency-group: minor\n...\n\nSigned-off-by: dependabot[bot] <support@github.com>",
"is_bot": true,
"headline": "chore(deps): bump the minor group with 5 updates",
"author_name": "dependabot[bot]",
"author_login": "dependabot[bot]",
"committed_at": "2026-06-12T07:03:41Z",
"body_truncated": true,
"is_coding_agent": false
},
{
"oid": "b6ca266ce6cc60f0de786bef036388a71a6cdb53",
"body": "In various places in the code, fs.IsOwner has been used to verify that\nfiles are root-owned prior to using them in setuid mode.\n\nReplace fs.IsOwner checks, which are based on a path, with\nOpenTrustedFile/Executable that perform the checks on an os.File or\nfile descriptor - returning it for subsequen\n[…]\nritable by their\nowner, not group or world writable.\n\nCodex was used to explore the code for this issue, and produce draft\nchanges that have been manually reviewed and modified.\n\nCo-authored-by: Codex",
"is_bot": false,
"headline": "hardening: Use FDs at IsOwner check locations",
"author_name": "David Trudgian",
"author_login": "dtrudg",
"committed_at": "2026-06-11T16:50:10Z",
"body_truncated": true,
"is_coding_agent": false
},
{
"oid": "390a5c5dde559b2cecfae1082f59b833550ff804",
"body": "Rather than using path-based checks to prevent escape from the\ndestination / specified root, use os.Root operations whenever\npossible.\n\nLsetxattr is not supported in a root, so xattrs are still set via a\npath, though this path is previously subject to the root controls for\nthe creation of the file /\n[…]\nodebase,\nand generation of draft changes used Claude code. However, the\nchanges committed here have been re-written by hand. The\nCo-authored-by tag is added on this basis.\n\nCo-authored-by: Claude Code",
"is_bot": false,
"headline": "archive: use os.Root when extracting tar files",
"author_name": "David Trudgian",
"author_login": "dtrudg",
"committed_at": "2026-06-11T16:36:45Z",
"body_truncated": true,
"is_coding_agent": false
},
{
"oid": "d14743461f0972e9101bdf7d96901e696baef5cb",
"body": "hardening: use O_NOFOLLOW widely at possible file creation points",
"is_bot": false,
"headline": "Merge pull request #4168 from dtrudg/nofollow",
"author_name": "Dave Trudgian",
"author_login": "dtrudg",
"committed_at": "2026-06-11T16:30:11Z",
"body_truncated": false,
"is_coding_agent": false
},
{
"oid": "91fd8fcbd676708a767d20d2e9d441e47026067b",
"body": "We don't want to create any files across a dangling symlink, so use\nO_NOFOLLOW if we have O_CREAT without O_EXCL.\n\nThere isn't really a valid use case for various config files, at\nknown system / user locations, being re-directed by a single\nsymlink. Add O_NOFOLLOW when working with these.\n\nDrop os.Create, in favour of an os.OpenFile with O_NOFOLLOW.\n\nAdd a helper fs.WriteFileNoFollow, which is the same as os.WriteFile\nbut with O_FOLLOW specified. Switch to using this instead of\nos.WriteFile.",
"is_bot": false,
"headline": "hardening: use O_NOFOLLOW widely at possible file creation points",
"author_name": "David Trudgian",
"author_login": "dtrudg",
"committed_at": "2026-06-11T16:15:10Z",
"body_truncated": false,
"is_coding_agent": false
},
{
"oid": "e512455992967bd4dddb4d841d061c30d9d3b064",
"body": "layout: ensure VFS operations are rooted in session dir",
"is_bot": false,
"headline": "Merge pull request #4167 from dtrudg/vfs-harden",
"author_name": "Dave Trudgian",
"author_login": "dtrudg",
"committed_at": "2026-06-11T15:19:45Z",
"body_truncated": false,
"is_coding_agent": false
},
{
"oid": "7fd29f74bc5d055ebc678898098d6a5bd3a128af",
"body": "chore: refactor loadImages sandbox/SIF handling",
"is_bot": false,
"headline": "Merge pull request #4166 from dtrudg/refactor-imageload",
"author_name": "Dave Trudgian",
"author_login": "dtrudg",
"committed_at": "2026-06-11T15:10:27Z",
"body_truncated": false,
"is_coding_agent": false
},
{
"oid": "3b697c12b5c9766932d62274f706f8f50370cead",
"body": "When a container is created using the native runtime, the structure of\nthe session dir is setup using a session manager and VFS functions. In\naddition, the VFS functions are used to create target directories or\nfiles required for nested bind mounts.\n\nPrior to this PR, the VFS operations are not root\n[…]\nd the potential issue,\nand produced draft changes. These were reviewed and modified\nextensively to ensure correct operation was preserved, and that the\ncode is easier to follow.\n\nCo-authored-by: Codex",
"is_bot": false,
"headline": "layout: ensure VFS operations are rooted in session dir",
"author_name": "David Trudgian",
"author_login": "dtrudg",
"committed_at": "2026-06-11T14:55:56Z",
"body_truncated": true,
"is_coding_agent": false
},
{
"oid": "bb43f85aa083c7b8c94d69234008fff502adb495",
"body": null,
"is_bot": false,
"headline": "Merge pull request #4163 from dtrudg/refactor-nested-bind",
"author_name": "Dave Trudgian",
"author_login": "dtrudg",
"committed_at": "2026-06-11T14:27:15Z",
"body_truncated": false,
"is_coding_agent": false
},
{
"oid": "b98f60d05f7498bfab3fa005346d7f09496701d0",
"body": null,
"is_bot": false,
"headline": "Merge pull request #4165 from dtrudg/loop-rpc-fd",
"author_name": "Dave Trudgian",
"author_login": "dtrudg",
"committed_at": "2026-06-11T14:26:52Z",
"body_truncated": false,
"is_coding_agent": false
},
{
"oid": "cfb612b1677d6c4e24d29e64856afa487e27ccee",
"body": "Prior to this PR, the LoopDevice rpc accepted a path for the image to\nattach to a loop device. The only call is from mount_image, which\nalways passes a `/proc/self/fd/X` obtained from the relevant\n`image.Source`, resulting in an fd flow being invoked in the\nLoopDevice rpc.\n\nRemove generic path handl\n[…]\nMove the parsing of the fd value from a `/proc/self/fd/X` string up\ninto the `mountImage` code.\n\nThis simplifies the LoopDevice rpc, and ensures the source image\ncannot be swapped during the rpc call.",
"is_bot": false,
"headline": "rpc: only mount from fd in LoopDevice rpc",
"author_name": "David Trudgian",
"author_login": "dtrudg",
"committed_at": "2026-06-11T13:50:04Z",
"body_truncated": true,
"is_coding_agent": false
},
{
"oid": "f73b10b2677d386c9b39eb5f9f289f65427b68bb",
"body": "Split out the sandbox and SIF checks / preparation code into separate\nfunctions, so that loadImages is easier to follow.",
"is_bot": false,
"headline": "chore: refactor loadImages sandbox/SIF handling",
"author_name": "David Trudgian",
"author_login": "dtrudg",
"committed_at": "2026-06-11T13:46:53Z",
"body_truncated": false,
"is_coding_agent": false
},
{
"oid": "6b4e9fb46cede8f024f593db0158b45045f83352",
"body": "Prior to adding hardening, via rooted VFS operations, refactor the\ntracking of binds / nested bind points in the layout.Manager.\n\nWhen a bind mount is performed, it overrides a path within the session\nlayout. Prior to this PR, the Manager tracks these paths as keys in the\novDirs map, where the bind \n[…]\nto VFS hardening with Claude Code. These have been\nextracted, manually reviewed, and heavily re-written by hand for this\nPR. The Co-authored-by tag is added on this basis.\n\nCo-authored-by: Claude Code",
"is_bot": false,
"headline": "chore: refactor nested bind handling, add tests",
"author_name": "David Trudgian",
"author_login": "dtrudg",
"committed_at": "2026-06-11T09:22:51Z",
"body_truncated": true,
"is_coding_agent": false
},
{
"oid": "90e1da56bd9c2954888d6060345cfe28a540d987",
"body": "chore: tidy up layout.Manager code",
"is_bot": false,
"headline": "Merge pull request #4162 from dtrudg/tidy-layout-manager",
"author_name": "Dave Trudgian",
"author_login": "dtrudg",
"committed_at": "2026-06-08T15:30:01Z",
"body_truncated": false,
"is_coding_agent": false
},
{
"oid": "ae77e2ad11d19e2c06e067d21ed2b002be12bc26",
"body": null,
"is_bot": false,
"headline": "Merge pull request #4161 from dtrudg/root-rpc",
"author_name": "Dave Trudgian",
"author_login": "dtrudg",
"committed_at": "2026-06-08T14:52:02Z",
"body_truncated": false,
"is_coding_agent": false
},
{
"oid": "79200c63c285afa7771cc2ca6aeba800501b2334",
"body": "util/fs: O_NOFOLLOW for EnsureFileWithPermission",
"is_bot": false,
"headline": "Merge pull request #4160 from dtrudg/nofollow-ensurefilewithpermission",
"author_name": "Dave Trudgian",
"author_login": "dtrudg",
"committed_at": "2026-06-08T13:43:18Z",
"body_truncated": false,
"is_coding_agent": false
},
{
"oid": "1177b49166992083600b978dffd390fd3176c4c5",
"body": "Tidy up the layout.Manager code a bit, before we do further\nwork on it.\n\nDrop the VFS interface. We've only ever had, and will only have one\nVFS implementation.\n\nMove the VFS implementation into a separate vfs.go file.\n\nCreate a Manager via NewManager, rather than bare struct. Set the root\npath in NewManager.\n\nIn TestLayout, the session var is actually a Manager... so call it mgr\nto be less confusing!",
"is_bot": false,
"headline": "chore: tidy up layout.Manager code",
"author_name": "David Trudgian",
"author_login": "dtrudg",
"committed_at": "2026-06-08T12:49:02Z",
"body_truncated": false,
"is_coding_agent": false
},
{
"oid": "9cd7760b842524aa8a4f6b3be32e0028039000c3",
"body": "The RPC Mount operation can now fail with an error from os.Root. These\nare *PathError, which can be non-exported *errors.errorString under\nthe hood. The RPC gob encoding doesn't handle this, so use a wrapper\nso that the encoding doesn't fail in this case.\n\nSince we make decisions on syscall.Exxx errors, make sure our wrapping\nsatisfies .Is comparisons on these, plus ErrNotExist/ErrPermission.",
"is_bot": false,
"headline": "fix:rpc: return os.Root errors properly from Mount",
"author_name": "David Trudgian",
"author_login": "dtrudg",
"committed_at": "2026-06-08T12:39:52Z",
"body_truncated": false,
"is_coding_agent": false
},
{
"oid": "5721e10e4a43822dd6c35cc130bc89db0b2ba6ab",
"body": "Ensure that the RPC Mkdir operation doesn't create a directory outside\nof a root, which can be set to the session directory.\n\nEnsure that the RPC Mount operation doesn't mount to a target that's\noutside of a root, which can be set to the session directory.",
"is_bot": false,
"headline": "rpc: root the RPC server Mkdir and Mount operations",
"author_name": "David Trudgian",
"author_login": "dtrudg",
"committed_at": "2026-06-08T12:39:26Z",
"body_truncated": false,
"is_coding_agent": false
},
{
"oid": "2b6830d858556888fd1404191b533e58f2035134",
"body": "…b8e1437d3d\n\nchore(deps): bump github.com/docker/cli from 29.5.2+incompatible to 29.5.3+incompatible in the moby group",
"is_bot": false,
"headline": "Merge pull request #4156 from sylabs/dependabot/go_modules/main/moby-…",
"author_name": "Dave Trudgian",
"author_login": "dtrudg",
"committed_at": "2026-06-08T12:35:48Z",
"body_truncated": false,
"is_coding_agent": false
},
{
"oid": "a470a4e5a747e39803052c8c7d00c1d44fd6ce58",
"body": "The fs.EnsureFileWithPermission function is used to ensure that some\nfiles with sensitive content (gpg keyring, remote config) are present\nwith restrictive perms enforced.\n\nAdding O_NOFOLLOW ensures the chmod can't be redirected through a\nsymlink in the final path element. This isn't a big risk, as we are\nonly applying restrictive 0o600 perms via EnsureFilePermission, but is\nworth adding, and is something cursory LLM analysis will pick up.",
"is_bot": false,
"headline": "util/fs: O_NOFOLLOW for EnsureFileWithPermission",
"author_name": "David Trudgian",
"author_login": "dtrudg",
"committed_at": "2026-06-08T12:25:35Z",
"body_truncated": false,
"is_coding_agent": false
},
{
"oid": "db85ac755623bc0a9a4b36774cca59384c6b269c",
"body": "Bumps the moby group with 1 update: [github.com/docker/cli](https://github.com/docker/cli).\n\n\nUpdates `github.com/docker/cli` from 29.5.2+incompatible to 29.5.3+incompatible\n- [Commits](https://github.com/docker/cli/compare/v29.5.2...v29.5.3)\n\n---\nupdated-dependencies:\n- dependency-name: github.com/\n[…]\nependency-version: 29.5.3+incompatible\n dependency-type: direct:production\n update-type: version-update:semver-patch\n dependency-group: moby\n...\n\nSigned-off-by: dependabot[bot] <support@github.com>",
"is_bot": true,
"headline": "chore(deps): bump github.com/docker/cli in the moby group",
"author_name": "dependabot[bot]",
"author_login": "dependabot[bot]",
"committed_at": "2026-06-05T07:03:12Z",
"body_truncated": true,
"is_coding_agent": false
},
{
"oid": "60cfba98b39e4dc9cf6edeb2eeae642062a817c1",
"body": "chore: merge 4.4.2 release onto main",
"is_bot": false,
"headline": "Merge pull request #4154 from dtrudg/merge-4.4.2",
"author_name": "Dave Trudgian",
"author_login": "dtrudg",
"committed_at": "2026-06-04T16:13:16Z",
"body_truncated": false,
"is_coding_agent": false
},
{
"oid": "edd64a8d6186d24f871b019263876b937d06bbba",
"body": null,
"is_bot": false,
"headline": "chore: merge 4.4.2 release onto main",
"author_name": "David Trudgian",
"author_login": "dtrudg",
"committed_at": "2026-06-04T15:58:42Z",
"body_truncated": false,
"is_coding_agent": false
},
{
"oid": "c7a67865580c6da9c8497bd3ebd81b4c34305a24",
"body": "fix: limit container paths using path prefix, not string prefix",
"is_bot": false,
"headline": "Merge commit from fork",
"author_name": "Dave Trudgian",
"author_login": "dtrudg",
"committed_at": "2026-06-04T14:03:16Z",
"body_truncated": false,
"is_coding_agent": false
},
{
"oid": "a2ece658a36c66ae085682cb7bfa11f22d1a8bd8",
"body": "…-c96715ed81\n\nchore(deps): bump github.com/sylabs/sif/v2 from 2.24.0 to 2.24.1 in the minor group",
"is_bot": false,
"headline": "Merge pull request #4147 from sylabs/dependabot/go_modules/main/minor…",
"author_name": "Dave Trudgian",
"author_login": "dtrudg",
"committed_at": "2026-06-03T09:50:33Z",
"body_truncated": false,
"is_coding_agent": false
},
{
"oid": "d93368c4432ba7454ae07e95bb1a1da66f65b100",
"body": "…ontainers-bc1720900b\n\nchore(deps): bump github.com/opencontainers/selinux from 1.15.0 to 1.15.1 in the opencontainers group",
"is_bot": false,
"headline": "Merge pull request #4146 from sylabs/dependabot/go_modules/main/openc…",
"author_name": "Dave Trudgian",
"author_login": "dtrudg",
"committed_at": "2026-06-03T09:39:11Z",
"body_truncated": false,
"is_coding_agent": false
},
{
"oid": "f7ed217779cf65b6a3aeabd31dda49d9b059a4a8",
"body": null,
"is_bot": false,
"headline": "chore: update LICENSE_DEPENDENCIES.md",
"author_name": "David Trudgian",
"author_login": "dtrudg",
"committed_at": "2026-06-03T09:38:25Z",
"body_truncated": false,
"is_coding_agent": false
},
{
"oid": "890f16160bf8d48b1d3e8303c64e9b0ecacb7d01",
"body": "Bumps the minor group with 1 update: [github.com/sylabs/sif/v2](https://github.com/sylabs/sif).\n\n\nUpdates `github.com/sylabs/sif/v2` from 2.24.0 to 2.24.1\n- [Release notes](https://github.com/sylabs/sif/releases)\n- [Commits](https://github.com/sylabs/sif/compare/v2.24.0...v2.24.1)\n\n---\nupdated-depen\n[…]\ns/sif/v2\n dependency-version: 2.24.1\n dependency-type: direct:production\n update-type: version-update:semver-patch\n dependency-group: minor\n...\n\nSigned-off-by: dependabot[bot] <support@github.com>",
"is_bot": true,
"headline": "chore(deps): bump github.com/sylabs/sif/v2 in the minor group",
"author_name": "dependabot[bot]",
"author_login": "dependabot[bot]",
"committed_at": "2026-06-03T08:33:25Z",
"body_truncated": true,
"is_coding_agent": false
},
{
"oid": "653f5d20e45152afdd183ac10644465e8843f90a",
"body": "Bumps the opencontainers group with 1 update: [github.com/opencontainers/selinux](https://github.com/opencontainers/selinux).\n\n\nUpdates `github.com/opencontainers/selinux` from 1.15.0 to 1.15.1\n- [Release notes](https://github.com/opencontainers/selinux/releases)\n- [Commits](https://github.com/openc\n[…]\n dependency-version: 1.15.1\n dependency-type: direct:production\n update-type: version-update:semver-patch\n dependency-group: opencontainers\n...\n\nSigned-off-by: dependabot[bot] <support@github.com>",
"is_bot": true,
"headline": "chore(deps): bump github.com/opencontainers/selinux",
"author_name": "dependabot[bot]",
"author_login": "dependabot[bot]",
"committed_at": "2026-06-03T08:33:10Z",
"body_truncated": true,
"is_coding_agent": false
},
{
"oid": "7a7cb67290da4670e6eaa37739263c029a628540",
"body": null,
"is_bot": false,
"headline": "Merge pull request #4142 from dtrudg/artifact-ggcr",
"author_name": "Dave Trudgian",
"author_login": "dtrudg",
"committed_at": "2026-06-02T07:28:15Z",
"body_truncated": false,
"is_coding_agent": false
},
{
"oid": "a281019673d75cddcb3f8d15e94ce64b9f94595a",
"body": "ggcr now supports OCI artifacts with artifactType properly, and\noci-tools can use this support.\n\nDrop the wrapper we previously used for OCI-SIF / data container code\nhere.",
"is_bot": false,
"headline": "ocisif: use oci-tools / ggcr ArtifactType support",
"author_name": "David Trudgian",
"author_login": "dtrudg",
"committed_at": "2026-06-01T16:15:48Z",
"body_truncated": false,
"is_coding_agent": false
},
{
"oid": "739d9ef513c9ac0a85620d92602e873c3ceecca9",
"body": "…-26f288ddc3\n\nchore(deps): bump the minor group with 2 updates",
"is_bot": false,
"headline": "Merge pull request #4139 from sylabs/dependabot/go_modules/main/minor…",
"author_name": "Dave Trudgian",
"author_login": "dtrudg",
"committed_at": "2026-06-01T14:02:05Z",
"body_truncated": false,
"is_coding_agent": false
},
{
"oid": "90b3319a0e9b4e1ef561a33849b62ff8e667c4a0",
"body": "In google/go-containerregistry, validation of private / link-local\nauth realms now requires a host:port match with the registry.\n\nWe need to put the auth behind a mux, so it's at the same host:port\ninstead of running at a separate listener.",
"is_bot": false,
"headline": "fix: e2e: registry & auth on same port",
"author_name": "David Trudgian",
"author_login": "dtrudg",
"committed_at": "2026-06-01T13:00:40Z",
"body_truncated": false,
"is_coding_agent": false
},
{
"oid": "58b34c54217d4c4777b763415d66b645a6bc7854",
"body": "Bumps the minor group with 2 updates: [github.com/ccoveille/go-safecast/v2](https://github.com/ccoveille/go-safecast) and [github.com/sylabs/oci-tools](https://github.com/sylabs/oci-tools).\n\n\nUpdates `github.com/ccoveille/go-safecast/v2` from 2.0.0 to 2.0.1\n- [Release notes](https://github.com/ccove\n[…]\nci-tools\n dependency-version: 0.20.0\n dependency-type: direct:production\n update-type: version-update:semver-minor\n dependency-group: minor\n...\n\nSigned-off-by: dependabot[bot] <support@github.com>",
"is_bot": true,
"headline": "chore(deps): bump the minor group with 2 updates",
"author_name": "dependabot[bot]",
"author_login": "dependabot[bot]",
"committed_at": "2026-05-29T07:05:14Z",
"body_truncated": true,
"is_coding_agent": false
},
{
"oid": "c95bfccc07541b1b8f8a327d4a50da78c908cdea",
"body": "…/containerd/containerd/v2-2.2.4\n\nchore(deps): bump github.com/containerd/containerd/v2 from 2.2.3 to 2.2.4",
"is_bot": false,
"headline": "Merge pull request #4131 from sylabs/dependabot/go_modules/github.com…",
"author_name": "Dave Trudgian",
"author_login": "dtrudg",
"committed_at": "2026-05-27T14:59:42Z",
"body_truncated": false,
"is_coding_agent": false
},
{
"oid": "b9694deb2807e3bf07bcd7dcf6f644cb54016f0e",
"body": "Bumps [github.com/containerd/containerd/v2](https://github.com/containerd/containerd) from 2.2.3 to 2.2.4.\n- [Release notes](https://github.com/containerd/containerd/releases)\n- [Changelog](https://github.com/containerd/containerd/blob/main/RELEASES.md)\n- [Commits](https://github.com/containerd/cont\n[…]\n-\nupdated-dependencies:\n- dependency-name: github.com/containerd/containerd/v2\n dependency-version: 2.2.4\n dependency-type: direct:production\n...\n\nSigned-off-by: dependabot[bot] <support@github.com>",
"is_bot": true,
"headline": "chore(deps): bump github.com/containerd/containerd/v2",
"author_name": "dependabot[bot]",
"author_login": "dependabot[bot]",
"committed_at": "2026-05-27T13:58:28Z",
"body_truncated": true,
"is_coding_agent": false
},
{
"oid": "9391a4615987d9007af16fc951f94f13d7f7f83b",
"body": "…ontainers-0daac42226\n\nchore(deps): bump github.com/opencontainers/selinux from 1.14.1 to 1.15.0 in the opencontainers group across 1 directory",
"is_bot": false,
"headline": "Merge pull request #4133 from sylabs/dependabot/go_modules/main/openc…",
"author_name": "Dave Trudgian",
"author_login": "dtrudg",
"committed_at": "2026-05-27T13:56:26Z",
"body_truncated": false,
"is_coding_agent": false
},
{
"oid": "2efea9eaae62be2c3b57f41b8b5726eb2f0fb39a",
"body": "Bumps the opencontainers group with 1 update in the / directory: [github.com/opencontainers/selinux](https://github.com/opencontainers/selinux).\n\n\nUpdates `github.com/opencontainers/selinux` from 1.14.1 to 1.15.0\n- [Release notes](https://github.com/opencontainers/selinux/releases)\n- [Commits](https\n[…]\n dependency-version: 1.15.0\n dependency-type: direct:production\n update-type: version-update:semver-minor\n dependency-group: opencontainers\n...\n\nSigned-off-by: dependabot[bot] <support@github.com>",
"is_bot": true,
"headline": "chore(deps): bump github.com/opencontainers/selinux",
"author_name": "dependabot[bot]",
"author_login": "dependabot[bot]",
"committed_at": "2026-05-27T13:14:44Z",
"body_truncated": true,
"is_coding_agent": false
},
{
"oid": "e2863a74227985870c380bba3c401608622473c3",
"body": "…-d4124cc10d\n\nchore(deps): bump the minor group across 1 directory with 2 updates",
"is_bot": false,
"headline": "Merge pull request #4134 from sylabs/dependabot/go_modules/main/minor…",
"author_name": "Dave Trudgian",
"author_login": "dtrudg",
"committed_at": "2026-05-27T13:12:58Z",
"body_truncated": false,
"is_coding_agent": false
},
{
"oid": "74d0b8f307448884cbc315246167bb722ae5f8fc",
"body": "Bumps the minor group with 1 update in the / directory: [golang.org/x/crypto](https://github.com/golang/crypto).\n\n\nUpdates `golang.org/x/crypto` from 0.51.0 to 0.52.0\n- [Commits](https://github.com/golang/crypto/compare/v0.51.0...v0.52.0)\n\nUpdates `golang.org/x/sys` from 0.44.0 to 0.45.0\n- [Commits]\n[…]\nrg/x/sys\n dependency-version: 0.45.0\n dependency-type: direct:production\n update-type: version-update:semver-minor\n dependency-group: minor\n...\n\nSigned-off-by: dependabot[bot] <support@github.com>",
"is_bot": true,
"headline": "chore(deps): bump the minor group across 1 directory with 2 updates",
"author_name": "dependabot[bot]",
"author_login": "dependabot[bot]",
"committed_at": "2026-05-27T11:07:22Z",
"body_truncated": true,
"is_coding_agent": false
}
],
"releases_count": 68,
"commits_last_year": 480,
"latest_release_at": "2026-06-25T10:59:15Z",
"latest_release_tag": "v4.5.0",
"releases_from_tags": false,
"days_since_last_push": 0,
"active_weeks_last_year": 49,
"days_since_latest_release": 28,
"mean_days_between_releases": 41.2
},
"community": {
"has_readme": true,
"has_license": true,
"has_description": true,
"has_contributing": true,
"health_percentage": 100,
"has_issue_template": false,
"has_code_of_conduct": true,
"has_pull_request_template": true
},
"ecosystem": {
"packages": [
{
"name": "github.com/sylabs/singularity/v4",
"exists": true,
"license": null,
"keywords": [],
"ecosystem": "go",
"matches_repo": true,
"registry_url": "https://pkg.go.dev/github.com/sylabs/singularity/v4",
"is_deprecated": false,
"latest_version": "v4.5.0",
"repository_url": "https://github.com/sylabs/singularity",
"versions_count": 30,
"total_downloads": null,
"dependents_count": null,
"deprecation_note": null,
"maintainers_count": null,
"monthly_downloads": null,
"first_published_at": null,
"latest_published_at": "2026-06-25T09:33:03Z",
"latest_version_yanked": null,
"days_since_latest_publish": 29
}
]
},
"popularity": {
"forks": 119,
"stars": 984,
"watchers": 15,
"fork_history": {
"days": [
{
"date": "2021-05-04",
"count": 2
},
{
"date": "2021-05-11",
"count": 1
},
{
"date": "2021-05-12",
"count": 1
},
{
"date": "2021-05-14",
"count": 1
},
{
"date": "2021-05-19",
"count": 1
},
{
"date": "2021-06-08",
"count": 1
},
{
"date": "2021-06-18",
"count": 1
},
{
"date": "2021-06-21",
"count": 1
},
{
"date": "2021-06-27",
"count": 1
},
{
"date": "2021-07-23",
"count": 1
},
{
"date": "2021-08-22",
"count": 1
},
{
"date": "2021-08-26",
"count": 1
},
{
"date": "2021-08-30",
"count": 1
},
{
"date": "2021-09-02",
"count": 1
},
{
"date": "2021-09-03",
"count": 1
},
{
"date": "2021-09-14",
"count": 1
},
{
"date": "2021-10-12",
"count": 1
},
{
"date": "2021-11-25",
"count": 1
},
{
"date": "2021-12-01",
"count": 1
},
{
"date": "2021-12-07",
"count": 1
},
{
"date": "2021-12-09",
"count": 1
},
{
"date": "2022-02-20",
"count": 1
},
{
"date": "2022-02-22",
"count": 1
},
{
"date": "2022-03-17",
"count": 2
},
{
"date": "2022-03-24",
"count": 1
},
{
"date": "2022-03-26",
"count": 1
},
{
"date": "2022-03-27",
"count": 1
},
{
"date": "2022-03-31",
"count": 1
},
{
"date": "2022-04-02",
"count": 1
},
{
"date": "2022-04-07",
"count": 1
},
{
"date": "2022-04-25",
"count": 1
},
{
"date": "2022-05-16",
"count": 1
},
{
"date": "2022-06-09",
"count": 1
},
{
"date": "2022-06-14",
"count": 1
},
{
"date": "2022-06-15",
"count": 1
},
{
"date": "2022-06-16",
"count": 1
},
{
"date": "2022-06-17",
"count": 1
},
{
"date": "2022-06-22",
"count": 1
},
{
"date": "2022-08-01",
"count": 1
},
{
"date": "2022-08-21",
"count": 1
},
{
"date": "2022-09-08",
"count": 1
},
{
"date": "2022-10-05",
"count": 1
},
{
"date": "2022-11-04",
"count": 1
},
{
"date": "2022-11-29",
"count": 1
},
{
"date": "2022-12-04",
"count": 1
},
{
"date": "2022-12-18",
"count": 1
},
{
"date": "2022-12-19",
"count": 1
},
{
"date": "2023-02-09",
"count": 1
},
{
"date": "2023-02-20",
"count": 1
},
{
"date": "2023-02-22",
"count": 2
},
{
"date": "2023-02-28",
"count": 1
},
{
"date": "2023-03-01",
"count": 1
},
{
"date": "2023-03-02",
"count": 2
},
{
"date": "2023-03-29",
"count": 1
},
{
"date": "2023-04-06",
"count": 1
},
{
"date": "2023-04-11",
"count": 1
},
{
"date": "2023-04-15",
"count": 1
},
{
"date": "2023-06-21",
"count": 1
},
{
"date": "2023-07-05",
"count": 1
},
{
"date": "2023-07-07",
"count": 1
},
{
"date": "2023-08-01",
"count": 1
},
{
"date": "2023-08-15",
"count": 1
},
{
"date": "2023-08-31",
"count": 1
},
{
"date": "2023-09-15",
"count": 1
},
{
"date": "2023-09-26",
"count": 1
},
{
"date": "2023-10-23",
"count": 2
},
{
"date": "2023-10-25",
"count": 1
},
{
"date": "2023-11-03",
"count": 1
},
{
"date": "2023-11-13",
"count": 2
},
{
"date": "2023-12-09",
"count": 1
},
{
"date": "2023-12-11",
"count": 1
},
{
"date": "2023-12-23",
"count": 1
},
{
"date": "2024-02-04",
"count": 1
},
{
"date": "2024-02-12",
"count": 1
},
{
"date": "2024-02-25",
"count": 1
},
{
"date": "2024-03-25",
"count": 1
},
{
"date": "2024-03-26",
"count": 1
},
{
"date": "2024-04-23",
"count": 1
},
{
"date": "2024-05-04",
"count": 1
},
{
"date": "2024-05-26",
"count": 1
},
{
"date": "2024-06-01",
"count": 1
},
{
"date": "2024-06-15",
"count": 1
},
{
"date": "2024-07-04",
"count": 1
},
{
"date": "2024-07-06",
"count": 1
},
{
"date": "2024-07-11",
"count": 1
},
{
"date": "2024-08-05",
"count": 1
},
{
"date": "2024-08-16",
"count": 1
},
{
"date": "2024-09-05",
"count": 1
},
{
"date": "2024-09-24",
"count": 1
},
{
"date": "2024-10-05",
"count": 1
},
{
"date": "2024-12-03",
"count": 1
},
{
"date": "2024-12-06",
"count": 1
},
{
"date": "2025-02-25",
"count": 2
},
{
"date": "2025-03-12",
"count": 1
},
{
"date": "2025-03-16",
"count": 1
},
{
"date": "2025-06-17",
"count": 1
},
{
"date": "2025-07-01",
"count": 1
},
{
"date": "2025-07-07",
"count": 1
},
{
"date": "2025-07-10",
"count": 1
},
{
"date": "2025-08-28",
"count": 1
},
{
"date": "2025-09-09",
"count": 1
},
{
"date": "2025-10-25",
"count": 1
},
{
"date": "2025-10-31",
"count": 1
},
{
"date": "2025-12-05",
"count": 1
},
{
"date": "2025-12-24",
"count": 1
},
{
"date": "2026-03-18",
"count": 1
},
{
"date": "2026-03-23",
"count": 1
},
{
"date": "2026-04-05",
"count": 1
},
{
"date": "2026-06-16",
"count": 1
},
{
"date": "2026-06-21",
"count": 1
},
{
"date": "2026-06-25",
"count": 1
},
{
"date": "2026-07-05",
"count": 1
}
],
"complete": true,
"collected": 119,
"total_forks": 119
},
"star_history": null,
"open_issues_and_prs": 40
},
"ai_readiness": {
"has_nix": false,
"example_dirs": [
"example",
"examples"
],
"has_llms_txt": false,
"has_dockerfile": true,
"has_mcp_signal": false,
"bootstrap_files": [],
"api_schema_files": [],
"has_devcontainer": false,
"typecheck_configs": [],
"toolchain_manifests": [
"go.mod"
],
"largest_source_bytes": 90986,
"source_files_sampled": 544,
"oversized_source_files": 4,
"agent_instruction_files": [
"AGENTS.md",
"CLAUDE.md"
],
"agent_instruction_max_bytes": 6883
},
"dependencies": {
"manifests": [
"go.mod"
],
"advisories": {
"error": null,
"scope": "repository_graph",
"source": "osv",
"findings": [
{
"name": "github.com/distribution/distribution",
"direct": true,
"version": "v2.8.3+incompatible",
"severity": "high",
"ecosystem": "go",
"cvss_score": 7.5,
"advisory_ids": [
"GHSA-3p65-76g6-3w7r",
"GHSA-6pjf-3r9x-m592",
"GHSA-f2g3-hh2r-cwgc",
"GO-2025-3460",
"GO-2026-5094",
"GO-2026-5185"
],
"fixed_version": "3.1.1",
"advisory_count": 6,
"oldest_advisory_days": 507
},
{
"name": "github.com/sylabs/singularity",
"direct": false,
"version": "0.0.0",
"severity": "high",
"ecosystem": "go",
"cvss_score": 8.8,
"advisory_ids": [
"GHSA-jv9c-w74q-6762",
"GHSA-wqcr-7rf3-f64m",
"GO-2025-4177",
"GO-2026-5715"
],
"fixed_version": "4.4.2",
"advisory_count": 4,
"oldest_advisory_days": 1886
},
{
"name": "github.com/ulikunitz/xz",
"direct": false,
"version": "v0.5.14",
"severity": "moderate",
"ecosystem": "go",
"cvss_score": 5.3,
"advisory_ids": [
"GHSA-jc7w-c686-c4v9",
"GO-2025-3922"
],
"fixed_version": "0.5.15",
"advisory_count": 2,
"oldest_advisory_days": 329
},
{
"name": "github.com/sigstore/cosign/v2",
"direct": true,
"version": "v2.6.4",
"severity": "unknown",
"ecosystem": "go",
"cvss_score": null,
"advisory_ids": [
"GO-2026-4529"
],
"fixed_version": "3.0.5",
"advisory_count": 1,
"oldest_advisory_days": 150
},
{
"name": "golang.org/x/crypto",
"direct": true,
"version": "v0.54.0",
"severity": "unknown",
"ecosystem": "go",
"cvss_score": null,
"advisory_ids": [
"GO-2026-5932"
],
"fixed_version": null,
"advisory_count": 1,
"oldest_advisory_days": 16
}
],
"collected": true,
"malicious": [],
"truncated": false,
"by_severity": {
"high": 2,
"unknown": 2,
"moderate": 1
},
"advisory_count": 14,
"affected_count": 5,
"assessed_count": 282,
"malicious_count": 0,
"assessed_package": null,
"unassessed_count": 0,
"direct_affected_count": 3
},
"ecosystems": [
"go"
],
"dependencies": [
{
"name": "github.com/Netflix/go-expect",
"manifest": "go.mod",
"ecosystem": "go",
"version_constraint": "v0.0.0-20220104043353-73e0943537d2"
},
{
"name": "github.com/ProtonMail/go-crypto",
"manifest": "go.mod",
"ecosystem": "go",
"version_constraint": "v1.4.1"
},
{
"name": "github.com/adigunhammedolalekan/registry-auth",
"manifest": "go.mod",
"ecosystem": "go",
"version_constraint": "v0.0.0-20200730122110-8cde180a3a60"
},
{
"name": "github.com/apex/log",
"manifest": "go.mod",
"ecosystem": "go",
"version_constraint": "v1.9.0"
},
{
"name": "github.com/astromechza/etcpwdparse",
"manifest": "go.mod",
"ecosystem": "go",
"version_constraint": "v0.0.0-20170319193008-f0e5f0779716"
},
{
"name": "github.com/blang/semver/v4",
"manifest": "go.mod",
"ecosystem": "go",
"version_constraint": "v4.0.0"
},
{
"name": "github.com/buger/goterm",
"manifest": "go.mod",
"ecosystem": "go",
"version_constraint": "v1.0.4"
},
{
"name": "github.com/buger/jsonparser",
"manifest": "go.mod",
"ecosystem": "go",
"version_constraint": "v1.2.0"
},
{
"name": "github.com/ccoveille/go-safecast/v2",
"manifest": "go.mod",
"ecosystem": "go",
"version_constraint": "v2.0.1"
},
{
"name": "github.com/containerd/containerd/v2",
"manifest": "go.mod",
"ecosystem": "go",
"version_constraint": "v2.2.6"
},
{
"name": "github.com/containerd/go-runc",
"manifest": "go.mod",
"ecosystem": "go",
"version_constraint": "v1.1.0"
},
{
"name": "github.com/containerd/platforms",
"manifest": "go.mod",
"ecosystem": "go",
"version_constraint": "v1.0.0-rc.4"
},
{
"name": "github.com/containernetworking/cni",
"manifest": "go.mod",
"ecosystem": "go",
"version_constraint": "v1.3.0"
},
{
"name": "github.com/containernetworking/plugins",
"manifest": "go.mod",
"ecosystem": "go",
"version_constraint": "v1.9.1"
},
{
"name": "github.com/containers/image/v5",
"manifest": "go.mod",
"ecosystem": "go",
"version_constraint": "v5.36.2"
},
{
"name": "github.com/coreos/go-systemd/v22",
"manifest": "go.mod",
"ecosystem": "go",
"version_constraint": "v22.7.0"
},
{
"name": "github.com/cyphar/filepath-securejoin",
"manifest": "go.mod",
"ecosystem": "go",
"version_constraint": "v0.7.0"
},
{
"name": "github.com/distribution/distribution",
"manifest": "go.mod",
"ecosystem": "go",
"version_constraint": "v2.8.3+incompatible"
},
{
"name": "github.com/docker/cli",
"manifest": "go.mod",
"ecosystem": "go",
"version_constraint": "v29.6.2+incompatible"
},
{
"name": "github.com/docker/distribution",
"manifest": "go.mod",
"ecosystem": "go",
"version_constraint": "v2.8.3+incompatible"
},
{
"name": "github.com/docker/go-units",
"manifest": "go.mod",
"ecosystem": "go",
"version_constraint": "v0.5.0"
},
{
"name": "github.com/fatih/color",
"manifest": "go.mod",
"ecosystem": "go",
"version_constraint": "v1.19.0"
},
{
"name": "github.com/go-log/log",
"manifest": "go.mod",
"ecosystem": "go",
"version_constraint": "v0.2.0"
},
{
"name": "github.com/gofrs/flock",
"manifest": "go.mod",
"ecosystem": "go",
"version_constraint": "v0.13.0"
},
{
"name": "github.com/google/go-containerregistry",
"manifest": "go.mod",
"ecosystem": "go",
"version_constraint": "v0.21.6"
},
{
"name": "github.com/google/uuid",
"manifest": "go.mod",
"ecosystem": "go",
"version_constraint": "v1.6.0"
},
{
"name": "github.com/gorilla/mux",
"manifest": "go.mod",
"ecosystem": "go",
"version_constraint": "v1.8.1"
},
{
"name": "github.com/gosimple/slug",
"manifest": "go.mod",
"ecosystem": "go",
"version_constraint": "v1.15.0"
},
{
"name": "github.com/moby/buildkit",
"manifest": "go.mod",
"ecosystem": "go",
"version_constraint": "v0.31.2"
},
{
"name": "github.com/moby/go-archive",
"manifest": "go.mod",
"ecosystem": "go",
"version_constraint": "v0.2.0"
},
{
"name": "github.com/moby/moby/client",
"manifest": "go.mod",
"ecosystem": "go",
"version_constraint": "v0.5.0"
},
{
"name": "github.com/moby/profiles/seccomp",
"manifest": "go.mod",
"ecosystem": "go",
"version_constraint": "v0.2.3"
},
{
"name": "github.com/moby/sys/user",
"manifest": "go.mod",
"ecosystem": "go",
"version_constraint": "v0.4.1"
},
{
"name": "github.com/moby/sys/userns",
"manifest": "go.mod",
"ecosystem": "go",
"version_constraint": "v0.1.0"
},
{
"name": "github.com/moby/term",
"manifest": "go.mod",
"ecosystem": "go",
"version_constraint": "v0.5.2"
},
{
"name": "github.com/opencontainers/cgroups",
"manifest": "go.mod",
"ecosystem": "go",
"version_constraint": "v0.0.6"
},
{
"name": "github.com/opencontainers/image-spec",
"manifest": "go.mod",
"ecosystem": "go",
"version_constraint": "v1.1.1"
},
{
"name": "github.com/opencontainers/runc",
"manifest": "go.mod",
"ecosystem": "go",
"version_constraint": "v1.5.1"
},
{
"name": "github.com/opencontainers/runtime-spec",
"manifest": "go.mod",
"ecosystem": "go",
"version_constraint": "v1.3.0"
},
{
"name": "github.com/opencontainers/runtime-tools",
"manifest": "go.mod",
"ecosystem": "go",
"version_constraint": "v0.9.1-0.20251205004911-5e639034dcdc"
},
{
"name": "github.com/opencontainers/selinux",
"manifest": "go.mod",
"ecosystem": "go",
"version_constraint": "v1.15.1"
},
{
"name": "github.com/opencontainers/umoci",
"manifest": "go.mod",
"ecosystem": "go",
"version_constraint": "v0.6.0"
},
{
"name": "github.com/pelletier/go-toml/v2",
"manifest": "go.mod",
"ecosystem": "go",
"version_constraint": "v2.4.3"
},
{
"name": "github.com/samber/lo",
"manifest": "go.mod",
"ecosystem": "go",
"version_constraint": "v1.53.0"
},
{
"name": "github.com/sebdah/goldie/v2",
"manifest": "go.mod",
"ecosystem": "go",
"version_constraint": "v2.8.0"
},
{
"name": "github.com/seccomp/libseccomp-golang",
"manifest": "go.mod",
"ecosystem": "go",
"version_constraint": "v0.11.1"
},
{
"name": "github.com/shopspring/decimal",
"manifest": "go.mod",
"ecosystem": "go",
"version_constraint": "v1.4.0"
},
{
"name": "github.com/sigstore/cosign/v2",
"manifest": "go.mod",
"ecosystem": "go",
"version_constraint": "v2.6.4"
},
{
"name": "github.com/sigstore/sigstore",
"manifest": "go.mod",
"ecosystem": "go",
"version_constraint": "v1.10.8"
},
{
"name": "github.com/sirupsen/logrus",
"manifest": "go.mod",
"ecosystem": "go",
"version_constraint": "v1.9.4"
},
{
"name": "github.com/spf13/cobra",
"manifest": "go.mod",
"ecosystem": "go",
"version_constraint": "v1.10.2"
},
{
"name": "github.com/spf13/pflag",
"manifest": "go.mod",
"ecosystem": "go",
"version_constraint": "v1.0.10"
},
{
"name": "github.com/stretchr/testify",
"manifest": "go.mod",
"ecosystem": "go",
"version_constraint": "v1.11.1"
},
{
"name": "github.com/sylabs/json-resp",
"manifest": "go.mod",
"ecosystem": "go",
"version_constraint": "v0.9.5"
},
{
"name": "github.com/sylabs/oci-tools",
"manifest": "go.mod",
"ecosystem": "go",
"version_constraint": "v0.20.0"
},
{
"name": "github.com/sylabs/scs-build-client",
"manifest": "go.mod",
"ecosystem": "go",
"version_constraint": "v0.9.22"
},
{
"name": "github.com/sylabs/scs-key-client",
"manifest": "go.mod",
"ecosystem": "go",
"version_constraint": "v0.7.9"
},
{
"name": "github.com/sylabs/scs-library-client",
"manifest": "go.mod",
"ecosystem": "go",
"version_constraint": "v1.4.16"
},
{
"name": "github.com/sylabs/sif/v2",
"manifest": "go.mod",
"ecosystem": "go",
"version_constraint": "v2.24.1"
},
{
"name": "github.com/sylabs/squashfs",
"manifest": "go.mod",
"ecosystem": "go",
"version_constraint": "v1.0.6"
},
{
"name": "github.com/tonistiigi/fsutil",
"manifest": "go.mod",
"ecosystem": "go",
"version_constraint": "v0.0.0-20260716115106-30cd4fc5d911"
},
{
"name": "github.com/vbauerster/mpb/v8",
"manifest": "go.mod",
"ecosystem": "go",
"version_constraint": "v8.13.0"
},
{
"name": "go.etcd.io/bbolt",
"manifest": "go.mod",
"ecosystem": "go",
"version_constraint": "v1.5.0"
},
{
"name": "go.yaml.in/yaml/v4",
"manifest": "go.mod",
"ecosystem": "go",
"version_constraint": "v4.0.0-rc.6"
},
{
"name": "golang.org/x/crypto",
"manifest": "go.mod",
"ecosystem": "go",
"version_constraint": "v0.54.0"
},
{
"name": "golang.org/x/sync",
"manifest": "go.mod",
"ecosystem": "go",
"version_constraint": "v0.22.0"
},
{
"name": "golang.org/x/sys",
"manifest": "go.mod",
"ecosystem": "go",
"version_constraint": "v0.47.0"
},
{
"name": "golang.org/x/term",
"manifest": "go.mod",
"ecosystem": "go",
"version_constraint": "v0.45.0"
},
{
"name": "golang.org/x/text",
"manifest": "go.mod",
"ecosystem": "go",
"version_constraint": "v0.40.0"
},
{
"name": "google.golang.org/grpc",
"manifest": "go.mod",
"ecosystem": "go",
"version_constraint": "v1.82.1"
},
{
"name": "mvdan.cc/sh/v3",
"manifest": "go.mod",
"ecosystem": "go",
"version_constraint": "v3.13.0"
},
{
"name": "tags.cncf.io/container-device-interface",
"manifest": "go.mod",
"ecosystem": "go",
"version_constraint": "v1.1.0"
},
{
"name": "tags.cncf.io/container-device-interface/specs-go",
"manifest": "go.mod",
"ecosystem": "go",
"version_constraint": "v1.1.0"
}
],
"all_dependencies": {
"error": null,
"source": "github-sbom",
"packages": [
{
"name": "github.com/adigunhammedolalekan/registry-auth",
"direct": true,
"version": "v0.0.0-20200730122110-8cde180a3a60",
"ecosystem": "go"
},
{
"name": "github.com/apex/log",
"direct": true,
"version": "v1.9.0",
"ecosystem": "go"
},
{
"name": "github.com/astromechza/etcpwdparse",
"direct": true,
"version": "v0.0.0-20170319193008-f0e5f0779716",
"ecosystem": "go"
},
{
"name": "github.com/blang/semver/v4",
"direct": true,
"version": "v4.0.0",
"ecosystem": "go"
},
{
"name": "github.com/buger/goterm",
"direct": true,
"version": "v1.0.4",
"ecosystem": "go"
},
{
"name": "github.com/buger/jsonparser",
"direct": true,
"version": "v1.2.0",
"ecosystem": "go"
},
{
"name": "github.com/ccoveille/go-safecast/v2",
"direct": true,
"version": "v2.0.1",
"ecosystem": "go"
},
{
"name": "github.com/containerd/containerd/v2",
"direct": true,
"version": "v2.2.6",
"ecosystem": "go"
},
{
"name": "github.com/containerd/go-runc",
"direct": true,
"version": "v1.1.0",
"ecosystem": "go"
},
{
"name": "github.com/containerd/platforms",
"direct": true,
"version": "v1.0.0-rc.4",
"ecosystem": "go"
},
{
"name": "github.com/containernetworking/cni",
"direct": true,
"version": "v1.3.0",
"ecosystem": "go"
},
{
"name": "github.com/containernetworking/plugins",
"direct": true,
"version": "v1.9.1",
"ecosystem": "go"
},
{
"name": "github.com/containers/image/v5",
"direct": true,
"version": "v5.36.2",
"ecosystem": "go"
},
{
"name": "github.com/coreos/go-systemd/v22",
"direct": true,
"version": "v22.7.0",
"ecosystem": "go"
},
{
"name": "github.com/cyphar/filepath-securejoin",
"direct": true,
"version": "v0.7.0",
"ecosystem": "go"
},
{
"name": "github.com/distribution/distribution",
"direct": true,
"version": "v2.8.3+incompatible",
"ecosystem": "go"
},
{
"name": "github.com/docker/cli",
"direct": true,
"version": "v29.6.2+incompatible",
"ecosystem": "go"
},
{
"name": "github.com/docker/distribution",
"direct": true,
"version": "v2.8.3+incompatible",
"ecosystem": "go"
},
{
"name": "github.com/docker/go-units",
"direct": true,
"version": "v0.5.0",
"ecosystem": "go"
},
{
"name": "github.com/fatih/color",
"direct": true,
"version": "v1.19.0",
"ecosystem": "go"
},
{
"name": "github.com/go-log/log",
"direct": true,
"version": "v0.2.0",
"ecosystem": "go"
},
{
"name": "github.com/gofrs/flock",
"direct": true,
"version": "v0.13.0",
"ecosystem": "go"
},
{
"name": "github.com/google/go-containerregistry",
"direct": true,
"version": "v0.21.6",
"ecosystem": "go"
},
{
"name": "github.com/google/uuid",
"direct": true,
"version": "v1.6.0",
"ecosystem": "go"
},
{
"name": "github.com/gorilla/mux",
"direct": true,
"version": "v1.8.1",
"ecosystem": "go"
},
{
"name": "github.com/gosimple/slug",
"direct": true,
"version": "v1.15.0",
"ecosystem": "go"
},
{
"name": "github.com/moby/buildkit",
"direct": true,
"version": "v0.31.2",
"ecosystem": "go"
},
{
"name": "github.com/moby/go-archive",
"direct": true,
"version": "v0.2.0",
"ecosystem": "go"
},
{
"name": "github.com/moby/moby/client",
"direct": true,
"version": "v0.5.0",
"ecosystem": "go"
},
{
"name": "github.com/moby/profiles/seccomp",
"direct": true,
"version": "v0.2.3",
"ecosystem": "go"
},
{
"name": "github.com/moby/sys/user",
"direct": true,
"version": "v0.4.1",
"ecosystem": "go"
},
{
"name": "github.com/moby/sys/userns",
"direct": true,
"version": "v0.1.0",
"ecosystem": "go"
},
{
"name": "github.com/moby/term",
"direct": true,
"version": "v0.5.2",
"ecosystem": "go"
},
{
"name": "github.com/netflix/go-expect",
"direct": true,
"version": "v0.0.0-20220104043353-73e0943537d2",
"ecosystem": "go"
},
{
"name": "github.com/opencontainers/cgroups",
"direct": true,
"version": "v0.0.6",
"ecosystem": "go"
},
{
"name": "github.com/opencontainers/image-spec",
"direct": true,
"version": "v1.1.1",
"ecosystem": "go"
},
{
"name": "github.com/opencontainers/runc",
"direct": true,
"version": "v1.5.1",
"ecosystem": "go"
},
{
"name": "github.com/opencontainers/runtime-spec",
"direct": true,
"version": "v1.3.0",
"ecosystem": "go"
},
{
"name": "github.com/opencontainers/runtime-tools",
"direct": true,
"version": "v0.9.1-0.20251205004911-5e639034dcdc",
"ecosystem": "go"
},
{
"name": "github.com/opencontainers/selinux",
"direct": true,
"version": "v1.15.1",
"ecosystem": "go"
},
{
"name": "github.com/opencontainers/umoci",
"direct": true,
"version": "v0.6.0",
"ecosystem": "go"
},
{
"name": "github.com/pelletier/go-toml/v2",
"direct": true,
"version": "v2.4.3",
"ecosystem": "go"
},
{
"name": "github.com/protonmail/go-crypto",
"direct": true,
"version": "v1.4.1",
"ecosystem": "go"
},
{
"name": "github.com/samber/lo",
"direct": true,
"version": "v1.53.0",
"ecosystem": "go"
},
{
"name": "github.com/sebdah/goldie/v2",
"direct": true,
"version": "v2.8.0",
"ecosystem": "go"
},
{
"name": "github.com/seccomp/libseccomp-golang",
"direct": true,
"version": "v0.11.1",
"ecosystem": "go"
},
{
"name": "github.com/shopspring/decimal",
"direct": true,
"version": "v1.4.0",
"ecosystem": "go"
},
{
"name": "github.com/sigstore/cosign/v2",
"direct": true,
"version": "v2.6.4",
"ecosystem": "go"
},
{
"name": "github.com/sigstore/sigstore",
"direct": true,
"version": "v1.10.8",
"ecosystem": "go"
},
{
"name": "github.com/sirupsen/logrus",
"direct": true,
"version": "v1.9.4",
"ecosystem": "go"
},
{
"name": "github.com/spf13/cobra",
"direct": true,
"version": "1.1.3",
"ecosystem": "go"
},
{
"name": "github.com/spf13/cobra",
"direct": true,
"version": "v1.10.2",
"ecosystem": "go"
},
{
"name": "github.com/spf13/pflag",
"direct": true,
"version": "v1.0.10",
"ecosystem": "go"
},
{
"name": "github.com/stretchr/testify",
"direct": true,
"version": "v1.11.1",
"ecosystem": "go"
},
{
"name": "github.com/sylabs/json-resp",
"direct": true,
"version": "v0.9.5",
"ecosystem": "go"
},
{
"name": "github.com/sylabs/oci-tools",
"direct": true,
"version": "v0.20.0",
"ecosystem": "go"
},
{
"name": "github.com/sylabs/scs-build-client",
"direct": true,
"version": "v0.9.22",
"ecosystem": "go"
},
{
"name": "github.com/sylabs/scs-key-client",
"direct": true,
"version": "v0.7.9",
"ecosystem": "go"
},
{
"name": "github.com/sylabs/scs-library-client",
"direct": true,
"version": "v1.4.16",
"ecosystem": "go"
},
{
"name": "github.com/sylabs/sif/v2",
"direct": true,
"version": "v2.24.1",
"ecosystem": "go"
},
{
"name": "github.com/sylabs/squashfs",
"direct": true,
"version": "v1.0.6",
"ecosystem": "go"
},
{
"name": "github.com/tonistiigi/fsutil",
"direct": true,
"version": "v0.0.0-20260716115106-30cd4fc5d911",
"ecosystem": "go"
},
{
"name": "github.com/vbauerster/mpb/v8",
"direct": true,
"version": "v8.13.0",
"ecosystem": "go"
},
{
"name": "go.etcd.io/bbolt",
"direct": true,
"version": "v1.5.0",
"ecosystem": "go"
},
{
"name": "go.yaml.in/yaml/v4",
"direct": true,
"version": "v4.0.0-rc.6",
"ecosystem": "go"
},
{
"name": "golang.org/x/crypto",
"direct": true,
"version": "v0.54.0",
"ecosystem": "go"
},
{
"name": "golang.org/x/sync",
"direct": true,
"version": "v0.22.0",
"ecosystem": "go"
},
{
"name": "golang.org/x/sys",
"direct": true,
"version": "v0.47.0",
"ecosystem": "go"
},
{
"name": "golang.org/x/term",
"direct": true,
"version": "v0.45.0",
"ecosystem": "go"
},
{
"name": "golang.org/x/text",
"direct": true,
"version": "v0.40.0",
"ecosystem": "go"
},
{
"name": "google.golang.org/grpc",
"direct": true,
"version": "v1.82.1",
"ecosystem": "go"
},
{
"name": "mvdan.cc/sh/v3",
"direct": true,
"version": "v3.13.0",
"ecosystem": "go"
},
{
"name": "tags.cncf.io/container-device-interface",
"direct": true,
"version": "v1.1.0",
"ecosystem": "go"
},
{
"name": "tags.cncf.io/container-device-interface/specs-go",
"direct": true,
"version": "v1.1.0",
"ecosystem": "go"
},
{
"name": "cyphar.com/go-pathrs",
"direct": false,
"version": "v0.2.5",
"ecosystem": "go"
},
{
"name": "github.com/acarl005/stripansi",
"direct": false,
"version": "v0.0.0-20180116102854-5a71ef0e047d",
"ecosystem": "go"
},
{
"name": "github.com/adalogics/go-fuzz-headers",
"direct": false,
"version": "v0.0.0-20240806141605-e8a1dd7889d6",
"ecosystem": "go"
},
{
"name": "github.com/agext/levenshtein",
"direct": false,
"version": "v1.2.3",
"ecosystem": "go"
},
{
"name": "github.com/alexflint/go-filemutex",
"direct": false,
"version": "v1.3.0",
"ecosystem": "go"
},
{
"name": "github.com/anchore/go-struct-converter",
"direct": false,
"version": "v0.1.0",
"ecosystem": "go"
},
{
"name": "github.com/armon/circbuf",
"direct": false,
"version": "v0.0.0-20190214190532-5111143e8da2",
"ecosystem": "go"
},
{
"name": "github.com/asaskevich/govalidator",
"direct": false,
"version": "v0.0.0-20230301143203-a9d515a09cc2",
"ecosystem": "go"
},
{
"name": "github.com/azure/go-ansiterm",
"direct": false,
"version": "v0.0.0-20250102033503-faa5f7b0171c",
"ecosystem": "go"
},
{
"name": "github.com/beorn7/perks",
"direct": false,
"version": "v1.0.1",
"ecosystem": "go"
},
{
"name": "github.com/blang/semver",
"direct": false,
"version": "v3.5.1+incompatible",
"ecosystem": "go"
},
{
"name": "github.com/cenkalti/backoff/v5",
"direct": false,
"version": "v5.0.3",
"ecosystem": "go"
},
{
"name": "github.com/cespare/xxhash/v2",
"direct": false,
"version": "v2.3.0",
"ecosystem": "go"
},
{
"name": "github.com/cilium/ebpf",
"direct": false,
"version": "v0.17.3",
"ecosystem": "go"
},
{
"name": "github.com/clipperhouse/uax29/v2",
"direct": false,
"version": "v2.7.0",
"ecosystem": "go"
},
{
"name": "github.com/cloudflare/circl",
"direct": false,
"version": "v1.6.3",
"ecosystem": "go"
},
{
"name": "github.com/containerd/accelerated-container-image",
"direct": false,
"version": "v1.3.0",
"ecosystem": "go"
},
{
"name": "github.com/containerd/cgroups/v3",
"direct": false,
"version": "v3.1.3",
"ecosystem": "go"
},
{
"name": "github.com/containerd/console",
"direct": false,
"version": "v1.0.5",
"ecosystem": "go"
},
{
"name": "github.com/containerd/containerd/api",
"direct": false,
"version": "v1.10.0",
"ecosystem": "go"
},
{
"name": "github.com/containerd/continuity",
"direct": false,
"version": "v0.5.0",
"ecosystem": "go"
},
{
"name": "github.com/containerd/errdefs",
"direct": false,
"version": "v1.0.0",
"ecosystem": "go"
},
{
"name": "github.com/containerd/errdefs/pkg",
"direct": false,
"version": "v0.3.0",
"ecosystem": "go"
},
{
"name": "github.com/containerd/fifo",
"direct": false,
"version": "v1.1.0",
"ecosystem": "go"
},
{
"name": "github.com/containerd/go-cni",
"direct": false,
"version": "v1.1.13",
"ecosystem": "go"
},
{
"name": "github.com/containerd/log",
"direct": false,
"version": "v0.1.0",
"ecosystem": "go"
},
{
"name": "github.com/containerd/nydus-snapshotter",
"direct": false,
"version": "v0.15.15",
"ecosystem": "go"
},
{
"name": "github.com/containerd/stargz-snapshotter/estargz",
"direct": false,
"version": "v0.18.2",
"ecosystem": "go"
},
{
"name": "github.com/containerd/ttrpc",
"direct": false,
"version": "v1.2.8",
"ecosystem": "go"
},
{
"name": "github.com/containerd/typeurl/v2",
"direct": false,
"version": "v2.3.0",
"ecosystem": "go"
},
{
"name": "github.com/containers/storage",
"direct": false,
"version": "v1.59.1",
"ecosystem": "go"
},
{
"name": "github.com/coreos/go-iptables",
"direct": false,
"version": "v0.8.0",
"ecosystem": "go"
},
{
"name": "github.com/coreos/go-oidc/v3",
"direct": false,
"version": "v3.17.0",
"ecosystem": "go"
},
{
"name": "github.com/cpuguy83/go-md2man/v2",
"direct": false,
"version": "v2.0.7",
"ecosystem": "go"
},
{
"name": "github.com/creack/pty",
"direct": false,
"version": "v1.1.24",
"ecosystem": "go"
},
{
"name": "github.com/cyberphone/json-canonicalization",
"direct": false,
"version": "v0.0.0-20241213102144-19d51d7fe467",
"ecosystem": "go"
},
{
"name": "github.com/davecgh/go-spew",
"direct": false,
"version": "v1.1.2-0.20180830191138-d8f796af33cc",
"ecosystem": "go"
},
{
"name": "github.com/digitorus/pkcs7",
"direct": false,
"version": "v0.0.0-20250730155240-ffadbf3f398c",
"ecosystem": "go"
},
{
"name": "github.com/digitorus/timestamp",
"direct": false,
"version": "v0.0.0-20250524132541-c45532741eea",
"ecosystem": "go"
},
{
"name": "github.com/distribution/reference",
"direct": false,
"version": "v0.6.0",
"ecosystem": "go"
},
{
"name": "github.com/docker/docker-credential-helpers",
"direct": false,
"version": "v0.9.8",
"ecosystem": "go"
},
{
"name": "github.com/docker/go-connections",
"direct": false,
"version": "v0.7.0",
"ecosystem": "go"
},
{
"name": "github.com/docker/go-metrics",
"direct": false,
"version": "v0.0.1",
"ecosystem": "go"
},
{
"name": "github.com/docker/libtrust",
"direct": false,
"version": "v0.0.0-20160708172513-aabc10ec26b7",
"ecosystem": "go"
},
{
"name": "github.com/dustin/go-humanize",
"direct": false,
"version": "v1.0.1",
"ecosystem": "go"
},
{
"name": "github.com/felixge/httpsnoop",
"direct": false,
"version": "v1.0.4",
"ecosystem": "go"
},
{
"name": "github.com/fsnotify/fsnotify",
"direct": false,
"version": "v1.9.0",
"ecosystem": "go"
},
{
"name": "github.com/garyburd/redigo",
"direct": false,
"version": "v1.6.4",
"ecosystem": "go"
},
{
"name": "github.com/go-chi/chi/v5",
"direct": false,
"version": "v5.3.0",
"ecosystem": "go"
},
{
"name": "github.com/go-jose/go-jose/v4",
"direct": false,
"version": "v4.1.4",
"ecosystem": "go"
},
{
"name": "github.com/go-logr/logr",
"direct": false,
"version": "v1.4.3",
"ecosystem": "go"
},
{
"name": "github.com/go-logr/stdr",
"direct": false,
"version": "v1.2.2",
"ecosystem": "go"
},
{
"name": "github.com/go-openapi/analysis",
"direct": false,
"version": "v0.25.2",
"ecosystem": "go"
},
{
"name": "github.com/go-openapi/errors",
"direct": false,
"version": "v0.22.7",
"ecosystem": "go"
},
{
"name": "github.com/go-openapi/jsonpointer",
"direct": false,
"version": "v0.23.1",
"ecosystem": "go"
},
{
"name": "github.com/go-openapi/jsonreference",
"direct": false,
"version": "v0.21.6",
"ecosystem": "go"
},
{
"name": "github.com/go-openapi/loads",
"direct": false,
"version": "v0.23.3",
"ecosystem": "go"
},
{
"name": "github.com/go-openapi/runtime",
"direct": false,
"version": "v0.32.3",
"ecosystem": "go"
},
{
"name": "github.com/go-openapi/runtime/server-middleware",
"direct": false,
"version": "v0.30.0",
"ecosystem": "go"
},
{
"name": "github.com/go-openapi/spec",
"direct": false,
"version": "v0.22.5",
"ecosystem": "go"
},
{
"name": "github.com/go-openapi/strfmt",
"direct": false,
"version": "v0.26.3",
"ecosystem": "go"
},
{
"name": "github.com/go-openapi/swag",
"direct": false,
"version": "v0.26.0",
"ecosystem": "go"
},
{
"name": "github.com/go-openapi/swag/cmdutils",
"direct": false,
"version": "v0.26.0",
"ecosystem": "go"
},
{
"name": "github.com/go-openapi/swag/conv",
"direct": false,
"version": "v0.26.0",
"ecosystem": "go"
},
{
"name": "github.com/go-openapi/swag/fileutils",
"direct": false,
"version": "v0.26.0",
"ecosystem": "go"
},
{
"name": "github.com/go-openapi/swag/jsonname",
"direct": false,
"version": "v0.26.0",
"ecosystem": "go"
},
{
"name": "github.com/go-openapi/swag/jsonutils",
"direct": false,
"version": "v0.26.0",
"ecosystem": "go"
},
{
"name": "github.com/go-openapi/swag/loading",
"direct": false,
"version": "v0.26.0",
"ecosystem": "go"
},
{
"name": "github.com/go-openapi/swag/mangling",
"direct": false,
"version": "v0.26.0",
"ecosystem": "go"
},
{
"name": "github.com/go-openapi/swag/netutils",
"direct": false,
"version": "v0.26.0",
"ecosystem": "go"
},
{
"name": "github.com/go-openapi/swag/stringutils",
"direct": false,
"version": "v0.26.0",
"ecosystem": "go"
},
{
"name": "github.com/go-openapi/swag/typeutils",
"direct": false,
"version": "v0.26.0",
"ecosystem": "go"
},
{
"name": "github.com/go-openapi/swag/yamlutils",
"direct": false,
"version": "v0.26.0",
"ecosystem": "go"
},
{
"name": "github.com/go-openapi/validate",
"direct": false,
"version": "v0.25.3",
"ecosystem": "go"
},
{
"name": "github.com/go-viper/mapstructure/v2",
"direct": false,
"version": "v2.5.0",
"ecosystem": "go"
},
{
"name": "github.com/godbus/dbus/v5",
"direct": false,
"version": "v5.2.2",
"ecosystem": "go"
},
{
"name": "github.com/golang/groupcache",
"direct": false,
"version": "v0.0.0-20241129210726-2c02b8208cf8",
"ecosystem": "go"
},
{
"name": "github.com/golang/snappy",
"direct": false,
"version": "v1.0.0",
"ecosystem": "go"
},
{
"name": "github.com/google/certificate-transparency-go",
"direct": false,
"version": "v1.3.3",
"ecosystem": "go"
},
{
"name": "github.com/google/go-cmp",
"direct": false,
"version": "v0.7.0",
"ecosystem": "go"
},
{
"name": "github.com/google/shlex",
"direct": false,
"version": "v0.0.0-20191202100458-e7afc7fbc510",
"ecosystem": "go"
},
{
"name": "github.com/gorilla/handlers",
"direct": false,
"version": "v1.5.2",
"ecosystem": "go"
},
{
"name": "github.com/gorilla/websocket",
"direct": false,
"version": "v1.5.4-0.20250319132907-e064f32e3674",
"ecosystem": "go"
},
{
"name": "github.com/gosimple/unidecode",
"direct": false,
"version": "v1.0.1",
"ecosystem": "go"
},
{
"name": "github.com/grpc-ecosystem/grpc-gateway/v2",
"direct": false,
"version": "v2.29.0",
"ecosystem": "go"
},
{
"name": "github.com/hashicorp/errwrap",
"direct": false,
"version": "v1.1.0",
"ecosystem": "go"
},
{
"name": "github.com/hashicorp/go-cleanhttp",
"direct": false,
"version": "v0.5.2",
"ecosystem": "go"
},
{
"name": "github.com/hashicorp/go-immutable-radix/v2",
"direct": false,
"version": "v2.1.0",
"ecosystem": "go"
},
{
"name": "github.com/hashicorp/go-multierror",
"direct": false,
"version": "v1.1.1",
"ecosystem": "go"
},
{
"name": "github.com/hashicorp/go-retryablehttp",
"direct": false,
"version": "v0.7.8",
"ecosystem": "go"
},
{
"name": "github.com/hashicorp/golang-lru/v2",
"direct": false,
"version": "v2.0.7",
"ecosystem": "go"
},
{
"name": "github.com/hiddeco/sshsig",
"direct": false,
"version": "v0.2.0",
"ecosystem": "go"
},
{
"name": "github.com/in-toto/attestation",
"direct": false,
"version": "v1.2.0",
"ecosystem": "go"
},
{
"name": "github.com/in-toto/in-toto-golang",
"direct": false,
"version": "v0.11.0",
"ecosystem": "go"
},
{
"name": "github.com/inconshreveable/mousetrap",
"direct": false,
"version": "v1.1.0",
"ecosystem": "go"
},
{
"name": "github.com/insomniacslk/dhcp",
"direct": false,
"version": "v0.0.0-20250417080101-5f8cf70e8c5f",
"ecosystem": "go"
},
{
"name": "github.com/jedisct1/go-minisign",
"direct": false,
"version": "v0.0.0-20241212093149-d2f9f49435c7",
"ecosystem": "go"
},
{
"name": "github.com/josharian/native",
"direct": false,
"version": "v1.1.0",
"ecosystem": "go"
},
{
"name": "github.com/klauspost/compress",
"direct": false,
"version": "v1.18.6",
"ecosystem": "go"
},
{
"name": "github.com/klauspost/pgzip",
"direct": false,
"version": "v1.2.6",
"ecosystem": "go"
},
{
"name": "github.com/letsencrypt/boulder",
"direct": false,
"version": "v0.20260309.0",
"ecosystem": "go"
},
{
"name": "github.com/mattn/go-colorable",
"direct": false,
"version": "v0.1.14",
"ecosystem": "go"
},
{
"name": "github.com/mattn/go-isatty",
"direct": false,
"version": "v0.0.20",
"ecosystem": "go"
},
{
"name": "github.com/mattn/go-runewidth",
"direct": false,
"version": "v0.0.24",
"ecosystem": "go"
},
{
"name": "github.com/mattn/go-shellwords",
"direct": false,
"version": "v1.0.12",
"ecosystem": "go"
},
{
"name": "github.com/mdlayher/packet",
"direct": false,
"version": "v1.1.2",
"ecosystem": "go"
},
{
"name": "github.com/mdlayher/socket",
"direct": false,
"version": "v0.5.1",
"ecosystem": "go"
},
{
"name": "github.com/microsoft/go-winio",
"direct": false,
"version": "v0.6.2",
"ecosystem": "go"
},
{
"name": "github.com/microsoft/hcsshim",
"direct": false,
"version": "v0.14.1",
"ecosystem": "go"
},
{
"name": "github.com/mitchellh/hashstructure/v2",
"direct": false,
"version": "v2.0.2",
"ecosystem": "go"
},
{
"name": "github.com/moby/docker-image-spec",
"direct": false,
"version": "v1.3.1",
"ecosystem": "go"
},
{
"name": "github.com/moby/locker",
"direct": false,
"version": "v1.0.1",
"ecosystem": "go"
},
{
"name": "github.com/moby/moby/api",
"direct": false,
"version": "v1.55.0",
"ecosystem": "go"
},
{
"name": "github.com/moby/patternmatcher",
"direct": false,
"version": "v0.6.1",
"ecosystem": "go"
},
{
"name": "github.com/moby/policy-helpers",
"direct": false,
"version": "v0.0.0-20260612073044-d5411a945cfc",
"ecosystem": "go"
},
{
"name": "github.com/moby/sys/capability",
"direct": false,
"version": "v0.4.0",
"ecosystem": "go"
},
{
"name": "github.com/moby/sys/mount",
"direct": false,
"version": "v0.3.5-0.20260529155943-fc52b7222d0b",
"ecosystem": "go"
},
{
"name": "github.com/moby/sys/mountinfo",
"direct": false,
"version": "v0.7.2",
"ecosystem": "go"
},
{
"name": "github.com/moby/sys/reexec",
"direct": false,
"version": "v0.1.0",
"ecosystem": "go"
},
{
"name": "github.com/moby/sys/sequential",
"direct": false,
"version": "v0.7.0",
"ecosystem": "go"
},
{
"name": "github.com/moby/sys/signal",
"direct": false,
"version": "v0.7.1",
"ecosystem": "go"
},
{
"name": "github.com/morikuni/aec",
"direct": false,
"version": "v1.1.0",
"ecosystem": "go"
},
{
"name": "github.com/munnerz/goautoneg",
"direct": false,
"version": "v0.0.0-20191010083416-a7dc8b61c822",
"ecosystem": "go"
},
{
"name": "github.com/networkplumbing/go-nft",
"direct": false,
"version": "v0.4.0",
"ecosystem": "go"
},
{
"name": "github.com/nozzle/throttler",
"direct": false,
"version": "v0.0.0-20180817012639-2ea982251481",
"ecosystem": "go"
},
{
"name": "github.com/oklog/ulid/v2",
"direct": false,
"version": "v2.1.1",
"ecosystem": "go"
},
{
"name": "github.com/opencontainers/go-digest",
"direct": false,
"version": "v1.0.0",
"ecosystem": "go"
},
{
"name": "github.com/package-url/packageurl-go",
"direct": false,
"version": "v0.1.3",
"ecosystem": "go"
},
{
"name": "github.com/petermattis/goid",
"direct": false,
"version": "v0.0.0-20250721140440-ea1c0173183e",
"ecosystem": "go"
},
{
"name": "github.com/pierrec/lz4/v4",
"direct": false,
"version": "v4.1.22",
"ecosystem": "go"
},
{
"name": "github.com/pkg/browser",
"direct": false,
"version": "v0.0.0-20240102092130-5ac0b6a4141c",
"ecosystem": "go"
},
{
"name": "github.com/pkg/errors",
"direct": false,
"version": "v0.9.1",
"ecosystem": "go"
},
{
"name": "github.com/planetscale/vtprotobuf",
"direct": false,
"version": "v0.6.1-0.20240319094008-0393e58bdf10",
"ecosystem": "go"
},
{
"name": "github.com/pmezard/go-difflib",
"direct": false,
"version": "v1.0.1-0.20181226105442-5d4384ee4fb2",
"ecosystem": "go"
},
{
"name": "github.com/prometheus/client_golang",
"direct": false,
"version": "v1.23.2",
"ecosystem": "go"
},
{
"name": "github.com/prometheus/client_model",
"direct": false,
"version": "v0.6.2",
"ecosystem": "go"
},
{
"name": "github.com/prometheus/common",
"direct": false,
"version": "v0.67.5",
"ecosystem": "go"
},
{
"name": "github.com/prometheus/procfs",
"direct": false,
"version": "v0.20.1",
"ecosystem": "go"
},
{
"name": "github.com/rootless-containers/proto/go-proto",
"direct": false,
"version": "v0.0.0-20230421021042-4cd87ebadd67",
"ecosystem": "go"
},
{
"name": "github.com/russross/blackfriday/v2",
"direct": false,
"version": "v2.1.0",
"ecosystem": "go"
},
{
"name": "github.com/safchain/ethtool",
"direct": false,
"version": "v0.6.2",
"ecosystem": "go"
},
{
"name": "github.com/sasha-s/go-deadlock",
"direct": false,
"version": "v0.3.5",
"ecosystem": "go"
},
{
"name": "github.com/sassoftware/relic",
"direct": false,
"version": "v7.2.1+incompatible",
"ecosystem": "go"
},
{
"name": "github.com/secure-systems-lab/go-securesystemslib",
"direct": false,
"version": "v0.11.0",
"ecosystem": "go"
},
{
"name": "github.com/sergi/go-diff",
"direct": false,
"version": "v1.4.0",
"ecosystem": "go"
},
{
"name": "github.com/shibumi/go-pathspec",
"direct": false,
"version": "v1.3.0",
"ecosystem": "go"
},
{
"name": "github.com/sigstore/protobuf-specs",
"direct": false,
"version": "v0.5.1",
"ecosystem": "go"
},
{
"name": "github.com/sigstore/rekor",
"direct": false,
"version": "v1.5.2",
"ecosystem": "go"
},
{
"name": "github.com/sigstore/rekor-tiles/v2",
"direct": false,
"version": "v2.2.2-0.20260601073857-5d098a2b6443",
"ecosystem": "go"
},
{
"name": "github.com/sigstore/sigstore-go",
"direct": false,
"version": "v1.2.1",
"ecosystem": "go"
},
{
"name": "github.com/sigstore/timestamp-authority/v2",
"direct": false,
"version": "v2.1.2",
"ecosystem": "go"
},
{
"name": "github.com/spdx/tools-golang",
"direct": false,
"version": "v0.5.7",
"ecosystem": "go"
},
{
"name": "github.com/sylabs/singularity",
"direct": false,
"version": "0.0.0",
"ecosystem": "go"
},
{
"name": "github.com/syndtr/goleveldb",
"direct": false,
"version": "v1.0.1-0.20220721030215-126854af5e6d",
"ecosystem": "go"
},
{
"name": "github.com/therootcompany/xz",
"direct": false,
"version": "v1.0.1",
"ecosystem": "go"
},
{
"name": "github.com/theupdateframework/go-tuf",
"direct": false,
"version": "v0.7.0",
"ecosystem": "go"
},
{
"name": "github.com/theupdateframework/go-tuf/v2",
"direct": false,
"version": "v2.4.2",
"ecosystem": "go"
},
{
"name": "github.com/titanous/rocacheck",
"direct": false,
"version": "v0.0.0-20171023193734-afe73141d399",
"ecosystem": "go"
},
{
"name": "github.com/tonistiigi/dchapes-mode",
"direct": false,
"version": "v0.0.0-20250318174251-73d941a28323",
"ecosystem": "go"
},
{
"name": "github.com/tonistiigi/go-archvariant",
"direct": false,
"version": "v1.0.0",
"ecosystem": "go"
},
{
"name": "github.com/tonistiigi/go-csvvalue",
"direct": false,
"version": "v0.0.0-20240814133006-030d3b2625d0",
"ecosystem": "go"
},
{
"name": "github.com/tonistiigi/units",
"direct": false,
"version": "v0.0.0-20180711220420-6950e57a87ea",
"ecosystem": "go"
},
{
"name": "github.com/tonistiigi/vt100",
"direct": false,
"version": "v0.0.0-20240514184818-90bafcd6abab",
"ecosystem": "go"
},
{
"name": "github.com/transparency-dev/formats",
"direct": false,
"version": "v0.1.1",
"ecosystem": "go"
},
{
"name": "github.com/transparency-dev/merkle",
"direct": false,
"version": "v0.0.2",
"ecosystem": "go"
},
{
"name": "github.com/u-root/uio",
"direct": false,
"version": "v0.0.0-20240224005618-d2acac8f3701",
"ecosystem": "go"
},
{
"name": "github.com/ulikunitz/xz",
"direct": false,
"version": "v0.5.14",
"ecosystem": "go"
},
{
"name": "github.com/vbatts/go-mtree",
"direct": false,
"version": "v0.6.1-0.20250911112631-8307d76bc1b9",
"ecosystem": "go"
},
{
"name": "github.com/vbatts/tar-split",
"direct": false,
"version": "v0.12.3",
"ecosystem": "go"
},
{
"name": "github.com/vishvananda/netlink",
"direct": false,
"version": "v1.3.1",
"ecosystem": "go"
},
{
"name": "github.com/vishvananda/netns",
"direct": false,
"version": "v0.0.5",
"ecosystem": "go"
},
{
"name": "github.com/vividcortex/ewma",
"direct": false,
"version": "v1.2.0",
"ecosystem": "go"
},
{
"name": "github.com/xeipuuv/gojsonpointer",
"direct": false,
"version": "v0.0.0-20190905194746-02993c407bfb",
"ecosystem": "go"
},
{
"name": "github.com/xeipuuv/gojsonreference",
"direct": false,
"version": "v0.0.0-20180127040603-bd5ef7bd5415",
"ecosystem": "go"
},
{
"name": "github.com/xeipuuv/gojsonschema",
"direct": false,
"version": "v1.2.0",
"ecosystem": "go"
},
{
"name": "github.com/youmark/pkcs8",
"direct": false,
"version": "v0.0.0-20240726163527-a2c0da244d78",
"ecosystem": "go"
},
{
"name": "go.opencensus.io",
"direct": false,
"version": "v0.24.0",
"ecosystem": "go"
},
{
"name": "go.opentelemetry.io/auto/sdk",
"direct": false,
"version": "v1.2.1",
"ecosystem": "go"
},
{
"name": "go.opentelemetry.io/contrib/instrumentation/google.golang.org/grpc/otelgrpc",
"direct": false,
"version": "v0.69.0",
"ecosystem": "go"
},
{
"name": "go.opentelemetry.io/contrib/instrumentation/net/http/httptrace/otelhttptrace",
"direct": false,
"version": "v0.69.0",
"ecosystem": "go"
},
{
"name": "go.opentelemetry.io/contrib/instrumentation/net/http/otelhttp",
"direct": false,
"version": "v0.69.0",
"ecosystem": "go"
},
{
"name": "go.opentelemetry.io/otel",
"direct": false,
"version": "v1.44.0",
"ecosystem": "go"
},
{
"name": "go.opentelemetry.io/otel/exporters/otlp/otlpmetric/otlpmetricgrpc",
"direct": false,
"version": "v1.44.0",
"ecosystem": "go"
},
{
"name": "go.opentelemetry.io/otel/exporters/otlp/otlpmetric/otlpmetrichttp",
"direct": false,
"version": "v1.44.0",
"ecosystem": "go"
},
{
"name": "go.opentelemetry.io/otel/exporters/otlp/otlptrace",
"direct": false,
"version": "v1.44.0",
"ecosystem": "go"
},
{
"name": "go.opentelemetry.io/otel/exporters/otlp/otlptrace/otlptracegrpc",
"direct": false,
"version": "v1.44.0",
"ecosystem": "go"
},
{
"name": "go.opentelemetry.io/otel/exporters/otlp/otlptrace/otlptracehttp",
"direct": false,
"version": "v1.44.0",
"ecosystem": "go"
},
{
"name": "go.opentelemetry.io/otel/metric",
"direct": false,
"version": "v1.44.0",
"ecosystem": "go"
},
{
"name": "go.opentelemetry.io/otel/sdk",
"direct": false,
"version": "v1.44.0",
"ecosystem": "go"
},
{
"name": "go.opentelemetry.io/otel/sdk/metric",
"direct": false,
"version": "v1.44.0",
"ecosystem": "go"
},
{
"name": "go.opentelemetry.io/otel/trace",
"direct": false,
"version": "v1.44.0",
"ecosystem": "go"
},
{
"name": "go.opentelemetry.io/proto/otlp",
"direct": false,
"version": "v1.10.0",
"ecosystem": "go"
},
{
"name": "go.uber.org/multierr",
"direct": false,
"version": "v1.11.0",
"ecosystem": "go"
},
{
"name": "go.uber.org/zap",
"direct": false,
"version": "v1.28.0",
"ecosystem": "go"
},
{
"name": "go.yaml.in/yaml/v2",
"direct": false,
"version": "v2.4.4",
"ecosystem": "go"
},
{
"name": "go.yaml.in/yaml/v3",
"direct": false,
"version": "v3.0.4",
"ecosystem": "go"
},
{
"name": "golang.org/x/mod",
"direct": false,
"version": "v0.37.0",
"ecosystem": "go"
},
{
"name": "golang.org/x/net",
"direct": false,
"version": "v0.56.0",
"ecosystem": "go"
},
{
"name": "golang.org/x/oauth2",
"direct": false,
"version": "v0.36.0",
"ecosystem": "go"
},
{
"name": "golang.org/x/time",
"direct": false,
"version": "v0.15.0",
"ecosystem": "go"
},
{
"name": "google.golang.org/genproto/googleapis/api",
"direct": false,
"version": "v0.0.0-20260526163538-3dc84a4a5aaa",
"ecosystem": "go"
},
{
"name": "google.golang.org/genproto/googleapis/rpc",
"direct": false,
"version": "v0.0.0-20260526163538-3dc84a4a5aaa",
"ecosystem": "go"
},
{
"name": "google.golang.org/protobuf",
"direct": false,
"version": "v1.36.11",
"ecosystem": "go"
},
{
"name": "gopkg.in/yaml.v2",
"direct": false,
"version": "v2.4.0",
"ecosystem": "go"
},
{
"name": "gopkg.in/yaml.v3",
"direct": false,
"version": "v3.0.1",
"ecosystem": "go"
},
{
"name": "k8s.io/klog/v2",
"direct": false,
"version": "v2.140.0",
"ecosystem": "go"
},
{
"name": "sigs.k8s.io/knftables",
"direct": false,
"version": "v0.0.18",
"ecosystem": "go"
},
{
"name": "sigs.k8s.io/yaml",
"direct": false,
"version": "v1.6.0",
"ecosystem": "go"
}
],
"collected": true,
"truncated": false,
"total_count": 282,
"direct_count": 74,
"indirect_count": 208
}
},
"maintainership": {
"issues": {
"open_prs": 3,
"merged_prs": 2809,
"open_issues": 37,
"closed_ratio": 0.957,
"closed_issues": 831,
"closed_unmerged_prs": 423
},
"bus_factor": 3,
"bot_contributors": 2,
"top_contributors": [
{
"type": "User",
"login": "dtrudg",
"commits": 3232,
"avatar_url": "https://avatars.githubusercontent.com/u/4522799?v=4"
},
{
"type": "User",
"login": "gmkurtzer",
"commits": 2526,
"avatar_url": "https://avatars.githubusercontent.com/u/13984965?v=4"
},
{
"type": "User",
"login": "cclerget",
"commits": 1924,
"avatar_url": "https://avatars.githubusercontent.com/u/3274134?v=4"
},
{
"type": "User",
"login": "bauerm97",
"commits": 939,
"avatar_url": "https://avatars.githubusercontent.com/u/14863407?v=4"
},
{
"type": "User",
"login": "ikaneshiro",
"commits": 841,
"avatar_url": "https://avatars.githubusercontent.com/u/15389064?v=4"
},
{
"type": "User",
"login": "GodloveD",
"commits": 704,
"avatar_url": "https://avatars.githubusercontent.com/u/7672924?v=4"
},
{
"type": "User",
"login": "vsoch",
"commits": 702,
"avatar_url": "https://avatars.githubusercontent.com/u/814322?v=4"
},
{
"type": "User",
"login": "yhcote",
"commits": 569,
"avatar_url": "https://avatars.githubusercontent.com/u/13560291?v=4"
},
{
"type": "User",
"login": "ArangoGutierrez",
"commits": 568,
"avatar_url": "https://avatars.githubusercontent.com/u/15933089?v=4"
},
{
"type": "User",
"login": "gvallee",
"commits": 363,
"avatar_url": "https://avatars.githubusercontent.com/u/419592?v=4"
}
],
"contributors_sampled": 98,
"top_contributor_share": 0.23
},
"quality_signals": {
"has_ci": false,
"has_tests": true,
"ci_workflows": [],
"has_docs_dir": true,
"linter_configs": [
".golangci.yml"
],
"has_editorconfig": false,
"has_linter_config": true,
"has_precommit_config": false
},
"security_signals": {
"lockfiles": [
"go.sum"
],
"scorecard": {
"checks": [
{
"name": "Binary-Artifacts",
"score": 10,
"reason": "no binaries found in the repo",
"documentation_url": "https://github.com/ossf/scorecard/blob/c395761df6afe1a69e476bc60a013a94bcbc153f/docs/checks.md#binary-artifacts"
},
{
"name": "Branch-Protection",
"score": null,
"reason": "internal error: error during branchesHandler.setup: internal error: some github tokens can't read classic branch protection rules: https://github.com/ossf/scorecard-action/blob/main/docs/authentication/fine-grained-auth-token.md",
"documentation_url": "https://github.com/ossf/scorecard/blob/c395761df6afe1a69e476bc60a013a94bcbc153f/docs/checks.md#branch-protection"
},
{
"name": "CI-Tests",
"score": 10,
"reason": "15 out of 15 merged PRs checked by a CI test -- score normalized to 10",
"documentation_url": "https://github.com/ossf/scorecard/blob/c395761df6afe1a69e476bc60a013a94bcbc153f/docs/checks.md#ci-tests"
},
{
"name": "CII-Best-Practices",
"score": 0,
"reason": "no effort to earn an OpenSSF best practices badge detected",
"documentation_url": "https://github.com/ossf/scorecard/blob/c395761df6afe1a69e476bc60a013a94bcbc153f/docs/checks.md#cii-best-practices"
},
{
"name": "Code-Review",
"score": 10,
"reason": "all changesets reviewed",
"documentation_url": "https://github.com/ossf/scorecard/blob/c395761df6afe1a69e476bc60a013a94bcbc153f/docs/checks.md#code-review"
},
{
"name": "Contributors",
"score": 10,
"reason": "project has 78 contributing companies or organizations",
"documentation_url": "https://github.com/ossf/scorecard/blob/c395761df6afe1a69e476bc60a013a94bcbc153f/docs/checks.md#contributors"
},
{
"name": "Dangerous-Workflow",
"score": null,
"reason": "no workflows found",
"documentation_url": "https://github.com/ossf/scorecard/blob/c395761df6afe1a69e476bc60a013a94bcbc153f/docs/checks.md#dangerous-workflow"
},
{
"name": "Dependency-Update-Tool",
"score": 10,
"reason": "update tool detected",
"documentation_url": "https://github.com/ossf/scorecard/blob/c395761df6afe1a69e476bc60a013a94bcbc153f/docs/checks.md#dependency-update-tool"
},
{
"name": "Fuzzing",
"score": 0,
"reason": "project is not fuzzed",
"documentation_url": "https://github.com/ossf/scorecard/blob/c395761df6afe1a69e476bc60a013a94bcbc153f/docs/checks.md#fuzzing"
},
{
"name": "License",
"score": 9,
"reason": "license file detected",
"documentation_url": "https://github.com/ossf/scorecard/blob/c395761df6afe1a69e476bc60a013a94bcbc153f/docs/checks.md#license"
},
{
"name": "Maintained",
"score": 10,
"reason": "30 commit(s) and 2 issue activity found in the last 90 days -- score normalized to 10",
"documentation_url": "https://github.com/ossf/scorecard/blob/c395761df6afe1a69e476bc60a013a94bcbc153f/docs/checks.md#maintained"
},
{
"name": "Packaging",
"score": null,
"reason": "packaging workflow not detected",
"documentation_url": "https://github.com/ossf/scorecard/blob/c395761df6afe1a69e476bc60a013a94bcbc153f/docs/checks.md#packaging"
},
{
"name": "Pinned-Dependencies",
"score": 0,
"reason": "dependency not pinned by hash detected -- score normalized to 0",
"documentation_url": "https://github.com/ossf/scorecard/blob/c395761df6afe1a69e476bc60a013a94bcbc153f/docs/checks.md#pinned-dependencies"
},
{
"name": "SAST",
"score": 0,
"reason": "SAST tool is not run on all commits -- score normalized to 0",
"documentation_url": "https://github.com/ossf/scorecard/blob/c395761df6afe1a69e476bc60a013a94bcbc153f/docs/checks.md#sast"
},
{
"name": "Security-Policy",
"score": 10,
"reason": "security policy file detected",
"documentation_url": "https://github.com/ossf/scorecard/blob/c395761df6afe1a69e476bc60a013a94bcbc153f/docs/checks.md#security-policy"
},
{
"name": "Signed-Releases",
"score": 0,
"reason": "Project has not signed or included provenance with any releases.",
"documentation_url": "https://github.com/ossf/scorecard/blob/c395761df6afe1a69e476bc60a013a94bcbc153f/docs/checks.md#signed-releases"
},
{
"name": "Token-Permissions",
"score": null,
"reason": "No tokens found",
"documentation_url": "https://github.com/ossf/scorecard/blob/c395761df6afe1a69e476bc60a013a94bcbc153f/docs/checks.md#token-permissions"
},
{
"name": "Vulnerabilities",
"score": 3,
"reason": "7 existing vulnerabilities detected",
"documentation_url": "https://github.com/ossf/scorecard/blob/c395761df6afe1a69e476bc60a013a94bcbc153f/docs/checks.md#vulnerabilities"
}
],
"commit": "6e4f96121cbe440600c9246136d8e66173a5eaaa",
"ran_at": "2026-07-24T10:31:19Z",
"aggregate_score": 5.9,
"scorecard_version": "v5.5.0"
},
"has_codeql_workflow": false,
"has_security_policy": true,
"has_dependabot_config": true
},
"contribution_flow": {
"collected": true,
"ci_last_run_at": "2026-07-24T07:03:38Z",
"oldest_open_prs": [
{
"number": 4234,
"created_at": "2026-07-24T07:03:10Z",
"last_comment_at": null,
"last_comment_author": null
},
{
"number": 4235,
"created_at": "2026-07-24T08:08:56Z",
"last_comment_at": null,
"last_comment_author": null
},
{
"number": 4236,
"created_at": "2026-07-24T08:09:13Z",
"last_comment_at": null,
"last_comment_author": null
}
],
"last_merged_pr_at": "2026-07-22T13:34:21Z",
"ci_last_conclusion": "SUCCESS",
"oldest_open_issues": [
{
"number": 76,
"created_at": "2021-06-03T20:13:11Z",
"last_comment_at": "2022-06-22T14:48:32Z",
"last_comment_author": "marcodelapierre"
},
{
"number": 84,
"created_at": "2021-06-03T20:24:42Z",
"last_comment_at": "2026-02-20T12:50:35Z",
"last_comment_author": "dtrudg"
},
{
"number": 212,
"created_at": "2021-08-04T16:22:33Z",
"last_comment_at": "2021-08-17T14:19:57Z",
"last_comment_author": "dtrudg"
},
{
"number": 353,
"created_at": "2021-10-06T22:49:36Z",
"last_comment_at": "2025-09-07T03:26:39Z",
"last_comment_author": "Likqez"
},
{
"number": 439,
"created_at": "2021-11-19T17:20:50Z",
"last_comment_at": null,
"last_comment_author": null
},
{
"number": 514,
"created_at": "2022-01-18T15:09:27Z",
"last_comment_at": "2022-01-20T14:58:35Z",
"last_comment_author": "dtrudg"
},
{
"number": 526,
"created_at": "2022-01-24T23:19:35Z",
"last_comment_at": "2022-03-30T17:14:36Z",
"last_comment_author": "olifre"
},
{
"number": 607,
"created_at": "2022-02-26T17:55:42Z",
"last_comment_at": "2022-04-04T16:53:05Z",
"last_comment_author": "dtrudg"
},
{
"number": 683,
"created_at": "2022-04-01T14:24:37Z",
"last_comment_at": "2022-04-04T14:26:33Z",
"last_comment_author": "tri-adam"
},
{
"number": 815,
"created_at": "2022-05-18T21:32:55Z",
"last_comment_at": null,
"last_comment_author": null
},
{
"number": 947,
"created_at": "2022-08-24T08:22:14Z",
"last_comment_at": "2022-08-24T13:35:44Z",
"last_comment_author": "wobito"
},
{
"number": 1150,
"created_at": "2022-11-29T15:49:29Z",
"last_comment_at": "2022-12-02T17:27:02Z",
"last_comment_author": "tri-adam"
},
{
"number": 1153,
"created_at": "2022-11-29T19:37:15Z",
"last_comment_at": null,
"last_comment_author": null
},
{
"number": 1188,
"created_at": "2022-12-09T15:43:56Z",
"last_comment_at": null,
"last_comment_author": null
},
{
"number": 1210,
"created_at": "2022-12-22T13:10:07Z",
"last_comment_at": "2023-07-31T09:00:41Z",
"last_comment_author": "dtrudg"
},
{
"number": 1240,
"created_at": "2023-01-11T10:19:31Z",
"last_comment_at": "2024-10-22T13:30:47Z",
"last_comment_author": "EmmEff"
},
{
"number": 1395,
"created_at": "2023-03-01T10:39:22Z",
"last_comment_at": "2023-03-01T13:08:06Z",
"last_comment_author": "ArangoGutierrez"
},
{
"number": 1476,
"created_at": "2023-03-24T12:38:41Z",
"last_comment_at": null,
"last_comment_author": null
},
{
"number": 1948,
"created_at": "2023-07-26T19:32:40Z",
"last_comment_at": null,
"last_comment_author": null
},
{
"number": 2127,
"created_at": "2023-08-29T11:43:53Z",
"last_comment_at": "2024-08-12T15:18:22Z",
"last_comment_author": "dtrudg"
}
]
}
},
"config": {
"disabled_metrics": [],
"disabled_categories": [],
"disabled_components": {}
},
"source": {
"url": "https://github.com/sylabs/singularity",
"host": "github.com",
"name": "singularity",
"owner": "sylabs"
},
"metrics": {
"overall": {
"key": "overall",
"band": "good",
"name": "Overall health",
"note": null,
"notes": [],
"value": 80,
"inputs": {
"security": 59,
"vitality": 95,
"community": 79,
"governance": 83,
"engineering": 76
},
"components": []
},
"categories": [
{
"key": "vitality",
"band": "excellent",
"name": "Vitality",
"value": 95,
"weight": 0.22,
"metrics": [
{
"key": "development_activity",
"band": "excellent",
"name": "Development activity",
"note": null,
"notes": [],
"value": 98,
"inputs": {
"commits_last_year": 480,
"human_commit_share": 0.74,
"days_since_last_push": 0,
"active_weeks_last_year": 49
},
"components": [
{
"key": "push_recency",
"name": "Push recency",
"detail": "last push 0 days ago",
"points": 36,
"status": "met",
"details": [
{
"code": "push_recency",
"params": {
"days": 0
}
}
],
"max_points": 36
},
{
"key": "commit_cadence",
"name": "Commit cadence",
"detail": "49/52 weeks with commits",
"points": 33.9,
"status": "partial",
"details": [
{
"code": "commit_cadence_weeks",
"params": {
"weeks": 49
}
}
],
"max_points": 36
},
{
"key": "commit_volume",
"name": "Commit volume",
"detail": "480 commits in the last year",
"points": 18,
"status": "met",
"details": [
{
"code": "commits_last_year",
"params": {
"count": 480
}
}
],
"max_points": 18
},
{
"key": "openssf_scorecard_maintained",
"name": "OpenSSF Scorecard: Maintained",
"detail": "30 commit(s) and 2 issue activity found in the last 90 days -- score normalized to 10",
"points": 10,
"status": "met",
"details": [],
"max_points": 10
}
]
},
{
"key": "release_discipline",
"band": "excellent",
"name": "Release discipline",
"note": null,
"notes": [],
"value": 90,
"inputs": {
"releases_count": 68,
"latest_release_tag": "v4.5.0",
"releases_from_tags": false,
"days_since_latest_release": 28,
"mean_days_between_releases": 41.2
},
"components": [
{
"key": "ships_releases",
"name": "Ships releases",
"detail": "68 releases published",
"points": 27,
"status": "met",
"details": [
{
"code": "releases_published",
"params": {
"count": 68
}
}
],
"max_points": 27
},
{
"key": "release_recency",
"name": "Release recency",
"detail": "latest release 28 days ago",
"points": 36,
"status": "met",
"details": [
{
"code": "release_recency",
"params": {
"days": 28
}
}
],
"max_points": 36
},
{
"key": "release_cadence",
"name": "Release cadence",
"detail": "a release every ~41.2 days",
"points": 27,
"status": "met",
"details": [
{
"code": "release_cadence",
"params": {
"gap": 41.2
}
}
],
"max_points": 27
},
{
"key": "openssf_scorecard_signed_releases",
"name": "OpenSSF Scorecard: Signed-Releases",
"detail": "Project has not signed or included provenance with any releases.",
"points": 0,
"status": "missed",
"details": [],
"max_points": 10
}
]
},
{
"key": "abandonment",
"band": "excellent",
"name": "Abandonment",
"note": null,
"notes": [],
"value": 100,
"inputs": {
"cap": null,
"state": "maintained",
"guards": [],
"signals": [],
"red_flag": false,
"multiplier_pct": 100,
"declared_reason": null,
"unverified_reason": null,
"unanswered_open_prs": null,
"unanswered_open_issues": null,
"days_since_last_merged_pr": null,
"days_since_last_human_commit": 1,
"days_since_last_human_commit_is_floor": false
},
"components": [
{
"key": "project_is_still_maintained",
"name": "Project is still maintained",
"detail": "last human commit 1 days ago",
"points": 100,
"status": "met",
"details": [
{
"code": "abandonment_maintained",
"params": {
"days": 1
}
}
],
"max_points": 100
}
]
}
],
"description": "Is the project alive — is code being written and are releases shipping?"
},
{
"key": "community",
"band": "good",
"name": "Community & Adoption",
"value": 79,
"weight": 0.18,
"metrics": [
{
"key": "popularity",
"band": "good",
"name": "Popularity & adoption",
"note": null,
"notes": [],
"value": 72,
"inputs": {
"forks": 119,
"stars": 984,
"watchers": 15,
"growth_state": "unverified",
"growth_factor_pct": 100,
"growth_unverified_reason": "no_history"
},
"components": [
{
"key": "stars",
"name": "Stars",
"detail": "984 stars",
"points": 48.5,
"status": "partial",
"details": [
{
"code": "stars",
"params": {
"count": 984
}
}
],
"max_points": 60
},
{
"key": "forks",
"name": "Forks",
"detail": "119 forks",
"points": 17.3,
"status": "partial",
"details": [
{
"code": "forks",
"params": {
"count": 119
}
}
],
"max_points": 25
},
{
"key": "watchers",
"name": "Watchers",
"detail": "15 watchers",
"points": 6.4,
"status": "partial",
"details": [
{
"code": "watchers",
"params": {
"count": 15
}
}
],
"max_points": 15
}
]
},
{
"key": "community_health",
"band": "excellent",
"name": "Community health",
"note": null,
"notes": [],
"value": 86,
"inputs": {
"has_readme": true,
"has_license": true,
"has_contributing": true,
"has_issue_template": false,
"has_code_of_conduct": true,
"has_pull_request_template": true
},
"components": [
{
"key": "readme",
"name": "README",
"detail": null,
"points": 22.5,
"status": "met",
"details": [],
"max_points": 22.5
},
{
"key": "license",
"name": "License",
"detail": "license file present, not a recognized license",
"points": 16.9,
"status": "partial",
"details": [
{
"code": "license_custom",
"params": {}
}
],
"max_points": 22.5
},
{
"key": "contributing_guide",
"name": "CONTRIBUTING guide",
"detail": null,
"points": 18,
"status": "met",
"details": [],
"max_points": 18
},
{
"key": "code_of_conduct",
"name": "Code of conduct",
"detail": null,
"points": 13.5,
"status": "met",
"details": [],
"max_points": 13.5
},
{
"key": "issue_template",
"name": "Issue template",
"detail": null,
"points": 0,
"status": "missed",
"details": [],
"max_points": 7.2
},
{
"key": "pr_template",
"name": "PR template",
"detail": null,
"points": 6.3,
"status": "met",
"details": [],
"max_points": 6.3
}
]
}
],
"description": "Does the project have users, downloads, attention, and a welcoming setup for contributors?"
},
{
"key": "governance",
"band": "good",
"name": "Sustainability & Governance",
"value": 83,
"weight": 0.24,
"metrics": [
{
"key": "maintainer_resilience",
"band": "good",
"name": "Maintainer resilience (bus factor)",
"note": null,
"notes": [],
"value": 77,
"inputs": {
"bus_factor": 3,
"contributors_sampled": 98,
"top_contributor_share": 0.23
},
"components": [
{
"key": "bus_factor",
"name": "Bus factor",
"detail": "3 contributor(s) cover half of all commits",
"points": 36,
"status": "partial",
"details": [
{
"code": "bus_factor",
"params": {
"count": 3
}
}
],
"max_points": 54
},
{
"key": "commit_distribution",
"name": "Commit distribution",
"detail": "top contributor authored 23% of commits",
"points": 17.3,
"status": "partial",
"details": [
{
"code": "top_contributor_share",
"params": {
"share": 23
}
}
],
"max_points": 22.5
},
{
"key": "contributor_breadth",
"name": "Contributor breadth",
"detail": "98 contributors",
"points": 13.5,
"status": "met",
"details": [
{
"code": "contributors_sampled",
"params": {
"count": 98
}
}
],
"max_points": 13.5
},
{
"key": "openssf_scorecard_contributors",
"name": "OpenSSF Scorecard: Contributors",
"detail": "project has 78 contributing companies or organizations",
"points": 10,
"status": "met",
"details": [],
"max_points": 10
}
]
},
{
"key": "responsiveness",
"band": "excellent",
"name": "Issue & PR responsiveness",
"note": null,
"notes": [],
"value": 93,
"inputs": {
"merged_prs": 2809,
"open_issues": 37,
"closed_issues": 831,
"issue_closed_ratio": 0.957,
"closed_unmerged_prs": 423
},
"components": [
{
"key": "issue_resolution",
"name": "Issue resolution",
"detail": "96% of issues closed",
"points": 44.7,
"status": "partial",
"details": [
{
"code": "issues_closed_share",
"params": {
"share": 96
}
}
],
"max_points": 46.75
},
{
"key": "pr_acceptance",
"name": "PR acceptance",
"detail": "2809/3232 decided PRs merged",
"points": 33.2,
"status": "partial",
"details": [
{
"code": "decided_prs_merged",
"params": {
"merged": 2809,
"decided": 3232
}
}
],
"max_points": 38.25
},
{
"key": "openssf_scorecard_code_review",
"name": "OpenSSF Scorecard: Code-Review",
"detail": "all changesets reviewed",
"points": 15,
"status": "met",
"details": [],
"max_points": 15
}
]
},
{
"key": "stewardship",
"band": "moderate",
"name": "Ownership & stewardship",
"note": null,
"notes": [],
"value": 68,
"inputs": {
"followers": 101,
"owner_type": "Organization",
"is_verified": null,
"owner_login": "sylabs",
"public_repos": 35,
"account_age_days": 3219
},
"components": [
{
"key": "ownership_backing",
"name": "Ownership backing",
"detail": "organization-owned",
"points": 30,
"status": "met",
"details": [
{
"code": "owner_organization",
"params": {}
}
],
"max_points": 30
},
{
"key": "verified_domain",
"name": "Verified domain",
"detail": null,
"points": 0,
"status": "missed",
"details": [],
"max_points": 20
},
{
"key": "owner_reach",
"name": "Owner reach",
"detail": "101 followers of sylabs",
"points": 14.4,
"status": "partial",
"details": [
{
"code": "owner_followers",
"params": {
"count": 101,
"login": "sylabs"
}
}
],
"max_points": 25
},
{
"key": "track_record",
"name": "Track record",
"detail": "35 public repos, account ~8 yr old",
"points": 23.3,
"status": "partial",
"details": [
{
"code": "public_repos",
"params": {
"count": 35
}
},
{
"code": "account_age_years",
"params": {
"years": 8
}
}
],
"max_points": 25
}
]
},
{
"key": "package_maintenance",
"band": "excellent",
"name": "Package maintenance",
"note": null,
"notes": [],
"value": 100,
"inputs": {
"packages": [
"github.com/sylabs/singularity/v4"
],
"ecosystems": "go",
"any_deprecated": false,
"min_days_since_publish": 29
},
"components": [
{
"key": "published_resolvable",
"name": "Published & resolvable",
"detail": "1 package(s) on go",
"points": 25,
"status": "met",
"details": [
{
"code": "packages_published",
"params": {
"count": 1,
"ecosystems": "go"
}
}
],
"max_points": 25
},
{
"key": "publish_recency",
"name": "Publish recency",
"detail": "latest publish 29 days ago",
"points": 35,
"status": "met",
"details": [
{
"code": "publish_recency",
"params": {
"days": 29
}
}
],
"max_points": 35
},
{
"key": "version_history",
"name": "Version history",
"detail": "30 published versions",
"points": 20,
"status": "met",
"details": [
{
"code": "published_versions",
"params": {
"count": 30
}
}
],
"max_points": 20
},
{
"key": "not_deprecated",
"name": "Not deprecated",
"detail": "active, not deprecated or yanked",
"points": 20,
"status": "met",
"details": [
{
"code": "package_not_deprecated",
"params": {}
}
],
"max_points": 20
}
]
}
],
"description": "Will the project survive its people — bus factor, responsiveness, who backs it, and package upkeep?"
},
{
"key": "engineering",
"band": "good",
"name": "Engineering Quality",
"value": 76,
"weight": 0.2,
"metrics": [
{
"key": "engineering_practices",
"band": "moderate",
"name": "Engineering practices",
"note": null,
"notes": [],
"value": 60,
"inputs": {
"has_ci": false,
"has_tests": true,
"has_editorconfig": false,
"has_linter_config": true,
"has_precommit_config": false
},
"components": [
{
"key": "ci_workflows",
"name": "CI workflows",
"detail": null,
"points": 0,
"status": "missed",
"details": [],
"max_points": 24
},
{
"key": "tests_present",
"name": "Tests present",
"detail": null,
"points": 24,
"status": "met",
"details": [],
"max_points": 24
},
{
"key": "linter_config",
"name": "Linter config",
"detail": ".golangci.yml",
"points": 16,
"status": "met",
"details": [
{
"code": "file_list",
"params": {
"files": ".golangci.yml"
}
}
],
"max_points": 16
},
{
"key": "pre_commit_hooks",
"name": "Pre-commit hooks",
"detail": null,
"points": 0,
"status": "missed",
"details": [],
"max_points": 9.6
},
{
"key": "editorconfig",
"name": ".editorconfig",
"detail": null,
"points": 0,
"status": "missed",
"details": [],
"max_points": 6.4
},
{
"key": "openssf_scorecard_ci_tests",
"name": "OpenSSF Scorecard: CI-Tests",
"detail": "15 out of 15 merged PRs checked by a CI test -- score normalized to 10",
"points": 20,
"status": "met",
"details": [],
"max_points": 20
}
]
},
{
"key": "documentation",
"band": "excellent",
"name": "Documentation",
"note": null,
"notes": [],
"value": 100,
"inputs": {
"topics": [
"containers",
"hpc",
"linux"
],
"has_wiki": true,
"homepage": "https://sylabs.io/docs/",
"has_readme": true,
"has_docs_dir": true,
"has_description": true
},
"components": [
{
"key": "readme",
"name": "README",
"detail": null,
"points": 30,
"status": "met",
"details": [],
"max_points": 30
},
{
"key": "documentation_directory",
"name": "Documentation directory",
"detail": null,
"points": 25,
"status": "met",
"details": [],
"max_points": 25
},
{
"key": "documentation_homepage_site",
"name": "Documentation / homepage site",
"detail": "https://sylabs.io/docs/",
"points": 15,
"status": "met",
"details": [],
"max_points": 15
},
{
"key": "repository_description",
"name": "Repository description",
"detail": null,
"points": 10,
"status": "met",
"details": [],
"max_points": 10
},
{
"key": "topics",
"name": "Topics",
"detail": "3 topics",
"points": 10,
"status": "met",
"details": [
{
"code": "topics_count",
"params": {
"count": 3
}
}
],
"max_points": 10
},
{
"key": "wiki",
"name": "Wiki",
"detail": null,
"points": 10,
"status": "met",
"details": [],
"max_points": 10
}
]
}
],
"description": "Are baseline engineering and documentation practices in place?"
},
{
"key": "security",
"band": "moderate",
"name": "Security",
"value": 59,
"weight": 0.16,
"metrics": [
{
"key": "security_posture",
"band": "moderate",
"name": "Security posture",
"note": "Excluded from scoring (no data or not applicable): Branch-Protection, Dangerous-Workflow, Packaging, Token-Permissions. Remaining weights renormalized.",
"notes": [
{
"code": "excluded_no_data",
"params": {
"components": [
"branch_protection",
"dangerous_workflow",
"packaging",
"token_permissions"
]
}
},
{
"code": "weights_renormalized",
"params": {}
}
],
"value": 59,
"inputs": {
"source": "openssf_scorecard",
"checks_evaluated": 14,
"scorecard_version": "v5.5.0",
"checks_inconclusive": 4,
"scorecard_aggregate": 5.9
},
"components": [
{
"key": "binary_artifacts",
"name": "Binary-Artifacts",
"detail": "no binaries found in the repo",
"points": 7.5,
"status": "met",
"details": [],
"max_points": 7.5
},
{
"key": "branch_protection",
"name": "Branch-Protection",
"detail": "internal error: error during branchesHandler.setup: internal error: some github tokens can't read classic branch protection rules: https://github.com/ossf/scorecard-action/blob/main/docs/authentication/fine-grained-auth-token.md",
"points": 0,
"status": "excluded",
"details": [
{
"code": "no_data",
"params": {}
}
],
"max_points": 7.5
},
{
"key": "ci_tests",
"name": "CI-Tests",
"detail": "15 out of 15 merged PRs checked by a CI test -- score normalized to 10",
"points": 2.5,
"status": "met",
"details": [],
"max_points": 2.5
},
{
"key": "cii_best_practices",
"name": "CII-Best-Practices",
"detail": "no effort to earn an OpenSSF best practices badge detected",
"points": 0,
"status": "missed",
"details": [],
"max_points": 2.5
},
{
"key": "code_review",
"name": "Code-Review",
"detail": "all changesets reviewed",
"points": 7.5,
"status": "met",
"details": [],
"max_points": 7.5
},
{
"key": "contributors",
"name": "Contributors",
"detail": "project has 78 contributing companies or organizations",
"points": 2.5,
"status": "met",
"details": [],
"max_points": 2.5
},
{
"key": "dangerous_workflow",
"name": "Dangerous-Workflow",
"detail": "no workflows found",
"points": 0,
"status": "excluded",
"details": [
{
"code": "no_data",
"params": {}
}
],
"max_points": 10
},
{
"key": "dependency_update_tool",
"name": "Dependency-Update-Tool",
"detail": "update tool detected",
"points": 7.5,
"status": "met",
"details": [],
"max_points": 7.5
},
{
"key": "fuzzing",
"name": "Fuzzing",
"detail": "project is not fuzzed",
"points": 0,
"status": "missed",
"details": [],
"max_points": 5
},
{
"key": "license",
"name": "License",
"detail": "license file detected",
"points": 2.2,
"status": "partial",
"details": [],
"max_points": 2.5
},
{
"key": "maintained",
"name": "Maintained",
"detail": "30 commit(s) and 2 issue activity found in the last 90 days -- score normalized to 10",
"points": 7.5,
"status": "met",
"details": [],
"max_points": 7.5
},
{
"key": "packaging",
"name": "Packaging",
"detail": "packaging workflow not detected",
"points": 0,
"status": "excluded",
"details": [
{
"code": "no_data",
"params": {}
}
],
"max_points": 5
},
{
"key": "pinned_dependencies",
"name": "Pinned-Dependencies",
"detail": "dependency not pinned by hash detected -- score normalized to 0",
"points": 0,
"status": "missed",
"details": [],
"max_points": 5
},
{
"key": "sast",
"name": "SAST",
"detail": "SAST tool is not run on all commits -- score normalized to 0",
"points": 0,
"status": "missed",
"details": [],
"max_points": 5
},
{
"key": "security_policy",
"name": "Security-Policy",
"detail": "security policy file detected",
"points": 5,
"status": "met",
"details": [],
"max_points": 5
},
{
"key": "signed_releases",
"name": "Signed-Releases",
"detail": "Project has not signed or included provenance with any releases.",
"points": 0,
"status": "missed",
"details": [],
"max_points": 7.5
},
{
"key": "token_permissions",
"name": "Token-Permissions",
"detail": "No tokens found",
"points": 0,
"status": "excluded",
"details": [
{
"code": "no_data",
"params": {}
}
],
"max_points": 7.5
},
{
"key": "vulnerabilities",
"name": "Vulnerabilities",
"detail": "7 existing vulnerabilities detected",
"points": 2.2,
"status": "partial",
"details": [],
"max_points": 7.5
}
]
},
{
"key": "dependency_advisories",
"band": "moderate",
"name": "Dependency advisories",
"note": "Excluded from scoring (no data or not applicable): Indirect dependencies free of known advisories. Remaining weights renormalized. Matched 282 resolved dependencies against OSV. This repository publishes no package the index resolves, so the repository dependency graph was assessed instead. That graph mixes development and test pins with shipped dependencies, so only the declared runtime dependencies are scored; transitive findings are reported as context and excluded from the score. Reachability is not analyzed.",
"notes": [
{
"code": "excluded_no_data",
"params": {
"components": [
"indirect_dependencies_free_of_known_advisories"
]
}
},
{
"code": "weights_renormalized",
"params": {}
},
{
"code": "advisories_scope_repository",
"params": {
"assessed": 282
}
},
{
"code": "advisories_repo_graph_caveat",
"params": {}
},
{
"code": "advisories_reachability",
"params": {}
}
],
"value": 59,
"inputs": {
"source": "osv",
"advisories": 14,
"affected_packages": 5,
"assessed_packages": 282,
"unassessed_packages": 0,
"affected_by_severity": "high 2, moderate 1, unknown 2",
"direct_affected_packages": 3
},
"components": [
{
"key": "direct_dependencies_free_of_known_advisories",
"name": "Direct dependencies free of known advisories",
"detail": "3 affected: github.com/distribution/distribution v2.8.3+incompatible (high 7.5), github.com/sigstore/cosign/v2 v2.6.4 (unknown), golang.org/x/crypto v0.54.0 (unknown)",
"points": 12.2,
"status": "partial",
"details": [
{
"code": "advisories_affected",
"params": {
"count": 3,
"packages": "github.com/distribution/distribution v2.8.3+incompatible (high 7.5), github.com/sigstore/cosign/v2 v2.6.4 (unknown), golang.org/x/crypto v0.54.0 (unknown)"
}
}
],
"max_points": 35
},
{
"key": "indirect_dependencies_free_of_known_advisories",
"name": "Indirect dependencies free of known advisories",
"detail": "transitive set not separable from development and test dependencies in this scope",
"points": 0,
"status": "excluded",
"details": [
{
"code": "advisories_scope_not_separable",
"params": {}
}
],
"max_points": 25
},
{
"key": "no_advisories_left_outstanding",
"name": "No advisories left outstanding",
"detail": "2 advisory-carrying package(s) unaddressed past 90 days; oldest published 507 days ago",
"points": 31.7,
"status": "partial",
"details": [
{
"code": "advisories_stale",
"params": {
"days": 90,
"count": 2,
"oldest": 507
}
}
],
"max_points": 40
}
]
},
{
"key": "malicious_dependencies",
"band": "excellent",
"name": "Malicious dependencies",
"note": null,
"notes": [],
"value": 100,
"inputs": {
"source": "osv",
"meaning": "reported as a malicious package by the OpenSSF corpus; the remedy is removal or moving off the compromised name, never an upgrade of the same artifact. Versions the registry has since pulled are listed but not scored",
"packages": [],
"red_flag": false,
"assessed_packages": 282,
"malicious_packages": 0,
"direct_malicious_packages": 0,
"withdrawn_malicious_packages": 0,
"installable_malicious_packages": 0
},
"components": [
{
"key": "no_dependency_reported_as_a_malicious_package",
"name": "No dependency reported as a malicious package",
"detail": "no dependency is reported as a malicious package",
"points": 100,
"status": "met",
"details": [
{
"code": "no_malicious_dependencies",
"params": {}
}
],
"max_points": 100
}
]
},
{
"key": "high_risk_jurisdiction_exposure",
"band": "excellent",
"name": "High-Risk Jurisdiction Exposure",
"note": "Only high-confidence self-published location evidence affects this multiplier. Ambiguous matches are review-only; country evidence is not proof of nationality, citizenship, legal registration, malicious intent, or sanctions status.",
"notes": [
{
"code": "jurisdiction_evidence_limits",
"params": {}
}
],
"value": 100,
"inputs": {
"meaning": "self-published location evidence; not nationality or citizenship",
"red_flag": false,
"exposures": [],
"policy_countries": [
"Russia",
"Iran",
"North Korea"
],
"review_only_matches": 0,
"assessed_self_published_locations": 13
},
"components": [
{
"key": "policy_exposure_multiplier",
"name": "Policy exposure multiplier",
"detail": "no confirmed policy-scope location match",
"points": 100,
"status": "met",
"details": [
{
"code": "jurisdiction_no_match",
"params": {}
}
],
"max_points": 100
}
]
}
],
"description": "Are visible security and supply-chain practices strong, with no malicious dependency and no unresolved high-risk jurisdiction exposure?"
},
{
"key": "ai_readiness",
"band": "good",
"name": "AI Readiness",
"value": 76,
"weight": 0,
"metrics": [
{
"key": "ai_agent_context",
"band": "excellent",
"name": "Agent context & guidance",
"note": null,
"notes": [],
"value": 85,
"inputs": {
"has_llms_txt": false,
"legible_history_share": 0.932,
"agent_instruction_files": [
"AGENTS.md",
"CLAUDE.md"
],
"agent_instruction_max_bytes": 6883
},
"components": [
{
"key": "agent_instructions",
"name": "Agent instructions",
"detail": "AGENTS.md, CLAUDE.md",
"points": 45,
"status": "met",
"details": [
{
"code": "file_list",
"params": {
"files": "AGENTS.md, CLAUDE.md"
}
}
],
"max_points": 45
},
{
"key": "machine_readable_docs_llms_txt",
"name": "Machine-readable docs (llms.txt)",
"detail": null,
"points": 0,
"status": "missed",
"details": [],
"max_points": 15
},
{
"key": "legible_commit_history",
"name": "Legible commit history",
"detail": "69 of 74 human commits state their intent (structured subject or explanatory body)",
"points": 40,
"status": "met",
"details": [
{
"code": "legible_history",
"params": {
"legible": 69,
"sampled": 74
}
}
],
"max_points": 40
}
]
},
{
"key": "ai_verify_loop",
"band": "good",
"name": "Verify loop (build / test / typecheck)",
"note": null,
"notes": [],
"value": 75,
"inputs": {
"has_nix": false,
"has_tests": true,
"lockfiles": [
"go.sum"
],
"has_dockerfile": true,
"typed_language": true,
"bootstrap_files": [],
"has_devcontainer": false,
"has_linter_config": true,
"typecheck_configs": [],
"agent_commit_share": 0,
"toolchain_manifests": [
"go.mod"
],
"dependency_bot_commit_share": 0.26
},
"components": [
{
"key": "one_command_bootstrap",
"name": "One-command bootstrap",
"detail": "go.mod (toolchain convention, no task runner)",
"points": 12.6,
"status": "partial",
"details": [
{
"code": "toolchain_convention",
"params": {
"files": "go.mod"
}
}
],
"max_points": 18
},
{
"key": "automated_tests",
"name": "Automated tests",
"detail": null,
"points": 22,
"status": "met",
"details": [],
"max_points": 22
},
{
"key": "lint_format_config",
"name": "Lint / format config",
"detail": ".golangci.yml",
"points": 11,
"status": "met",
"details": [
{
"code": "file_list",
"params": {
"files": ".golangci.yml"
}
}
],
"max_points": 11
},
{
"key": "static_type_checking",
"name": "Static type checking",
"detail": "Go (statically typed)",
"points": 11,
"status": "met",
"details": [
{
"code": "statically_typed_language",
"params": {
"language": "Go"
}
}
],
"max_points": 11
},
{
"key": "reproducible_environment",
"name": "Reproducible environment",
"detail": "Dockerfile, lockfile",
"points": 10,
"status": "met",
"details": [
{
"code": "file_list",
"params": {
"files": "Dockerfile, lockfile"
}
}
],
"max_points": 10
},
{
"key": "demonstrated_agent_practice",
"name": "Demonstrated agent practice",
"detail": "no agent-authored commits among the last 100",
"points": 0,
"status": "missed",
"details": [
{
"code": "no_agent_authored_commits",
"params": {
"sampled": 100
}
}
],
"max_points": 10
},
{
"key": "automated_maintenance",
"name": "Automated maintenance",
"detail": "26 of the last 100 commits are automated dependency updates",
"points": 8,
"status": "met",
"details": [
{
"code": "dependency_bot_commits",
"params": {
"count": 26,
"sampled": 100
}
}
],
"max_points": 8
},
{
"key": "openssf_scorecard_pinned_dependencies",
"name": "OpenSSF Scorecard: Pinned-Dependencies",
"detail": "dependency not pinned by hash detected -- score normalized to 0",
"points": 0,
"status": "missed",
"details": [],
"max_points": 10
}
]
},
{
"key": "ai_code_legibility",
"band": "excellent",
"name": "Code legibility for models",
"note": null,
"notes": [],
"value": 100,
"inputs": {
"primary_language": "Go",
"largest_source_bytes": 90986,
"source_files_sampled": 544,
"oversized_source_files": 4
},
"components": [
{
"key": "type_checkable_code",
"name": "Type-checkable code",
"detail": "Go (statically typed)",
"points": 45,
"status": "met",
"details": [
{
"code": "statically_typed_language",
"params": {
"language": "Go"
}
}
],
"max_points": 45
},
{
"key": "manageable_file_sizes",
"name": "Manageable file sizes",
"detail": "4/544 source files over 60KB",
"points": 54.6,
"status": "partial",
"details": [
{
"code": "oversized_source_files",
"params": {
"kb": 60,
"sampled": 544,
"oversized": 4
}
}
],
"max_points": 55
}
]
},
{
"key": "ai_interfaces",
"band": "at_risk",
"name": "Machine-readable interfaces",
"note": null,
"notes": [],
"value": 40,
"inputs": {
"example_dirs": [
"example",
"examples"
],
"has_mcp_signal": false,
"api_schema_files": []
},
"components": [
{
"key": "api_schema_openapi_graphql_proto",
"name": "API schema (OpenAPI/GraphQL/proto)",
"detail": null,
"points": 0,
"status": "missed",
"details": [],
"max_points": 40
},
{
"key": "mcp_server",
"name": "MCP server",
"detail": null,
"points": 0,
"status": "missed",
"details": [],
"max_points": 20
},
{
"key": "runnable_examples",
"name": "Runnable examples",
"detail": "example, examples",
"points": 40,
"status": "met",
"details": [
{
"code": "file_list",
"params": {
"files": "example, examples"
}
}
],
"max_points": 40
}
]
}
],
"description": "How well is the repo equipped to be developed and maintained with AI coding agents? An independent, experimental badge — weight 0.0, so it is surfaced on its own and does not affect the overall health score."
}
],
"metrics_version": "1.13.0"
},
"warnings": [
"Star history unavailable: GitHub GraphQL error: Resource not accessible by personal access token"
],
"report_type": "repository",
"generated_at": "2026-07-24T10:31:45.748814Z",
"schema_version": "0.27.0",
"badge_url": "https://raw.githubusercontent.com/inspect-software/badges/main/v1/s/sylabs/singularity.svg",
"full_name": "sylabs/singularity",
"license_state": "custom",
"license_spdx": null
}