symfony / ux

每颗 star 和每个 fork 的添加时间，来自 GitHub 并按天汇总。累计增长位于其构成来源——每日新增——的正上方，二者可相互对照：稳定的自然增长与短暂的突增形态截然不同。当这一差别可被衡量时，它会作为增长真实性予以报告。

每个点涵盖 6 天。

来自 GitHub 依赖图的完整解析依赖集合：63 个直接依赖与 688 个间接（传递）软件包。仓库提交锁文件时，传递闭包才是完整的。

该仓库未发布可被索引解析的包，因此评估的是其自身的依赖图——共 606 个包，其中也包含从不交付的开发与测试版本固定：14 个存在已知公告，0 个为直接依赖。 有 145 个无法评估——没有已解析的版本、生态系统不受支持，或不在所列包清单之内。

公告表示依赖图中记录的版本落入某条公告的受影响范围。可达性未经分析，且依赖图包含开发与测试的版本固定——某项发现可能只涉及工具链而非交付的软件。

{
  "data": {
    "repo": {
      "topics": [
        "symfony",
        "javascript",
        "hacktoberfest"
      ],
      "is_fork": false,
      "size_kb": 43283,
      "has_wiki": false,
      "homepage": "https://ux.symfony.com/",
      "languages": {
        "CSS": 4050,
        "PHP": 2696831,
        "Vue": 173,
        "HTML": 2559398,
        "Twig": 303851,
        "Shell": 5622,
        "JavaScript": 86471,
        "TypeScript": 733894
      },
      "pushed_at": "2026-07-25T12:33:42Z",
      "created_at": "2020-11-28T10:09:32Z",
      "owner_type": "Organization",
      "updated_at": "2026-07-24T18:26:10Z",
      "description": "Symfony UX initiative: a JavaScript ecosystem for Symfony",
      "is_archived": false,
      "is_disabled": false,
      "license_spdx": "MIT",
      "default_branch": "3.x",
      "license_spdx_raw": "MIT",
      "primary_language": "PHP",
      "significant_languages": [
        "PHP",
        "HTML",
        "TypeScript"
      ]
    },
    "owner": {
      "blog": "https://symfony.com/",
      "name": "Symfony",
      "type": "Organization",
      "login": "symfony",
      "company": null,
      "location": "The Internet",
      "followers": 2177,
      "avatar_url": "https://avatars.githubusercontent.com/u/143937?v=4",
      "created_at": "2009-10-24T04:05:23Z",
      "is_verified": null,
      "public_repos": 414,
      "account_age_days": 6119
    },
    "license": {
      "state": "standard",
      "spdx_id": "MIT",
      "raw_spdx": "MIT",
      "file_present": true,
      "scorecard_found": true,
      "profile_has_license": true
    },
    "activity": {
      "releases": [
        {
          "tag": "v3.3.0",
          "kind": "minor",
          "published_at": "2026-07-14T16:28:47Z"
        },
        {
          "tag": "v2.36.2",
          "kind": "patch",
          "published_at": "2026-07-08T13:57:48Z"
        },
        {
          "tag": "v3.2.0",
          "kind": "minor",
          "published_at": "2026-06-19T07:14:51Z"
        },
        {
          "tag": "v2.36.1",
          "kind": "patch",
          "published_at": "2026-06-19T07:08:33Z"
        },
        {
          "tag": "v3.1.0",
          "kind": "minor",
          "published_at": "2026-05-29T07:09:52Z"
        },
        {
          "tag": "v2.36.0",
          "kind": "minor",
          "published_at": "2026-05-29T07:00:18Z"
        },
        {
          "tag": "v2.35.0",
          "kind": "minor",
          "published_at": "2026-04-13T14:51:09Z"
        },
        {
          "tag": "v3.0.0",
          "kind": "major",
          "published_at": "2026-04-13T14:00:21Z"
        },
        {
          "tag": "v2.34.0",
          "kind": "minor",
          "published_at": "2026-03-22T22:21:57Z"
        },
        {
          "tag": "v2.33.0",
          "kind": "minor",
          "published_at": "2026-03-17T21:15:45Z"
        },
        {
          "tag": "v2.32.0",
          "kind": "minor",
          "published_at": "2026-01-05T14:07:17Z"
        },
        {
          "tag": "v2.31.0",
          "kind": "minor",
          "published_at": "2025-10-23T13:28:18Z"
        },
        {
          "tag": "v2.30.0",
          "kind": "minor",
          "published_at": "2025-08-27T18:29:03Z"
        },
        {
          "tag": "v2.29.2",
          "kind": "patch",
          "published_at": "2025-08-19T12:13:30Z"
        },
        {
          "tag": "v2.29.1",
          "kind": "patch",
          "published_at": "2025-08-08T12:47:38Z"
        },
        {
          "tag": "v2.29.0",
          "kind": "minor",
          "published_at": "2025-08-08T11:45:37Z"
        },
        {
          "tag": "v2.28.2",
          "kind": "patch",
          "published_at": "2025-07-30T12:27:55Z"
        },
        {
          "tag": "v2.28.1",
          "kind": "patch",
          "published_at": "2025-07-28T20:46:32Z"
        },
        {
          "tag": "v2.28.0",
          "kind": "minor",
          "published_at": "2025-07-28T19:26:51Z"
        },
        {
          "tag": "v2.27.0",
          "kind": "minor",
          "published_at": "2025-06-27T12:30:02Z"
        },
        {
          "tag": "v2.26.1",
          "kind": "patch",
          "published_at": "2025-06-06T20:31:40Z"
        },
        {
          "tag": "v2.26.0",
          "kind": "minor",
          "published_at": "2025-06-05T17:57:10Z"
        },
        {
          "tag": "v2.25.2",
          "kind": "patch",
          "published_at": "2025-05-20T14:18:00Z"
        },
        {
          "tag": "v2.25.1",
          "kind": "patch",
          "published_at": "2025-05-19T15:51:54Z"
        },
        {
          "tag": "v2.25.0",
          "kind": "minor",
          "published_at": "2025-05-19T15:47:10Z"
        },
        {
          "tag": "v2.24.0",
          "kind": "minor",
          "published_at": "2025-04-05T14:45:05Z"
        },
        {
          "tag": "v2.23.0",
          "kind": "minor",
          "published_at": "2025-02-10T02:34:28Z"
        },
        {
          "tag": "v2.22.1",
          "kind": "patch",
          "published_at": "2024-12-09T22:14:09Z"
        },
        {
          "tag": "v2.22.0",
          "kind": "minor",
          "published_at": "2024-11-30T19:52:19Z"
        },
        {
          "tag": "v2.21.0",
          "kind": "minor",
          "published_at": "2024-10-22T23:54:25Z"
        },
        {
          "tag": "v2.20.0",
          "kind": "minor",
          "published_at": "2024-09-24T19:01:58Z"
        },
        {
          "tag": "v2.19.3",
          "kind": "patch",
          "published_at": "2024-08-16T18:49:45Z"
        },
        {
          "tag": "v2.19.2",
          "kind": "patch",
          "published_at": "2024-08-13T17:20:51Z"
        },
        {
          "tag": "v2.19.1",
          "kind": "patch",
          "published_at": "2024-08-12T20:53:51Z"
        },
        {
          "tag": "v2.19.0",
          "kind": "minor",
          "published_at": "2024-08-12T20:04:08Z"
        },
        {
          "tag": "v2.18.1",
          "kind": "patch",
          "published_at": "2024-06-12T13:54:38Z"
        },
        {
          "tag": "v2.18.0",
          "kind": "minor",
          "published_at": "2024-06-07T23:35:17Z"
        },
        {
          "tag": "v2.17.0",
          "kind": "minor",
          "published_at": "2024-04-23T14:16:34Z"
        },
        {
          "tag": "v2.16.0",
          "kind": "minor",
          "published_at": "2024-02-29T16:53:40Z"
        },
        {
          "tag": "v2.15.0",
          "kind": "minor",
          "published_at": "2024-02-20T16:23:25Z"
        },
        {
          "tag": "v2.14.2",
          "kind": "patch",
          "published_at": "2024-02-07T20:35:08Z"
        },
        {
          "tag": "v2.14.1",
          "kind": "patch",
          "published_at": "2024-02-03T01:15:10Z"
        },
        {
          "tag": "v2.14.0",
          "kind": "minor",
          "published_at": "2024-01-30T19:40:54Z"
        },
        {
          "tag": "v2.13.3",
          "kind": "patch",
          "published_at": "2024-01-30T14:34:50Z"
        },
        {
          "tag": "v2.13.2",
          "kind": "patch",
          "published_at": "2023-11-11T01:30:59Z"
        },
        {
          "tag": "v2.13.1",
          "kind": "patch",
          "published_at": "2023-11-09T15:42:44Z"
        },
        {
          "tag": "v2.13.0",
          "kind": "minor",
          "published_at": "2023-11-08T14:59:20Z"
        },
        {
          "tag": "v2.12.0",
          "kind": "minor",
          "published_at": "2023-09-22T14:04:43Z"
        },
        {
          "tag": "v2.11.2",
          "kind": "patch",
          "published_at": "2023-09-11T13:25:29Z"
        },
        {
          "tag": "v2.11.1",
          "kind": "patch",
          "published_at": "2023-09-07T15:09:20Z"
        },
        {
          "tag": "v2.11.0",
          "kind": "minor",
          "published_at": "2023-08-28T13:05:10Z"
        },
        {
          "tag": "v2.10.0",
          "kind": "minor",
          "published_at": "2023-07-06T10:42:13Z"
        },
        {
          "tag": "v2.9.1",
          "kind": "patch",
          "published_at": "2023-05-31T14:01:05Z"
        },
        {
          "tag": "v2.9.0",
          "kind": "minor",
          "published_at": "2023-05-29T00:42:45Z"
        },
        {
          "tag": "v2.8.1",
          "kind": "patch",
          "published_at": "2023-05-16T17:46:57Z"
        },
        {
          "tag": "v2.8.0",
          "kind": "minor",
          "published_at": "2023-05-03T12:48:30Z"
        },
        {
          "tag": "v2.7.1",
          "kind": "patch",
          "published_at": "2023-01-25T13:52:39Z"
        },
        {
          "tag": "v2.7.0",
          "kind": "minor",
          "published_at": "2023-01-23T15:13:51Z"
        },
        {
          "tag": "v2.6.1",
          "kind": "patch",
          "published_at": "2022-12-07T16:58:33Z"
        },
        {
          "tag": "v2.6.0",
          "kind": "minor",
          "published_at": "2022-11-28T18:20:52Z"
        },
        {
          "tag": "v2.5.0",
          "kind": "minor",
          "published_at": "2022-11-08T14:17:45Z"
        },
        {
          "tag": "v2.3.0",
          "kind": "minor",
          "published_at": "2022-07-11T13:22:13Z"
        }
      ],
      "recent_commits": [
        {
          "oid": "095f29610b644fa8260ee3407b4cab7bd52ac765",
          "body": "…PI reference (kbond)\n\nThis PR was merged into the 3.x branch.\n\nDiscussion\n----------\n\n[Toolkit] Document Stimulus controllers in the recipe API reference\n\n| Q             | A\n| ------------- | ---\n| Bug fix?      | no\n| New feature?  | yes\n| Docs?         | no\n| Issues        | -\n| License       | \n[…]\nc values`/`static targets` declarations in both directions, and every ``@action`` matching a real method.\n\nCommits\n-------\n\n20426dee [Toolkit] Document Stimulus controllers in the recipe API reference",
          "is_bot": false,
          "headline": "feature #3724 [Toolkit] Document Stimulus controllers in the recipe A…",
          "author_name": "Kevin Bond",
          "author_login": "kbond",
          "committed_at": "2026-07-24T18:25:57Z",
          "body_truncated": true,
          "is_coding_agent": false
        },
        {
          "oid": "20426dee96f21cccd124153d4e2a6a25581e90aa",
          "body": "Recipes that ship a Stimulus controller had no way to surface its public API in\ntheir documentation. `RecipeDocRenderer` now parses each controller's `@value`/\n`@target`/`@action` docblock tags and renders them under `::: api-reference`,\nalongside the existing Twig component tables. The code stays t\n[…]\n consistent with the\n`static values`/`static targets` declarations in both directions, and every\n`@action` matching a real method. Documentation is opt-in: a controller with no\ntags is left untouched.",
          "is_bot": false,
          "headline": "[Toolkit] Document Stimulus controllers in the recipe API reference",
          "author_name": "Kevin Bond",
          "author_login": "kbond",
          "committed_at": "2026-07-24T18:12:36Z",
          "body_truncated": true,
          "is_coding_agent": false
        },
        {
          "oid": "0ac0c6cc44b9f1946b85eaf4be8ba93a9c0d8095",
          "body": "This PR was merged into the 3.x branch.\n\nDiscussion\n----------\n\n[Toolkit][Common] Add `closeable` recipe\n\n| Q             | A\n| ------------- | ---\n| Bug fix?      | no\n| New feature?  | yes\n| Docs?         | no\n| Issues        | -\n| License       | MIT\n\nAdds `common/closeable`, a controller-only re\n[…]\n for its API reference to render. A companion PR on `symfony/ux.symfony.com` will register the controller so the live previews boot.\n\nCommits\n-------\n\n715f1858 [Toolkit][Common] Add `closeable` recipe",
          "is_bot": false,
          "headline": "feature #3725 [Toolkit][Common] Add `closeable` recipe (kbond)",
          "author_name": "Kevin Bond",
          "author_login": "kbond",
          "committed_at": "2026-07-23T23:57:33Z",
          "body_truncated": true,
          "is_coding_agent": false
        },
        {
          "oid": "715f1858cc9cfd971d382bb85a8820815cbb9711",
          "body": null,
          "is_bot": false,
          "headline": "[Toolkit][Common] Add `closeable` recipe",
          "author_name": "Kevin Bond",
          "author_login": "kbond",
          "committed_at": "2026-07-23T23:40:14Z",
          "body_truncated": false,
          "is_coding_agent": false
        },
        {
          "oid": "02e0ecf1059c457381aca1825f2e21f9a3ccaa75",
          "body": "This PR was merged into the 3.x branch.\n\nDiscussion\n----------\n\n[Translator] Make the component non-experimental\n\n| Q              | A\n| -------------- | ---\n| Bug fix?       | no\n| New feature?   | yes <!-- please update src/**/CHANGELOG.md files -->\n| Deprecations?  | no <!-- if yes, also update U\n[…]\neak (in a minor version) was done 7 months ago (2.32).\n\nIt's been pretty stable since.\n\nTime to make it non-experimental!\n\nCommits\n-------\n\n5f92e393bf4 [Translator] Make the component non-experimental",
          "is_bot": false,
          "headline": "feature #3716 [Translator] Make the component non-experimental (Kocal)",
          "author_name": "Hugo Alliaume",
          "author_login": "Kocal",
          "committed_at": "2026-07-23T09:05:15Z",
          "body_truncated": true,
          "is_coding_agent": false
        },
        {
          "oid": "5f92e393bf4e2ad9cdc1777ec060b370a58f1396",
          "body": "UX Translator has been released 3 years ago, and the latest BC break (in a minor version) was done 7 months ago (2.32).\n\nIt's been pretty stable since.\n\nTime to make it non-experimental!",
          "is_bot": false,
          "headline": "[Translator] Make the component non-experimental",
          "author_name": "Hugo Alliaume",
          "author_login": "Kocal",
          "committed_at": "2026-07-23T09:01:56Z",
          "body_truncated": false,
          "is_coding_agent": false
        },
        {
          "oid": "9b2b83537bc8502606c47e5da6064f507943be8d",
          "body": "This PR was merged into the 3.x branch.\n\nDiscussion\n----------\n\n[Toolkit] Boostrap Toolkit\n\n| Q              | A\n| -------------- | ---\n| Bug fix?       | no\n| New feature?   | yes\n| Deprecations?  | no\n| Documentation? | yes\n| Issues         | Fix #...\n| License        | MIT\n\nIntroducing Bootstrap \n[…]\nap 5.3)\n\nNot sure if all these files are supposed to be commited\n\nCommits\n-------\n\n404f2dbb748 [Toolkit][Bootstrap] Manually fixes somes examples\nfad9f8463c8 [Toolkit][Bootstrap] Add the Bootstrap kit",
          "is_bot": false,
          "headline": "feature #3713 [Toolkit] Boostrap Toolkit (smnandre, Kocal)",
          "author_name": "Hugo Alliaume",
          "author_login": "Kocal",
          "committed_at": "2026-07-23T06:12:11Z",
          "body_truncated": true,
          "is_coding_agent": false
        },
        {
          "oid": "404f2dbb7485d1c470217586b2145c7e641c555f",
          "body": null,
          "is_bot": false,
          "headline": "[Toolkit][Bootstrap] Manually fixes somes examples",
          "author_name": "Hugo Alliaume",
          "author_login": "Kocal",
          "committed_at": "2026-07-23T06:07:01Z",
          "body_truncated": false,
          "is_coding_agent": false
        },
        {
          "oid": "fad9f8463c8b581a43babea48666ca2f0428b017",
          "body": "[Toolkit][Bootstrap] Harden Offcanvas a11y wiring and Toast attributes\n\nOffcanvas now mirrors Modal's provide/inject pattern with Offcanvas:Header,\nOffcanvas:Title and Offcanvas:Body sub-components. The title id is auto-wired\nto the root aria-labelledby, so a custom header can no longer leave a dang\n[…]\nImage overlays\n+\n+Use an image as the card background and place concise, high-contrast content over it.\n+\n+```twig {\"preview\":true,\"height\":\"410px\"}\n+{% set image_url = 'https://images.unsplash.com/p…",
          "is_bot": false,
          "headline": "[Toolkit][Bootstrap] Add the Bootstrap kit",
          "author_name": "Simon André",
          "author_login": "smnandre",
          "committed_at": "2026-07-22T22:25:58Z",
          "body_truncated": true,
          "is_coding_agent": false
        },
        {
          "oid": "4af61f6468e696da31b248a48d92aca410bc0f4d",
          "body": "…andre)\n\nThis PR was merged into the 3.x branch.\n\nDiscussion\n----------\n\n[Toolkit] Fix suggested frontend installation commands\n\n| Q              | A\n| -------------- | ---\n| Bug fix?       | yes\n| New feature?   | no <!-- please update src/**/CHANGELOG.md files -->\n| Deprecations?  | no <!-- if yes\n[…]\nexist, explain below instead -->\n| License        | MIT\n\nCherry-picked from https://github.com/symfony/ux/pull/3713\n\nCommits\n-------\n\n69d6b8feb34 [Toolkit] Fix suggested frontend installation commands",
          "is_bot": false,
          "headline": "bug #3720 [Toolkit] Fix suggested frontend installation commands (smn…",
          "author_name": "Hugo Alliaume",
          "author_login": "Kocal",
          "committed_at": "2026-07-22T22:21:23Z",
          "body_truncated": true,
          "is_coding_agent": false
        },
        {
          "oid": "69d6b8feb34bbc5107896d88a0d28e0e389e8736",
          "body": null,
          "is_bot": false,
          "headline": "[Toolkit] Fix suggested frontend installation commands",
          "author_name": "Simon André",
          "author_login": "smnandre",
          "committed_at": "2026-07-22T21:59:42Z",
          "body_truncated": false,
          "is_coding_agent": false
        },
        {
          "oid": "49953a9754d4f18e58c277786e61dc302e1c1715",
          "body": "This PR was merged into the 3.x branch.\n\nDiscussion\n----------\n\n[Toolkit] Support kit-level dependencies\n\n| Q              | A\n| -------------- | ---\n| Bug fix?       | no\n| New feature?   | yes <!-- please update src/**/CHANGELOG.md files -->\n| Deprecations?  | no <!-- if yes, also update UPGRADE-*\n[…]\nissue if none exist, explain below instead -->\n| License        | MIT\n\nCherry-picked from https://github.com/symfony/ux/pull/3713\n\nCommits\n-------\n\n6aa0a049592 [Toolkit] Support kit-level dependencies",
          "is_bot": false,
          "headline": "feature #3719 [Toolkit] Support kit-level dependencies (smnandre)",
          "author_name": "Hugo Alliaume",
          "author_login": "Kocal",
          "committed_at": "2026-07-22T21:58:33Z",
          "body_truncated": true,
          "is_coding_agent": false
        },
        {
          "oid": "d73427cea4fea8eab3349677da3b69d7c433bbe9",
          "body": "…html_attr_*` filters (Kocal)\n\nThis PR was merged into the 3.x branch.\n\nDiscussion\n----------\n\n[Toolkit] Require the correct twig/html-extra version for `html_attr_*` filters\n\n| Q              | A\n| -------------- | ---\n| Bug fix?       | yes\n| New feature?   | no <!-- please update src/**/CHANGELOG\n[…]\nstead -->\n| License        | MIT\n\nCherry-picked from https://github.com/symfony/ux/pull/3713\n\nCommits\n-------\n\n45696601469 [Toolkit] Require the correct twig/html-extra version for html_attr_* filters",
          "is_bot": false,
          "headline": "bug #3721 [Toolkit] Require the correct twig/html-extra version for `…",
          "author_name": "Hugo Alliaume",
          "author_login": "Kocal",
          "committed_at": "2026-07-22T21:58:04Z",
          "body_truncated": true,
          "is_coding_agent": false
        },
        {
          "oid": "6aa0a049592e9da9d7f99158edfae4066c591710",
          "body": null,
          "is_bot": false,
          "headline": "[Toolkit] Support kit-level dependencies",
          "author_name": "Simon André",
          "author_login": "smnandre",
          "committed_at": "2026-07-22T21:48:30Z",
          "body_truncated": false,
          "is_coding_agent": false
        },
        {
          "oid": "45696601469e0c0c49d978b7acb93af5b99cb68d",
          "body": "… filters\n\nRework ComposerSymbolChecker to a \"symbol -> required packages\" model with AND\nsemantics: a Twig filter is satisfied only when every Composer package it needs\nis declared at a compatible version. html_attr_merge/html_attr_type now require\nboth twig/extra-bundle and twig/html-extra:^3.24, instead of a version-less\ntwig/extra-bundle masking an under-pinned twig/html-extra.\n\nBump the bootstrap tooltip and popover manifests to twig/html-extra:^3.24.0.",
          "is_bot": false,
          "headline": "[Toolkit] Require the correct twig/html-extra version for html_attr_*…",
          "author_name": "Hugo Alliaume",
          "author_login": "Kocal",
          "committed_at": "2026-07-22T21:43:18Z",
          "body_truncated": false,
          "is_coding_agent": false
        },
        {
          "oid": "b512b740563c7c402e8c93e7921eba699bcc1401",
          "body": "…an describe themselves (Kocal)\n\nThis PR was squashed before being merged into the 3.x branch.\n\nDiscussion\n----------\n\n[Toolkit] Add a documentation rendering layer so kits can describe themselves\n\n| Q              | A\n| -------------- | ---\n| Bug fix?       | no\n| New feature?   | yes\n| Deprecation\n[…]\nline-README examples model\n5ef931a8967 [Toolkit] Inline recipe examples into README; drop examples/*.html.twig\ne54d9ceaad3 [Toolkit] Add a documentation rendering layer so kits can describe themselves",
          "is_bot": false,
          "headline": "feature #3718 [Toolkit] Add a documentation rendering layer so kits c…",
          "author_name": "Hugo Alliaume",
          "author_login": "Kocal",
          "committed_at": "2026-07-21T06:23:18Z",
          "body_truncated": true,
          "is_coding_agent": false
        },
        {
          "oid": "5c4d6cf7389d4e9dfec021eb992f521e05391f5a",
          "body": "…ME examples model\n\nUpdate the symfony-ux-toolkit-kit skill for the new single-source model:\nexamples are inline ```twig {\"preview\":true} blocks in each recipe README.md,\nno more examples/*.html.twig files, no `::: example` directive, no per-recipe\n.md.twig companion (docs render from the README), a\n[…]\nkeyed by example\nindex via phpunit (simple-phpunit is gone).\n\nScaffold a Button/README.md in that structure from ux:toolkit:create-kit so new\nkits start correct, and assert it in CreateKitCommandTest.",
          "is_bot": false,
          "headline": "[Toolkit] Align kit-authoring skill + scaffolder with the inline-READ…",
          "author_name": "Hugo Alliaume",
          "author_login": "Kocal",
          "committed_at": "2026-07-21T06:14:31Z",
          "body_truncated": true,
          "is_coding_agent": false
        },
        {
          "oid": "5ef931a8967830f827b18341658d9744fe301a43",
          "body": "Each `::: example <Name> {opts}` directive is replaced by the example's Twig\ninlined as a fenced block: runnable examples as ```twig {\"preview\":true, ...opts}\n(rendered by FencedCodePreviewExtension), the Usage block as a plain static\n```twig. The examples/*.html.twig files are removed, so the READM\n[…]\nrates Recipe::getExamples() instead of the\nfiles; snapshots regenerated. The three previously test-only fixtures (button-group\nAccessibility, typography Arabic/Hebrew RTL) are now documented examples.",
          "is_bot": false,
          "headline": "[Toolkit] Inline recipe examples into README; drop examples/*.html.twig",
          "author_name": "Hugo Alliaume",
          "author_login": "Kocal",
          "committed_at": "2026-07-21T06:14:31Z",
          "body_truncated": true,
          "is_coding_agent": false
        },
        {
          "oid": "e54d9ceaad3af701477ff70c2f846aa929059818",
          "body": "…emselves",
          "is_bot": false,
          "headline": "[Toolkit] Add a documentation rendering layer so kits can describe th…",
          "author_name": "Hugo Alliaume",
          "author_login": "Kocal",
          "committed_at": "2026-07-21T06:00:13Z",
          "body_truncated": false,
          "is_coding_agent": false
        },
        {
          "oid": "4c9bfe16c79b25d45a907bb901271e1c922ce784",
          "body": null,
          "is_bot": false,
          "headline": "Update branch reference for features and deprecations",
          "author_name": "Hugo Alliaume",
          "author_login": "Kocal",
          "committed_at": "2026-07-19T14:17:03Z",
          "body_truncated": false,
          "is_coding_agent": false
        },
        {
          "oid": "632b601057fc5a1d21e661533df8414acfe20ed6",
          "body": "…d Symfony version (MrYamous)\n\nThis PR was merged into the 3.x branch.\n\nDiscussion\n----------\n\n[Turbo][Documention] Remove mention to unsupported Symfony version\n\n| Q              | A\n| -------------- | ---\n| Bug fix?       | no\n| New feature?   | no\n| Deprecations?  | no\n| Documentation? | yes\n| Is\n[…]\nis requiring Symfony 6.4, I think it's no longer relevant to keep in documentation an example about 6.2\n\nCommits\n-------\n\n44d18a31b51 [Documention][Turbo] Remove mention to unsupported Symfony version",
          "is_bot": false,
          "headline": "documentation #3715 [Turbo][Documention] Remove mention to unsupporte…",
          "author_name": "Hugo Alliaume",
          "author_login": "Kocal",
          "committed_at": "2026-07-19T08:22:10Z",
          "body_truncated": true,
          "is_coding_agent": false
        },
        {
          "oid": "44d18a31b51c802317d8c0985828ca41760ce545",
          "body": null,
          "is_bot": false,
          "headline": "[Documention][Turbo] Remove mention to unsupported Symfony version",
          "author_name": "Matthieu Lempereur",
          "author_login": "MrYamous",
          "committed_at": "2026-07-19T08:12:19Z",
          "body_truncated": false,
          "is_coding_agent": false
        },
        {
          "oid": "20bf32441651a604bdfbe301c054f713bf06d16f",
          "body": "…ony Reprise) (Kocal)\n\nThis PR was merged into the 3.x branch.\n\nDiscussion\n----------\n\n[React][Vue] Add support for `import.meta.glob()` (Symfony Reprise)\n\n| Q              | A\n| -------------- | ---\n| Bug fix?       | no\n| New feature?   | yes <!-- please update src/**/CHANGELOG.md files -->\n| Depr\n[…]\n- https://github.com/symfony/reprise/pull/43\n\nSupport for React and HMR with Vite requires Reprise 0.4\n\nCommits\n-------\n\n578acb9cafd [React][Vue] Add support for `import.meta.glob()` (Symfony Reprise)",
          "is_bot": false,
          "headline": "feature #3714 [React][Vue] Add support for `import.meta.glob()` (Symf…",
          "author_name": "Hugo Alliaume",
          "author_login": "Kocal",
          "committed_at": "2026-07-19T08:09:07Z",
          "body_truncated": true,
          "is_coding_agent": false
        },
        {
          "oid": "578acb9cafd4211d1b069011131a2cfc3f5b3b33",
          "body": "registerReactControllerComponents() and registerVueControllerComponents() only\naccepted a Webpack require.context(). Vite and Rsbuild (used by Symfony Reprise)\ndo not provide it and expose import.meta.glob() instead. Both functions now accept\neither input: a require.context() (a function) or an import.meta.glob() result (an\nobject), whose keys are normalized to the ./<name>.<ext> form. React expects the\neager option; Vue supports both eager and lazy globs.",
          "is_bot": false,
          "headline": "[React][Vue] Add support for `import.meta.glob()` (Symfony Reprise)",
          "author_name": "Hugo Alliaume",
          "author_login": "Kocal",
          "committed_at": "2026-07-19T07:51:48Z",
          "body_truncated": false,
          "is_coding_agent": false
        },
        {
          "oid": "0e423fd53442e6f02fd070f7e68888bf74ffbd51",
          "body": "…k` and `post-link` recipes (kbond)\n\nThis PR was merged into the 3.x branch.\n\nDiscussion\n----------\n\n[Toolkit][Common] Add the `common` kit with `logout-link` and `post-link` recipes\n\n| Q              | A\n| -------------- | ---\n| Bug fix?       | no\n| New feature?   | yes\n| Deprecations?  | https://\n[…]\ns the [companion ux.symfony.com PR](https://github.com/symfony/ux.symfony.com/pull/159).\n\nCommits\n-------\n\n166a59a70a9 [Toolkit][Common] Add the `common` kit with `logout-link` and `post-link` recipes",
          "is_bot": false,
          "headline": "feature #3707 [Toolkit][Common] Add the `common` kit with `logout-lin…",
          "author_name": "Hugo Alliaume",
          "author_login": "Kocal",
          "committed_at": "2026-07-17T09:18:55Z",
          "body_truncated": true,
          "is_coding_agent": false
        },
        {
          "oid": "166a59a70a95614669487130d13945ddf60c22e4",
          "body": "…ink` recipes\n\nIntroduce a new design-system agnostic kit for common Symfony needs. It ships\ntwo recipes:\n\n- `post-link`: a link submitted as a form, with optional HTTP method spoofing,\n  CSRF protection, and a confirmation prompt\n- `logout-link`: a link that logs the current user out through a secure POST\n  form (built on top of `post-link`)",
          "is_bot": false,
          "headline": "[Toolkit][Common] Add the `common` kit with `logout-link` and `post-l…",
          "author_name": "Kevin Bond",
          "author_login": "kbond",
          "committed_at": "2026-07-17T09:13:23Z",
          "body_truncated": false,
          "is_coding_agent": false
        },
        {
          "oid": "dbf2f0a404a7a2431606eba651922ade4ead3b04",
          "body": "…ttibutes merging (stephen-lewis)\n\nThis PR was merged into the 3.x branch.\n\nDiscussion\n----------\n\n[Toolkit][Shadcn] Fix `Table:Cell` and `Table:Head` class attibutes merging\n\n| Q              | A\n| -------------- | ---\n| Bug fix?       | yes\n| New feature?   | no <!-- please update src/**/CHANGELOG\n[…]\nting-a-changelog-entry\n - Never break backward compatibility (see https://symfony.com/bc).\n-->\n\nCommits\n-------\n\nb68bbf62b06 [Toolkit][Shadcn] Fix `Table:Cell` and `Table:Head` class attibutes merging",
          "is_bot": false,
          "headline": "bug #3710 [Toolkit][Shadcn] Fix `Table:Cell` and `Table:Head` class a…",
          "author_name": "Hugo Alliaume",
          "author_login": "Kocal",
          "committed_at": "2026-07-17T08:36:03Z",
          "body_truncated": true,
          "is_coding_agent": false
        },
        {
          "oid": "b68bbf62b069088d1cea4b2603abded974767170",
          "body": "…erging",
          "is_bot": false,
          "headline": "[Toolkit][Shadcn] Fix `Table:Cell` and `Table:Head` class attibutes m…",
          "author_name": "Stephen Lewis",
          "author_login": "stephen-lewis",
          "committed_at": "2026-07-17T08:31:09Z",
          "body_truncated": false,
          "is_coding_agent": false
        },
        {
          "oid": "e740d84b76603af03398e0d11506ec787ffbc07d",
          "body": "… linter (Kocal)\n\nThis PR was merged into the 3.x branch.\n\nDiscussion\n----------\n\n[Toolkit] Add `ClassMergeSpacingChecker` checker to the linter\n\n| Q              | A\n| -------------- | ---\n| Bug fix?       | no\n| New feature?   | yes <!-- please update src/**/CHANGELOG.md files -->\n| Deprecations? \n[…]\nll render `class=\"foobar\"`\n\nRelated to https://github.com/symfony/ux/pull/3708#pullrequestreview-4720468133\n\nCommits\n-------\n\ne5cb89c37e7 [Toolkit] Add `ClassMergeSpacingChecker` checker to the linter",
          "is_bot": false,
          "headline": "feature #3709 [Toolkit] Add `ClassMergeSpacingChecker` checker to the…",
          "author_name": "Hugo Alliaume",
          "author_login": "Kocal",
          "committed_at": "2026-07-17T08:17:06Z",
          "body_truncated": true,
          "is_coding_agent": false
        },
        {
          "oid": "e5cb89c37e719f9f000a22c8ac8e884d76fc8f02",
          "body": "We have some occurences `'foo' ~ attributes.render('class')` which generates invalid classes when the user is passing `class` attr  (e.g.: `<twig:Toto class=\"bar\">` will render `class=\"foobar\"`",
          "is_bot": false,
          "headline": "[Toolkit] Add `ClassMergeSpacingChecker` checker to the linter",
          "author_name": "Hugo Alliaume",
          "author_login": "Kocal",
          "committed_at": "2026-07-17T08:11:18Z",
          "body_truncated": false,
          "is_coding_agent": false
        },
        {
          "oid": "d4fb61166d0a96f7c13265df4ae3247f9723d7e2",
          "body": "This PR was merged into the 3.x branch.\n\nDiscussion\n----------\n\n[StimulusBundle] Add support for Symfony Reprise\n\n| Q              | A\n| -------------- | ---\n| Bug fix?       | no\n| New feature?   | yes\n| Deprecations?  | no\n| Documentation? | yes\n| Issues         | -\n| License        | MIT\n\n[Symfon\n[…]\ndge manually (documented).\n\nRelated: symfony/recipes#1543 (matching Flex recipes) and https://github.com/symfony/reprise.\n\nCommits\n-------\n\n9c50560b1c8 [StimulusBundle] Add support for Symfony Reprise",
          "is_bot": false,
          "headline": "feature #3705 [StimulusBundle] Add support for Symfony Reprise (Kocal)",
          "author_name": "Hugo Alliaume",
          "author_login": "Kocal",
          "committed_at": "2026-07-13T16:18:59Z",
          "body_truncated": true,
          "is_coding_agent": false
        },
        {
          "oid": "9c50560b1c83fc65e9b64ad2b03eb9f964732e1e",
          "body": "Document Symfony Reprise (the Vite and Rsbuild asset integration) as a supported\nasset system next to AssetMapper and Webpack Encore, and drop the Encore-specific\n`@symfony/stimulus-bridge` from the npm peer dependencies so AssetMapper and\nReprise projects no longer pull it in. Webpack Encore still needs it and now\ninstalls it manually (documented).",
          "is_bot": false,
          "headline": "[StimulusBundle] Add support for Symfony Reprise",
          "author_name": "Hugo Alliaume",
          "author_login": "Kocal",
          "committed_at": "2026-07-13T16:10:12Z",
          "body_truncated": false,
          "is_coding_agent": false
        },
        {
          "oid": "1311aa13e9df7cf826a9f60234c8302e9d3ad7ee",
          "body": "…'lazy' */` syntax (IndraGunawan)\n\nThis PR was merged into the 3.x branch.\n\nDiscussion\n----------\n\n[StimulusBundle] Support preserved `/*! stimulusFetch: 'lazy' */` syntax\n\n| Q              | A\n| -------------- | ---\n| Bug fix?       | no\n| New feature?   | yes <!-- please update src/**/CHANGELOG.md\n[…]\nd.\n\nThis also fixes the tests, was `OK (1 test, 2 assertions)`, now `OK (2 tests, 15 assertions)`\n\nCommits\n-------\n\nfbe243ebcf1 [StimulusBundle] Support preserved `/*! stimulusFetch: 'lazy' */` syntax",
          "is_bot": false,
          "headline": "feature #3702 [StimulusBundle] Support preserved `/*! stimulusFetch: …",
          "author_name": "Hugo Alliaume",
          "author_login": "Kocal",
          "committed_at": "2026-07-10T16:08:11Z",
          "body_truncated": true,
          "is_coding_agent": false
        },
        {
          "oid": "fbe243ebcf194988be396e9f9125f7f6589a5ae5",
          "body": null,
          "is_bot": false,
          "headline": "[StimulusBundle] Support preserved `/*! stimulusFetch: 'lazy' */` syntax",
          "author_name": "Indra Gunawan",
          "author_login": "IndraGunawan",
          "committed_at": "2026-07-10T16:03:59Z",
          "body_truncated": false,
          "is_coding_agent": false
        },
        {
          "oid": "6c3ac801cd6b2ee05106ec02839f3f3c2aac374b",
          "body": "…ted loader deterministic (Amoifr)\n\nThis PR was merged into the 3.x branch.\n\nDiscussion\n----------\n\n[StimulusBundle] Sort custom controllers to keep the generated loader deterministic\n\n| Q             | A\n| ------------- | ---\n| Bug fix?      | yes\n| New feature?  | no\n| Issues        | Fix #3562\n| \n[…]\n.md` points at, but I'm happy to retarget if you'd rather have it on the older branch.\n\nCommits\n-------\n\n29098634257 [StimulusBundle] Sort custom controllers to keep the generated loader deterministic",
          "is_bot": false,
          "headline": "bug #3703 [StimulusBundle] Sort custom controllers to keep the genera…",
          "author_name": "Hugo Alliaume",
          "author_login": "Kocal",
          "committed_at": "2026-07-10T15:48:03Z",
          "body_truncated": true,
          "is_coding_agent": false
        },
        {
          "oid": "88cb1a0a7cfa9070162b1343cecb435b0968c164",
          "body": "…loads (Amoifr)\n\nThis PR was merged into the 3.x branch.\n\nDiscussion\n----------\n\n[LiveComponent] Avoid 500 errors on malformed hydration payloads\n\n| Q             | A\n| ------------- | ---\n| Bug fix?      | yes\n| New feature?  | no\n| Tickets       | -\n| License       | MIT\n\nHydrating a LiveComponent\n[…]\nitable value is ignored like any other bad data and the original value is kept.\n\nDiscussed with `@Kocal`.\n\nCommits\n-------\n\n0a4503f285f [LiveComponent] Avoid 500 errors on malformed hydration payloads",
          "is_bot": false,
          "headline": "bug #3676 [LiveComponent] Avoid 500 errors on malformed hydration pay…",
          "author_name": "Hugo Alliaume",
          "author_login": "Kocal",
          "committed_at": "2026-07-10T15:47:13Z",
          "body_truncated": true,
          "is_coding_agent": false
        },
        {
          "oid": "3b7f212e78eb6d1fd411a35b5c5dc8476bc6fa57",
          "body": "…-ignore subtrees (Amoifr)\n\nThis PR was merged into the 3.x branch.\n\nDiscussion\n----------\n\n[LiveComponent] Fix data-loading scanner ignoring data-live-ignore subtrees\n\n| Q              | A\n| -------------- | ---\n| Bug fix?       | yes\n| New feature?   | no\n| Deprecations?  | no\n| Documentation? | n\n[…]\ne-ignore` subtree, the same way nested live-component elements are already skipped just above.\n\nCommits\n-------\n\n41a0807514b [LiveComponent] Fix data-loading scanner ignoring data-live-ignore subtrees",
          "is_bot": false,
          "headline": "bug #3688 [LiveComponent] Fix data-loading scanner ignoring data-live…",
          "author_name": "Hugo Alliaume",
          "author_login": "Kocal",
          "committed_at": "2026-07-10T15:46:39Z",
          "body_truncated": true,
          "is_coding_agent": false
        },
        {
          "oid": "2909863425757454ca7cf81819205ec5770dda04",
          "body": "… deterministic\n\n`ControllersMapGenerator::loadCustomControllers()` iterated a `Finder` without\nany sort. Directory iteration order is filesystem-dependent, so the controllers\nwere emitted in a different order across builds, changing the contents of the\ngenerated loader and therefore its digest, even though no controller had\nchanged.",
          "is_bot": false,
          "headline": "[StimulusBundle] Sort custom controllers to keep the generated loader…",
          "author_name": "Amoifr",
          "author_login": "Amoifr",
          "committed_at": "2026-07-10T12:23:54Z",
          "body_truncated": false,
          "is_coding_agent": false
        },
        {
          "oid": "bd86a5fb2ac7291b5ba541ea4ec162da12781d06",
          "body": "…(Kocal)\n\nThis PR was merged into the 3.x branch.\n\nDiscussion\n----------\n\n[CI] Pin actions to latest releases with version comments\n\n| Q              | A\n| -------------- | ---\n| Bug fix?       | no\n| New feature?   | no <!-- please update src/**/CHANGELOG.md files -->\n| Deprecations?  | no <!-- if \n[…]\nLicense        | MIT\n\nTIL: Dependabot correctly update the version comments, see dependabot/dependabot-core#5951\n\nCommits\n-------\n\n001eb2e89f6 [CI] Pin actions to latest releases with version comments",
          "is_bot": false,
          "headline": "tidy #3701 [CI] Pin actions to latest releases with version comments …",
          "author_name": "Hugo Alliaume",
          "author_login": "Kocal",
          "committed_at": "2026-07-10T06:06:07Z",
          "body_truncated": true,
          "is_coding_agent": false
        },
        {
          "oid": "001eb2e89f6078b6de6a43171fed988180937319",
          "body": "Bump every SHA-pinned GitHub Action to its latest stable release and add a\ntrailing version comment (e.g. `# v7.0.0`) next to each pin, so Dependabot can\ntrack the pinned SHAs and keep the human-readable version in sync\n(dependabot/dependabot-core#5951).\n\nMajor bumps: actions/checkout v6->v7, actions/cache v5->v6,\nactions/github-script v8->v9.",
          "is_bot": false,
          "headline": "[CI] Pin actions to latest releases with version comments",
          "author_name": "Hugo Alliaume",
          "author_login": "Kocal",
          "committed_at": "2026-07-10T05:58:00Z",
          "body_truncated": false,
          "is_coding_agent": false
        },
        {
          "oid": "13027df28cbc8f306d6672c4ef779c35689ac443",
          "body": "…ies on component (rogierknoester)\n\nThis PR was merged into the 3.x branch.\n\nDiscussion\n----------\n\n[LiveComponent] Fix support for nullable collection properties on component\n\n| Q              | A\n| -------------- | ---\n| Bug fix?       | yes\n| New feature?   | no <!-- please update src/**/CHANGELO\n[…]\ning>`. This PR fixes that by checking if the inner type of a nullable type might be a collection type.\n\nCommits\n-------\n\n0725ea5e527 [LiveComponent] Support nullable collection properties on component",
          "is_bot": false,
          "headline": "bug #3690 [LiveComponent] Fix support for nullable collection propert…",
          "author_name": "Hugo Alliaume",
          "author_login": "Kocal",
          "committed_at": "2026-07-09T16:01:20Z",
          "body_truncated": true,
          "is_coding_agent": false
        },
        {
          "oid": "0725ea5e5277de404182df4f136ab49760986742",
          "body": null,
          "is_bot": false,
          "headline": "[LiveComponent] Support nullable collection properties on component",
          "author_name": "rogierknoester",
          "author_login": "rogierknoester",
          "committed_at": "2026-07-09T08:44:12Z",
          "body_truncated": false,
          "is_coding_agent": false
        },
        {
          "oid": "fb1f26eadd717a537c2fbb714e1e6fb8c538d908",
          "body": "* 2.x:\n  Bump npm packages to v2.36.2\n  Fix typo",
          "is_bot": false,
          "headline": "Merge branch '2.x' into 3.x",
          "author_name": "Hugo Alliaume",
          "author_login": "Kocal",
          "committed_at": "2026-07-09T05:17:17Z",
          "body_truncated": false,
          "is_coding_agent": false
        },
        {
          "oid": "e909a16d537571a4494a85097c0742a941af762a",
          "body": "…tively and suggest alternatives (Kocal)\n\nThis PR was merged into the 3.x branch.\n\nDiscussion\n----------\n\n[Toolkit] Resolve `ux:install` recipe name case-insensitively and suggest alternatives\n\n| Q              | A\n| -------------- | ---\n| Bug fix?       | no\n| New feature?   | yes <!-- please updat\n[…]\n any official kit, the error now suggests\nclose alternatives found across all kits.\n\nCommits\n-------\n\n975d48f3cff [Toolkit] Resolve `ux:install` recipe name case-insensitively and suggest alternatives",
          "is_bot": false,
          "headline": "feature #3700 [Toolkit] Resolve `ux:install` recipe name case-insensi…",
          "author_name": "Hugo Alliaume",
          "author_login": "Kocal",
          "committed_at": "2026-07-09T05:13:44Z",
          "body_truncated": true,
          "is_coding_agent": false
        },
        {
          "oid": "975d48f3cff7bf75727ae0a884cec8fa1ebd93e8",
          "body": "…gest alternatives\n\nRecipe names are stored in lower-case, so `ux:install Alert` used to fail\nwith a raw \"does not exist in any official kits\" error. Recipe lookup is now\ncase-insensitive: `Alert` resolves to the `alert` recipe and offers to install\nit from the kits that contain it, both without `--\n[…]\nfirmation). Genuine typos still go through the alternative-recipe\nsuggestions.\n\nWhen a recipe truly does not exist in any official kit, the error now suggests\nclose alternatives found across all kits.",
          "is_bot": false,
          "headline": "[Toolkit] Resolve `ux:install` recipe name case-insensitively and sug…",
          "author_name": "Hugo Alliaume",
          "author_login": "Kocal",
          "committed_at": "2026-07-09T05:03:19Z",
          "body_truncated": true,
          "is_coding_agent": false
        },
        {
          "oid": "6644c07c30f7167cc413e444141907c85fc7b87f",
          "body": " Bump npm packages to v2.36.2",
          "is_bot": false,
          "headline": "Merge pull request #3698 from symfony/bump/v2.36.2",
          "author_name": "Fabien Potencier",
          "author_login": "fabpot",
          "committed_at": "2026-07-08T13:57:17Z",
          "body_truncated": false,
          "is_coding_agent": false
        },
        {
          "oid": "20721611e7bb4f977036fcb90ea80ac41df2aae1",
          "body": null,
          "is_bot": true,
          "headline": "Bump npm packages to v2.36.2",
          "author_name": "github-actions[bot]",
          "author_login": "github-actions[bot]",
          "committed_at": "2026-07-08T13:49:33Z",
          "body_truncated": false,
          "is_coding_agent": false
        },
        {
          "oid": "8d0770f74395144475ff1470f6c85542c9c9cb4e",
          "body": null,
          "is_bot": false,
          "headline": "Fix typo",
          "author_name": "Fabien Potencier",
          "author_login": "fabpot",
          "committed_at": "2026-07-08T08:47:43Z",
          "body_truncated": false,
          "is_coding_agent": false
        },
        {
          "oid": "024a8d0e47c25e2d40713f0da36e4a65060d0d0d",
          "body": "This PR was merged into the 3.x branch.\n\nDiscussion\n----------\n\n[TwigComponent] Fix syntax\n\n| Q              | A\n| -------------- | ---\n| Bug fix?       | no\n| New feature?   | no\n| Deprecations?  | no\n| Documentation? | yes\n| Issues         |\n| License        | MIT\n\nI suppose it's caused by rst syn\n[…]\napture d’écran 2026-07-05 à 17 45 48\" src=\"https://github.com/user-attachments/assets/426533d1-145f-471e-a1a8-4b000725c65c\" />\n\nCommits\n-------\n\nd3a0692870b [Documentation][TwigComponent] Fix syntax",
          "is_bot": false,
          "headline": "documentation #3695 [TwigComponent] Fix syntax (MrYamous)",
          "author_name": "Hugo Alliaume",
          "author_login": "Kocal",
          "committed_at": "2026-07-05T21:52:01Z",
          "body_truncated": true,
          "is_coding_agent": false
        },
        {
          "oid": "43f11e180719b14ad340af1c36e540837e741046",
          "body": "…esize, and stop it from intercepting pointer events while hidden (Kocal)\n\nThis PR was merged into the 3.x branch.\n\nDiscussion\n----------\n\n[Toolkit][Shadcn] Dismiss the `tooltip` on scroll and resize, and stop it from intercepting pointer events while hidden\n\n| Q              | A\n| -------------- | \n[…]\nhttps://github.com/symfony/ux.symfony.com/pull/157\n\nCommits\n-------\n\n79b974903a9 [Toolkit][Shadcn] Dismiss the `tooltip` on scroll and resize, and stop it from intercepting pointer events while hidden",
          "is_bot": false,
          "headline": "feature #3696 [Toolkit][Shadcn] Dismiss the `tooltip` on scroll and r…",
          "author_name": "Hugo Alliaume",
          "author_login": "Kocal",
          "committed_at": "2026-07-05T21:17:35Z",
          "body_truncated": true,
          "is_coding_agent": false
        },
        {
          "oid": "79b974903a92408f211496b0257bbe34de5174f8",
          "body": "…p it from intercepting pointer events while hidden\n\nFound while working on UX website.",
          "is_bot": false,
          "headline": "[Toolkit][Shadcn] Dismiss the `tooltip` on scroll and resize, and sto…",
          "author_name": "Hugo Alliaume",
          "author_login": "Kocal",
          "committed_at": "2026-07-05T21:03:49Z",
          "body_truncated": false,
          "is_coding_agent": false
        },
        {
          "oid": "ac4f12fb75e0621efc0092896f99fcb1712824c2",
          "body": "…@block`` comments format (Kocal)\n\nThis PR was merged into the 3.x branch.\n\nDiscussion\n----------\n\n[Toolkit] Refactor (again) but improve ``@prop`` and ``@block`` comments format\n\n| Q              | A\n| -------------- | ---\n| Bug fix?       | no\n| New feature?   | yes <!-- please update src/**/CHANG\n[…]\ns to easily fix issues found by the linting tool.\n\nAll kit recipes were fixed accordingly.\n\nCommits\n-------\n\n359ffca0752 [Toolkit] Refactor (again) but improve ``@prop`` and ``@block`` comments format",
          "is_bot": false,
          "headline": "feature #3694 [Toolkit] Refactor (again) but improve ``@prop`` and ``…",
          "author_name": "Hugo Alliaume",
          "author_login": "Kocal",
          "committed_at": "2026-07-05T19:30:28Z",
          "body_truncated": true,
          "is_coding_agent": false
        },
        {
          "oid": "359ffca07521954ab3379789bd981a5ea3a8bf7a",
          "body": "…format",
          "is_bot": false,
          "headline": "[Toolkit] Refactor (again) but improve `@prop` and `@block` comments …",
          "author_name": "Hugo Alliaume",
          "author_login": "Kocal",
          "committed_at": "2026-07-05T19:00:40Z",
          "body_truncated": false,
          "is_coding_agent": false
        },
        {
          "oid": "d3a0692870b36ce91f26c53b1ff2ad72b98432fd",
          "body": null,
          "is_bot": false,
          "headline": "[Documentation][TwigComponent] Fix syntax",
          "author_name": "Matthieu Lempereur",
          "author_login": "MrYamous",
          "committed_at": "2026-07-05T15:45:35Z",
          "body_truncated": false,
          "is_coding_agent": false
        },
        {
          "oid": "94167345de06acd1939bdd4deba84d4d771dbbcb",
          "body": "* 2.x:\n  [Autocomplete] Fix next 2.x release",
          "is_bot": false,
          "headline": "Merge branch '2.x' into 3.x",
          "author_name": "Hugo Alliaume",
          "author_login": "Kocal",
          "committed_at": "2026-07-05T08:08:37Z",
          "body_truncated": false,
          "is_coding_agent": false
        },
        {
          "oid": "c328b22a7bbab6e596564dceb34d3dc06381da56",
          "body": null,
          "is_bot": false,
          "headline": "[Autocomplete] Fix next 2.x release",
          "author_name": "Hugo Alliaume",
          "author_login": "Kocal",
          "committed_at": "2026-07-05T08:07:54Z",
          "body_truncated": false,
          "is_coding_agent": false
        },
        {
          "oid": "721a0cd5dd6c96653ebbb0961cf03a097522c00c",
          "body": "* 2.x:\n  [Autocomplete] Fix LIKE ESCAPE clause breaking search on PostgreSQL",
          "is_bot": false,
          "headline": "Merge branch '2.x' into 3.x",
          "author_name": "Hugo Alliaume",
          "author_login": "Kocal",
          "committed_at": "2026-07-05T08:06:04Z",
          "body_truncated": false,
          "is_coding_agent": false
        },
        {
          "oid": "39378083fd5373e8ea691ede2700d0dd209cf281",
          "body": "…stgreSQL (Amoifr)\n\nThis PR was merged into the 2.x branch.\n\nDiscussion\n----------\n\n[Autocomplete] Fix LIKE ESCAPE clause breaking search on PostgreSQL\n\n| Q             | A\n| ------------- | ---\n| Bug fix?      | yes\n| New feature?  | no\n| Tickets       | Fix #3668\n| License       | MIT\n\nSince 2.36,\n[…]\noff`; the new `ESCAPE '!'` works\n  under both settings and correctly matches literal `%`, `_` and `!`.\n\nCommits\n-------\n\n91d8147c5b1 [Autocomplete] Fix LIKE ESCAPE clause breaking search on PostgreSQL",
          "is_bot": false,
          "headline": "bug #3685 [Autocomplete] Fix LIKE ESCAPE clause breaking search on Po…",
          "author_name": "Hugo Alliaume",
          "author_login": "Kocal",
          "committed_at": "2026-07-05T08:03:21Z",
          "body_truncated": true,
          "is_coding_agent": false
        },
        {
          "oid": "91d8147c5b18487969847e01a58512763e620c99",
          "body": "The \"ESCAPE '\\'\" clause added in 2.36 to escape LIKE wildcards produces\ninvalid SQL on PostgreSQL: with standard_conforming_strings=off the\nbackslash escapes the closing quote, breaking the statement (surfaces as\nSQLSTATE[HY093] / [22025]).\n\nUse a backslash-free escape character (\"!\") via the platform's\nescapeStringForLike() instead. The explicit ESCAPE clause is kept since\nSQLite has no default LIKE escape character.",
          "is_bot": false,
          "headline": "[Autocomplete] Fix LIKE ESCAPE clause breaking search on PostgreSQL",
          "author_name": "Amoifr",
          "author_login": "Amoifr",
          "committed_at": "2026-07-05T07:59:36Z",
          "body_truncated": false,
          "is_coding_agent": false
        },
        {
          "oid": "401acbcab9467ff2430ec70977dfc15ebd9e77a1",
          "body": "This PR was merged into the 3.x branch.\n\nDiscussion\n----------\n\n[Shadcn] Add Sonner\n\n| Q              | A\n| -------------- | ---\n| Bug fix?       | no\n| New feature?   | yes\n| Deprecations?  | no\n| Documentation? | no\n| Issues         | Part of #3233\n| License        | MIT\n\nAdd Sonner component\n\nCommits\n-------\n\n9d523ec8f8a [Toolkit][Shadcn] Add `sonner` recipe",
          "is_bot": false,
          "headline": "feature #3477 [Shadcn] Add Sonner (makraz)",
          "author_name": "Hugo Alliaume",
          "author_login": "Kocal",
          "committed_at": "2026-07-05T07:55:03Z",
          "body_truncated": false,
          "is_coding_agent": false
        },
        {
          "oid": "9d523ec8f8aa9a6760192d0dc7f7985564fdedf4",
          "body": null,
          "is_bot": false,
          "headline": "[Toolkit][Shadcn] Add `sonner` recipe",
          "author_name": "Hamza Makraz",
          "author_login": "makraz",
          "committed_at": "2026-07-05T07:51:11Z",
          "body_truncated": false,
          "is_coding_agent": false
        },
        {
          "oid": "d37ae1b9ec47ca2dd6617a00467a0faac7cc1355",
          "body": "…from the libxml version (Kocal)\n\nThis PR was merged into the 3.x branch.\n\nDiscussion\n----------\n\n[Toolkit] Make component rendering snapshots independent from the libxml version\n\n| Q              | A\n| -------------- | ---\n| Bug fix?       | no\n| New feature?   | no <!-- please update src/**/CHANGE\n[…]\nse I (and other people with recent libxml) were not able to regenerate Toolkit snapshots.\n\nCommits\n-------\n\n52fa673fcfd [Toolkit] Make component rendering snapshots independent from the libxml version",
          "is_bot": false,
          "headline": "minor #3693 [Toolkit] Make component rendering snapshots independent …",
          "author_name": "Hugo Alliaume",
          "author_login": "Kocal",
          "committed_at": "2026-07-05T06:57:35Z",
          "body_truncated": true,
          "is_coding_agent": false
        },
        {
          "oid": "52fa673fcfdeb3f94ab0e451118a3c3af75ea776",
          "body": "…xml version\n\nSince I changed how I installed PHP on my machine (from HomeBrew to Nix), it looks like `libxml` was updated and rendered snapshots by not converting \"weird symbols\" to HTML entities (e.g. `מאומת` stays `מאומת` instead of `&times;&#158;&times;&#144;&times;&#149;&times;&#158;&times;&ordf;`).\n\nI then challenged Claude to write a path to normalize things between my machine and the CI, otherwise I (and other people with recent libxml) were not able to regenerate Toolkit snapshots.",
          "is_bot": false,
          "headline": "[Toolkit] Make component rendering snapshots independent from the lib…",
          "author_name": "Hugo Alliaume",
          "author_login": "Kocal",
          "committed_at": "2026-07-05T06:49:49Z",
          "body_truncated": false,
          "is_coding_agent": false
        },
        {
          "oid": "aa3b3323944e70bbe9381f6959633b51e7097508",
          "body": "This PR was merged into the 3.x branch.\n\nDiscussion\n----------\n\n[Toolkit][Shadcn] Add Combobox\n\n| Q              | A\n| -------------- | ---\n| Bug fix?       | no\n| New feature?   | yes\n| Deprecations?  | no\n| Documentation? | no\n| Issues         | Part of https://github.com/symfony/ux/issues/3233\n| License        | MIT\n\nAdd Combobox component\n\nhttps://github.com/user-attachments/assets/e756b9f7-00e1-436c-aa7e-c8b616f363ff\n\nCommits\n-------\n\nfceec5f1448 [Shadcn] Add `combobox` recipe",
          "is_bot": false,
          "headline": "feature #3482 [Toolkit][Shadcn] Add Combobox (makraz)",
          "author_name": "Hugo Alliaume",
          "author_login": "Kocal",
          "committed_at": "2026-07-05T06:12:52Z",
          "body_truncated": false,
          "is_coding_agent": false
        },
        {
          "oid": "fceec5f14487119617dc7f66145f43565efe55b7",
          "body": null,
          "is_bot": false,
          "headline": "[Shadcn] Add `combobox` recipe",
          "author_name": "Hamza Makraz",
          "author_login": "makraz",
          "committed_at": "2026-07-05T06:03:04Z",
          "body_truncated": false,
          "is_coding_agent": false
        },
        {
          "oid": "41a0807514b9b0eff54302a023bbd26fc4f2e94b",
          "body": "…btrees",
          "is_bot": false,
          "headline": "[LiveComponent] Fix data-loading scanner ignoring data-live-ignore su…",
          "author_name": "Amoifr",
          "author_login": "Amoifr",
          "committed_at": "2026-06-25T16:47:40Z",
          "body_truncated": false,
          "is_coding_agent": false
        },
        {
          "oid": "721417c64bbc85022c56d1e3fb7f66874a38cef2",
          "body": null,
          "is_bot": false,
          "headline": "Update CHANGELOGs for 3.2.0",
          "author_name": "Fabien Potencier",
          "author_login": "fabpot",
          "committed_at": "2026-06-19T07:14:15Z",
          "body_truncated": false,
          "is_coding_agent": false
        },
        {
          "oid": "dcf035ec8c6cd2dec729950cd72a7b61ed52c19c",
          "body": "* ux-2.x:\n  [UX][Icons] Add missing changelog entry\n  [Icons] Sanitize SVG output and unify icon creation\n  [Toolkit] Harden recipe installer against path traversal",
          "is_bot": false,
          "headline": "Merge branch 'ux-2.x' into ux-3.x",
          "author_name": "Hugo Alliaume",
          "author_login": "Kocal",
          "committed_at": "2026-06-19T06:54:48Z",
          "body_truncated": false,
          "is_coding_agent": false
        },
        {
          "oid": "dfd2ce941ec3e92af36427685cfb4e900ea9244c",
          "body": null,
          "is_bot": false,
          "headline": "[UX][Icons] Add missing changelog entry",
          "author_name": "Hugo Alliaume",
          "author_login": "Kocal",
          "committed_at": "2026-06-19T06:52:36Z",
          "body_truncated": false,
          "is_coding_agent": false
        },
        {
          "oid": "3a4964ec3700f0af4e13f7bfbf8bb3174c3e79d1",
          "body": "…y icon creation (Kocal)\n\nThis PR was merged into the ux-2.x branch.",
          "is_bot": false,
          "headline": "security #cve-2026-55877 [Icons] Sanitize Iconify SVG output and unif…",
          "author_name": "Hugo Alliaume",
          "author_login": "Kocal",
          "committed_at": "2026-06-19T06:41:32Z",
          "body_truncated": false,
          "is_coding_agent": false
        },
        {
          "oid": "7b4ddf3764bf269a1b5fde5bf03c4bce568694e4",
          "body": "…th traversal (Kocal)\n\nThis PR was merged into the ux-2.x branch.",
          "is_bot": false,
          "headline": "security #cve-2026-55878 [Toolkit] Harden recipe installer against pa…",
          "author_name": "Hugo Alliaume",
          "author_login": "Kocal",
          "committed_at": "2026-06-19T06:40:29Z",
          "body_truncated": false,
          "is_coding_agent": false
        },
        {
          "oid": "cf07ac2bcd2edeb787e310abdf0bda9ad2bb451e",
          "body": "SVG from the Iconify API and from local SVG files was rendered as raw HTML\nwithout sanitization, allowing XSS.\n\nA new IconFactory unifies icon creation: fromBody() (Iconify) and fromFile()\n(local files, moved out of Icon::fromFile) share the same sanitization path.\nIcon becomes a pure value object. \n[…]\n an IconNotFoundException so\n\"ignore_not_found\" still works, and skips the offending icon in fetchIcons()\nbatches.\n\nNote: clear the icon cache after upgrading so already-cached icons are\nre-sanitized.",
          "is_bot": false,
          "headline": "[Icons] Sanitize SVG output and unify icon creation",
          "author_name": "Hugo Alliaume",
          "author_login": "Kocal",
          "committed_at": "2026-06-16T05:43:46Z",
          "body_truncated": true,
          "is_coding_agent": false
        },
        {
          "oid": "d9996ebeb5c92b11f1f84f7987dba2b8dd96473d",
          "body": "A recipe's `copy-files` map drives the source/destination of each copied\nfile. The only guard was `Path::isRelative()`, which returns true for\npaths like `../../../etc`, so `Path::join()` resolved the `..` segments\nand let a crafted kit read from or write to arbitrary locations outside\nthe recipe/ta\n[…]\n (the gate that also protects the source Finder) and\n`File`. As a last-line defense, the installer re-checks the fully resolved\npaths with `Path::isBasePath()` right before each filesystem read/write.",
          "is_bot": false,
          "headline": "[Toolkit] Harden recipe installer against path traversal",
          "author_name": "Hugo Alliaume",
          "author_login": "Kocal",
          "committed_at": "2026-06-16T04:43:23Z",
          "body_truncated": true,
          "is_coding_agent": false
        },
        {
          "oid": "b033596d894938b4e4756ca8cba763572dbea9b6",
          "body": "* 2.x:\n  Revert \"[CI] Add workflow to prepare NPM release\"\n  Bump npm packages to v2.36.1\n  [CI] Add workflow to prepare NPM release",
          "is_bot": false,
          "headline": "Merge branch '2.x' into 3.x",
          "author_name": "Hugo Alliaume",
          "author_login": "Kocal",
          "committed_at": "2026-06-15T22:23:16Z",
          "body_truncated": false,
          "is_coding_agent": false
        },
        {
          "oid": "35715a14ea69acda2979b16207e4769747c226f0",
          "body": "This PR was merged into the 2.x branch.\n\nDiscussion\n----------\n\n Bump npm packages to v2.36.1\n\nPrepared by the `Prepare NPM release` workflow.\n\nOnce merged, create and push the `v2.36.1` tag via the standard Symfony release process. The `release-on-npm.yaml` workflow then publishes via OIDC.\n\nCommits\n-------\n\n4266f1358d7 Bump npm packages to v2.36.1",
          "is_bot": false,
          "headline": "minor #3683  Bump npm packages to v2.36.1 (github-actions[bot])",
          "author_name": "Hugo Alliaume",
          "author_login": "Kocal",
          "committed_at": "2026-06-15T22:21:39Z",
          "body_truncated": false,
          "is_coding_agent": false
        },
        {
          "oid": "109cd644ac6e107d8630c8f7cf0a1a0f0f6a8af1",
          "body": "This reverts commit 8a78621321b40401a07f7e73f234bee8553cf114.",
          "is_bot": false,
          "headline": "Revert \"[CI] Add workflow to prepare NPM release\"",
          "author_name": "Hugo Alliaume",
          "author_login": "Kocal",
          "committed_at": "2026-06-15T22:19:11Z",
          "body_truncated": false,
          "is_coding_agent": false
        },
        {
          "oid": "4266f1358d78bd37e8f0c13a7eb79d0b2ff95936",
          "body": null,
          "is_bot": true,
          "headline": "Bump npm packages to v2.36.1",
          "author_name": "github-actions[bot]",
          "author_login": "github-actions[bot]",
          "committed_at": "2026-06-15T22:17:30Z",
          "body_truncated": false,
          "is_coding_agent": false
        },
        {
          "oid": "8a78621321b40401a07f7e73f234bee8553cf114",
          "body": null,
          "is_bot": false,
          "headline": "[CI] Add workflow to prepare NPM release",
          "author_name": "Hugo Alliaume",
          "author_login": "Kocal",
          "committed_at": "2026-06-15T22:15:17Z",
          "body_truncated": false,
          "is_coding_agent": false
        },
        {
          "oid": "08eeb19ebba378b9f22ee3ed358df98970ba462f",
          "body": "…oltip` recipe (Kocal)\n\nThis PR was merged into the 3.x branch.\n\nDiscussion\n----------\n\n[Toolkit][Shadcn] Fix position and phantom text-node in `tooltip` recipe\n\n| Q              | A\n| -------------- | ---\n| Bug fix?       | yes\n| New feature?   | no <!-- please update src/**/CHANGELOG.md files -->\n\n[…]\n implementing `tooltip` recipe in UX website (https://github.com/symfony/ux.symfony.com/pull/149)\n\nCommits\n-------\n\na9188dea114 [Toolkit][Shadcn] Fix position and phantom text-node in `tooltip` recipe",
          "is_bot": false,
          "headline": "bug #3682 [Toolkit][Shadcn] Fix position and phantom text-node in `to…",
          "author_name": "Hugo Alliaume",
          "author_login": "Kocal",
          "committed_at": "2026-06-14T17:42:52Z",
          "body_truncated": true,
          "is_coding_agent": false
        },
        {
          "oid": "a9188dea1145a09724e71ad9287739c7f6fbb0e6",
          "body": "Noticed while implementing `tooltip` recipe in UX website",
          "is_bot": false,
          "headline": "[Toolkit][Shadcn] Fix position and phantom text-node in `tooltip` recipe",
          "author_name": "Hugo Alliaume",
          "author_login": "Kocal",
          "committed_at": "2026-06-14T08:51:27Z",
          "body_truncated": false,
          "is_coding_agent": false
        },
        {
          "oid": "36130e5a47dbaad19e3cd60e181d4f3ba9cb1bf0",
          "body": "…updates (dependabot[bot])\n\nThis PR was merged into the 3.x branch.\n\nDiscussion\n----------\n\n Bump the github-actions group across 1 directory with 2 updates\n\nBumps the github-actions group with 2 updates in the / directory: [ramsey/composer-install](https://github.com/ramsey/composer-install) and [a\n[…]\ncondition>` will remove the ignore condition of the specified dependency and ignore conditions\n\n</details>\n\nCommits\n-------\n\n6e263d76b4a Bump the github-actions group across 1 directory with 2 updates",
          "is_bot": false,
          "headline": "minor #3681  Bump the github-actions group across 1 directory with 2 …",
          "author_name": "Hugo Alliaume",
          "author_login": "Kocal",
          "committed_at": "2026-06-13T21:37:10Z",
          "body_truncated": true,
          "is_coding_agent": false
        },
        {
          "oid": "6e263d76b4ac42a5701e514a0557c3921ebe5592",
          "body": "Bumps the github-actions group with 2 updates in the / directory: [ramsey/composer-install](https://github.com/ramsey/composer-install) and [actions/setup-node](https://github.com/actions/setup-node).\n\n\nUpdates `ramsey/composer-install` from 5c2bcf28d7b060ef3c601d7b476d5430a7b46c27 to 26d8a556604053\n[…]\n\n  dependency-version: 6.4.0\n  dependency-type: direct:production\n  update-type: version-update:semver-minor\n  dependency-group: github-actions\n...\n\nSigned-off-by: dependabot[bot] <support@github.com>",
          "is_bot": true,
          "headline": "Bump the github-actions group across 1 directory with 2 updates",
          "author_name": "dependabot[bot]",
          "author_login": "dependabot[bot]",
          "committed_at": "2026-06-13T12:33:50Z",
          "body_truncated": true,
          "is_coding_agent": false
        },
        {
          "oid": "5a70caf530481939a34ab8974a03f0e16d8d4de0",
          "body": "…container (guillaume-sainthillier)\n\nThis PR was merged into the 3.x branch.\n\nDiscussion\n----------\n\n[TwigComponent] Allow standalone usage with any PSR-11 container\n\n| Q              | A\n| -------------- | ---\n| Bug fix?       | no\n| New feature?   | yes\n| Deprecations?  | no\n| Documentation? | no\n\n[…]\nContainerInterface\n    $propertyAccessor,\n    $eventDispatcher,\n    $config,\n    $classMap,\n    $twig,\n);\n\nCommits\n-------\n\n81802443a34 [TwigComponent] Allow standalone usage with any PSR-11 container",
          "is_bot": false,
          "headline": "feature #3602 [TwigComponent] Allow standalone usage with any PSR-11 …",
          "author_name": "Hugo Alliaume",
          "author_login": "Kocal",
          "committed_at": "2026-06-11T20:45:21Z",
          "body_truncated": true,
          "is_coding_agent": false
        },
        {
          "oid": "81802443a34603f46587a13d886d14b0255cbfc3",
          "body": null,
          "is_bot": false,
          "headline": "[TwigComponent] Allow standalone usage with any PSR-11 container",
          "author_name": "Guillaume Sainthillier",
          "author_login": "guillaume-sainthillier",
          "committed_at": "2026-06-11T20:32:06Z",
          "body_truncated": false,
          "is_coding_agent": false
        },
        {
          "oid": "e48c3952428d05248172359cabd398d3bb42e080",
          "body": "This PR was merged into the 3.x branch.\n\nDiscussion\n----------\n\n[CalendarLink] Fix rendering issue\n\n| Q              | A\n| -------------- | ---\n| Bug fix?       | no\n| New feature?   | no\n| Deprecations?  | no\n| Documentation? | yes\n| Issues         |\n| License        | MIT\n\nIn documentation, - in r\n[…]\n\"image\" src=\"https://github.com/user-attachments/assets/1631e773-bb61-460b-b0e1-a470b362e631\" />\n\nMinor fix to wrap it as code for rendering\n\nCommits\n-------\n\n3819b6e2f21 [CalendarLink][Documentation]",
          "is_bot": false,
          "headline": "minor #3677 [CalendarLink] Fix rendering issue (MrYamous)",
          "author_name": "Hugo Alliaume",
          "author_login": "Kocal",
          "committed_at": "2026-06-11T20:18:56Z",
          "body_truncated": true,
          "is_coding_agent": false
        },
        {
          "oid": "3819b6e2f21096f72812e51c90ed3e2e11a3a280",
          "body": null,
          "is_bot": false,
          "headline": "[CalendarLink][Documentation]",
          "author_name": "Matthieu Lempereur",
          "author_login": "MrYamous",
          "committed_at": "2026-06-11T18:39:20Z",
          "body_truncated": false,
          "is_coding_agent": false
        },
        {
          "oid": "0a4503f285f17c48e36a7e09dc33090826a57a56",
          "body": null,
          "is_bot": false,
          "headline": "[LiveComponent] Avoid 500 errors on malformed hydration payloads",
          "author_name": "Pascal CESCON - Amoifr",
          "author_login": "Amoifr",
          "committed_at": "2026-06-11T12:34:13Z",
          "body_truncated": false,
          "is_coding_agent": false
        },
        {
          "oid": "d7912e6318da931f01c61d7f5e7e764769dfd8d2",
          "body": "… upstream publish\" (Kocal)\n\nThis PR was merged into the 3.x branch.\n\nDiscussion\n----------\n\n Revert \"[Encore] Pin vue to <3.5.36 to workaround broken upstream publish\"\n\nReverts symfony/ux#3673, https://github.com/vuejs/core/issues/14952#issuecomment-4677482782 should have fixed the issue.\n\nCommits\n-------\n\ne8056f854f0 Revert \"[Encore] Pin vue to <3.5.36 to workaround broken upstream publish\"",
          "is_bot": false,
          "headline": "minor #3675  Revert \"[Encore] Pin vue to <3.5.36 to workaround broken…",
          "author_name": "Hugo Alliaume",
          "author_login": "Kocal",
          "committed_at": "2026-06-11T05:43:38Z",
          "body_truncated": false,
          "is_coding_agent": false
        },
        {
          "oid": "e8056f854f003e10b44371f43e4d26fa78a5322a",
          "body": "…lish\"",
          "is_bot": false,
          "headline": "Revert \"[Encore] Pin vue to <3.5.36 to workaround broken upstream pub…",
          "author_name": "Hugo Alliaume",
          "author_login": "Kocal",
          "committed_at": "2026-06-11T05:42:22Z",
          "body_truncated": false,
          "is_coding_agent": false
        },
        {
          "oid": "bfcead6fd70dc4fb468775d4651606e09c76950d",
          "body": "This PR was merged into the 3.x branch.\n\nDiscussion\n----------\n\n Update pnpm to ^11.5\n\n| Q              | A\n| -------------- | ---\n| Bug fix?       | no\n| New feature?   | no <!-- please update src/**/CHANGELOG.md files -->\n| Deprecations?  | no <!-- if yes, also update UPGRADE-*.md and src/**/CHANG\n[…]\n.com/doc/current/contributing/code/conventions.html#writing-a-changelog-entry\n - Never break backward compatibility (see https://symfony.com/bc).\n-->\n\nCommits\n-------\n\n1133a1f26e4 Update pnpm to ^11.5",
          "is_bot": false,
          "headline": "minor #3674  Update pnpm to ^11.5 (Kocal)",
          "author_name": "Hugo Alliaume",
          "author_login": "Kocal",
          "committed_at": "2026-06-11T05:40:50Z",
          "body_truncated": true,
          "is_coding_agent": false
        },
        {
          "oid": "1133a1f26e4e5b4c8bf7a4db7cd911dc39530697",
          "body": null,
          "is_bot": false,
          "headline": "Update pnpm to ^11.5",
          "author_name": "Hugo Alliaume",
          "author_login": "Kocal",
          "committed_at": "2026-06-11T05:27:02Z",
          "body_truncated": false,
          "is_coding_agent": false
        },
        {
          "oid": "0cd3c6066f81a1a1a4563bccf85ba91d022cad5f",
          "body": "…ublish (Kocal)\n\nThis PR was merged into the 3.x branch.\n\nDiscussion\n----------\n\n[Encore] Pin vue to <3.5.36 to workaround broken upstream publish\n\n| Q              | A\n| -------------- | ---\n| Bug fix?       | yes\n| New feature?   | no <!-- please update src/**/CHANGELOG.md files -->\n| Deprecations\n[…]\nour Encore (based on npm) jobs fail.\n\nTo revert when https://github.com/vuejs/core/issues/14952 is fixed\n\nCommits\n-------\n\n827eb6b0b6b [Encore] Pin vue to <3.5.36 to workaround broken upstream publish",
          "is_bot": false,
          "headline": "bug #3673 [Encore] Pin vue to <3.5.36 to workaround broken upstream p…",
          "author_name": "Hugo Alliaume",
          "author_login": "Kocal",
          "committed_at": "2026-06-11T04:48:48Z",
          "body_truncated": true,
          "is_coding_agent": false
        },
        {
          "oid": "827eb6b0b6be449718cbd0a41ff2f0c25343a506",
          "body": "vue@3.5.36 shipped ~1h ago, ships with `workspace:*` in constrain version, making our Encore (based on npm) jobs fail.\n\nTo revert when https://github.com/vuejs/core/issues/14952 is fixed",
          "is_bot": false,
          "headline": "[Encore] Pin vue to <3.5.36 to workaround broken upstream publish",
          "author_name": "Hugo Alliaume",
          "author_login": "Kocal",
          "committed_at": "2026-06-11T04:46:44Z",
          "body_truncated": false,
          "is_coding_agent": false
        },
        {
          "oid": "c3921cd203ad09d816aea94542d61bb06c646f80",
          "body": "This PR was merged into the 3.x branch.\n\nDiscussion\n----------\n\n[Toolkit][Flowbite4] Fix linting issues\n\n| Q              | A\n| -------------- | ---\n| Bug fix?       | yes\n| New feature?   | no <!-- please update src/**/CHANGELOG.md files -->\n| Deprecations?  | no <!-- if yes, also update UPGRADE-*.\n[…]\nntributing/code/conventions.html#writing-a-changelog-entry\n - Never break backward compatibility (see https://symfony.com/bc).\n-->\n\nCommits\n-------\n\n753650caea3 [Toolkit][Flowbite4] Fix linting issues",
          "is_bot": false,
          "headline": "bug #3672 [Toolkit][Flowbite4] Fix linting issues (Kocal)",
          "author_name": "Hugo Alliaume",
          "author_login": "Kocal",
          "committed_at": "2026-06-11T04:26:55Z",
          "body_truncated": true,
          "is_coding_agent": false
        },
        {
          "oid": "753650caea39ac56eb06a252e50d9808b3fc7216",
          "body": null,
          "is_bot": false,
          "headline": "[Toolkit][Flowbite4] Fix linting issues",
          "author_name": "Hugo Alliaume",
          "author_login": "Kocal",
          "committed_at": "2026-06-11T04:22:59Z",
          "body_truncated": false,
          "is_coding_agent": false
        },
        {
          "oid": "b97a9b13e992f04437605445d6a2225fc11794f5",
          "body": "…t manifest (Kocal)\n\nThis PR was merged into the 3.x branch.\n\nDiscussion\n----------\n\n[Toolkit] Allow declaring kit-global dependencies in kit manifest\n\n| Q              | A\n| -------------- | ---\n| Bug fix?       | no\n| New feature?   | yes <!-- please update src/**/CHANGELOG.md files -->\n| Deprecat\n[…]\nl npm/importmap packages as available for\nall recipes. Extract the shared parsing into DependencyParser.\n\nCommits\n-------\n\nb54bef6bdd1 [Toolkit] Allow declaring kit-global dependencies in kit manifest",
          "is_bot": false,
          "headline": "feature #3671 [Toolkit] Allow declaring kit-global dependencies in ki…",
          "author_name": "Hugo Alliaume",
          "author_login": "Kocal",
          "committed_at": "2026-06-11T04:19:22Z",
          "body_truncated": true,
          "is_coding_agent": false
        },
        {
          "oid": "b54bef6bdd11ec2114aa351f8556f371f3a83caf",
          "body": "The `JsImportChecker` only matched JS imports against per-recipe npm/importmap\ndependencies, so kit-global libraries (e.g. flowbite, installed once via the\nkit's ` INSTALL.md) were reported as `js.import.undeclared` on every recipe.\n\nAdd a `dependencies` object (composer/npm/importmap) to the kit manifest and\nhave JsImportChecker treat kit-level npm/importmap packages as available for\nall recipes. Extract the shared parsing into DependencyParser.",
          "is_bot": false,
          "headline": "[Toolkit] Allow declaring kit-global dependencies in kit manifest",
          "author_name": "Hugo Alliaume",
          "author_login": "Kocal",
          "committed_at": "2026-06-11T04:12:44Z",
          "body_truncated": false,
          "is_coding_agent": false
        },
        {
          "oid": "d013d926dbdb80fe577bfe09ae799055edeeec1f",
          "body": "This PR was merged into the 3.x branch.\n\nDiscussion\n----------\n\n[CalendarLink] Add E2E tests\n\n| Q              | A\n| -------------- | ---\n| Bug fix?       | no\n| New feature?   | no <!-- please update src/**/CHANGELOG.md files -->\n| Deprecations?  | no <!-- if yes, also update UPGRADE-*.md and src/*\n[…]\n/current/contributing/code/conventions.html#writing-a-changelog-entry\n - Never break backward compatibility (see https://symfony.com/bc).\n-->\n\nCommits\n-------\n\n8091fa867d4 [CalendarLink] Add E2E tests",
          "is_bot": false,
          "headline": "minor #3670 [CalendarLink] Add E2E tests (Kocal)",
          "author_name": "Hugo Alliaume",
          "author_login": "Kocal",
          "committed_at": "2026-06-11T03:42:44Z",
          "body_truncated": true,
          "is_coding_agent": false
        },
        {
          "oid": "8091fa867d479b3294c2f3120c84f10dd988d186",
          "body": null,
          "is_bot": false,
          "headline": "[CalendarLink] Add E2E tests",
          "author_name": "Hugo Alliaume",
          "author_login": "Kocal",
          "committed_at": "2026-06-10T21:21:21Z",
          "body_truncated": false,
          "is_coding_agent": false
        },
        {
          "oid": "4474e2fd7c1acd963492e22c24d57fe10d224780",
          "body": "…nd recurrence fields",
          "is_bot": false,
          "headline": "[Documentation] Update index.rst to correct formatting of reminders a…",
          "author_name": "Hugo Alliaume",
          "author_login": "Kocal",
          "committed_at": "2026-06-05T15:19:52Z",
          "body_truncated": false,
          "is_coding_agent": false
        }
      ],
      "releases_count": 62,
      "commits_last_year": 1040,
      "latest_release_at": "2026-07-14T16:28:47Z",
      "latest_release_tag": "v3.3.0",
      "releases_from_tags": false,
      "days_since_last_push": 0,
      "active_weeks_last_year": 52,
      "days_since_latest_release": 11,
      "mean_days_between_releases": 13.2
    },
    "community": {
      "has_readme": true,
      "has_license": true,
      "has_description": true,
      "has_contributing": true,
      "health_percentage": 87,
      "has_issue_template": false,
      "has_code_of_conduct": true,
      "has_pull_request_template": true
    },
    "ecosystem": {
      "packages": [
        {
          "name": "symfony/ux-map",
          "exists": true,
          "license": "MIT",
          "keywords": [
            "map",
            "maps",
            "markers",
            "symfony-ux"
          ],
          "ecosystem": "packagist",
          "matches_repo": true,
          "registry_url": "https://packagist.org/packages/symfony/ux-map",
          "is_deprecated": false,
          "latest_version": "v3.3.0",
          "repository_url": "https://github.com/symfony/ux-map",
          "versions_count": 32,
          "total_downloads": 254986,
          "dependents_count": 6,
          "deprecation_note": null,
          "maintainers_count": null,
          "monthly_downloads": 20203,
          "first_published_at": null,
          "latest_published_at": "2026-07-09T05:17:17Z",
          "latest_version_yanked": null,
          "days_since_latest_publish": 16
        },
        {
          "name": "symfony/ux-icons",
          "exists": true,
          "license": "MIT",
          "keywords": [
            "twig",
            "icons",
            "svg",
            "symfony-ux"
          ],
          "ecosystem": "packagist",
          "matches_repo": true,
          "registry_url": "https://packagist.org/packages/symfony/ux-icons",
          "is_deprecated": false,
          "latest_version": "v3.3.0",
          "repository_url": "https://github.com/symfony/ux-icons",
          "versions_count": 29,
          "total_downloads": 7729925,
          "dependents_count": 64,
          "deprecation_note": null,
          "maintainers_count": null,
          "monthly_downloads": 455073,
          "first_published_at": null,
          "latest_published_at": "2026-06-19T06:54:48Z",
          "latest_version_yanked": null,
          "days_since_latest_publish": 36
        },
        {
          "name": "symfony/ux-react",
          "exists": true,
          "license": "MIT",
          "keywords": [
            "symfony-ux"
          ],
          "ecosystem": "packagist",
          "matches_repo": true,
          "registry_url": "https://packagist.org/packages/symfony/ux-react",
          "is_deprecated": false,
          "latest_version": "v3.3.0",
          "repository_url": "https://github.com/symfony/ux-react",
          "versions_count": 54,
          "total_downloads": 1689899,
          "dependents_count": 2,
          "deprecation_note": null,
          "maintainers_count": null,
          "monthly_downloads": 61519,
          "first_published_at": null,
          "latest_published_at": "2026-07-09T05:17:17Z",
          "latest_version_yanked": null,
          "days_since_latest_publish": 16
        },
        {
          "name": "symfony/ux-turbo",
          "exists": true,
          "license": "MIT",
          "keywords": [
            "javascript",
            "turbo",
            "mercure",
            "symfony-ux",
            "hotwire",
            "turbo-stream"
          ],
          "ecosystem": "packagist",
          "matches_repo": true,
          "registry_url": "https://packagist.org/packages/symfony/ux-turbo",
          "is_deprecated": false,
          "latest_version": "v3.3.0",
          "repository_url": "https://github.com/symfony/ux-turbo",
          "versions_count": 61,
          "total_downloads": 8618506,
          "dependents_count": 64,
          "deprecation_note": null,
          "maintainers_count": null,
          "monthly_downloads": 455046,
          "first_published_at": null,
          "latest_published_at": "2026-07-09T05:17:17Z",
          "latest_version_yanked": null,
          "days_since_latest_publish": 16
        },
        {
          "name": "symfony/ux-native",
          "exists": true,
          "license": "MIT",
          "keywords": [
            "native",
            "symfony-ux",
            "hotwire"
          ],
          "ecosystem": "packagist",
          "matches_repo": true,
          "registry_url": "https://packagist.org/packages/symfony/ux-native",
          "is_deprecated": false,
          "latest_version": "v3.3.0",
          "repository_url": "https://github.com/symfony/ux-native",
          "versions_count": 8,
          "total_downloads": 11888,
          "dependents_count": 0,
          "deprecation_note": null,
          "maintainers_count": null,
          "monthly_downloads": 3984,
          "first_published_at": null,
          "latest_published_at": "2026-07-09T05:17:17Z",
          "latest_version_yanked": null,
          "days_since_latest_publish": 16
        },
        {
          "name": "symfony/ux-notify",
          "exists": true,
          "license": "MIT",
          "keywords": [
            "symfony-ux"
          ],
          "ecosystem": "packagist",
          "matches_repo": true,
          "registry_url": "https://packagist.org/packages/symfony/ux-notify",
          "is_deprecated": false,
          "latest_version": "v3.3.0",
          "repository_url": "https://github.com/symfony/ux-notify",
          "versions_count": 54,
          "total_downloads": 96538,
          "dependents_count": 0,
          "deprecation_note": null,
          "maintainers_count": null,
          "monthly_downloads": 5766,
          "first_published_at": null,
          "latest_published_at": "2026-07-09T05:17:17Z",
          "latest_version_yanked": null,
          "days_since_latest_publish": 16
        },
        {
          "name": "symfony/ux-chartjs",
          "exists": true,
          "license": "MIT",
          "keywords": [
            "symfony-ux"
          ],
          "ecosystem": "packagist",
          "matches_repo": true,
          "registry_url": "https://packagist.org/packages/symfony/ux-chartjs",
          "is_deprecated": false,
          "latest_version": "v3.3.0",
          "repository_url": "https://github.com/symfony/ux-chartjs",
          "versions_count": 63,
          "total_downloads": 3955161,
          "dependents_count": 20,
          "deprecation_note": null,
          "maintainers_count": null,
          "monthly_downloads": 177924,
          "first_published_at": null,
          "latest_published_at": "2026-07-09T05:17:17Z",
          "latest_version_yanked": null,
          "days_since_latest_publish": 16
        },
        {
          "name": "symfony/ux-toolkit",
          "exists": true,
          "license": "MIT",
          "keywords": [
            "twig",
            "ui",
            "components",
            "design-system",
            "symfony-ux"
          ],
          "ecosystem": "packagist",
          "matches_repo": true,
          "registry_url": "https://packagist.org/packages/symfony/ux-toolkit",
          "is_deprecated": false,
          "latest_version": "v3.3.0",
          "repository_url": "https://github.com/symfony/ux-toolkit",
          "versions_count": 10,
          "total_downloads": 157204,
          "dependents_count": 1,
          "deprecation_note": null,
          "maintainers_count": null,
          "monthly_downloads": 37025,
          "first_published_at": null,
          "latest_published_at": "2026-07-09T05:03:19Z",
          "latest_version_yanked": null,
          "days_since_latest_publish": 17
        }
      ]
    },
    "popularity": {
      "forks": 425,
      "stars": 1068,
      "watchers": 31,
      "fork_history": {
        "days": [
          {
            "date": "2020-12-04",
            "count": 1
          },
          {
            "date": "2020-12-05",
            "count": 3
          },
          {
            "date": "2020-12-07",
            "count": 1
          },
          {
            "date": "2020-12-10",
            "count": 1
          },
          {
            "date": "2020-12-29",
            "count": 1
          },
          {
            "date": "2021-01-05",
            "count": 1
          },
          {
            "date": "2021-01-23",
            "count": 1
          },
          {
            "date": "2021-02-02",
            "count": 1
          },
          {
            "date": "2021-02-20",
            "count": 1
          },
          {
            "date": "2021-03-02",
            "count": 2
          },
          {
            "date": "2021-03-08",
            "count": 1
          },
          {
            "date": "2021-03-18",
            "count": 1
          },
          {
            "date": "2021-03-23",
            "count": 1
          },
          {
            "date": "2021-03-31",
            "count": 1
          },
          {
            "date": "2021-04-05",
            "count": 2
          },
          {
            "date": "2021-04-07",
            "count": 1
          },
          {
            "date": "2021-04-09",
            "count": 1
          },
          {
            "date": "2021-04-14",
            "count": 1
          },
          {
            "date": "2021-05-03",
            "count": 1
          },
          {
            "date": "2021-05-05",
            "count": 1
          },
          {
            "date": "2021-05-07",
            "count": 1
          },
          {
            "date": "2021-06-16",
            "count": 1
          },
          {
            "date": "2021-06-18",
            "count": 1
          },
          {
            "date": "2021-06-19",
            "count": 2
          },
          {
            "date": "2021-06-22",
            "count": 1
          },
          {
            "date": "2021-06-30",
            "count": 1
          },
          {
            "date": "2021-07-02",
            "count": 1
          },
          {
            "date": "2021-07-05",
            "count": 1
          },
          {
            "date": "2021-07-06",
            "count": 1
          },
          {
            "date": "2021-07-08",
            "count": 1
          },
          {
            "date": "2021-07-13",
            "count": 1
          },
          {
            "date": "2021-11-20",
            "count": 1
          },
          {
            "date": "2021-11-28",
            "count": 1
          },
          {
            "date": "2021-11-29",
            "count": 1
          },
          {
            "date": "2021-12-08",
            "count": 1
          },
          {
            "date": "2021-12-12",
            "count": 1
          },
          {
            "date": "2021-12-15",
            "count": 1
          },
          {
            "date": "2021-12-27",
            "count": 1
          },
          {
            "date": "2022-01-11",
            "count": 1
          },
          {
            "date": "2022-01-12",
            "count": 1
          },
          {
            "date": "2022-01-14",
            "count": 1
          },
          {
            "date": "2022-01-21",
            "count": 1
          },
          {
            "date": "2022-01-23",
            "count": 1
          },
          {
            "date": "2022-01-24",
            "count": 1
          },
          {
            "date": "2022-01-28",
            "count": 1
          },
          {
            "date": "2022-02-09",
            "count": 1
          },
          {
            "date": "2022-03-03",
            "count": 1
          },
          {
            "date": "2022-03-22",
            "count": 1
          },
          {
            "date": "2022-04-23",
            "count": 1
          },
          {
            "date": "2022-05-22",
            "count": 1
          },
          {
            "date": "2022-05-25",
            "count": 1
          },
          {
            "date": "2022-05-29",
            "count": 1
          },
          {
            "date": "2022-06-16",
            "count": 1
          },
          {
            "date": "2022-06-17",
            "count": 1
          },
          {
            "date": "2022-06-18",
            "count": 1
          },
          {
            "date": "2022-06-21",
            "count": 1
          },
          {
            "date": "2022-06-22",
            "count": 1
          },
          {
            "date": "2022-06-29",
            "count": 1
          },
          {
            "date": "2022-06-30",
            "count": 1
          },
          {
            "date": "2022-07-04",
            "count": 2
          },
          {
            "date": "2022-07-05",
            "count": 1
          },
          {
            "date": "2022-07-27",
            "count": 1
          },
          {
            "date": "2022-08-11",
            "count": 1
          },
          {
            "date": "2022-08-27",
            "count": 1
          },
          {
            "date": "2022-09-06",
            "count": 1
          },
          {
            "date": "2022-09-11",
            "count": 1
          },
          {
            "date": "2022-09-12",
            "count": 1
          },
          {
            "date": "2022-09-21",
            "count": 1
          },
          {
            "date": "2022-09-22",
            "count": 1
          },
          {
            "date": "2022-09-24",
            "count": 1
          },
          {
            "date": "2022-09-29",
            "count": 1
          },
          {
            "date": "2022-10-06",
            "count": 1
          },
          {
            "date": "2022-10-09",
            "count": 2
          },
          {
            "date": "2022-10-17",
            "count": 1
          },
          {
            "date": "2022-10-28",
            "count": 1
          },
          {
            "date": "2022-11-07",
            "count": 1
          },
          {
            "date": "2022-11-12",
            "count": 1
          },
          {
            "date": "2022-11-15",
            "count": 1
          },
          {
            "date": "2022-11-18",
            "count": 1
          },
          {
            "date": "2022-11-26",
            "count": 1
          },
          {
            "date": "2022-11-28",
            "count": 1
          },
          {
            "date": "2022-12-04",
            "count": 1
          },
          {
            "date": "2022-12-08",
            "count": 1
          },
          {
            "date": "2022-12-14",
            "count": 1
          },
          {
            "date": "2022-12-15",
            "count": 1
          },
          {
            "date": "2022-12-17",
            "count": 1
          },
          {
            "date": "2022-12-22",
            "count": 1
          },
          {
            "date": "2022-12-26",
            "count": 1
          },
          {
            "date": "2023-01-03",
            "count": 1
          },
          {
            "date": "2023-01-20",
            "count": 1
          },
          {
            "date": "2023-01-26",
            "count": 1
          },
          {
            "date": "2023-02-01",
            "count": 1
          },
          {
            "date": "2023-02-09",
            "count": 1
          },
          {
            "date": "2023-02-20",
            "count": 2
          },
          {
            "date": "2023-02-23",
            "count": 1
          },
          {
            "date": "2023-02-27",
            "count": 1
          },
          {
            "date": "2023-03-01",
            "count": 1
          },
          {
            "date": "2023-03-05",
            "count": 2
          },
          {
            "date": "2023-03-06",
            "count": 1
          },
          {
            "date": "2023-03-15",
            "count": 2
          },
          {
            "date": "2023-03-19",
            "count": 1
          },
          {
            "date": "2023-03-21",
            "count": 1
          },
          {
            "date": "2023-04-11",
            "count": 1
          },
          {
            "date": "2023-04-12",
            "count": 1
          },
          {
            "date": "2023-04-17",
            "count": 1
          },
          {
            "date": "2023-04-19",
            "count": 1
          },
          {
            "date": "2023-05-08",
            "count": 2
          },
          {
            "date": "2023-05-11",
            "count": 1
          },
          {
            "date": "2023-05-15",
            "count": 1
          },
          {
            "date": "2023-05-25",
            "count": 1
          },
          {
            "date": "2023-06-06",
            "count": 2
          },
          {
            "date": "2023-06-08",
            "count": 1
          },
          {
            "date": "2023-06-12",
            "count": 1
          },
          {
            "date": "2023-06-19",
            "count": 1
          },
          {
            "date": "2023-06-20",
            "count": 1
          },
          {
            "date": "2023-06-21",
            "count": 1
          },
          {
            "date": "2023-06-27",
            "count": 2
          },
          {
            "date": "2023-06-30",
            "count": 1
          },
          {
            "date": "2023-07-01",
            "count": 1
          },
          {
            "date": "2023-07-04",
            "count": 1
          },
          {
            "date": "2023-07-09",
            "count": 1
          },
          {
            "date": "2023-07-10",
            "count": 1
          },
          {
            "date": "2023-07-11",
            "count": 1
          },
          {
            "date": "2023-07-20",
            "count": 2
          },
          {
            "date": "2023-07-23",
            "count": 1
          },
          {
            "date": "2023-07-24",
            "count": 1
          },
          {
            "date": "2023-07-25",
            "count": 1
          },
          {
            "date": "2023-07-26",
            "count": 1
          },
          {
            "date": "2023-08-04",
            "count": 1
          },
          {
            "date": "2023-08-07",
            "count": 1
          },
          {
            "date": "2023-08-21",
            "count": 1
          },
          {
            "date": "2023-08-23",
            "count": 1
          },
          {
            "date": "2023-08-24",
            "count": 1
          },
          {
            "date": "2023-08-29",
            "count": 1
          },
          {
            "date": "2023-08-30",
            "count": 1
          },
          {
            "date": "2023-09-01",
            "count": 1
          },
          {
            "date": "2023-09-07",
            "count": 1
          },
          {
            "date": "2023-09-20",
            "count": 1
          },
          {
            "date": "2023-09-22",
            "count": 2
          },
          {
            "date": "2023-09-23",
            "count": 1
          },
          {
            "date": "2023-09-26",
            "count": 3
          },
          {
            "date": "2023-09-27",
            "count": 1
          },
          {
            "date": "2023-10-03",
            "count": 1
          },
          {
            "date": "2023-10-05",
            "count": 1
          },
          {
            "date": "2023-10-08",
            "count": 1
          },
          {
            "date": "2023-10-10",
            "count": 1
          },
          {
            "date": "2023-10-13",
            "count": 1
          },
          {
            "date": "2023-10-16",
            "count": 2
          },
          {
            "date": "2023-10-17",
            "count": 1
          },
          {
            "date": "2023-10-21",
            "count": 1
          },
          {
            "date": "2023-11-01",
            "count": 1
          },
          {
            "date": "2023-11-02",
            "count": 1
          },
          {
            "date": "2023-11-05",
            "count": 1
          },
          {
            "date": "2023-11-08",
            "count": 1
          },
          {
            "date": "2023-11-10",
            "count": 2
          },
          {
            "date": "2023-11-12",
            "count": 1
          },
          {
            "date": "2023-11-13",
            "count": 1
          },
          {
            "date": "2023-11-15",
            "count": 1
          },
          {
            "date": "2023-11-16",
            "count": 1
          },
          {
            "date": "2023-11-23",
            "count": 1
          },
          {
            "date": "2023-11-24",
            "count": 1
          },
          {
            "date": "2023-11-28",
            "count": 2
          },
          {
            "date": "2023-11-29",
            "count": 1
          },
          {
            "date": "2023-12-02",
            "count": 1
          },
          {
            "date": "2023-12-11",
            "count": 1
          },
          {
            "date": "2023-12-21",
            "count": 1
          },
          {
            "date": "2023-12-24",
            "count": 1
          },
          {
            "date": "2024-01-01",
            "count": 1
          },
          {
            "date": "2024-01-30",
            "count": 1
          },
          {
            "date": "2024-02-01",
            "count": 1
          },
          {
            "date": "2024-02-07",
            "count": 1
          },
          {
            "date": "2024-02-09",
            "count": 1
          },
          {
            "date": "2024-02-17",
            "count": 2
          },
          {
            "date": "2024-02-19",
            "count": 1
          },
          {
            "date": "2024-02-22",
            "count": 1
          },
          {
            "date": "2024-02-23",
            "count": 1
          },
          {
            "date": "2024-03-01",
            "count": 1
          },
          {
            "date": "2024-03-05",
            "count": 1
          },
          {
            "date": "2024-03-10",
            "count": 1
          },
          {
            "date": "2024-03-14",
            "count": 1
          },
          {
            "date": "2024-03-24",
            "count": 1
          },
          {
            "date": "2024-03-25",
            "count": 1
          },
          {
            "date": "2024-03-28",
            "count": 1
          },
          {
            "date": "2024-04-04",
            "count": 1
          },
          {
            "date": "2024-04-06",
            "count": 1
          },
          {
            "date": "2024-04-07",
            "count": 1
          },
          {
            "date": "2024-04-09",
            "count": 2
          },
          {
            "date": "2024-04-10",
            "count": 2
          },
          {
            "date": "2024-04-11",
            "count": 1
          },
          {
            "date": "2024-04-15",
            "count": 1
          },
          {
            "date": "2024-04-17",
            "count": 2
          },
          {
            "date": "2024-04-24",
            "count": 3
          },
          {
            "date": "2024-04-28",
            "count": 1
          },
          {
            "date": "2024-04-29",
            "count": 1
          },
          {
            "date": "2024-04-30",
            "count": 1
          },
          {
            "date": "2024-05-03",
            "count": 1
          },
          {
            "date": "2024-05-05",
            "count": 1
          },
          {
            "date": "2024-05-06",
            "count": 2
          },
          {
            "date": "2024-05-09",
            "count": 2
          },
          {
            "date": "2024-05-17",
            "count": 1
          },
          {
            "date": "2024-05-19",
            "count": 1
          },
          {
            "date": "2024-05-20",
            "count": 1
          },
          {
            "date": "2024-05-23",
            "count": 1
          },
          {
            "date": "2024-05-29",
            "count": 1
          },
          {
            "date": "2024-06-03",
            "count": 1
          },
          {
            "date": "2024-06-16",
            "count": 1
          },
          {
            "date": "2024-06-19",
            "count": 1
          },
          {
            "date": "2024-06-28",
            "count": 1
          },
          {
            "date": "2024-07-04",
            "count": 1
          },
          {
            "date": "2024-07-05",
            "count": 1
          },
          {
            "date": "2024-07-08",
            "count": 1
          },
          {
            "date": "2024-07-10",
            "count": 1
          },
          {
            "date": "2024-07-15",
            "count": 1
          },
          {
            "date": "2024-07-17",
            "count": 1
          },
          {
            "date": "2024-07-20",
            "count": 1
          },
          {
            "date": "2024-07-24",
            "count": 1
          },
          {
            "date": "2024-07-25",
            "count": 1
          },
          {
            "date": "2024-07-26",
            "count": 1
          },
          {
            "date": "2024-08-01",
            "count": 2
          },
          {
            "date": "2024-08-07",
            "count": 1
          },
          {
            "date": "2024-08-08",
            "count": 1
          },
          {
            "date": "2024-08-10",
            "count": 1
          },
          {
            "date": "2024-08-12",
            "count": 1
          },
          {
            "date": "2024-08-18",
            "count": 1
          },
          {
            "date": "2024-08-20",
            "count": 1
          },
          {
            "date": "2024-08-24",
            "count": 1
          },
          {
            "date": "2024-08-28",
            "count": 1
          },
          {
            "date": "2024-08-31",
            "count": 1
          },
          {
            "date": "2024-09-02",
            "count": 1
          },
          {
            "date": "2024-09-03",
            "count": 1
          },
          {
            "date": "2024-09-11",
            "count": 3
          },
          {
            "date": "2024-09-19",
            "count": 1
          },
          {
            "date": "2024-09-23",
            "count": 1
          },
          {
            "date": "2024-09-27",
            "count": 1
          },
          {
            "date": "2024-10-02",
            "count": 1
          },
          {
            "date": "2024-10-04",
            "count": 2
          },
          {
            "date": "2024-10-11",
            "count": 2
          },
          {
            "date": "2024-10-15",
            "count": 1
          },
          {
            "date": "2024-10-17",
            "count": 3
          },
          {
            "date": "2024-10-18",
            "count": 1
          },
          {
            "date": "2024-10-19",
            "count": 1
          },
          {
            "date": "2024-10-23",
            "count": 1
          },
          {
            "date": "2024-10-25",
            "count": 1
          },
          {
            "date": "2024-11-02",
            "count": 2
          },
          {
            "date": "2024-11-03",
            "count": 1
          },
          {
            "date": "2024-11-04",
            "count": 2
          },
          {
            "date": "2024-11-14",
            "count": 1
          },
          {
            "date": "2024-11-20",
            "count": 1
          },
          {
            "date": "2024-12-02",
            "count": 1
          },
          {
            "date": "2024-12-05",
            "count": 1
          },
          {
            "date": "2024-12-06",
            "count": 1
          },
          {
            "date": "2024-12-07",
            "count": 2
          },
          {
            "date": "2024-12-17",
            "count": 1
          },
          {
            "date": "2024-12-18",
            "count": 2
          },
          {
            "date": "2024-12-30",
            "count": 3
          },
          {
            "date": "2025-01-01",
            "count": 1
          },
          {
            "date": "2025-01-06",
            "count": 1
          },
          {
            "date": "2025-01-10",
            "count": 1
          },
          {
            "date": "2025-01-17",
            "count": 1
          },
          {
            "date": "2025-01-19",
            "count": 2
          },
          {
            "date": "2025-01-22",
            "count": 1
          },
          {
            "date": "2025-01-25",
            "count": 1
          },
          {
            "date": "2025-01-28",
            "count": 1
          },
          {
            "date": "2025-01-31",
            "count": 2
          },
          {
            "date": "2025-02-02",
            "count": 1
          },
          {
            "date": "2025-02-20",
            "count": 1
          },
          {
            "date": "2025-02-25",
            "count": 1
          },
          {
            "date": "2025-02-27",
            "count": 1
          },
          {
            "date": "2025-02-28",
            "count": 1
          },
          {
            "date": "2025-03-03",
            "count": 1
          },
          {
            "date": "2025-03-06",
            "count": 2
          },
          {
            "date": "2025-03-13",
            "count": 1
          },
          {
            "date": "2025-03-24",
            "count": 1
          },
          {
            "date": "2025-03-25",
            "count": 1
          },
          {
            "date": "2025-03-26",
            "count": 1
          },
          {
            "date": "2025-03-28",
            "count": 1
          },
          {
            "date": "2025-03-29",
            "count": 1
          },
          {
            "date": "2025-04-01",
            "count": 1
          },
          {
            "date": "2025-04-07",
            "count": 1
          },
          {
            "date": "2025-04-10",
            "count": 3
          },
          {
            "date": "2025-04-15",
            "count": 1
          },
          {
            "date": "2025-04-21",
            "count": 1
          },
          {
            "date": "2025-04-29",
            "count": 1
          },
          {
            "date": "2025-05-05",
            "count": 1
          },
          {
            "date": "2025-05-08",
            "count": 1
          },
          {
            "date": "2025-05-22",
            "count": 1
          },
          {
            "date": "2025-05-23",
            "count": 1
          },
          {
            "date": "2025-05-29",
            "count": 1
          },
          {
            "date": "2025-05-31",
            "count": 1
          },
          {
            "date": "2025-06-02",
            "count": 1
          },
          {
            "date": "2025-06-04",
            "count": 1
          },
          {
            "date": "2025-06-12",
            "count": 3
          },
          {
            "date": "2025-06-30",
            "count": 1
          },
          {
            "date": "2025-07-02",
            "count": 1
          },
          {
            "date": "2025-07-03",
            "count": 1
          },
          {
            "date": "2025-07-11",
            "count": 1
          },
          {
            "date": "2025-07-18",
            "count": 1
          },
          {
            "date": "2025-07-23",
            "count": 1
          },
          {
            "date": "2025-07-28",
            "count": 1
          },
          {
            "date": "2025-07-29",
            "count": 1
          },
          {
            "date": "2025-08-05",
            "count": 1
          },
          {
            "date": "2025-08-07",
            "count": 1
          },
          {
            "date": "2025-08-10",
            "count": 1
          },
          {
            "date": "2025-08-16",
            "count": 1
          },
          {
            "date": "2025-08-20",
            "count": 1
          },
          {
            "date": "2025-08-22",
            "count": 2
          },
          {
            "date": "2025-08-24",
            "count": 1
          },
          {
            "date": "2025-08-26",
            "count": 1
          },
          {
            "date": "2025-09-02",
            "count": 1
          },
          {
            "date": "2025-09-05",
            "count": 2
          },
          {
            "date": "2025-09-24",
            "count": 1
          },
          {
            "date": "2025-10-08",
            "count": 1
          },
          {
            "date": "2025-10-17",
            "count": 3
          },
          {
            "date": "2025-10-19",
            "count": 1
          },
          {
            "date": "2025-11-02",
            "count": 1
          },
          {
            "date": "2025-11-05",
            "count": 2
          },
          {
            "date": "2025-11-07",
            "count": 1
          },
          {
            "date": "2025-11-10",
            "count": 1
          },
          {
            "date": "2025-11-11",
            "count": 2
          },
          {
            "date": "2025-11-14",
            "count": 1
          },
          {
            "date": "2025-11-22",
            "count": 1
          },
          {
            "date": "2025-11-23",
            "count": 1
          },
          {
            "date": "2025-11-28",
            "count": 1
          },
          {
            "date": "2025-11-29",
            "count": 2
          },
          {
            "date": "2025-12-12",
            "count": 2
          },
          {
            "date": "2026-01-02",
            "count": 1
          },
          {
            "date": "2026-01-09",
            "count": 1
          },
          {
            "date": "2026-01-11",
            "count": 1
          },
          {
            "date": "2026-01-19",
            "count": 1
          },
          {
            "date": "2026-01-31",
            "count": 1
          },
          {
            "date": "2026-02-11",
            "count": 1
          },
          {
            "date": "2026-02-12",
            "count": 1
          },
          {
            "date": "2026-02-20",
            "count": 3
          },
          {
            "date": "2026-02-24",
            "count": 1
          },
          {
            "date": "2026-03-02",
            "count": 1
          },
          {
            "date": "2026-03-09",
            "count": 1
          },
          {
            "date": "2026-03-12",
            "count": 1
          },
          {
            "date": "2026-03-14",
            "count": 1
          },
          {
            "date": "2026-03-16",
            "count": 1
          },
          {
            "date": "2026-03-19",
            "count": 2
          },
          {
            "date": "2026-03-20",
            "count": 1
          },
          {
            "date": "2026-03-26",
            "count": 1
          },
          {
            "date": "2026-04-07",
            "count": 2
          },
          {
            "date": "2026-04-17",
            "count": 1
          },
          {
            "date": "2026-04-26",
            "count": 2
          },
          {
            "date": "2026-05-01",
            "count": 1
          },
          {
            "date": "2026-05-06",
            "count": 1
          },
          {
            "date": "2026-05-09",
            "count": 1
          },
          {
            "date": "2026-05-18",
            "count": 1
          },
          {
            "date": "2026-05-20",
            "count": 1
          },
          {
            "date": "2026-05-22",
            "count": 1
          },
          {
            "date": "2026-05-26",
            "count": 1
          },
          {
            "date": "2026-05-27",
            "count": 1
          },
          {
            "date": "2026-05-31",
            "count": 1
          },
          {
            "date": "2026-06-11",
            "count": 2
          },
          {
            "date": "2026-06-19",
            "count": 1
          },
          {
            "date": "2026-06-29",
            "count": 1
          },
          {
            "date": "2026-07-01",
            "count": 1
          },
          {
            "date": "2026-07-09",
            "count": 1
          },
          {
            "date": "2026-07-17",
            "count": 1
          },
          {
            "date": "2026-07-25",
            "count": 1
          }
        ],
        "complete": true,
        "collected": 423,
        "total_forks": 425
      },
      "star_history": null,
      "open_issues_and_prs": 154
    },
    "ai_readiness": {
      "has_nix": false,
      "example_dirs": [],
      "has_llms_txt": false,
      "has_dockerfile": true,
      "has_mcp_signal": false,
      "bootstrap_files": [],
      "api_schema_files": [],
      "has_devcontainer": false,
      "typecheck_configs": [
        "src/Autocomplete/assets/tsconfig.json",
        "src/Chartjs/assets/tsconfig.json",
        "src/Cropperjs/assets/tsconfig.json",
        "src/Dropzone/assets/tsconfig.json",
        "src/LiveComponent/assets/tsconfig.json",
        "src/Map/assets/tsconfig.json",
        "src/Map/src/Bridge/Google/assets/tsconfig.json",
        "src/Map/src/Bridge/Leaflet/assets/tsconfig.json",
        "src/Notify/assets/tsconfig.json",
        "src/React/assets/tsconfig.json",
        "src/StimulusBundle/assets/tsconfig.json",
        "src/Translator/assets/tsconfig.json",
        "src/Turbo/assets/tsconfig.json",
        "src/Vue/assets/tsconfig.json",
        "tsconfig.json"
      ],
      "toolchain_manifests": [],
      "largest_source_bytes": 100720,
      "source_files_sampled": 1243,
      "oversized_source_files": 1,
      "agent_instruction_files": [
        "AGENTS.md",
        "CLAUDE.md"
      ],
      "agent_instruction_max_bytes": 5223
    },
    "dependencies": {
      "manifests": [
        "composer.json",
        "package.json"
      ],
      "advisories": {
        "error": null,
        "scope": "repository_graph",
        "source": "osv",
        "findings": [
          {
            "name": "basic-ftp",
            "direct": false,
            "version": "5.2.0",
            "severity": "high",
            "ecosystem": "npm",
            "cvss_score": 8.6,
            "advisory_ids": [
              "GHSA-6v7q-wjvx-w8wg",
              "GHSA-chqc-8p9q-pq6q",
              "GHSA-rp42-5vxx-qpwr",
              "GHSA-rpmf-866q-6p89"
            ],
            "fixed_version": "5.3.1",
            "advisory_count": 4,
            "oldest_advisory_days": 108
          },
          {
            "name": "brace-expansion",
            "direct": false,
            "version": "1.1.12",
            "severity": "high",
            "ecosystem": "npm",
            "cvss_score": 7.5,
            "advisory_ids": [
              "GHSA-3jxr-9vmj-r5cp",
              "GHSA-f886-m6hf-6m8v",
              "GHSA-mh99-v99m-4gvg"
            ],
            "fixed_version": "5.0.8",
            "advisory_count": 3,
            "oldest_advisory_days": 121
          },
          {
            "name": "form-data",
            "direct": false,
            "version": "4.0.4",
            "severity": "high",
            "ecosystem": "npm",
            "cvss_score": 7.5,
            "advisory_ids": [
              "GHSA-hmw2-7cc7-3qxx"
            ],
            "fixed_version": "4.0.6",
            "advisory_count": 1,
            "oldest_advisory_days": 40
          },
          {
            "name": "minimatch",
            "direct": false,
            "version": "3.1.2",
            "severity": "high",
            "ecosystem": "npm",
            "cvss_score": 7.5,
            "advisory_ids": [
              "GHSA-23c5-xmqv-rm74",
              "GHSA-3ppc-4f35-3m26",
              "GHSA-7r86-cg39-jmmj"
            ],
            "fixed_version": "10.2.3",
            "advisory_count": 3,
            "oldest_advisory_days": 157
          },
          {
            "name": "picomatch",
            "direct": false,
            "version": "2.3.1",
            "severity": "high",
            "ecosystem": "npm",
            "cvss_score": 7.5,
            "advisory_ids": [
              "GHSA-3v7f-55p6-f55p",
              "GHSA-c2c7-rcm5-vvqj"
            ],
            "fixed_version": "4.0.4",
            "advisory_count": 2,
            "oldest_advisory_days": 122
          },
          {
            "name": "picomatch",
            "direct": false,
            "version": "4.0.3",
            "severity": "high",
            "ecosystem": "npm",
            "cvss_score": 7.5,
            "advisory_ids": [
              "GHSA-3v7f-55p6-f55p",
              "GHSA-c2c7-rcm5-vvqj"
            ],
            "fixed_version": "4.0.4",
            "advisory_count": 2,
            "oldest_advisory_days": 122
          },
          {
            "name": "postcss",
            "direct": false,
            "version": "8.5.6",
            "severity": "high",
            "ecosystem": "npm",
            "cvss_score": 7.5,
            "advisory_ids": [
              "GHSA-6g55-p6wh-862q",
              "GHSA-qx2v-qp2m-jg93",
              "GHSA-r28c-9q8g-f849"
            ],
            "fixed_version": "8.5.18",
            "advisory_count": 3,
            "oldest_advisory_days": 92
          },
          {
            "name": "vite",
            "direct": false,
            "version": "7.3.1",
            "severity": "high",
            "ecosystem": "npm",
            "cvss_score": 7.5,
            "advisory_ids": [
              "GHSA-4w7w-66w2-5vf9",
              "GHSA-fx2h-pf6j-xcff",
              "GHSA-p9ff-h696-f583",
              "GHSA-v2wj-q39q-566r",
              "GHSA-v6wh-96g9-6wx3"
            ],
            "fixed_version": "8.0.16",
            "advisory_count": 5,
            "oldest_advisory_days": 110
          },
          {
            "name": "ws",
            "direct": false,
            "version": "8.18.3",
            "severity": "high",
            "ecosystem": "npm",
            "cvss_score": 7.5,
            "advisory_ids": [
              "GHSA-58qx-3vcg-4xpx",
              "GHSA-96hv-2xvq-fx4p"
            ],
            "fixed_version": "8.21.0",
            "advisory_count": 2,
            "oldest_advisory_days": 68
          },
          {
            "name": "@hotwired/turbo",
            "direct": false,
            "version": "8.0.13",
            "severity": "moderate",
            "ecosystem": "npm",
            "cvss_score": 4.8,
            "advisory_ids": [
              "GHSA-qppm-g56g-fpvp"
            ],
            "fixed_version": "8.0.21",
            "advisory_count": 1,
            "oldest_advisory_days": 186
          },
          {
            "name": "ip-address",
            "direct": false,
            "version": "10.1.0",
            "severity": "moderate",
            "ecosystem": "npm",
            "cvss_score": null,
            "advisory_ids": [
              "GHSA-v2v4-37r5-5v8g"
            ],
            "fixed_version": "10.1.1",
            "advisory_count": 1,
            "oldest_advisory_days": 81
          },
          {
            "name": "@babel/core",
            "direct": false,
            "version": "7.28.0",
            "severity": "low",
            "ecosystem": "npm",
            "cvss_score": 3.2,
            "advisory_ids": [
              "GHSA-4x5r-pxfx-6jf8"
            ],
            "fixed_version": "8.0.0-rc.6",
            "advisory_count": 1,
            "oldest_advisory_days": 40
          },
          {
            "name": "@babel/core",
            "direct": false,
            "version": "7.28.3",
            "severity": "low",
            "ecosystem": "npm",
            "cvss_score": 3.2,
            "advisory_ids": [
              "GHSA-4x5r-pxfx-6jf8"
            ],
            "fixed_version": "8.0.0-rc.6",
            "advisory_count": 1,
            "oldest_advisory_days": 40
          },
          {
            "name": "esbuild",
            "direct": false,
            "version": "0.27.3",
            "severity": "low",
            "ecosystem": "npm",
            "cvss_score": 2.5,
            "advisory_ids": [
              "GHSA-g7r4-m6w7-qqqr"
            ],
            "fixed_version": "0.28.1",
            "advisory_count": 1,
            "oldest_advisory_days": 43
          }
        ],
        "collected": true,
        "malicious": [],
        "truncated": false,
        "by_severity": {
          "low": 3,
          "high": 9,
          "moderate": 2
        },
        "advisory_count": 30,
        "affected_count": 14,
        "assessed_count": 606,
        "malicious_count": 0,
        "assessed_package": null,
        "unassessed_count": 145,
        "direct_affected_count": 0
      },
      "ecosystems": [
        "npm",
        "packagist"
      ],
      "dependencies": [
        {
          "name": "symfony/asset",
          "manifest": "apps/demo-native/composer.json",
          "ecosystem": "packagist",
          "version_constraint": "8.0.*"
        },
        {
          "name": "symfony/asset-mapper",
          "manifest": "apps/demo-native/composer.json",
          "ecosystem": "packagist",
          "version_constraint": "8.0.*"
        },
        {
          "name": "symfony/console",
          "manifest": "apps/demo-native/composer.json",
          "ecosystem": "packagist",
          "version_constraint": "8.0.*"
        },
        {
          "name": "symfony/dotenv",
          "manifest": "apps/demo-native/composer.json",
          "ecosystem": "packagist",
          "version_constraint": "8.0.*"
        },
        {
          "name": "symfony/flex",
          "manifest": "apps/demo-native/composer.json",
          "ecosystem": "packagist",
          "version_constraint": "^2.10"
        },
        {
          "name": "symfony/framework-bundle",
          "manifest": "apps/demo-native/composer.json",
          "ecosystem": "packagist",
          "version_constraint": "8.0.*"
        },
        {
          "name": "symfony/runtime",
          "manifest": "apps/demo-native/composer.json",
          "ecosystem": "packagist",
          "version_constraint": "8.0.*"
        },
        {
          "name": "symfony/stimulus-bundle",
          "manifest": "apps/demo-native/composer.json",
          "ecosystem": "packagist",
          "version_constraint": "3.x-dev"
        },
        {
          "name": "symfony/twig-bundle",
          "manifest": "apps/demo-native/composer.json",
          "ecosystem": "packagist",
          "version_constraint": "8.0.*"
        },
        {
          "name": "symfony/ux-native",
          "manifest": "apps/demo-native/composer.json",
          "ecosystem": "packagist",
          "version_constraint": "3.x-dev"
        },
        {
          "name": "symfony/ux-turbo",
          "manifest": "apps/demo-native/composer.json",
          "ecosystem": "packagist",
          "version_constraint": "3.x-dev"
        },
        {
          "name": "symfony/yaml",
          "manifest": "apps/demo-native/composer.json",
          "ecosystem": "packagist",
          "version_constraint": "8.0.*"
        },
        {
          "name": "twig/extra-bundle",
          "manifest": "apps/demo-native/composer.json",
          "ecosystem": "packagist",
          "version_constraint": "^3.24"
        },
        {
          "name": "twig/string-extra",
          "manifest": "apps/demo-native/composer.json",
          "ecosystem": "packagist",
          "version_constraint": "^3.24"
        },
        {
          "name": "twig/twig",
          "manifest": "apps/demo-native/composer.json",
          "ecosystem": "packagist",
          "version_constraint": "^3.24"
        },
        {
          "name": "doctrine/dbal",
          "manifest": "apps/e2e/composer.json",
          "ecosystem": "packagist",
          "version_constraint": "^3.10.1|^4.4.3"
        },
        {
          "name": "doctrine/doctrine-bundle",
          "manifest": "apps/e2e/composer.json",
          "ecosystem": "packagist",
          "version_constraint": "^2.15.1|^3.2.2"
        },
        {
          "name": "doctrine/orm",
          "manifest": "apps/e2e/composer.json",
          "ecosystem": "packagist",
          "version_constraint": "^3.5.2"
        },
        {
          "name": "symfony/asset",
          "manifest": "apps/e2e/composer.json",
          "ecosystem": "packagist",
          "version_constraint": "7.4.*|8.1.*"
        },
        {
          "name": "symfony/asset-mapper",
          "manifest": "apps/e2e/composer.json",
          "ecosystem": "packagist",
          "version_constraint": "7.4.*|8.1.*"
        },
        {
          "name": "symfony/console",
          "manifest": "apps/e2e/composer.json",
          "ecosystem": "packagist",
          "version_constraint": "7.4.*|8.1.*"
        },
        {
          "name": "symfony/dotenv",
          "manifest": "apps/e2e/composer.json",
          "ecosystem": "packagist",
          "version_constraint": "7.4.*|8.1.*"
        },
        {
          "name": "symfony/expression-language",
          "manifest": "apps/e2e/composer.json",
          "ecosystem": "packagist",
          "version_constraint": "7.4.*|8.1.*"
        },
        {
          "name": "symfony/flex",
          "manifest": "apps/e2e/composer.json",
          "ecosystem": "packagist",
          "version_constraint": "^2.8.1"
        },
        {
          "name": "symfony/form",
          "manifest": "apps/e2e/composer.json",
          "ecosystem": "packagist",
          "version_constraint": "7.4.*|8.1.*"
        },
        {
          "name": "symfony/framework-bundle",
          "manifest": "apps/e2e/composer.json",
          "ecosystem": "packagist",
          "version_constraint": "7.4.*|8.1.*"
        },
        {
          "name": "symfony/http-client",
          "manifest": "apps/e2e/composer.json",
          "ecosystem": "packagist",
          "version_constraint": "7.4.*|8.1.*"
        },
        {
          "name": "symfony/intl",
          "manifest": "apps/e2e/composer.json",
          "ecosystem": "packagist",
          "version_constraint": "7.4.*|8.1.*"
        },
        {
          "name": "symfony/monolog-bundle",
          "manifest": "apps/e2e/composer.json",
          "ecosystem": "packagist",
          "version_constraint": "^3.10|^4.0"
        },
        {
          "name": "symfony/property-access",
          "manifest": "apps/e2e/composer.json",
          "ecosystem": "packagist",
          "version_constraint": "7.4.*|8.1.*"
        },
        {
          "name": "symfony/property-info",
          "manifest": "apps/e2e/composer.json",
          "ecosystem": "packagist",
          "version_constraint": "7.4.*|8.1.*"
        },
        {
          "name": "symfony/runtime",
          "manifest": "apps/e2e/composer.json",
          "ecosystem": "packagist",
          "version_constraint": "7.4.*|8.1.*"
        },
        {
          "name": "symfony/serializer",
          "manifest": "apps/e2e/composer.json",
          "ecosystem": "packagist",
          "version_constraint": "7.4.*|8.1.*"
        },
        {
          "name": "symfony/stimulus-bundle",
          "manifest": "apps/e2e/composer.json",
          "ecosystem": "packagist",
          "version_constraint": "3.x-dev"
        },
        {
          "name": "symfony/twig-bundle",
          "manifest": "apps/e2e/composer.json",
          "ecosystem": "packagist",
          "version_constraint": "7.4.*|8.1.*"
        },
        {
          "name": "symfony/ux-autocomplete",
          "manifest": "apps/e2e/composer.json",
          "ecosystem": "packagist",
          "version_constraint": "3.x-dev"
        },
        {
          "name": "symfony/ux-calendar-link",
          "manifest": "apps/e2e/composer.json",
          "ecosystem": "packagist",
          "version_constraint": "3.x-dev"
        },
        {
          "name": "symfony/ux-chartjs",
          "manifest": "apps/e2e/composer.json",
          "ecosystem": "packagist",
          "version_constraint": "3.x-dev"
        },
        {
          "name": "symfony/ux-cropperjs",
          "manifest": "apps/e2e/composer.json",
          "ecosystem": "packagist",
          "version_constraint": "3.x-dev"
        },
        {
          "name": "symfony/ux-dropzone",
          "manifest": "apps/e2e/composer.json",
          "ecosystem": "packagist",
          "version_constraint": "3.x-dev"
        },
        {
          "name": "symfony/ux-google-map",
          "manifest": "apps/e2e/composer.json",
          "ecosystem": "packagist",
          "version_constraint": "3.x-dev"
        },
        {
          "name": "symfony/ux-icons",
          "manifest": "apps/e2e/composer.json",
          "ecosystem": "packagist",
          "version_constraint": "3.x-dev"
        },
        {
          "name": "symfony/ux-leaflet-map",
          "manifest": "apps/e2e/composer.json",
          "ecosystem": "packagist",
          "version_constraint": "3.x-dev"
        },
        {
          "name": "symfony/ux-live-component",
          "manifest": "apps/e2e/composer.json",
          "ecosystem": "packagist",
          "version_constraint": "3.x-dev"
        },
        {
          "name": "symfony/ux-map",
          "manifest": "apps/e2e/composer.json",
          "ecosystem": "packagist",
          "version_constraint": "3.x-dev"
        },
        {
          "name": "symfony/ux-native",
          "manifest": "apps/e2e/composer.json",
          "ecosystem": "packagist",
          "version_constraint": "3.x-dev"
        },
        {
          "name": "symfony/ux-notify",
          "manifest": "apps/e2e/composer.json",
          "ecosystem": "packagist",
          "version_constraint": "3.x-dev"
        },
        {
          "name": "symfony/ux-react",
          "manifest": "apps/e2e/composer.json",
          "ecosystem": "packagist",
          "version_constraint": "3.x-dev"
        },
        {
          "name": "symfony/ux-translator",
          "manifest": "apps/e2e/composer.json",
          "ecosystem": "packagist",
          "version_constraint": "3.x-dev"
        },
        {
          "name": "symfony/ux-turbo",
          "manifest": "apps/e2e/composer.json",
          "ecosystem": "packagist",
          "version_constraint": "3.x-dev"
        },
        {
          "name": "symfony/ux-twig-component",
          "manifest": "apps/e2e/composer.json",
          "ecosystem": "packagist",
          "version_constraint": "3.x-dev"
        },
        {
          "name": "symfony/ux-vue",
          "manifest": "apps/e2e/composer.json",
          "ecosystem": "packagist",
          "version_constraint": "3.x-dev"
        },
        {
          "name": "symfony/yaml",
          "manifest": "apps/e2e/composer.json",
          "ecosystem": "packagist",
          "version_constraint": "7.4.*|8.1.*"
        },
        {
          "name": "symfonycasts/dynamic-forms",
          "manifest": "apps/e2e/composer.json",
          "ecosystem": "packagist",
          "version_constraint": "^0.2"
        },
        {
          "name": "twig/extra-bundle",
          "manifest": "apps/e2e/composer.json",
          "ecosystem": "packagist",
          "version_constraint": "^3.21"
        },
        {
          "name": "twig/twig",
          "manifest": "apps/e2e/composer.json",
          "ecosystem": "packagist",
          "version_constraint": "^3.21.1"
        },
        {
          "name": "zenstruck/foundry",
          "manifest": "apps/e2e/composer.json",
          "ecosystem": "packagist",
          "version_constraint": "^2.8"
        },
        {
          "name": "symfony/console",
          "manifest": "apps/encore/composer.json",
          "ecosystem": "packagist",
          "version_constraint": "7.4.*"
        },
        {
          "name": "symfony/dotenv",
          "manifest": "apps/encore/composer.json",
          "ecosystem": "packagist",
          "version_constraint": "7.4.*"
        },
        {
          "name": "symfony/flex",
          "manifest": "apps/encore/composer.json",
          "ecosystem": "packagist",
          "version_constraint": "^2.10"
        },
        {
          "name": "symfony/framework-bundle",
          "manifest": "apps/encore/composer.json",
          "ecosystem": "packagist",
          "version_constraint": "7.4.*"
        },
        {
          "name": "symfony/runtime",
          "manifest": "apps/encore/composer.json",
          "ecosystem": "packagist",
          "version_constraint": "7.4.*"
        },
        {
          "name": "symfony/stimulus-bundle",
          "manifest": "apps/encore/composer.json",
          "ecosystem": "packagist",
          "version_constraint": "3.x-dev"
        },
        {
          "name": "symfony/ux-autocomplete",
          "manifest": "apps/encore/composer.json",
          "ecosystem": "packagist",
          "version_constraint": "3.x-dev"
        },
        {
          "name": "symfony/ux-chartjs",
          "manifest": "apps/encore/composer.json",
          "ecosystem": "packagist",
          "version_constraint": "3.x-dev"
        },
        {
          "name": "symfony/ux-cropperjs",
          "manifest": "apps/encore/composer.json",
          "ecosystem": "packagist",
          "version_constraint": "3.x-dev"
        },
        {
          "name": "symfony/ux-dropzone",
          "manifest": "apps/encore/composer.json",
          "ecosystem": "packagist",
          "version_constraint": "3.x-dev"
        },
        {
          "name": "symfony/ux-google-map",
          "manifest": "apps/encore/composer.json",
          "ecosystem": "packagist",
          "version_constraint": "3.x-dev"
        },
        {
          "name": "symfony/ux-icons",
          "manifest": "apps/encore/composer.json",
          "ecosystem": "packagist",
          "version_constraint": "3.x-dev"
        },
        {
          "name": "symfony/ux-leaflet-map",
          "manifest": "apps/encore/composer.json",
          "ecosystem": "packagist",
          "version_constraint": "3.x-dev"
        },
        {
          "name": "symfony/ux-live-component",
          "manifest": "apps/encore/composer.json",
          "ecosystem": "packagist",
          "version_constraint": "3.x-dev"
        },
        {
          "name": "symfony/ux-map",
          "manifest": "apps/encore/composer.json",
          "ecosystem": "packagist",
          "version_constraint": "3.x-dev"
        },
        {
          "name": "symfony/ux-native",
          "manifest": "apps/encore/composer.json",
          "ecosystem": "packagist",
          "version_constraint": "3.x-dev"
        },
        {
          "name": "symfony/ux-notify",
          "manifest": "apps/encore/composer.json",
          "ecosystem": "packagist",
          "version_constraint": "3.x-dev"
        },
        {
          "name": "symfony/ux-react",
          "manifest": "apps/encore/composer.json",
          "ecosystem": "packagist",
          "version_constraint": "3.x-dev"
        },
        {
          "name": "symfony/ux-translator",
          "manifest": "apps/encore/composer.json",
          "ecosystem": "packagist",
          "version_constraint": "3.x-dev"
        },
        {
          "name": "symfony/ux-turbo",
          "manifest": "apps/encore/composer.json",
          "ecosystem": "packagist",
          "version_constraint": "3.x-dev"
        },
        {
          "name": "symfony/ux-twig-component",
          "manifest": "apps/encore/composer.json",
          "ecosystem": "packagist",
          "version_constraint": "3.x-dev"
        },
        {
          "name": "symfony/ux-vue",
          "manifest": "apps/encore/composer.json",
          "ecosystem": "packagist",
          "version_constraint": "3.x-dev"
        },
        {
          "name": "symfony/webpack-encore-bundle",
          "manifest": "apps/encore/composer.json",
          "ecosystem": "packagist",
          "version_constraint": "^2.4"
        },
        {
          "name": "symfony/yaml",
          "manifest": "apps/encore/composer.json",
          "ecosystem": "packagist",
          "version_constraint": "7.4.*"
        },
        {
          "name": "symfony/dependency-injection",
          "manifest": "src/Autocomplete/composer.json",
          "ecosystem": "packagist",
          "version_constraint": "^7.4|^8.0"
        },
        {
          "name": "symfony/deprecation-contracts",
          "manifest": "src/Autocomplete/composer.json",
          "ecosystem": "packagist",
          "version_constraint": "^2.5|^3"
        },
        {
          "name": "symfony/http-foundation",
          "manifest": "src/Autocomplete/composer.json",
          "ecosystem": "packagist",
          "version_constraint": "^7.4|^8.0"
        },
        {
          "name": "symfony/http-kernel",
          "manifest": "src/Autocomplete/composer.json",
          "ecosystem": "packagist",
          "version_constraint": "^7.4|^8.0"
        },
        {
          "name": "symfony/property-access",
          "manifest": "src/Autocomplete/composer.json",
          "ecosystem": "packagist",
          "version_constraint": "^7.4|^8.0"
        },
        {
          "name": "symfony/framework-bundle",
          "manifest": "src/CalendarLink/composer.json",
          "ecosystem": "packagist",
          "version_constraint": "^7.4|^8.0"
        },
        {
          "name": "symfony/twig-bundle",
          "manifest": "src/CalendarLink/composer.json",
          "ecosystem": "packagist",
          "version_constraint": "^7.4|^8.0"
        },
        {
          "name": "symfony/uid",
          "manifest": "src/CalendarLink/composer.json",
          "ecosystem": "packagist",
          "version_constraint": "^7.4|^8.0"
        },
        {
          "name": "symfony/config",
          "manifest": "src/Chartjs/composer.json",
          "ecosystem": "packagist",
          "version_constraint": "^7.4|^8.0"
        },
        {
          "name": "symfony/dependency-injection",
          "manifest": "src/Chartjs/composer.json",
          "ecosystem": "packagist",
          "version_constraint": "^7.4|^8.0"
        },
        {
          "name": "symfony/http-kernel",
          "manifest": "src/Chartjs/composer.json",
          "ecosystem": "packagist",
          "version_constraint": "^7.4|^8.0"
        },
        {
          "name": "symfony/stimulus-bundle",
          "manifest": "src/Chartjs/composer.json",
          "ecosystem": "packagist",
          "version_constraint": "^2.9.1|^3.0"
        },
        {
          "name": "intervention/image",
          "manifest": "src/Cropperjs/composer.json",
          "ecosystem": "packagist",
          "version_constraint": "^2.5"
        },
        {
          "name": "symfony/config",
          "manifest": "src/Cropperjs/composer.json",
          "ecosystem": "packagist",
          "version_constraint": "^7.4|^8.0"
        },
        {
          "name": "symfony/dependency-injection",
          "manifest": "src/Cropperjs/composer.json",
          "ecosystem": "packagist",
          "version_constraint": "^7.4|^8.0"
        },
        {
          "name": "symfony/deprecation-contracts",
          "manifest": "src/Cropperjs/composer.json",
          "ecosystem": "packagist",
          "version_constraint": "^2.5|^3"
        },
        {
          "name": "symfony/form",
          "manifest": "src/Cropperjs/composer.json",
          "ecosystem": "packagist",
          "version_constraint": "^7.4|^8.0"
        },
        {
          "name": "symfony/http-kernel",
          "manifest": "src/Cropperjs/composer.json",
          "ecosystem": "packagist",
          "version_constraint": "^7.4|^8.0"
        },
        {
          "name": "symfony/options-resolver",
          "manifest": "src/Cropperjs/composer.json",
          "ecosystem": "packagist",
          "version_constraint": "^7.4|^8.0"
        },
        {
          "name": "symfony/validator",
          "manifest": "src/Cropperjs/composer.json",
          "ecosystem": "packagist",
          "version_constraint": "^7.4|^8.0"
        },
        {
          "name": "symfony/config",
          "manifest": "src/Dropzone/composer.json",
          "ecosystem": "packagist",
          "version_constraint": "^7.4|^8.0"
        },
        {
          "name": "symfony/dependency-injection",
          "manifest": "src/Dropzone/composer.json",
          "ecosystem": "packagist",
          "version_constraint": "^7.4|^8.0"
        },
        {
          "name": "symfony/form",
          "manifest": "src/Dropzone/composer.json",
          "ecosystem": "packagist",
          "version_constraint": "^7.4|^8.0"
        },
        {
          "name": "symfony/http-kernel",
          "manifest": "src/Dropzone/composer.json",
          "ecosystem": "packagist",
          "version_constraint": "^7.4|^8.0"
        },
        {
          "name": "symfony/options-resolver",
          "manifest": "src/Dropzone/composer.json",
          "ecosystem": "packagist",
          "version_constraint": "^7.4|^8.0"
        },
        {
          "name": "symfony/framework-bundle",
          "manifest": "src/Icons/composer.json",
          "ecosystem": "packagist",
          "version_constraint": "^7.4|^8.0"
        },
        {
          "name": "symfony/twig-bundle",
          "manifest": "src/Icons/composer.json",
          "ecosystem": "packagist",
          "version_constraint": "^7.4|^8.0"
        },
        {
          "name": "symfony/deprecation-contracts",
          "manifest": "src/LiveComponent/composer.json",
          "ecosystem": "packagist",
          "version_constraint": "^2.5|^3.0"
        },
        {
          "name": "symfony/property-access",
          "manifest": "src/LiveComponent/composer.json",
          "ecosystem": "packagist",
          "version_constraint": "^7.4|^8.0"
        },
        {
          "name": "symfony/property-info",
          "manifest": "src/LiveComponent/composer.json",
          "ecosystem": "packagist",
          "version_constraint": "^7.4|^8.0"
        },
        {
          "name": "symfony/type-info",
          "manifest": "src/LiveComponent/composer.json",
          "ecosystem": "packagist",
          "version_constraint": "^7.4|^8.0"
        },
        {
          "name": "symfony/stimulus-bundle",
          "manifest": "src/LiveComponent/composer.json",
          "ecosystem": "packagist",
          "version_constraint": "^2.9|^3.0"
        },
        {
          "name": "symfony/ux-twig-component",
          "manifest": "src/LiveComponent/composer.json",
          "ecosystem": "packagist",
          "version_constraint": "^2.33.0|^3.0"
        },
        {
          "name": "twig/twig",
          "manifest": "src/LiveComponent/composer.json",
          "ecosystem": "packagist",
          "version_constraint": "^3.10.3"
        },
        {
          "name": "symfony/stimulus-bundle",
          "manifest": "src/Map/composer.json",
          "ecosystem": "packagist",
          "version_constraint": "^2.18.1|^3.0"
        },
        {
          "name": "symfony/asset",
          "manifest": "src/Native/composer.json",
          "ecosystem": "packagist",
          "version_constraint": "^7.4|^8.0"
        },
        {
          "name": "symfony/filesystem",
          "manifest": "src/Native/composer.json",
          "ecosystem": "packagist",
          "version_constraint": "^7.4|^8.0"
        },
        {
          "name": "symfony/process",
          "manifest": "src/Native/composer.json",
          "ecosystem": "packagist",
          "version_constraint": "^7.4|^8.0"
        },
        {
          "name": "symfony/stimulus-bundle",
          "manifest": "src/Native/composer.json",
          "ecosystem": "packagist",
          "version_constraint": "^2.18.1|^3.0"
        },
        {
          "name": "symfony/ux-turbo",
          "manifest": "src/Native/composer.json",
          "ecosystem": "packagist",
          "version_constraint": "^2.18.1|^3.0"
        },
        {
          "name": "symfony/config",
          "manifest": "src/Notify/composer.json",
          "ecosystem": "packagist",
          "version_constraint": "^7.4|^8.0"
        },
        {
          "name": "symfony/dependency-injection",
          "manifest": "src/Notify/composer.json",
          "ecosystem": "packagist",
          "version_constraint": "^7.4|^8.0"
        },
        {
          "name": "symfony/http-kernel",
          "manifest": "src/Notify/composer.json",
          "ecosystem": "packagist",
          "version_constraint": "^7.4|^8.0"
        },
        {
          "name": "symfony/mercure-bundle",
          "manifest": "src/Notify/composer.json",
          "ecosystem": "packagist",
          "version_constraint": "^0.3.4|^0.4.1"
        },
        {
          "name": "symfony/mercure-notifier",
          "manifest": "src/Notify/composer.json",
          "ecosystem": "packagist",
          "version_constraint": "^7.4|^8.0"
        },
        {
          "name": "symfony/stimulus-bundle",
          "manifest": "src/Notify/composer.json",
          "ecosystem": "packagist",
          "version_constraint": "^2.9.1|^3.0"
        },
        {
          "name": "symfony/twig-bundle",
          "manifest": "src/Notify/composer.json",
          "ecosystem": "packagist",
          "version_constraint": "^7.4|^8.0"
        },
        {
          "name": "symfony/stimulus-bundle",
          "manifest": "src/React/composer.json",
          "ecosystem": "packagist",
          "version_constraint": "^2.9.1|^3.0"
        },
        {
          "name": "symfony/config",
          "manifest": "src/StimulusBundle/composer.json",
          "ecosystem": "packagist",
          "version_constraint": "^7.4|^8.0"
        },
        {
          "name": "symfony/dependency-injection",
          "manifest": "src/StimulusBundle/composer.json",
          "ecosystem": "packagist",
          "version_constraint": "^7.4|^8.0"
        },
        {
          "name": "symfony/finder",
          "manifest": "src/StimulusBundle/composer.json",
          "ecosystem": "packagist",
          "version_constraint": "^7.4|^8.0"
        },
        {
          "name": "symfony/http-kernel",
          "manifest": "src/StimulusBundle/composer.json",
          "ecosystem": "packagist",
          "version_constraint": "^7.4|^8.0"
        },
        {
          "name": "twig/twig",
          "manifest": "src/StimulusBundle/composer.json",
          "ecosystem": "packagist",
          "version_constraint": "^2.15.3|^3.8"
        },
        {
          "name": "symfony/deprecation-contracts",
          "manifest": "src/StimulusBundle/composer.json",
          "ecosystem": "packagist",
          "version_constraint": "^2.0|^3.0"
        },
        {
          "name": "twig/twig",
          "manifest": "src/Toolkit/composer.json",
          "ecosystem": "packagist",
          "version_constraint": "^3.0"
        },
        {
          "name": "symfony/console",
          "manifest": "src/Toolkit/composer.json",
          "ecosystem": "packagist",
          "version_constraint": "^7.4|^8.0"
        },
        {
          "name": "symfony/filesystem",
          "manifest": "src/Toolkit/composer.json",
          "ecosystem": "packagist",
          "version_constraint": "^7.4|^8.0"
        },
        {
          "name": "symfony/framework-bundle",
          "manifest": "src/Toolkit/composer.json",
          "ecosystem": "packagist",
          "version_constraint": "^7.4|^8.0"
        },
        {
          "name": "symfony/string",
          "manifest": "src/Toolkit/composer.json",
          "ecosystem": "packagist",
          "version_constraint": "^7.4|^8.0"
        },
        {
          "name": "symfony/twig-bundle",
          "manifest": "src/Toolkit/composer.json",
          "ecosystem": "packagist",
          "version_constraint": "^7.4|^8.0"
        },
        {
          "name": "symfony/ux-twig-component",
          "manifest": "src/Toolkit/composer.json",
          "ecosystem": "packagist",
          "version_constraint": "^3.1"
        },
        {
          "name": "symfony/yaml",
          "manifest": "src/Toolkit/composer.json",
          "ecosystem": "packagist",
          "version_constraint": "^7.4|^8.0"
        },
        {
          "name": "symfony/console",
          "manifest": "src/Translator/composer.json",
          "ecosystem": "packagist",
          "version_constraint": "^7.4|^8.0"
        },
        {
          "name": "symfony/filesystem",
          "manifest": "src/Translator/composer.json",
          "ecosystem": "packagist",
          "version_constraint": "^7.4|^8.0"
        },
        {
          "name": "symfony/string",
          "manifest": "src/Translator/composer.json",
          "ecosystem": "packagist",
          "version_constraint": "^7.4|^8.0"
        },
        {
          "name": "symfony/translation",
          "manifest": "src/Translator/composer.json",
          "ecosystem": "packagist",
          "version_constraint": "^7.4|^8.0"
        },
        {
          "name": "symfony/stimulus-bundle",
          "manifest": "src/Turbo/composer.json",
          "ecosystem": "packagist",
          "version_constraint": "^2.9.1|^3.0"
        },
        {
          "name": "psr/container",
          "manifest": "src/TwigComponent/composer.json",
          "ecosystem": "packagist",
          "version_constraint": "^1.1|^2.0"
        },
        {
          "name": "symfony/deprecation-contracts",
          "manifest": "src/TwigComponent/composer.json",
          "ecosystem": "packagist",
          "version_constraint": "^2.2|^3.0"
        },
        {
          "name": "symfony/event-dispatcher",
          "manifest": "src/TwigComponent/composer.json",
          "ecosystem": "packagist",
          "version_constraint": "^7.4|^8.0"
        },
        {
          "name": "symfony/property-access",
          "manifest": "src/TwigComponent/composer.json",
          "ecosystem": "packagist",
          "version_constraint": "^7.4|^8.0"
        },
        {
          "name": "twig/twig",
          "manifest": "src/TwigComponent/composer.json",
          "ecosystem": "packagist",
          "version_constraint": "^3.10.3"
        }
      ],
      "all_dependencies": {
        "error": null,
        "source": "github-sbom",
        "packages": [
          {
            "name": "doctrine/dbal",
            "direct": true,
            "version": null,
            "ecosystem": "packagist"
          },
          {
            "name": "doctrine/doctrine-bundle",
            "direct": true,
            "version": null,
            "ecosystem": "packagist"
          },
          {
            "name": "doctrine/orm",
            "direct": true,
            "version": null,
            "ecosystem": "packagist"
          },
          {
            "name": "intervention/image",
            "direct": true,
            "version": null,
            "ecosystem": "packagist"
          },
          {
            "name": "psr/container",
            "direct": true,
            "version": null,
            "ecosystem": "packagist"
          },
          {
            "name": "symfony/asset",
            "direct": true,
            "version": null,
            "ecosystem": "packagist"
          },
          {
            "name": "symfony/asset-mapper",
            "direct": true,
            "version": null,
            "ecosystem": "packagist"
          },
          {
            "name": "symfony/config",
            "direct": true,
            "version": null,
            "ecosystem": "packagist"
          },
          {
            "name": "symfony/console",
            "direct": true,
            "version": null,
            "ecosystem": "packagist"
          },
          {
            "name": "symfony/dependency-injection",
            "direct": true,
            "version": null,
            "ecosystem": "packagist"
          },
          {
            "name": "symfony/deprecation-contracts",
            "direct": true,
            "version": null,
            "ecosystem": "packagist"
          },
          {
            "name": "symfony/dotenv",
            "direct": true,
            "version": null,
            "ecosystem": "packagist"
          },
          {
            "name": "symfony/event-dispatcher",
            "direct": true,
            "version": null,
            "ecosystem": "packagist"
          },
          {
            "name": "symfony/expression-language",
            "direct": true,
            "version": null,
            "ecosystem": "packagist"
          },
          {
            "name": "symfony/filesystem",
            "direct": true,
            "version": null,
            "ecosystem": "packagist"
          },
          {
            "name": "symfony/finder",
            "direct": true,
            "version": null,
            "ecosystem": "packagist"
          },
          {
            "name": "symfony/flex",
            "direct": true,
            "version": null,
            "ecosystem": "packagist"
          },
          {
            "name": "symfony/form",
            "direct": true,
            "version": null,
            "ecosystem": "packagist"
          },
          {
            "name": "symfony/framework-bundle",
            "direct": true,
            "version": null,
            "ecosystem": "packagist"
          },
          {
            "name": "symfony/http-client",
            "direct": true,
            "version": null,
            "ecosystem": "packagist"
          },
          {
            "name": "symfony/http-foundation",
            "direct": true,
            "version": null,
            "ecosystem": "packagist"
          },
          {
            "name": "symfony/http-kernel",
            "direct": true,
            "version": null,
            "ecosystem": "packagist"
          },
          {
            "name": "symfony/intl",
            "direct": true,
            "version": null,
            "ecosystem": "packagist"
          },
          {
            "name": "symfony/mercure-bundle",
            "direct": true,
            "version": null,
            "ecosystem": "packagist"
          },
          {
            "name": "symfony/mercure-notifier",
            "direct": true,
            "version": null,
            "ecosystem": "packagist"
          },
          {
            "name": "symfony/monolog-bundle",
            "direct": true,
            "version": null,
            "ecosystem": "packagist"
          },
          {
            "name": "symfony/options-resolver",
            "direct": true,
            "version": null,
            "ecosystem": "packagist"
          },
          {
            "name": "symfony/process",
            "direct": true,
            "version": null,
            "ecosystem": "packagist"
          },
          {
            "name": "symfony/property-access",
            "direct": true,
            "version": null,
            "ecosystem": "packagist"
          },
          {
            "name": "symfony/property-info",
            "direct": true,
            "version": null,
            "ecosystem": "packagist"
          },
          {
            "name": "symfony/runtime",
            "direct": true,
            "version": null,
            "ecosystem": "packagist"
          },
          {
            "name": "symfony/serializer",
            "direct": true,
            "version": null,
            "ecosystem": "packagist"
          },
          {
            "name": "symfony/stimulus-bundle",
            "direct": true,
            "version": null,
            "ecosystem": "packagist"
          },
          {
            "name": "symfony/string",
            "direct": true,
            "version": null,
            "ecosystem": "packagist"
          },
          {
            "name": "symfony/translation",
            "direct": true,
            "version": null,
            "ecosystem": "packagist"
          },
          {
            "name": "symfony/twig-bundle",
            "direct": true,
            "version": null,
            "ecosystem": "packagist"
          },
          {
            "name": "symfony/type-info",
            "direct": true,
            "version": null,
            "ecosystem": "packagist"
          },
          {
            "name": "symfony/uid",
            "direct": true,
            "version": null,
            "ecosystem": "packagist"
          },
          {
            "name": "symfony/ux-autocomplete",
            "direct": true,
            "version": null,
            "ecosystem": "packagist"
          },
          {
            "name": "symfony/ux-calendar-link",
            "direct": true,
            "version": null,
            "ecosystem": "packagist"
          },
          {
            "name": "symfony/ux-chartjs",
            "direct": true,
            "version": null,
            "ecosystem": "packagist"
          },
          {
            "name": "symfony/ux-cropperjs",
            "direct": true,
            "version": null,
            "ecosystem": "packagist"
          },
          {
            "name": "symfony/ux-dropzone",
            "direct": true,
            "version": null,
            "ecosystem": "packagist"
          },
          {
            "name": "symfony/ux-google-map",
            "direct": true,
            "version": null,
            "ecosystem": "packagist"
          },
          {
            "name": "symfony/ux-icons",
            "direct": true,
            "version": null,
            "ecosystem": "packagist"
          },
          {
            "name": "symfony/ux-leaflet-map",
            "direct": true,
            "version": null,
            "ecosystem": "packagist"
          },
          {
            "name": "symfony/ux-live-component",
            "direct": true,
            "version": null,
            "ecosystem": "packagist"
          },
          {
            "name": "symfony/ux-map",
            "direct": true,
            "version": null,
            "ecosystem": "packagist"
          },
          {
            "name": "symfony/ux-native",
            "direct": true,
            "version": null,
            "ecosystem": "packagist"
          },
          {
            "name": "symfony/ux-notify",
            "direct": true,
            "version": null,
            "ecosystem": "packagist"
          },
          {
            "name": "symfony/ux-react",
            "direct": true,
            "version": null,
            "ecosystem": "packagist"
          },
          {
            "name": "symfony/ux-translator",
            "direct": true,
            "version": null,
            "ecosystem": "packagist"
          },
          {
            "name": "symfony/ux-turbo",
            "direct": true,
            "version": null,
            "ecosystem": "packagist"
          },
          {
            "name": "symfony/ux-twig-component",
            "direct": true,
            "version": null,
            "ecosystem": "packagist"
          },
          {
            "name": "symfony/ux-vue",
            "direct": true,
            "version": null,
            "ecosystem": "packagist"
          },
          {
            "name": "symfony/validator",
            "direct": true,
            "version": null,
            "ecosystem": "packagist"
          },
          {
            "name": "symfony/webpack-encore-bundle",
            "direct": true,
            "version": null,
            "ecosystem": "packagist"
          },
          {
            "name": "symfony/yaml",
            "direct": true,
            "version": null,
            "ecosystem": "packagist"
          },
          {
            "name": "symfonycasts/dynamic-forms",
            "direct": true,
            "version": null,
            "ecosystem": "packagist"
          },
          {
            "name": "twig/extra-bundle",
            "direct": true,
            "version": null,
            "ecosystem": "packagist"
          },
          {
            "name": "twig/string-extra",
            "direct": true,
            "version": null,
            "ecosystem": "packagist"
          },
          {
            "name": "twig/twig",
            "direct": true,
            "version": null,
            "ecosystem": "packagist"
          },
          {
            "name": "zenstruck/foundry",
            "direct": true,
            "version": null,
            "ecosystem": "packagist"
          },
          {
            "name": "@adobe/css-tools",
            "direct": false,
            "version": "4.4.3",
            "ecosystem": "npm"
          },
          {
            "name": "@adobe/css-tools",
            "direct": false,
            "version": "4.4.4",
            "ecosystem": "npm"
          },
          {
            "name": "@ampproject/remapping",
            "direct": false,
            "version": "2.3.0",
            "ecosystem": "npm"
          },
          {
            "name": "@asamuzakjp/css-color",
            "direct": false,
            "version": "3.2.0",
            "ecosystem": "npm"
          },
          {
            "name": "@babel/cli",
            "direct": false,
            "version": "7.28.3",
            "ecosystem": "npm"
          },
          {
            "name": "@babel/code-frame",
            "direct": false,
            "version": "7.27.1",
            "ecosystem": "npm"
          },
          {
            "name": "@babel/code-frame",
            "direct": false,
            "version": "7.29.0",
            "ecosystem": "npm"
          },
          {
            "name": "@babel/compat-data",
            "direct": false,
            "version": "7.28.0",
            "ecosystem": "npm"
          },
          {
            "name": "@babel/core",
            "direct": false,
            "version": "7.28.0",
            "ecosystem": "npm"
          },
          {
            "name": "@babel/core",
            "direct": false,
            "version": "7.28.3",
            "ecosystem": "npm"
          },
          {
            "name": "@babel/core",
            "direct": false,
            "version": "^7.17.0",
            "ecosystem": "npm"
          },
          {
            "name": "@babel/generator",
            "direct": false,
            "version": "7.28.0",
            "ecosystem": "npm"
          },
          {
            "name": "@babel/generator",
            "direct": false,
            "version": "7.28.3",
            "ecosystem": "npm"
          },
          {
            "name": "@babel/generator",
            "direct": false,
            "version": "8.0.0-rc.4",
            "ecosystem": "npm"
          },
          {
            "name": "@babel/helper-annotate-as-pure",
            "direct": false,
            "version": "7.27.3",
            "ecosystem": "npm"
          },
          {
            "name": "@babel/helper-compilation-targets",
            "direct": false,
            "version": "7.27.2",
            "ecosystem": "npm"
          },
          {
            "name": "@babel/helper-globals",
            "direct": false,
            "version": "7.28.0",
            "ecosystem": "npm"
          },
          {
            "name": "@babel/helper-module-imports",
            "direct": false,
            "version": "7.27.1",
            "ecosystem": "npm"
          },
          {
            "name": "@babel/helper-module-transforms",
            "direct": false,
            "version": "7.27.3",
            "ecosystem": "npm"
          },
          {
            "name": "@babel/helper-module-transforms",
            "direct": false,
            "version": "7.28.3",
            "ecosystem": "npm"
          },
          {
            "name": "@babel/helper-plugin-utils",
            "direct": false,
            "version": "7.27.1",
            "ecosystem": "npm"
          },
          {
            "name": "@babel/helper-string-parser",
            "direct": false,
            "version": "7.27.1",
            "ecosystem": "npm"
          },
          {
            "name": "@babel/helper-string-parser",
            "direct": false,
            "version": "8.0.0-rc.5",
            "ecosystem": "npm"
          },
          {
            "name": "@babel/helper-validator-identifier",
            "direct": false,
            "version": "7.27.1",
            "ecosystem": "npm"
          },
          {
            "name": "@babel/helper-validator-identifier",
            "direct": false,
            "version": "7.28.5",
            "ecosystem": "npm"
          },
          {
            "name": "@babel/helper-validator-identifier",
            "direct": false,
            "version": "8.0.0-rc.4",
            "ecosystem": "npm"
          },
          {
            "name": "@babel/helper-validator-identifier",
            "direct": false,
            "version": "8.0.0-rc.5",
            "ecosystem": "npm"
          },
          {
            "name": "@babel/helper-validator-option",
            "direct": false,
            "version": "7.27.1",
            "ecosystem": "npm"
          },
          {
            "name": "@babel/helpers",
            "direct": false,
            "version": "7.27.6",
            "ecosystem": "npm"
          },
          {
            "name": "@babel/helpers",
            "direct": false,
            "version": "7.28.3",
            "ecosystem": "npm"
          },
          {
            "name": "@babel/parser",
            "direct": false,
            "version": "7.28.0",
            "ecosystem": "npm"
          },
          {
            "name": "@babel/parser",
            "direct": false,
            "version": "7.28.3",
            "ecosystem": "npm"
          },
          {
            "name": "@babel/parser",
            "direct": false,
            "version": "8.0.0-rc.4",
            "ecosystem": "npm"
          },
          {
            "name": "@babel/plugin-syntax-jsx",
            "direct": false,
            "version": "7.27.1",
            "ecosystem": "npm"
          },
          {
            "name": "@babel/plugin-transform-react-display-name",
            "direct": false,
            "version": "7.28.0",
            "ecosystem": "npm"
          },
          {
            "name": "@babel/plugin-transform-react-jsx",
            "direct": false,
            "version": "7.27.1",
            "ecosystem": "npm"
          },
          {
            "name": "@babel/plugin-transform-react-jsx-development",
            "direct": false,
            "version": "7.27.1",
            "ecosystem": "npm"
          },
          {
            "name": "@babel/plugin-transform-react-jsx-self",
            "direct": false,
            "version": "7.27.1",
            "ecosystem": "npm"
          },
          {
            "name": "@babel/plugin-transform-react-jsx-source",
            "direct": false,
            "version": "7.27.1",
            "ecosystem": "npm"
          },
          {
            "name": "@babel/plugin-transform-react-pure-annotations",
            "direct": false,
            "version": "7.27.1",
            "ecosystem": "npm"
          },
          {
            "name": "@babel/preset-env",
            "direct": false,
            "version": "^7.16.0",
            "ecosystem": "npm"
          },
          {
            "name": "@babel/preset-react",
            "direct": false,
            "version": "7.27.1",
            "ecosystem": "npm"
          },
          {
            "name": "@babel/preset-react",
            "direct": false,
            "version": "^7.27.1",
            "ecosystem": "npm"
          },
          {
            "name": "@babel/runtime",
            "direct": false,
            "version": "7.27.6",
            "ecosystem": "npm"
          },
          {
            "name": "@babel/runtime",
            "direct": false,
            "version": "7.28.6",
            "ecosystem": "npm"
          },
          {
            "name": "@babel/template",
            "direct": false,
            "version": "7.27.2",
            "ecosystem": "npm"
          },
          {
            "name": "@babel/traverse",
            "direct": false,
            "version": "7.28.0",
            "ecosystem": "npm"
          },
          {
            "name": "@babel/traverse",
            "direct": false,
            "version": "7.28.3",
            "ecosystem": "npm"
          },
          {
            "name": "@babel/types",
            "direct": false,
            "version": "7.28.1",
            "ecosystem": "npm"
          },
          {
            "name": "@babel/types",
            "direct": false,
            "version": "7.28.2",
            "ecosystem": "npm"
          },
          {
            "name": "@babel/types",
            "direct": false,
            "version": "8.0.0-rc.5",
            "ecosystem": "npm"
          },
          {
            "name": "@bundled-es-modules/cookie",
            "direct": false,
            "version": "2.0.1",
            "ecosystem": "npm"
          },
          {
            "name": "@bundled-es-modules/statuses",
            "direct": false,
            "version": "1.0.1",
            "ecosystem": "npm"
          },
          {
            "name": "@bundled-es-modules/tough-cookie",
            "direct": false,
            "version": "0.1.6",
            "ecosystem": "npm"
          },
          {
            "name": "@csstools/color-helpers",
            "direct": false,
            "version": "5.0.2",
            "ecosystem": "npm"
          },
          {
            "name": "@csstools/css-calc",
            "direct": false,
            "version": "2.1.4",
            "ecosystem": "npm"
          },
          {
            "name": "@csstools/css-color-parser",
            "direct": false,
            "version": "3.0.10",
            "ecosystem": "npm"
          },
          {
            "name": "@csstools/css-parser-algorithms",
            "direct": false,
            "version": "3.0.5",
            "ecosystem": "npm"
          },
          {
            "name": "@csstools/css-tokenizer",
            "direct": false,
            "version": "3.0.4",
            "ecosystem": "npm"
          },
          {
            "name": "@emnapi/core",
            "direct": false,
            "version": "1.10.0",
            "ecosystem": "npm"
          },
          {
            "name": "@emnapi/runtime",
            "direct": false,
            "version": "1.10.0",
            "ecosystem": "npm"
          },
          {
            "name": "@emnapi/wasi-threads",
            "direct": false,
            "version": "1.2.1",
            "ecosystem": "npm"
          },
          {
            "name": "@esbuild/aix-ppc64",
            "direct": false,
            "version": "0.25.8",
            "ecosystem": "npm"
          },
          {
            "name": "@esbuild/aix-ppc64",
            "direct": false,
            "version": "0.27.3",
            "ecosystem": "npm"
          },
          {
            "name": "@esbuild/android-arm",
            "direct": false,
            "version": "0.25.8",
            "ecosystem": "npm"
          },
          {
            "name": "@esbuild/android-arm",
            "direct": false,
            "version": "0.27.3",
            "ecosystem": "npm"
          },
          {
            "name": "@esbuild/android-arm64",
            "direct": false,
            "version": "0.25.8",
            "ecosystem": "npm"
          },
          {
            "name": "@esbuild/android-arm64",
            "direct": false,
            "version": "0.27.3",
            "ecosystem": "npm"
          },
          {
            "name": "@esbuild/android-x64",
            "direct": false,
            "version": "0.25.8",
            "ecosystem": "npm"
          },
          {
            "name": "@esbuild/android-x64",
            "direct": false,
            "version": "0.27.3",
            "ecosystem": "npm"
          },
          {
            "name": "@esbuild/darwin-arm64",
            "direct": false,
            "version": "0.25.8",
            "ecosystem": "npm"
          },
          {
            "name": "@esbuild/darwin-arm64",
            "direct": false,
            "version": "0.27.3",
            "ecosystem": "npm"
          },
          {
            "name": "@esbuild/darwin-x64",
            "direct": false,
            "version": "0.25.8",
            "ecosystem": "npm"
          },
          {
            "name": "@esbuild/darwin-x64",
            "direct": false,
            "version": "0.27.3",
            "ecosystem": "npm"
          },
          {
            "name": "@esbuild/freebsd-arm64",
            "direct": false,
            "version": "0.25.8",
            "ecosystem": "npm"
          },
          {
            "name": "@esbuild/freebsd-arm64",
            "direct": false,
            "version": "0.27.3",
            "ecosystem": "npm"
          },
          {
            "name": "@esbuild/freebsd-x64",
            "direct": false,
            "version": "0.25.8",
            "ecosystem": "npm"
          },
          {
            "name": "@esbuild/freebsd-x64",
            "direct": false,
            "version": "0.27.3",
            "ecosystem": "npm"
          },
          {
            "name": "@esbuild/linux-arm",
            "direct": false,
            "version": "0.25.8",
            "ecosystem": "npm"
          },
          {
            "name": "@esbuild/linux-arm",
            "direct": false,
            "version": "0.27.3",
            "ecosystem": "npm"
          },
          {
            "name": "@esbuild/linux-arm64",
            "direct": false,
            "version": "0.25.8",
            "ecosystem": "npm"
          },
          {
            "name": "@esbuild/linux-arm64",
            "direct": false,
            "version": "0.27.3",
            "ecosystem": "npm"
          },
          {
            "name": "@esbuild/linux-ia32",
            "direct": false,
            "version": "0.25.8",
            "ecosystem": "npm"
          },
          {
            "name": "@esbuild/linux-ia32",
            "direct": false,
            "version": "0.27.3",
            "ecosystem": "npm"
          },
          {
            "name": "@esbuild/linux-loong64",
            "direct": false,
            "version": "0.25.8",
            "ecosystem": "npm"
          },
          {
            "name": "@esbuild/linux-loong64",
            "direct": false,
            "version": "0.27.3",
            "ecosystem": "npm"
          },
          {
            "name": "@esbuild/linux-mips64el",
            "direct": false,
            "version": "0.25.8",
            "ecosystem": "npm"
          },
          {
            "name": "@esbuild/linux-mips64el",
            "direct": false,
            "version": "0.27.3",
            "ecosystem": "npm"
          },
          {
            "name": "@esbuild/linux-ppc64",
            "direct": false,
            "version": "0.25.8",
            "ecosystem": "npm"
          },
          {
            "name": "@esbuild/linux-ppc64",
            "direct": false,
            "version": "0.27.3",
            "ecosystem": "npm"
          },
          {
            "name": "@esbuild/linux-riscv64",
            "direct": false,
            "version": "0.25.8",
            "ecosystem": "npm"
          },
          {
            "name": "@esbuild/linux-riscv64",
            "direct": false,
            "version": "0.27.3",
            "ecosystem": "npm"
          },
          {
            "name": "@esbuild/linux-s390x",
            "direct": false,
            "version": "0.25.8",
            "ecosystem": "npm"
          },
          {
            "name": "@esbuild/linux-s390x",
            "direct": false,
            "version": "0.27.3",
            "ecosystem": "npm"
          },
          {
            "name": "@esbuild/linux-x64",
            "direct": false,
            "version": "0.25.8",
            "ecosystem": "npm"
          },
          {
            "name": "@esbuild/linux-x64",
            "direct": false,
            "version": "0.27.3",
            "ecosystem": "npm"
          },
          {
            "name": "@esbuild/netbsd-arm64",
            "direct": false,
            "version": "0.25.8",
            "ecosystem": "npm"
          },
          {
            "name": "@esbuild/netbsd-arm64",
            "direct": false,
            "version": "0.27.3",
            "ecosystem": "npm"
          },
          {
            "name": "@esbuild/netbsd-x64",
            "direct": false,
            "version": "0.25.8",
            "ecosystem": "npm"
          },
          {
            "name": "@esbuild/netbsd-x64",
            "direct": false,
            "version": "0.27.3",
            "ecosystem": "npm"
          },
          {
            "name": "@esbuild/openbsd-arm64",
            "direct": false,
            "version": "0.25.8",
            "ecosystem": "npm"
          },
          {
            "name": "@esbuild/openbsd-arm64",
            "direct": false,
            "version": "0.27.3",
            "ecosystem": "npm"
          },
          {
            "name": "@esbuild/openbsd-x64",
            "direct": false,
            "version": "0.25.8",
            "ecosystem": "npm"
          },
          {
            "name": "@esbuild/openbsd-x64",
            "direct": false,
            "version": "0.27.3",
            "ecosystem": "npm"
          },
          {
            "name": "@esbuild/openharmony-arm64",
            "direct": false,
            "version": "0.25.8",
            "ecosystem": "npm"
          },
          {
            "name": "@esbuild/openharmony-arm64",
            "direct": false,
            "version": "0.27.3",
            "ecosystem": "npm"
          },
          {
            "name": "@esbuild/sunos-x64",
            "direct": false,
            "version": "0.25.8",
            "ecosystem": "npm"
          },
          {
            "name": "@esbuild/sunos-x64",
            "direct": false,
            "version": "0.27.3",
            "ecosystem": "npm"
          },
          {
            "name": "@esbuild/win32-arm64",
            "direct": false,
            "version": "0.25.8",
            "ecosystem": "npm"
          },
          {
            "name": "@esbuild/win32-arm64",
            "direct": false,
            "version": "0.27.3",
            "ecosystem": "npm"
          },
          {
            "name": "@esbuild/win32-ia32",
            "direct": false,
            "version": "0.25.8",
            "ecosystem": "npm"
          },
          {
            "name": "@esbuild/win32-ia32",
            "direct": false,
            "version": "0.27.3",
            "ecosystem": "npm"
          },
          {
            "name": "@esbuild/win32-x64",
            "direct": false,
            "version": "0.25.8",
            "ecosystem": "npm"
          },
          {
            "name": "@esbuild/win32-x64",
            "direct": false,
            "version": "0.27.3",
            "ecosystem": "npm"
          },
          {
            "name": "@formatjs/ecma402-abstract",
            "direct": false,
            "version": "2.3.4",
            "ecosystem": "npm"
          },
          {
            "name": "@formatjs/fast-memoize",
            "direct": false,
            "version": "2.2.7",
            "ecosystem": "npm"
          },
          {
            "name": "@formatjs/icu-messageformat-parser",
            "direct": false,
            "version": "2.11.2",
            "ecosystem": "npm"
          },
          {
            "name": "@formatjs/icu-skeleton-parser",
            "direct": false,
            "version": "1.8.14",
            "ecosystem": "npm"
          },
          {
            "name": "@formatjs/intl-localematcher",
            "direct": false,
            "version": "0.6.1",
            "ecosystem": "npm"
          },
          {
            "name": "@googlemaps/js-api-loader",
            "direct": false,
            "version": "2.0.0",
            "ecosystem": "npm"
          },
          {
            "name": "@googlemaps/js-api-loader",
            "direct": false,
            "version": "^2.0.0",
            "ecosystem": "npm"
          },
          {
            "name": "@hotwired/hotwire-native-bridge",
            "direct": false,
            "version": "1.2.2",
            "ecosystem": "npm"
          },
          {
            "name": "@hotwired/stimulus",
            "direct": false,
            "version": "3.2.2",
            "ecosystem": "npm"
          },
          {
            "name": "@hotwired/stimulus",
            "direct": false,
            "version": "^3.0.0",
            "ecosystem": "npm"
          },
          {
            "name": "@hotwired/turbo",
            "direct": false,
            "version": "8.0.13",
            "ecosystem": "npm"
          },
          {
            "name": "@hotwired/turbo",
            "direct": false,
            "version": "^7.1.0 || ^8.0",
            "ecosystem": "npm"
          },
          {
            "name": "@hotwired/turbo",
            "direct": false,
            "version": "^7.1.1 || ^8.0",
            "ecosystem": "npm"
          },
          {
            "name": "@inquirer/ansi",
            "direct": false,
            "version": "1.0.2",
            "ecosystem": "npm"
          },
          {
            "name": "@inquirer/confirm",
            "direct": false,
            "version": "5.1.21",
            "ecosystem": "npm"
          },
          {
            "name": "@inquirer/core",
            "direct": false,
            "version": "10.3.2",
            "ecosystem": "npm"
          },
          {
            "name": "@inquirer/figures",
            "direct": false,
            "version": "1.0.15",
            "ecosystem": "npm"
          },
          {
            "name": "@inquirer/type",
            "direct": false,
            "version": "3.0.10",
            "ecosystem": "npm"
          },
          {
            "name": "@jridgewell/gen-mapping",
            "direct": false,
            "version": "0.3.12",
            "ecosystem": "npm"
          },
          {
            "name": "@jridgewell/gen-mapping",
            "direct": false,
            "version": "0.3.13",
            "ecosystem": "npm"
          },
          {
            "name": "@jridgewell/resolve-uri",
            "direct": false,
            "version": "3.1.2",
            "ecosystem": "npm"
          },
          {
            "name": "@jridgewell/source-map",
            "direct": false,
            "version": "0.3.11",
            "ecosystem": "npm"
          },
          {
            "name": "@jridgewell/sourcemap-codec",
            "direct": false,
            "version": "1.5.4",
            "ecosystem": "npm"
          },
          {
            "name": "@jridgewell/sourcemap-codec",
            "direct": false,
            "version": "1.5.5",
            "ecosystem": "npm"
          },
          {
            "name": "@jridgewell/trace-mapping",
            "direct": false,
            "version": "0.3.29",
            "ecosystem": "npm"
          },
          {
            "name": "@jridgewell/trace-mapping",
            "direct": false,
            "version": "0.3.30",
            "ecosystem": "npm"
          },
          {
            "name": "@jridgewell/trace-mapping",
            "direct": false,
            "version": "0.3.31",
            "ecosystem": "npm"
          },
          {
            "name": "@mswjs/interceptors",
            "direct": false,
            "version": "0.39.8",
            "ecosystem": "npm"
          },
          {
            "name": "@napi-rs/wasm-runtime",
            "direct": false,
            "version": "1.1.4",
            "ecosystem": "npm"
          },
          {
            "name": "@nicolo-ribaudo/chokidar-2",
            "direct": false,
            "version": "2.1.8-no-fsevents.3",
            "ecosystem": "npm"
          },
          {
            "name": "@open-draft/deferred-promise",
            "direct": false,
            "version": "2.2.0",
            "ecosystem": "npm"
          },
          {
            "name": "@open-draft/logger",
            "direct": false,
            "version": "0.3.0",
            "ecosystem": "npm"
          },
          {
            "name": "@open-draft/until",
            "direct": false,
            "version": "2.1.0",
            "ecosystem": "npm"
          },
          {
            "name": "@orchidjs/sifter",
            "direct": false,
            "version": "1.1.0",
            "ecosystem": "npm"
          },
          {
            "name": "@orchidjs/unicode-variants",
            "direct": false,
            "version": "1.1.2",
            "ecosystem": "npm"
          },
          {
            "name": "@oxc-project/types",
            "direct": false,
            "version": "0.115.0",
            "ecosystem": "npm"
          },
          {
            "name": "@oxc-project/types",
            "direct": false,
            "version": "0.130.0",
            "ecosystem": "npm"
          },
          {
            "name": "@oxfmt/binding-android-arm-eabi",
            "direct": false,
            "version": "0.41.0",
            "ecosystem": "npm"
          },
          {
            "name": "@oxfmt/binding-android-arm64",
            "direct": false,
            "version": "0.41.0",
            "ecosystem": "npm"
          },
          {
            "name": "@oxfmt/binding-darwin-arm64",
            "direct": false,
            "version": "0.41.0",
            "ecosystem": "npm"
          },
          {
            "name": "@oxfmt/binding-darwin-x64",
            "direct": false,
            "version": "0.41.0",
            "ecosystem": "npm"
          },
          {
            "name": "@oxfmt/binding-freebsd-x64",
            "direct": false,
            "version": "0.41.0",
            "ecosystem": "npm"
          },
          {
            "name": "@oxfmt/binding-linux-arm-gnueabihf",
            "direct": false,
            "version": "0.41.0",
            "ecosystem": "npm"
          },
          {
            "name": "@oxfmt/binding-linux-arm-musleabihf",
            "direct": false,
            "version": "0.41.0",
            "ecosystem": "npm"
          },
          {
            "name": "@oxfmt/binding-linux-arm64-gnu",
            "direct": false,
            "version": "0.41.0",
            "ecosystem": "npm"
          },
          {
            "name": "@oxfmt/binding-linux-arm64-musl",
            "direct": false,
            "version": "0.41.0",
            "ecosystem": "npm"
          },
          {
            "name": "@oxfmt/binding-linux-ppc64-gnu",
            "direct": false,
            "version": "0.41.0",
            "ecosystem": "npm"
          },
          {
            "name": "@oxfmt/binding-linux-riscv64-gnu",
            "direct": false,
            "version": "0.41.0",
            "ecosystem": "npm"
          },
          {
            "name": "@oxfmt/binding-linux-riscv64-musl",
            "direct": false,
            "version": "0.41.0",
            "ecosystem": "npm"
          },
          {
            "name": "@oxfmt/binding-linux-s390x-gnu",
            "direct": false,
            "version": "0.41.0",
            "ecosystem": "npm"
          },
          {
            "name": "@oxfmt/binding-linux-x64-gnu",
            "direct": false,
            "version": "0.41.0",
            "ecosystem": "npm"
          },
          {
            "name": "@oxfmt/binding-linux-x64-musl",
            "direct": false,
            "version": "0.41.0",
            "ecosystem": "npm"
          },
          {
            "name": "@oxfmt/binding-openharmony-arm64",
            "direct": false,
            "version": "0.41.0",
            "ecosystem": "npm"
          },
          {
            "name": "@oxfmt/binding-win32-arm64-msvc",
            "direct": false,
            "version": "0.41.0",
            "ecosystem": "npm"
          },
          {
            "name": "@oxfmt/binding-win32-ia32-msvc",
            "direct": false,
            "version": "0.41.0",
            "ecosystem": "npm"
          },
          {
            "name": "@oxfmt/binding-win32-x64-msvc",
            "direct": false,
            "version": "0.41.0",
            "ecosystem": "npm"
          },
          {
            "name": "@oxlint/binding-android-arm-eabi",
            "direct": false,
            "version": "1.56.0",
            "ecosystem": "npm"
          },
          {
            "name": "@oxlint/binding-android-arm64",
            "direct": false,
            "version": "1.56.0",
            "ecosystem": "npm"
          },
          {
            "name": "@oxlint/binding-darwin-arm64",
            "direct": false,
            "version": "1.56.0",
            "ecosystem": "npm"
          },
          {
            "name": "@oxlint/binding-darwin-x64",
            "direct": false,
            "version": "1.56.0",
            "ecosystem": "npm"
          },
          {
            "name": "@oxlint/binding-freebsd-x64",
            "direct": false,
            "version": "1.56.0",
            "ecosystem": "npm"
          },
          {
            "name": "@oxlint/binding-linux-arm-gnueabihf",
            "direct": false,
            "version": "1.56.0",
            "ecosystem": "npm"
          },
          {
            "name": "@oxlint/binding-linux-arm-musleabihf",
            "direct": false,
            "version": "1.56.0",
            "ecosystem": "npm"
          },
          {
            "name": "@oxlint/binding-linux-arm64-gnu",
            "direct": false,
            "version": "1.56.0",
            "ecosystem": "npm"
          },
          {
            "name": "@oxlint/binding-linux-arm64-musl",
            "direct": false,
            "version": "1.56.0",
            "ecosystem": "npm"
          },
          {
            "name": "@oxlint/binding-linux-ppc64-gnu",
            "direct": false,
            "version": "1.56.0",
            "ecosystem": "npm"
          },
          {
            "name": "@oxlint/binding-linux-riscv64-gnu",
            "direct": false,
            "version": "1.56.0",
            "ecosystem": "npm"
          },
          {
            "name": "@oxlint/binding-linux-riscv64-musl",
            "direct": false,
            "version": "1.56.0",
            "ecosystem": "npm"
          },
          {
            "name": "@oxlint/binding-linux-s390x-gnu",
            "direct": false,
            "version": "1.56.0",
            "ecosystem": "npm"
          },
          {
            "name": "@oxlint/binding-linux-x64-gnu",
            "direct": false,
            "version": "1.56.0",
            "ecosystem": "npm"
          },
          {
            "name": "@oxlint/binding-linux-x64-musl",
            "direct": false,
            "version": "1.56.0",
            "ecosystem": "npm"
          },
          {
            "name": "@oxlint/binding-openharmony-arm64",
            "direct": false,
            "version": "1.56.0",
            "ecosystem": "npm"
          },
          {
            "name": "@oxlint/binding-win32-arm64-msvc",
            "direct": false,
            "version": "1.56.0",
            "ecosystem": "npm"
          },
          {
            "name": "@oxlint/binding-win32-ia32-msvc",
            "direct": false,
            "version": "1.56.0",
            "ecosystem": "npm"
          },
          {
            "name": "@oxlint/binding-win32-x64-msvc",
            "direct": false,
            "version": "1.56.0",
            "ecosystem": "npm"
          },
          {
            "name": "@playwright/test",
            "direct": false,
            "version": "1.58.2",
            "ecosystem": "npm"
          },
          {
            "name": "@puppeteer/browsers",
            "direct": false,
            "version": "2.13.0",
            "ecosystem": "npm"
          },
          {
            "name": "@quansync/fs",
            "direct": false,
            "version": "1.0.0",
            "ecosystem": "npm"
          },
          {
            "name": "@rolldown/binding-android-arm64",
            "direct": false,
            "version": "1.0.0-rc.9",
            "ecosystem": "npm"
          },
          {
            "name": "@rolldown/binding-android-arm64",
            "direct": false,
            "version": "1.0.1",
            "ecosystem": "npm"
          },
          {
            "name": "@rolldown/binding-darwin-arm64",
            "direct": false,
            "version": "1.0.0-rc.9",
            "ecosystem": "npm"
          },
          {
            "name": "@rolldown/binding-darwin-arm64",
            "direct": false,
            "version": "1.0.1",
            "ecosystem": "npm"
          },
          {
            "name": "@rolldown/binding-darwin-x64",
            "direct": false,
            "version": "1.0.0-rc.9",
            "ecosystem": "npm"
          },
          {
            "name": "@rolldown/binding-darwin-x64",
            "direct": false,
            "version": "1.0.1",
            "ecosystem": "npm"
          },
          {
            "name": "@rolldown/binding-freebsd-x64",
            "direct": false,
            "version": "1.0.0-rc.9",
            "ecosystem": "npm"
          },
          {
            "name": "@rolldown/binding-freebsd-x64",
            "direct": false,
            "version": "1.0.1",
            "ecosystem": "npm"
          },
          {
            "name": "@rolldown/binding-linux-arm-gnueabihf",
            "direct": false,
            "version": "1.0.0-rc.9",
            "ecosystem": "npm"
          },
          {
            "name": "@rolldown/binding-linux-arm-gnueabihf",
            "direct": false,
            "version": "1.0.1",
            "ecosystem": "npm"
          },
          {
            "name": "@rolldown/binding-linux-arm64-gnu",
            "direct": false,
            "version": "1.0.0-rc.9",
            "ecosystem": "npm"
          },
          {
            "name": "@rolldown/binding-linux-arm64-gnu",
            "direct": false,
            "version": "1.0.1",
            "ecosystem": "npm"
          },
          {
            "name": "@rolldown/binding-linux-arm64-musl",
            "direct": false,
            "version": "1.0.0-rc.9",
            "ecosystem": "npm"
          },
          {
            "name": "@rolldown/binding-linux-arm64-musl",
            "direct": false,
            "version": "1.0.1",
            "ecosystem": "npm"
          },
          {
            "name": "@rolldown/binding-linux-ppc64-gnu",
            "direct": false,
            "version": "1.0.0-rc.9",
            "ecosystem": "npm"
          },
          {
            "name": "@rolldown/binding-linux-ppc64-gnu",
            "direct": false,
            "version": "1.0.1",
            "ecosystem": "npm"
          },
          {
            "name": "@rolldown/binding-linux-s390x-gnu",
            "direct": false,
            "version": "1.0.0-rc.9",
            "ecosystem": "npm"
          },
          {
            "name": "@rolldown/binding-linux-s390x-gnu",
            "direct": false,
            "version": "1.0.1",
            "ecosystem": "npm"
          },
          {
            "name": "@rolldown/binding-linux-x64-gnu",
            "direct": false,
            "version": "1.0.0-rc.9",
            "ecosystem": "npm"
          },
          {
            "name": "@rolldown/binding-linux-x64-gnu",
            "direct": false,
            "version": "1.0.1",
            "ecosystem": "npm"
          },
          {
            "name": "@rolldown/binding-linux-x64-musl",
            "direct": false,
            "version": "1.0.0-rc.9",
            "ecosystem": "npm"
          },
          {
            "name": "@rolldown/binding-linux-x64-musl",
            "direct": false,
            "version": "1.0.1",
            "ecosystem": "npm"
          },
          {
            "name": "@rolldown/binding-openharmony-arm64",
            "direct": false,
            "version": "1.0.0-rc.9",
            "ecosystem": "npm"
          },
          {
            "name": "@rolldown/binding-openharmony-arm64",
            "direct": false,
            "version": "1.0.1",
            "ecosystem": "npm"
          },
          {
            "name": "@rolldown/binding-wasm32-wasi",
            "direct": false,
            "version": "1.0.0-rc.9",
            "ecosystem": "npm"
          },
          {
            "name": "@rolldown/binding-wasm32-wasi",
            "direct": false,
            "version": "1.0.1",
            "ecosystem": "npm"
          },
          {
            "name": "@rolldown/binding-win32-arm64-msvc",
            "direct": false,
            "version": "1.0.0-rc.9",
            "ecosystem": "npm"
          },
          {
            "name": "@rolldown/binding-win32-arm64-msvc",
            "direct": false,
            "version": "1.0.1",
            "ecosystem": "npm"
          },
          {
            "name": "@rolldown/binding-win32-x64-msvc",
            "direct": false,
            "version": "1.0.0-rc.9",
            "ecosystem": "npm"
          },
          {
            "name": "@rolldown/binding-win32-x64-msvc",
            "direct": false,
            "version": "1.0.1",
            "ecosystem": "npm"
          },
          {
            "name": "@rolldown/pluginutils",
            "direct": false,
            "version": "1.0.0-beta.27",
            "ecosystem": "npm"
          },
          {
            "name": "@rolldown/pluginutils",
            "direct": false,
            "version": "1.0.0-beta.29",
            "ecosystem": "npm"
          },
          {
            "name": "@rolldown/pluginutils",
            "direct": false,
            "version": "1.0.0-rc.9",
            "ecosystem": "npm"
          },
          {
            "name": "@rolldown/pluginutils",
            "direct": false,
            "version": "1.0.1",
            "ecosystem": "npm"
          },
          {
            "name": "@rollup/rollup-android-arm-eabi",
            "direct": false,
            "version": "4.59.0",
            "ecosystem": "npm"
          },
          {
            "name": "@rollup/rollup-android-arm64",
            "direct": false,
            "version": "4.59.0",
            "ecosystem": "npm"
          },
          {
            "name": "@rollup/rollup-darwin-arm64",
            "direct": false,
            "version": "4.59.0",
            "ecosystem": "npm"
          },
          {
            "name": "@rollup/rollup-darwin-x64",
            "direct": false,
            "version": "4.59.0",
            "ecosystem": "npm"
          },
          {
            "name": "@rollup/rollup-freebsd-arm64",
            "direct": false,
            "version": "4.59.0",
            "ecosystem": "npm"
          },
          {
            "name": "@rollup/rollup-freebsd-x64",
            "direct": false,
            "version": "4.59.0",
            "ecosystem": "npm"
          },
          {
            "name": "@rollup/rollup-linux-arm-gnueabihf",
            "direct": false,
            "version": "4.59.0",
            "ecosystem": "npm"
          },
          {
            "name": "@rollup/rollup-linux-arm-musleabihf",
            "direct": false,
            "version": "4.59.0",
            "ecosystem": "npm"
          },
          {
            "name": "@rollup/rollup-linux-arm64-gnu",
            "direct": false,
            "version": "4.59.0",
            "ecosystem": "npm"
          },
          {
            "name": "@rollup/rollup-linux-arm64-musl",
            "direct": false,
            "version": "4.59.0",
            "ecosystem": "npm"
          },
          {
            "name": "@rollup/rollup-linux-loong64-gnu",
            "direct": false,
            "version": "4.59.0",
            "ecosystem": "npm"
          },
          {
            "name": "@rollup/rollup-linux-loong64-musl",
            "direct": false,
            "version": "4.59.0",
            "ecosystem": "npm"
          },
          {
            "name": "@rollup/rollup-linux-ppc64-gnu",
            "direct": false,
            "version": "4.59.0",
            "ecosystem": "npm"
          },
          {
            "name": "@rollup/rollup-linux-ppc64-musl",
            "direct": false,
            "version": "4.59.0",
            "ecosystem": "npm"
          },
          {
            "name": "@rollup/rollup-linux-riscv64-gnu",
            "direct": false,
            "version": "4.59.0",
            "ecosystem": "npm"
          },
          {
            "name": "@rollup/rollup-linux-riscv64-musl",
            "direct": false,
            "version": "4.59.0",
            "ecosystem": "npm"
          },
          {
            "name": "@rollup/rollup-linux-s390x-gnu",
            "direct": false,
            "version": "4.59.0",
            "ecosystem": "npm"
          },
          {
            "name": "@rollup/rollup-linux-x64-gnu",
            "direct": false,
            "version": "4.59.0",
            "ecosystem": "npm"
          },
          {
            "name": "@rollup/rollup-linux-x64-musl",
            "direct": false,
            "version": "4.59.0",
            "ecosystem": "npm"
          },
          {
            "name": "@rollup/rollup-openbsd-x64",
            "direct": false,
            "version": "4.59.0",
            "ecosystem": "npm"
          },
          {
            "name": "@rollup/rollup-openharmony-arm64",
            "direct": false,
            "version": "4.59.0",
            "ecosystem": "npm"
          },
          {
            "name": "@rollup/rollup-win32-arm64-msvc",
            "direct": false,
            "version": "4.59.0",
            "ecosystem": "npm"
          },
          {
            "name": "@rollup/rollup-win32-ia32-msvc",
            "direct": false,
            "version": "4.59.0",
            "ecosystem": "npm"
          },
          {
            "name": "@rollup/rollup-win32-x64-gnu",
            "direct": false,
            "version": "4.59.0",
            "ecosystem": "npm"
          },
          {
            "name": "@rollup/rollup-win32-x64-msvc",
            "direct": false,
            "version": "4.59.0",
            "ecosystem": "npm"
          },
          {
            "name": "@standard-schema/spec",
            "direct": false,
            "version": "1.1.0",
            "ecosystem": "npm"
          },
          {
            "name": "@symfony/stimulus-bridge",
            "direct": false,
            "version": "^3.2.0",
            "ecosystem": "npm"
          },
          {
            "name": "@symfony/webpack-encore",
            "direct": false,
            "version": "^5.0.0",
            "ecosystem": "npm"
          },
          {
            "name": "@testing-library/dom",
            "direct": false,
            "version": "10.4.0",
            "ecosystem": "npm"
          },
          {
            "name": "@testing-library/dom",
            "direct": false,
            "version": "10.4.1",
            "ecosystem": "npm"
          },
          {
            "name": "@testing-library/dom",
            "direct": false,
            "version": "^10.4.0",
            "ecosystem": "npm"
          },
          {
            "name": "@testing-library/dom",
            "direct": false,
            "version": "^10.4.1",
            "ecosystem": "npm"
          },
          {
            "name": "@testing-library/jest-dom",
            "direct": false,
            "version": "6.7.0",
            "ecosystem": "npm"
          },
          {
            "name": "@testing-library/jest-dom",
            "direct": false,
            "version": "6.9.1",
            "ecosystem": "npm"
          },
          {
            "name": "@testing-library/jest-dom",
            "direct": false,
            "version": "^6.6.3",
            "ecosystem": "npm"
          },
          {
            "name": "@testing-library/user-event",
            "direct": false,
            "version": "13.5.0",
            "ecosystem": "npm"
          },
          {
            "name": "@testing-library/user-event",
            "direct": false,
            "version": "14.6.1",
            "ecosystem": "npm"
          },
          {
            "name": "@testing-library/user-event",
            "direct": false,
            "version": "^13.1.9",
            "ecosystem": "npm"
          },
          {
            "name": "@testing-library/user-event",
            "direct": false,
            "version": "^14.6.1",
            "ecosystem": "npm"
          },
          {
            "name": "@tootallnate/quickjs-emscripten",
            "direct": false,
            "version": "0.23.0",
            "ecosystem": "npm"
          },
          {
            "name": "@tsdown/css",
            "direct": false,
            "version": "0.22.0",
            "ecosystem": "npm"
          },
          {
            "name": "@tybys/wasm-util",
            "direct": false,
            "version": "0.10.1",
            "ecosystem": "npm"
          },
          {
            "name": "@types/aria-query",
            "direct": false,
            "version": "5.0.4",
            "ecosystem": "npm"
          },
          {
            "name": "@types/babel__core",
            "direct": false,
            "version": "7.20.5",
            "ecosystem": "npm"
          },
          {
            "name": "@types/babel__generator",
            "direct": false,
            "version": "7.27.0",
            "ecosystem": "npm"
          },
          {
            "name": "@types/babel__template",
            "direct": false,
            "version": "7.4.4",
            "ecosystem": "npm"
          },
          {
            "name": "@types/babel__traverse",
            "direct": false,
            "version": "7.20.7",
            "ecosystem": "npm"
          },
          {
            "name": "@types/chai",
            "direct": false,
            "version": "5.2.3",
            "ecosystem": "npm"
          },
          {
            "name": "@types/cookie",
            "direct": false,
            "version": "0.6.0",
            "ecosystem": "npm"
          },
          {
            "name": "@types/deep-eql",
            "direct": false,
            "version": "4.0.2",
            "ecosystem": "npm"
          },
          {
            "name": "@types/estree",
            "direct": false,
            "version": "1.0.8",
            "ecosystem": "npm"
          },
          {
            "name": "@types/geojson",
            "direct": false,
            "version": "7946.0.16",
            "ecosystem": "npm"
          },
          {
            "name": "@types/google.maps",
            "direct": false,
            "version": "3.58.1",
            "ecosystem": "npm"
          },
          {
            "name": "@types/google.maps",
            "direct": false,
            "version": "^3.55.9",
            "ecosystem": "npm"
          },
          {
            "name": "@types/hotwired__turbo",
            "direct": false,
            "version": "8.0.4",
            "ecosystem": "npm"
          },
          {
            "name": "@types/hotwired__turbo",
            "direct": false,
            "version": "^8.0.4",
            "ecosystem": "npm"
          },
          {
            "name": "@types/jsesc",
            "direct": false,
            "version": "2.5.1",
            "ecosystem": "npm"
          },
          {
            "name": "@types/leaflet",
            "direct": false,
            "version": "1.9.20",
            "ecosystem": "npm"
          },
          {
            "name": "@types/leaflet",
            "direct": false,
            "version": "^1.9.12",
            "ecosystem": "npm"
          },
          {
            "name": "@types/node",
            "direct": false,
            "version": "22.19.11",
            "ecosystem": "npm"
          },
          {
            "name": "@types/node",
            "direct": false,
            "version": "25.3.0",
            "ecosystem": "npm"
          },
          {
            "name": "@types/node-fetch",
            "direct": false,
            "version": "2.6.13",
            "ecosystem": "npm"
          },
          {
            "name": "@types/node-fetch",
            "direct": false,
            "version": "^2.6.13",
            "ecosystem": "npm"
          },
          {
            "name": "@types/prop-types",
            "direct": false,
            "version": "15.7.15",
            "ecosystem": "npm"
          },
          {
            "name": "@types/react",
            "direct": false,
            "version": "18.3.23",
            "ecosystem": "npm"
          },
          {
            "name": "@types/react",
            "direct": false,
            "version": "^18.0 || ^19.0",
            "ecosystem": "npm"
          },
          {
            "name": "@types/react-dom",
            "direct": false,
            "version": "18.3.7",
            "ecosystem": "npm"
          },
          {
            "name": "@types/react-dom",
            "direct": false,
            "version": "^18.0 || ^19.0",
            "ecosystem": "npm"
          },
          {
            "name": "@types/statuses",
            "direct": false,
            "version": "2.0.6",
            "ecosystem": "npm"
          },
          {
            "name": "@types/tough-cookie",
            "direct": false,
            "version": "4.0.5",
            "ecosystem": "npm"
          },
          {
            "name": "@types/webpack-env",
            "direct": false,
            "version": "1.18.8",
            "ecosystem": "npm"
          },
          {
            "name": "@types/webpack-env",
            "direct": false,
            "version": "^1.16",
            "ecosystem": "npm"
          },
          {
            "name": "@types/yauzl",
            "direct": false,
            "version": "2.10.3",
            "ecosystem": "npm"
          },
          {
            "name": "@vitejs/plugin-react",
            "direct": false,
            "version": "4.7.0",
            "ecosystem": "npm"
          },
          {
            "name": "@vitejs/plugin-react",
            "direct": false,
            "version": "^4.1.0",
            "ecosystem": "npm"
          },
          {
            "name": "@vitejs/plugin-vue",
            "direct": false,
            "version": "6.0.1",
            "ecosystem": "npm"
          },
          {
            "name": "@vitejs/plugin-vue",
            "direct": false,
            "version": "^6.0.0",
            "ecosystem": "npm"
          },
          {
            "name": "@vitest/expect",
            "direct": false,
            "version": "4.1.0",
            "ecosystem": "npm"
          },
          {
            "name": "@vitest/mocker",
            "direct": false,
            "version": "4.1.0",
            "ecosystem": "npm"
          },
          {
            "name": "@vitest/pretty-format",
            "direct": false,
            "version": "4.1.0",
            "ecosystem": "npm"
          },
          {
            "name": "@vitest/runner",
            "direct": false,
            "version": "4.1.0",
            "ecosystem": "npm"
          },
          {
            "name": "@vitest/snapshot",
            "direct": false,
            "version": "4.1.0",
            "ecosystem": "npm"
          },
          {
            "name": "@vitest/spy",
            "direct": false,
            "version": "4.1.0",
            "ecosystem": "npm"
          },
          {
            "name": "@vitest/utils",
            "direct": false,
            "version": "4.1.0",
            "ecosystem": "npm"
          },
          {
            "name": "@vue/compiler-core",
            "direct": false,
            "version": "3.5.17",
            "ecosystem": "npm"
          },
          {
            "name": "@vue/compiler-dom",
            "direct": false,
            "version": "3.5.17",
            "ecosystem": "npm"
          },
          {
            "name": "@vue/compiler-sfc",
            "direct": false,
            "version": "3.5.17",
            "ecosystem": "npm"
          },
          {
            "name": "@vue/compiler-ssr",
            "direct": false,
            "version": "3.5.17",
            "ecosystem": "npm"
          },
          {
            "name": "@vue/reactivity",
            "direct": false,
            "version": "3.5.17",
            "ecosystem": "npm"
          },
          {
            "name": "@vue/runtime-core",
            "direct": false,
            "version": "3.5.17",
            "ecosystem": "npm"
          },
          {
            "name": "@vue/runtime-dom",
            "direct": false,
            "version": "3.5.17",
            "ecosystem": "npm"
          },
          {
            "name": "@vue/server-renderer",
            "direct": false,
            "version": "3.5.17",
            "ecosystem": "npm"
          },
          {
            "name": "@vue/shared",
            "direct": false,
            "version": "3.5.17",
            "ecosystem": "npm"
          },
          {
            "name": "acorn",
            "direct": false,
            "version": "8.16.0",
            "ecosystem": "npm"
          },
          {
            "name": "agent-base",
            "direct": false,
            "version": "7.1.4",
            "ecosystem": "npm"
          },
          {
            "name": "ansi-regex",
            "direct": false,
            "version": "5.0.1",
            "ecosystem": "npm"
          },
          {
            "name": "ansi-styles",
            "direct": false,
            "version": "4.3.0",
            "ecosystem": "npm"
          },
          {
            "name": "ansi-styles",
            "direct": false,
            "version": "5.2.0",
            "ecosystem": "npm"
          },
          {
            "name": "ansis",
            "direct": false,
            "version": "4.2.0",
            "ecosystem": "npm"
          },
          {
            "name": "anymatch",
            "direct": false,
            "version": "3.1.3",
            "ecosystem": "npm"
          },
          {
            "name": "aria-query",
            "direct": false,
            "version": "5.3.0",
            "ecosystem": "npm"
          },
          {
            "name": "aria-query",
            "direct": false,
            "version": "5.3.2",
            "ecosystem": "npm"
          },
          {
            "name": "assertion-error",
            "direct": false,
            "version": "2.0.1",
            "ecosystem": "npm"
          },
          {
            "name": "ast-kit",
            "direct": false,
            "version": "3.0.0-beta.1",
            "ecosystem": "npm"
          },
          {
            "name": "ast-types",
            "direct": false,
            "version": "0.13.4",
            "ecosystem": "npm"
          },
          {
            "name": "asynckit",
            "direct": false,
            "version": "0.4.0",
            "ecosystem": "npm"
          },
          {
            "name": "b4a",
            "direct": false,
            "version": "1.8.0",
            "ecosystem": "npm"
          },
          {
            "name": "balanced-match",
            "direct": false,
            "version": "1.0.2",
            "ecosystem": "npm"
          },
          {
            "name": "bare-events",
            "direct": false,
            "version": "2.8.2",
            "ecosystem": "npm"
          },
          {
            "name": "bare-fs",
            "direct": false,
            "version": "4.5.5",
            "ecosystem": "npm"
          },
          {
            "name": "bare-os",
            "direct": false,
            "version": "3.7.0",
            "ecosystem": "npm"
          },
          {
            "name": "bare-path",
            "direct": false,
            "version": "3.0.0",
            "ecosystem": "npm"
          },
          {
            "name": "bare-stream",
            "direct": false,
            "version": "2.8.0",
            "ecosystem": "npm"
          },
          {
            "name": "bare-url",
            "direct": false,
            "version": "2.3.2",
            "ecosystem": "npm"
          },
          {
            "name": "basic-ftp",
            "direct": false,
            "version": "5.2.0",
            "ecosystem": "npm"
          },
          {
            "name": "binary-extensions",
            "direct": false,
            "version": "2.3.0",
            "ecosystem": "npm"
          },
          {
            "name": "birpc",
            "direct": false,
            "version": "4.0.0",
            "ecosystem": "npm"
          },
          {
            "name": "brace-expansion",
            "direct": false,
            "version": "1.1.12",
            "ecosystem": "npm"
          },
          {
            "name": "braces",
            "direct": false,
            "version": "3.0.3",
            "ecosystem": "npm"
          },
          {
            "name": "browserslist",
            "direct": false,
            "version": "4.25.1",
            "ecosystem": "npm"
          },
          {
            "name": "browserslist",
            "direct": false,
            "version": "4.25.3",
            "ecosystem": "npm"
          },
          {
            "name": "buffer-crc32",
            "direct": false,
            "version": "0.2.13",
            "ecosystem": "npm"
          },
          {
            "name": "buffer-from",
            "direct": false,
            "version": "1.1.2",
            "ecosystem": "npm"
          },
          {
            "name": "cac",
            "direct": false,
            "version": "7.0.0",
            "ecosystem": "npm"
          },
          {
            "name": "call-bind-apply-helpers",
            "direct": false,
            "version": "1.0.2",
            "ecosystem": "npm"
          },
          {
            "name": "caniuse-lite",
            "direct": false,
            "version": "1.0.30001727",
            "ecosystem": "npm"
          },
          {
            "name": "caniuse-lite",
            "direct": false,
            "version": "1.0.30001737",
            "ecosystem": "npm"
          },
          {
            "name": "chai",
            "direct": false,
            "version": "6.2.2",
            "ecosystem": "npm"
          },
          {
            "name": "chalk",
            "direct": false,
            "version": "4.1.2",
            "ecosystem": "npm"
          },
          {
            "name": "chart.js",
            "direct": false,
            "version": "3.9.1",
            "ecosystem": "npm"
          },
          {
            "name": "chart.js",
            "direct": false,
            "version": "^3.4.1 || ^4.0",
            "ecosystem": "npm"
          },
          {
            "name": "chokidar",
            "direct": false,
            "version": "3.6.0",
            "ecosystem": "npm"
          },
          {
            "name": "cli-width",
            "direct": false,
            "version": "4.1.0",
            "ecosystem": "npm"
          },
          {
            "name": "cliui",
            "direct": false,
            "version": "8.0.1",
            "ecosystem": "npm"
          },
          {
            "name": "color-convert",
            "direct": false,
            "version": "2.0.1",
            "ecosystem": "npm"
          },
          {
            "name": "color-name",
            "direct": false,
            "version": "1.1.4",
            "ecosystem": "npm"
          },
          {
            "name": "combined-stream",
            "direct": false,
            "version": "1.0.8",
            "ecosystem": "npm"
          },
          {
            "name": "commander",
            "direct": false,
            "version": "2.20.3",
            "ecosystem": "npm"
          },
          {
            "name": "commander",
            "direct": false,
            "version": "6.2.1",
            "ecosystem": "npm"
          },
          {
            "name": "concat-map",
            "direct": false,
            "version": "0.0.1",
            "ecosystem": "npm"
          },
          {
            "name": "confbox",
            "direct": false,
            "version": "0.2.4",
            "ecosystem": "npm"
          },
          {
            "name": "convert-source-map",
            "direct": false,
            "version": "2.0.0",
            "ecosystem": "npm"
          },
          {
            "name": "cookie",
            "direct": false,
            "version": "0.7.2",
            "ecosystem": "npm"
          },
          {
            "name": "core-js",
            "direct": false,
            "version": "^3.38.0",
            "ecosystem": "npm"
          },
          {
            "name": "cropperjs",
            "direct": false,
            "version": "1.6.2",
            "ecosystem": "npm"
          },
          {
            "name": "cropperjs",
            "direct": false,
            "version": "^1.5.9",
            "ecosystem": "npm"
          },
          {
            "name": "cross-fetch",
            "direct": false,
            "version": "3.2.0",
            "ecosystem": "npm"
          },
          {
            "name": "css.escape",
            "direct": false,
            "version": "1.5.1",
            "ecosystem": "npm"
          },
          {
            "name": "cssfontparser",
            "direct": false,
            "version": "1.2.1",
            "ecosystem": "npm"
          },
          {
            "name": "cssstyle",
            "direct": false,
            "version": "4.6.0",
            "ecosystem": "npm"
          },
          {
            "name": "csstype",
            "direct": false,
            "version": "3.1.3",
            "ecosystem": "npm"
          },
          {
            "name": "data-uri-to-buffer",
            "direct": false,
            "version": "6.0.2",
            "ecosystem": "npm"
          },
          {
            "name": "data-urls",
            "direct": false,
            "version": "5.0.0",
            "ecosystem": "npm"
          },
          {
            "name": "debug",
            "direct": false,
            "version": "4.4.1",
            "ecosystem": "npm"
          },
          {
            "name": "debug",
            "direct": false,
            "version": "4.4.3",
            "ecosystem": "npm"
          },
          {
            "name": "decimal.js",
            "direct": false,
            "version": "10.6.0",
            "ecosystem": "npm"
          },
          {
            "name": "defu",
            "direct": false,
            "version": "6.1.7",
            "ecosystem": "npm"
          },
          {
            "name": "degenerator",
            "direct": false,
            "version": "5.0.1",
            "ecosystem": "npm"
          },
          {
            "name": "delayed-stream",
            "direct": false,
            "version": "1.0.0",
            "ecosystem": "npm"
          },
          {
            "name": "dequal",
            "direct": false,
            "version": "2.0.3",
            "ecosystem": "npm"
          },
          {
            "name": "detect-libc",
            "direct": false,
            "version": "2.1.2",
            "ecosystem": "npm"
          },
          {
            "name": "dom-accessibility-api",
            "direct": false,
            "version": "0.5.16",
            "ecosystem": "npm"
          },
          {
            "name": "dom-accessibility-api",
            "direct": false,
            "version": "0.6.3",
            "ecosystem": "npm"
          },
          {
            "name": "dts-resolver",
            "direct": false,
            "version": "3.0.0",
            "ecosystem": "npm"
          },
          {
            "name": "dunder-proto",
            "direct": false,
            "version": "1.0.1",
            "ecosystem": "npm"
          },
          {
            "name": "electron-to-chromium",
            "direct": false,
            "version": "1.5.187",
            "ecosystem": "npm"
          },
          {
            "name": "electron-to-chromium",
            "direct": false,
            "version": "1.5.208",
            "ecosystem": "npm"
          },
          {
            "name": "emoji-regex",
            "direct": false,
            "version": "8.0.0",
            "ecosystem": "npm"
          },
          {
            "name": "empathic",
            "direct": false,
            "version": "2.0.0",
            "ecosystem": "npm"
          },
          {
            "name": "end-of-stream",
            "direct": false,
            "version": "1.4.5",
            "ecosystem": "npm"
          },
          {
            "name": "entities",
            "direct": false,
            "version": "4.5.0",
            "ecosystem": "npm"
          },
          {
            "name": "entities",
            "direct": false,
            "version": "6.0.1",
            "ecosystem": "npm"
          },
          {
            "name": "es-define-property",
            "direct": false,
            "version": "1.0.1",
            "ecosystem": "npm"
          },
          {
            "name": "es-errors",
            "direct": false,
            "version": "1.3.0",
            "ecosystem": "npm"
          },
          {
            "name": "es-module-lexer",
            "direct": false,
            "version": "2.0.0",
            "ecosystem": "npm"
          },
          {
            "name": "es-object-atoms",
            "direct": false,
            "version": "1.1.1",
            "ecosystem": "npm"
          },
          {
            "name": "es-set-tostringtag",
            "direct": false,
            "version": "2.1.0",
            "ecosystem": "npm"
          },
          {
            "name": "esbuild",
            "direct": false,
            "version": "0.25.8",
            "ecosystem": "npm"
          },
          {
            "name": "esbuild",
            "direct": false,
            "version": "0.27.3",
            "ecosystem": "npm"
          },
          {
            "name": "escalade",
            "direct": false,
            "version": "3.2.0",
            "ecosystem": "npm"
          },
          {
            "name": "escodegen",
            "direct": false,
            "version": "2.1.0",
            "ecosystem": "npm"
          },
          {
            "name": "esprima",
            "direct": false,
            "version": "4.0.1",
            "ecosystem": "npm"
          },
          {
            "name": "estraverse",
            "direct": false,
            "version": "5.3.0",
            "ecosystem": "npm"
          },
          {
            "name": "estree-walker",
            "direct": false,
            "version": "2.0.2",
            "ecosystem": "npm"
          },
          {
            "name": "estree-walker",
            "direct": false,
            "version": "3.0.3",
            "ecosystem": "npm"
          },
          {
            "name": "esutils",
            "direct": false,
            "version": "2.0.3",
            "ecosystem": "npm"
          },
          {
            "name": "events-universal",
            "direct": false,
            "version": "1.0.1",
            "ecosystem": "npm"
          },
          {
            "name": "expect-type",
            "direct": false,
            "version": "1.3.0",
            "ecosystem": "npm"
          },
          {
            "name": "exsolve",
            "direct": false,
            "version": "1.0.8",
            "ecosystem": "npm"
          },
          {
            "name": "extract-zip",
            "direct": false,
            "version": "2.0.1",
            "ecosystem": "npm"
          },
          {
            "name": "fast-fifo",
            "direct": false,
            "version": "1.3.2",
            "ecosystem": "npm"
          },
          {
            "name": "fd-slicer",
            "direct": false,
            "version": "1.1.0",
            "ecosystem": "npm"
          },
          {
            "name": "fdir",
            "direct": false,
            "version": "6.5.0",
            "ecosystem": "npm"
          },
          {
            "name": "fill-range",
            "direct": false,
            "version": "7.1.1",
            "ecosystem": "npm"
          },
          {
            "name": "form-data",
            "direct": false,
            "version": "4.0.4",
            "ecosystem": "npm"
          },
          {
            "name": "fs-readdir-recursive",
            "direct": false,
            "version": "1.1.0",
            "ecosystem": "npm"
          },
          {
            "name": "fs.realpath",
            "direct": false,
            "version": "1.0.0",
            "ecosystem": "npm"
          },
          {
            "name": "fsevents",
            "direct": false,
            "version": "2.3.2",
            "ecosystem": "npm"
          },
          {
            "name": "fsevents",
            "direct": false,
            "version": "2.3.3",
            "ecosystem": "npm"
          },
          {
            "name": "function-bind",
            "direct": false,
            "version": "1.1.2",
            "ecosystem": "npm"
          },
          {
            "name": "gensync",
            "direct": false,
            "version": "1.0.0-beta.2",
            "ecosystem": "npm"
          },
          {
            "name": "get-caller-file",
            "direct": false,
            "version": "2.0.5",
            "ecosystem": "npm"
          },
          {
            "name": "get-intrinsic",
            "direct": false,
            "version": "1.3.0",
            "ecosystem": "npm"
          },
          {
            "name": "get-proto",
            "direct": false,
            "version": "1.0.1",
            "ecosystem": "npm"
          },
          {
            "name": "get-stream",
            "direct": false,
            "version": "5.2.0",
            "ecosystem": "npm"
          },
          {
            "name": "get-tsconfig",
            "direct": false,
            "version": "4.13.6",
            "ecosystem": "npm"
          },
          {
            "name": "get-tsconfig",
            "direct": false,
            "version": "5.0.0-beta.5",
            "ecosystem": "npm"
          },
          {
            "name": "get-uri",
            "direct": false,
            "version": "6.0.5",
            "ecosystem": "npm"
          },
          {
            "name": "glob",
            "direct": false,
            "version": "7.2.3",
            "ecosystem": "npm"
          },
          {
            "name": "glob-parent",
            "direct": false,
            "version": "5.1.2",
            "ecosystem": "npm"
          },
          {
            "name": "gopd",
            "direct": false,
            "version": "1.2.0",
            "ecosystem": "npm"
          },
          {
            "name": "graphql",
            "direct": false,
            "version": "16.13.0",
            "ecosystem": "npm"
          },
          {
            "name": "has-flag",
            "direct": false,
            "version": "4.0.0",
            "ecosystem": "npm"
          },
          {
            "name": "has-symbols",
            "direct": false,
            "version": "1.1.0",
            "ecosystem": "npm"
          },
          {
            "name": "has-tostringtag",
            "direct": false,
            "version": "1.0.2",
            "ecosystem": "npm"
          },
          {
            "name": "hasown",
            "direct": false,
            "version": "2.0.2",
            "ecosystem": "npm"
          },
          {
            "name": "headers-polyfill",
            "direct": false,
            "version": "4.0.3",
            "ecosystem": "npm"
          },
          {
            "name": "hookable",
            "direct": false,
            "version": "6.1.1",
            "ecosystem": "npm"
          },
          {
            "name": "html-encoding-sniffer",
            "direct": false,
            "version": "4.0.0",
            "ecosystem": "npm"
          },
          {
            "name": "http-proxy-agent",
            "direct": false,
            "version": "7.0.2",
            "ecosystem": "npm"
          },
          {
            "name": "https-proxy-agent",
            "direct": false,
            "version": "7.0.6",
            "ecosystem": "npm"
          },
          {
            "name": "iconv-lite",
            "direct": false,
            "version": "0.6.3",
            "ecosystem": "npm"
          },
          {
            "name": "idiomorph",
            "direct": false,
            "version": "0.3.0",
            "ecosystem": "npm"
          },
          {
            "name": "idiomorph",
            "direct": false,
            "version": "^0.3.0",
            "ecosystem": "npm"
          },
          {
            "name": "import-without-cache",
            "direct": false,
            "version": "0.4.0",
            "ecosystem": "npm"
          },
          {
            "name": "indent-string",
            "direct": false,
            "version": "4.0.0",
            "ecosystem": "npm"
          },
          {
            "name": "inflight",
            "direct": false,
            "version": "1.0.6",
            "ecosystem": "npm"
          },
          {
            "name": "inherits",
            "direct": false,
            "version": "2.0.4",
            "ecosystem": "npm"
          },
          {
            "name": "intl-messageformat",
            "direct": false,
            "version": "10.7.16",
            "ecosystem": "npm"
          },
          {
            "name": "intl-messageformat",
            "direct": false,
            "version": "^10.5.11",
            "ecosystem": "npm"
          },
          {
            "name": "ip-address",
            "direct": false,
            "version": "10.1.0",
            "ecosystem": "npm"
          },
          {
            "name": "is-binary-path",
            "direct": false,
            "version": "2.1.0",
            "ecosystem": "npm"
          },
          {
            "name": "is-extglob",
            "direct": false,
            "version": "2.1.1",
            "ecosystem": "npm"
          },
          {
            "name": "is-fullwidth-code-point",
            "direct": false,
            "version": "3.0.0",
            "ecosystem": "npm"
          },
          {
            "name": "is-glob",
            "direct": false,
            "version": "4.0.3",
            "ecosystem": "npm"
          },
          {
            "name": "is-node-process",
            "direct": false,
            "version": "1.2.0",
            "ecosystem": "npm"
          },
          {
            "name": "is-number",
            "direct": false,
            "version": "7.0.0",
            "ecosystem": "npm"
          },
          {
            "name": "is-potential-custom-element-name",
            "direct": false,
            "version": "1.0.1",
            "ecosystem": "npm"
          },
          {
            "name": "jest-canvas-mock",
            "direct": false,
            "version": "2.5.2",
            "ecosystem": "npm"
          },
          {
            "name": "js-tokens",
            "direct": false,
            "version": "4.0.0",
            "ecosystem": "npm"
          },
          {
            "name": "jsdom",
            "direct": false,
            "version": "26.1.0",
            "ecosystem": "npm"
          },
          {
            "name": "jsdom",
            "direct": false,
            "version": "^26.1.0",
            "ecosystem": "npm"
          },
          {
            "name": "jsesc",
            "direct": false,
            "version": "3.1.0",
            "ecosystem": "npm"
          },
          {
            "name": "json5",
            "direct": false,
            "version": "2.2.3",
            "ecosystem": "npm"
          },
          {
            "name": "leaflet",
            "direct": false,
            "version": "1.9.4",
            "ecosystem": "npm"
          },
          {
            "name": "leaflet",
            "direct": false,
            "version": "^1.9.4",
            "ecosystem": "npm"
          },
          {
            "name": "lightningcss",
            "direct": false,
            "version": "1.32.0",
            "ecosystem": "npm"
          },
          {
            "name": "lightningcss-android-arm64",
            "direct": false,
            "version": "1.32.0",
            "ecosystem": "npm"
          },
          {
            "name": "lightningcss-darwin-arm64",
            "direct": false,
            "version": "1.32.0",
            "ecosystem": "npm"
          },
          {
            "name": "lightningcss-darwin-x64",
            "direct": false,
            "version": "1.32.0",
            "ecosystem": "npm"
          },
          {
            "name": "lightningcss-freebsd-x64",
            "direct": false,
            "version": "1.32.0",
            "ecosystem": "npm"
          },
          {
            "name": "lightningcss-linux-arm-gnueabihf",
            "direct": false,
            "version": "1.32.0",
            "ecosystem": "npm"
          },
          {
            "name": "lightningcss-linux-arm64-gnu",
            "direct": false,
            "version": "1.32.0",
            "ecosystem": "npm"
          },
          {
            "name": "lightningcss-linux-arm64-musl",
            "direct": false,
            "version": "1.32.0",
            "ecosystem": "npm"
          },
          {
            "name": "lightningcss-linux-x64-gnu",
            "direct": false,
            "version": "1.32.0",
            "ecosystem": "npm"
          },
          {
            "name": "lightningcss-linux-x64-musl",
            "direct": false,
            "version": "1.32.0",
            "ecosystem": "npm"
          },
          {
            "name": "lightningcss-win32-arm64-msvc",
            "direct": false,
            "version": "1.32.0",
            "ecosystem": "npm"
          },
          {
            "name": "lightningcss-win32-x64-msvc",
            "direct": false,
            "version": "1.32.0",
            "ecosystem": "npm"
          },
          {
            "name": "lilconfig",
            "direct": false,
            "version": "3.1.3",
            "ecosystem": "npm"
          },
          {
            "name": "loose-envify",
            "direct": false,
            "version": "1.4.0",
            "ecosystem": "npm"
          },
          {
            "name": "lru-cache",
            "direct": false,
            "version": "10.4.3",
            "ecosystem": "npm"
          },
          {
            "name": "lru-cache",
            "direct": false,
            "version": "5.1.1",
            "ecosystem": "npm"
          },
          {
            "name": "lru-cache",
            "direct": false,
            "version": "7.18.3",
            "ecosystem": "npm"
          },
          {
            "name": "lz-string",
            "direct": false,
            "version": "1.5.0",
            "ecosystem": "npm"
          },
          {
            "name": "magic-string",
            "direct": false,
            "version": "0.30.21",
            "ecosystem": "npm"
          },
          {
            "name": "make-dir",
            "direct": false,
            "version": "2.1.0",
            "ecosystem": "npm"
          },
          {
            "name": "math-intrinsics",
            "direct": false,
            "version": "1.1.0",
            "ecosystem": "npm"
          },
          {
            "name": "mime-db",
            "direct": false,
            "version": "1.52.0",
            "ecosystem": "npm"
          },
          {
            "name": "mime-types",
            "direct": false,
            "version": "2.1.35",
            "ecosystem": "npm"
          },
          {
            "name": "min-indent",
            "direct": false,
            "version": "1.0.1",
            "ecosystem": "npm"
          },
          {
            "name": "minimatch",
            "direct": false,
            "version": "3.1.2",
            "ecosystem": "npm"
          },
          {
            "name": "moo-color",
            "direct": false,
            "version": "1.0.3",
            "ecosystem": "npm"
          },
          {
            "name": "ms",
            "direct": false,
            "version": "2.1.3",
            "ecosystem": "npm"
          },
          {
            "name": "msw",
            "direct": false,
            "version": "2.10.4",
            "ecosystem": "npm"
          },
          {
            "name": "mute-stream",
            "direct": false,
            "version": "2.0.0",
            "ecosystem": "npm"
          },
          {
            "name": "nanoid",
            "direct": false,
            "version": "3.3.11",
            "ecosystem": "npm"
          },
          {
            "name": "netmask",
            "direct": false,
            "version": "2.0.2",
            "ecosystem": "npm"
          },
          {
            "name": "node-fetch",
            "direct": false,
            "version": "2.7.0",
            "ecosystem": "npm"
          },
          {
            "name": "node-fetch",
            "direct": false,
            "version": "^2.6.1",
            "ecosystem": "npm"
          },
          {
            "name": "node-releases",
            "direct": false,
            "version": "2.0.19",
            "ecosystem": "npm"
          },
          {
            "name": "normalize-path",
            "direct": false,
            "version": "3.0.0",
            "ecosystem": "npm"
          },
          {
            "name": "nwsapi",
            "direct": false,
            "version": "2.2.20",
            "ecosystem": "npm"
          },
          {
            "name": "obug",
            "direct": false,
            "version": "2.1.1",
            "ecosystem": "npm"
          },
          {
            "name": "once",
            "direct": false,
            "version": "1.4.0",
            "ecosystem": "npm"
          },
          {
            "name": "outvariant",
            "direct": false,
            "version": "1.4.3",
            "ecosystem": "npm"
          },
          {
            "name": "oxfmt",
            "direct": false,
            "version": "0.41.0",
            "ecosystem": "npm"
          },
          {
            "name": "oxlint",
            "direct": false,
            "version": "1.56.0",
            "ecosystem": "npm"
          },
          {
            "name": "pac-proxy-agent",
            "direct": false,
            "version": "7.2.0",
            "ecosystem": "npm"
          },
          {
            "name": "pac-resolver",
            "direct": false,
            "version": "7.0.1",
            "ecosystem": "npm"
          },
          {
            "name": "parse5",
            "direct": false,
            "version": "7.3.0",
            "ecosystem": "npm"
          },
          {
            "name": "path-is-absolute",
            "direct": false,
            "version": "1.0.1",
            "ecosystem": "npm"
          },
          {
            "name": "path-to-regexp",
            "direct": false,
            "version": "6.3.0",
            "ecosystem": "npm"
          },
          {
            "name": "pathe",
            "direct": false,
            "version": "2.0.3",
            "ecosystem": "npm"
          },
          {
            "name": "pend",
            "direct": false,
            "version": "1.2.0",
            "ecosystem": "npm"
          },
          {
            "name": "picocolors",
            "direct": false,
            "version": "1.1.1",
            "ecosystem": "npm"
          },
          {
            "name": "picomatch",
            "direct": false,
            "version": "2.3.1",
            "ecosystem": "npm"
          },
          {
            "name": "picomatch",
            "direct": false,
            "version": "4.0.3",
            "ecosystem": "npm"
          },
          {
            "name": "picomatch",
            "direct": false,
            "version": "4.0.4",
            "ecosystem": "npm"
          },
          {
            "name": "pify",
            "direct": false,
            "version": "4.0.1",
            "ecosystem": "npm"
          },
          {
            "name": "pkg-types",
            "direct": false,
            "version": "2.3.0",
            "ecosystem": "npm"
          },
          {
            "name": "playwright",
            "direct": false,
            "version": "1.58.2",
            "ecosystem": "npm"
          },
          {
            "name": "playwright-core",
            "direct": false,
            "version": "1.58.2",
            "ecosystem": "npm"
          },
          {
            "name": "postcss",
            "direct": false,
            "version": "8.5.6",
            "ecosystem": "npm"
          },
          {
            "name": "postcss-load-config",
            "direct": false,
            "version": "6.0.1",
            "ecosystem": "npm"
          },
          {
            "name": "pretty-format",
            "direct": false,
            "version": "27.5.1",
            "ecosystem": "npm"
          },
          {
            "name": "progress",
            "direct": false,
            "version": "2.0.3",
            "ecosystem": "npm"
          },
          {
            "name": "proxy-agent",
            "direct": false,
            "version": "6.5.0",
            "ecosystem": "npm"
          },
          {
            "name": "proxy-from-env",
            "direct": false,
            "version": "1.1.0",
            "ecosystem": "npm"
          },
          {
            "name": "psl",
            "direct": false,
            "version": "1.15.0",
            "ecosystem": "npm"
          },
          {
            "name": "pump",
            "direct": false,
            "version": "3.0.3",
            "ecosystem": "npm"
          },
          {
            "name": "punycode",
            "direct": false,
            "version": "2.3.1",
            "ecosystem": "npm"
          },
          {
            "name": "quansync",
            "direct": false,
            "version": "1.0.0",
            "ecosystem": "npm"
          },
          {
            "name": "querystringify",
            "direct": false,
            "version": "2.2.0",
            "ecosystem": "npm"
          },
          {
            "name": "react",
            "direct": false,
            "version": "18.3.1",
            "ecosystem": "npm"
          },
          {
            "name": "react",
            "direct": false,
            "version": "^18.0",
            "ecosystem": "npm"
          },
          {
            "name": "react",
            "direct": false,
            "version": "^18.0 || ^19.0",
            "ecosystem": "npm"
          },
          {
            "name": "react-dom",
            "direct": false,
            "version": "18.3.1",
            "ecosystem": "npm"
          },
          {
            "name": "react-dom",
            "direct": false,
            "version": "^18.0",
            "ecosystem": "npm"
          },
          {
            "name": "react-dom",
            "direct": false,
            "version": "^18.0 || ^19.0",
            "ecosystem": "npm"
          },
          {
            "name": "react-is",
            "direct": false,
            "version": "17.0.2",
            "ecosystem": "npm"
          },
          {
            "name": "react-refresh",
            "direct": false,
            "version": "0.17.0",
            "ecosystem": "npm"
          },
          {
            "name": "readdirp",
            "direct": false,
            "version": "3.6.0",
            "ecosystem": "npm"
          },
          {
            "name": "redent",
            "direct": false,
            "version": "3.0.0",
            "ecosystem": "npm"
          },
          {
            "name": "regenerator-runtime",
            "direct": false,
            "version": "^0.13.9",
            "ecosystem": "npm"
          },
          {
            "name": "require-directory",
            "direct": false,
            "version": "2.1.1",
            "ecosystem": "npm"
          },
          {
            "name": "requires-port",
            "direct": false,
            "version": "1.0.0",
            "ecosystem": "npm"
          },
          {
            "name": "resize-observer-polyfill",
            "direct": false,
            "version": "1.5.1",
            "ecosystem": "npm"
          },
          {
            "name": "resize-observer-polyfill",
            "direct": false,
            "version": "^1.5.1",
            "ecosystem": "npm"
          },
          {
            "name": "resolve-pkg-maps",
            "direct": false,
            "version": "1.0.0",
            "ecosystem": "npm"
          },
          {
            "name": "rolldown",
            "direct": false,
            "version": "1.0.0-rc.9",
            "ecosystem": "npm"
          },
          {
            "name": "rolldown",
            "direct": false,
            "version": "1.0.1",
            "ecosystem": "npm"
          },
          {
            "name": "rolldown-plugin-dts",
            "direct": false,
            "version": "0.25.0",
            "ecosystem": "npm"
          },
          {
            "name": "rollup",
            "direct": false,
            "version": "4.59.0",
            "ecosystem": "npm"
          },
          {
            "name": "rrweb-cssom",
            "direct": false,
            "version": "0.8.0",
            "ecosystem": "npm"
          },
          {
            "name": "safer-buffer",
            "direct": false,
            "version": "2.1.2",
            "ecosystem": "npm"
          },
          {
            "name": "saxes",
            "direct": false,
            "version": "6.0.0",
            "ecosystem": "npm"
          },
          {
            "name": "scheduler",
            "direct": false,
            "version": "0.23.2",
            "ecosystem": "npm"
          },
          {
            "name": "semver",
            "direct": false,
            "version": "5.7.2",
            "ecosystem": "npm"
          },
          {
            "name": "semver",
            "direct": false,
            "version": "6.3.1",
            "ecosystem": "npm"
          },
          {
            "name": "semver",
            "direct": false,
            "version": "7.7.4",
            "ecosystem": "npm"
          },
          {
            "name": "siginfo",
            "direct": false,
            "version": "2.0.0",
            "ecosystem": "npm"
          },
          {
            "name": "signal-exit",
            "direct": false,
            "version": "4.1.0",
            "ecosystem": "npm"
          },
          {
            "name": "slash",
            "direct": false,
            "version": "2.0.0",
            "ecosystem": "npm"
          },
          {
            "name": "smart-buffer",
            "direct": false,
            "version": "4.2.0",
            "ecosystem": "npm"
          },
          {
            "name": "socks",
            "direct": false,
            "version": "2.8.7",
            "ecosystem": "npm"
          },
          {
            "name": "socks-proxy-agent",
            "direct": false,
            "version": "8.0.5",
            "ecosystem": "npm"
          },
          {
            "name": "source-map",
            "direct": false,
            "version": "0.6.1",
            "ecosystem": "npm"
          },
          {
            "name": "source-map-js",
            "direct": false,
            "version": "1.2.1",
            "ecosystem": "npm"
          },
          {
            "name": "source-map-support",
            "direct": false,
            "version": "0.5.21",
            "ecosystem": "npm"
          },
          {
            "name": "stackback",
            "direct": false,
            "version": "0.0.2",
            "ecosystem": "npm"
          },
          {
            "name": "statuses",
            "direct": false,
            "version": "2.0.2",
            "ecosystem": "npm"
          },
          {
            "name": "std-env",
            "direct": false,
            "version": "4.0.0",
            "ecosystem": "npm"
          },
          {
            "name": "streamx",
            "direct": false,
            "version": "2.23.0",
            "ecosystem": "npm"
          },
          {
            "name": "strict-event-emitter",
            "direct": false,
            "version": "0.5.1",
            "ecosystem": "npm"
          },
          {
            "name": "string-width",
            "direct": false,
            "version": "4.2.3",
            "ecosystem": "npm"
          },
          {
            "name": "strip-ansi",
            "direct": false,
            "version": "6.0.1",
            "ecosystem": "npm"
          },
          {
            "name": "strip-indent",
            "direct": false,
            "version": "3.0.0",
            "ecosystem": "npm"
          },
          {
            "name": "supports-color",
            "direct": false,
            "version": "7.2.0",
            "ecosystem": "npm"
          },
          {
            "name": "symbol-tree",
            "direct": false,
            "version": "3.2.4",
            "ecosystem": "npm"
          },
          {
            "name": "tar-fs",
            "direct": false,
            "version": "3.1.1",
            "ecosystem": "npm"
          },
          {
            "name": "tar-stream",
            "direct": false,
            "version": "3.1.7",
            "ecosystem": "npm"
          },
          {
            "name": "teex",
            "direct": false,
            "version": "1.0.1",
            "ecosystem": "npm"
          },
          {
            "name": "terser",
            "direct": false,
            "version": "5.43.1",
            "ecosystem": "npm"
          },
          {
            "name": "text-decoder",
            "direct": false,
            "version": "1.2.7",
            "ecosystem": "npm"
          },
          {
            "name": "tinybench",
            "direct": false,
            "version": "2.9.0",
            "ecosystem": "npm"
          },
          {
            "name": "tinyexec",
            "direct": false,
            "version": "1.0.2",
            "ecosystem": "npm"
          },
          {
            "name": "tinyexec",
            "direct": false,
            "version": "1.1.2",
            "ecosystem": "npm"
          },
          {
            "name": "tinyglobby",
            "direct": false,
            "version": "0.2.15",
            "ecosystem": "npm"
          },
          {
            "name": "tinyglobby",
            "direct": false,
            "version": "0.2.16",
            "ecosystem": "npm"
          },
          {
            "name": "tinypool",
            "direct": false,
            "version": "2.1.0",
            "ecosystem": "npm"
          },
          {
            "name": "tinyrainbow",
            "direct": false,
            "version": "3.1.0",
            "ecosystem": "npm"
          },
          {
            "name": "tldts",
            "direct": false,
            "version": "6.1.86",
            "ecosystem": "npm"
          },
          {
            "name": "tldts-core",
            "direct": false,
            "version": "6.1.86",
            "ecosystem": "npm"
          },
          {
            "name": "to-regex-range",
            "direct": false,
            "version": "5.0.1",
            "ecosystem": "npm"
          },
          {
            "name": "tom-select",
            "direct": false,
            "version": "2.4.3",
            "ecosystem": "npm"
          },
          {
            "name": "tom-select",
            "direct": false,
            "version": "^2.2.2",
            "ecosystem": "npm"
          },
          {
            "name": "tough-cookie",
            "direct": false,
            "version": "4.1.4",
            "ecosystem": "npm"
          },
          {
            "name": "tough-cookie",
            "direct": false,
            "version": "5.1.2",
            "ecosystem": "npm"
          },
          {
            "name": "tr46",
            "direct": false,
            "version": "0.0.3",
            "ecosystem": "npm"
          },
          {
            "name": "tr46",
            "direct": false,
            "version": "5.1.1",
            "ecosystem": "npm"
          },
          {
            "name": "tree-kill",
            "direct": false,
            "version": "1.2.2",
            "ecosystem": "npm"
          },
          {
            "name": "tsdown",
            "direct": false,
            "version": "0.22.0",
            "ecosystem": "npm"
          },
          {
            "name": "tslib",
            "direct": false,
            "version": "2.8.1",
            "ecosystem": "npm"
          },
          {
            "name": "tslib",
            "direct": false,
            "version": "^2.8.1",
            "ecosystem": "npm"
          },
          {
            "name": "tsx",
            "direct": false,
            "version": "4.20.3",
            "ecosystem": "npm"
          },
          {
            "name": "type-fest",
            "direct": false,
            "version": "4.41.0",
            "ecosystem": "npm"
          },
          {
            "name": "typescript",
            "direct": false,
            "version": "5.8.3",
            "ecosystem": "npm"
          },
          {
            "name": "typescript",
            "direct": false,
            "version": "^5.8.3",
            "ecosystem": "npm"
          },
          {
            "name": "unconfig-core",
            "direct": false,
            "version": "7.5.0",
            "ecosystem": "npm"
          },
          {
            "name": "undici-types",
            "direct": false,
            "version": "6.21.0",
            "ecosystem": "npm"
          },
          {
            "name": "undici-types",
            "direct": false,
            "version": "7.18.2",
            "ecosystem": "npm"
          },
          {
            "name": "universalify",
            "direct": false,
            "version": "0.2.0",
            "ecosystem": "npm"
          },
          {
            "name": "unrun",
            "direct": false,
            "version": "0.2.32",
            "ecosystem": "npm"
          },
          {
            "name": "update-browserslist-db",
            "direct": false,
            "version": "1.1.3",
            "ecosystem": "npm"
          },
          {
            "name": "url-parse",
            "direct": false,
            "version": "1.5.10",
            "ecosystem": "npm"
          },
          {
            "name": "vite",
            "direct": false,
            "version": "7.3.1",
            "ecosystem": "npm"
          },
          {
            "name": "vitest",
            "direct": false,
            "version": "4.1.0",
            "ecosystem": "npm"
          },
          {
            "name": "vitest",
            "direct": false,
            "version": "^4.1.0",
            "ecosystem": "npm"
          },
          {
            "name": "vitest-canvas-mock",
            "direct": false,
            "version": "0.3.3",
            "ecosystem": "npm"
          },
          {
            "name": "vitest-canvas-mock",
            "direct": false,
            "version": "^0.3.3",
            "ecosystem": "npm"
          },
          {
            "name": "vitest-fetch-mock",
            "direct": false,
            "version": "0.2.2",
            "ecosystem": "npm"
          },
          {
            "name": "vitest-fetch-mock",
            "direct": false,
            "version": "^0.2.2",
            "ecosystem": "npm"
          },
          {
            "name": "vue",
            "direct": false,
            "version": "3.5.17",
            "ecosystem": "npm"
          },
          {
            "name": "vue",
            "direct": false,
            "version": "^3.0",
            "ecosystem": "npm"
          },
          {
            "name": "vue-loader",
            "direct": false,
            "version": "^17.0.0",
            "ecosystem": "npm"
          },
          {
            "name": "w3c-xmlserializer",
            "direct": false,
            "version": "5.0.0",
            "ecosystem": "npm"
          },
          {
            "name": "webidl-conversions",
            "direct": false,
            "version": "3.0.1",
            "ecosystem": "npm"
          },
          {
            "name": "webidl-conversions",
            "direct": false,
            "version": "7.0.0",
            "ecosystem": "npm"
          },
          {
            "name": "webpack",
            "direct": false,
            "version": "^5.74.0",
            "ecosystem": "npm"
          },
          {
            "name": "webpack-cli",
            "direct": false,
            "version": "^5.1.0",
            "ecosystem": "npm"
          },
          {
            "name": "whatwg-encoding",
            "direct": false,
            "version": "3.1.1",
            "ecosystem": "npm"
          },
          {
            "name": "whatwg-mimetype",
            "direct": false,
            "version": "4.0.0",
            "ecosystem": "npm"
          },
          {
            "name": "whatwg-url",
            "direct": false,
            "version": "14.2.0",
            "ecosystem": "npm"
          },
          {
            "name": "whatwg-url",
            "direct": false,
            "version": "5.0.0",
            "ecosystem": "npm"
          },
          {
            "name": "why-is-node-running",
            "direct": false,
            "version": "2.3.0",
            "ecosystem": "npm"
          },
          {
            "name": "wrap-ansi",
            "direct": false,
            "version": "6.2.0",
            "ecosystem": "npm"
          },
          {
            "name": "wrap-ansi",
            "direct": false,
            "version": "7.0.0",
            "ecosystem": "npm"
          },
          {
            "name": "wrappy",
            "direct": false,
            "version": "1.0.2",
            "ecosystem": "npm"
          },
          {
            "name": "ws",
            "direct": false,
            "version": "8.18.3",
            "ecosystem": "npm"
          },
          {
            "name": "xml-name-validator",
            "direct": false,
            "version": "5.0.0",
            "ecosystem": "npm"
          },
          {
            "name": "xmlchars",
            "direct": false,
            "version": "2.2.0",
            "ecosystem": "npm"
          },
          {
            "name": "y18n",
            "direct": false,
            "version": "5.0.8",
            "ecosystem": "npm"
          },
          {
            "name": "yallist",
            "direct": false,
            "version": "3.1.1",
            "ecosystem": "npm"
          },
          {
            "name": "yargs",
            "direct": false,
            "version": "17.7.2",
            "ecosystem": "npm"
          },
          {
            "name": "yargs-parser",
            "direct": false,
            "version": "21.1.1",
            "ecosystem": "npm"
          },
          {
            "name": "yauzl",
            "direct": false,
            "version": "2.10.0",
            "ecosystem": "npm"
          },
          {
            "name": "yoctocolors-cjs",
            "direct": false,
            "version": "2.1.3",
            "ecosystem": "npm"
          },
          {
            "name": "doctrine/annotations",
            "direct": false,
            "version": null,
            "ecosystem": "packagist"
          },
          {
            "name": "doctrine/collections",
            "direct": false,
            "version": null,
            "ecosystem": "packagist"
          },
          {
            "name": "doctrine/persistence",
            "direct": false,
            "version": null,
            "ecosystem": "packagist"
          },
          {
            "name": "ext-ctype",
            "direct": false,
            "version": null,
            "ecosystem": "packagist"
          },
          {
            "name": "ext-iconv",
            "direct": false,
            "version": null,
            "ecosystem": "packagist"
          },
          {
            "name": "fakerphp/faker",
            "direct": false,
            "version": null,
            "ecosystem": "packagist"
          },
          {
            "name": "kornrunner/blurhash",
            "direct": false,
            "version": null,
            "ecosystem": "packagist"
          },
          {
            "name": "league/commonmark",
            "direct": false,
            "version": null,
            "ecosystem": "packagist"
          },
          {
            "name": "mtdowling/jmespath.php",
            "direct": false,
            "version": null,
            "ecosystem": "packagist"
          },
          {
            "name": "php",
            "direct": false,
            "version": null,
            "ecosystem": "packagist"
          },
          {
            "name": "php-cs-fixer/shim",
            "direct": false,
            "version": null,
            "ecosystem": "packagist"
          },
          {
            "name": "phpdocumentor/reflection-docblock",
            "direct": false,
            "version": null,
            "ecosystem": "packagist"
          },
          {
            "name": "phpstan/phpdoc-parser",
            "direct": false,
            "version": null,
            "ecosystem": "packagist"
          },
          {
            "name": "phpstan/phpstan",
            "direct": false,
            "version": null,
            "ecosystem": "packagist"
          },
          {
            "name": "phpunit/phpunit",
            "direct": false,
            "version": null,
            "ecosystem": "packagist"
          },
          {
            "name": "psr/log",
            "direct": false,
            "version": null,
            "ecosystem": "packagist"
          },
          {
            "name": "spatie/phpunit-snapshot-assertions",
            "direct": false,
            "version": null,
            "ecosystem": "packagist"
          },
          {
            "name": "symfony/browser-kit",
            "direct": false,
            "version": null,
            "ecosystem": "packagist"
          },
          {
            "name": "symfony/cache-contracts",
            "direct": false,
            "version": null,
            "ecosystem": "packagist"
          },
          {
            "name": "symfony/css-selector",
            "direct": false,
            "version": null,
            "ecosystem": "packagist"
          },
          {
            "name": "symfony/debug-bundle",
            "direct": false,
            "version": null,
            "ecosystem": "packagist"
          },
          {
            "name": "symfony/dom-crawler",
            "direct": false,
            "version": null,
            "ecosystem": "packagist"
          },
          {
            "name": "symfony/maker-bundle",
            "direct": false,
            "version": null,
            "ecosystem": "packagist"
          },
          {
            "name": "symfony/messenger",
            "direct": false,
            "version": null,
            "ecosystem": "packagist"
          },
          {
            "name": "symfony/phpunit-bridge",
            "direct": false,
            "version": null,
            "ecosystem": "packagist"
          },
          {
            "name": "symfony/security-bundle",
            "direct": false,
            "version": null,
            "ecosystem": "packagist"
          },
          {
            "name": "symfony/security-core",
            "direct": false,
            "version": null,
            "ecosystem": "packagist"
          },
          {
            "name": "symfony/stopwatch",
            "direct": false,
            "version": null,
            "ecosystem": "packagist"
          },
          {
            "name": "symfony/var-dumper",
            "direct": false,
            "version": null,
            "ecosystem": "packagist"
          },
          {
            "name": "symfony/web-profiler-bundle",
            "direct": false,
            "version": null,
            "ecosystem": "packagist"
          },
          {
            "name": "tales-from-a-dev/twig-tailwind-extra",
            "direct": false,
            "version": null,
            "ecosystem": "packagist"
          },
          {
            "name": "twig/html-extra",
            "direct": false,
            "version": null,
            "ecosystem": "packagist"
          },
          {
            "name": "vincentlanglet/twig-cs-fixer",
            "direct": false,
            "version": null,
            "ecosystem": "packagist"
          },
          {
            "name": "zenstruck/browser",
            "direct": false,
            "version": null,
            "ecosystem": "packagist"
          },
          {
            "name": "zenstruck/console-test",
            "direct": false,
            "version": null,
            "ecosystem": "packagist"
          }
        ],
        "collected": true,
        "truncated": false,
        "total_count": 751,
        "direct_count": 63,
        "indirect_count": 688
      }
    },
    "maintainership": {
      "issues": {
        "open_prs": 55,
        "merged_prs": 1891,
        "open_issues": 99,
        "closed_ratio": 0.922,
        "closed_issues": 1168,
        "closed_unmerged_prs": 387
      },
      "bus_factor": 2,
      "bot_contributors": 2,
      "top_contributors": [
        {
          "type": "User",
          "login": "Kocal",
          "commits": 1284,
          "avatar_url": "https://avatars.githubusercontent.com/u/2103975?v=4"
        },
        {
          "type": "User",
          "login": "weaverryan",
          "commits": 1085,
          "avatar_url": "https://avatars.githubusercontent.com/u/121003?v=4"
        },
        {
          "type": "User",
          "login": "smnandre",
          "commits": 438,
          "avatar_url": "https://avatars.githubusercontent.com/u/1359581?v=4"
        },
        {
          "type": "User",
          "login": "kbond",
          "commits": 396,
          "avatar_url": "https://avatars.githubusercontent.com/u/127811?v=4"
        },
        {
          "type": "User",
          "login": "javiereguiluz",
          "commits": 121,
          "avatar_url": "https://avatars.githubusercontent.com/u/73419?v=4"
        },
        {
          "type": "User",
          "login": "Lustmored",
          "commits": 63,
          "avatar_url": "https://avatars.githubusercontent.com/u/2358046?v=4"
        },
        {
          "type": "User",
          "login": "seb-jean",
          "commits": 61,
          "avatar_url": "https://avatars.githubusercontent.com/u/12116264?v=4"
        },
        {
          "type": "User",
          "login": "tgalopin",
          "commits": 54,
          "avatar_url": "https://avatars.githubusercontent.com/u/1651494?v=4"
        },
        {
          "type": "User",
          "login": "norkunas",
          "commits": 36,
          "avatar_url": "https://avatars.githubusercontent.com/u/2722872?v=4"
        },
        {
          "type": "User",
          "login": "nicolas-grekas",
          "commits": 34,
          "avatar_url": "https://avatars.githubusercontent.com/u/243674?v=4"
        }
      ],
      "contributors_sampled": 98,
      "top_contributor_share": 0.315
    },
    "quality_signals": {
      "has_ci": true,
      "has_tests": true,
      "ci_workflows": [
        "app-demo-native.yaml",
        "app-encore.yaml",
        "browser-tests.yml",
        "code-quality.yaml",
        "dist-files-size-diff-comment.yaml",
        "dist-files-size-diff.yaml",
        "dist-files-unbuilt.yaml",
        "doctor-rst.yaml",
        "fabbot.yaml",
        "prepare-npm-release.yaml",
        "release-on-npm.yaml",
        "toolkit-lint-kits.yaml",
        "unit-tests.yaml",
        "zizmor.yaml"
      ],
      "has_docs_dir": false,
      "linter_configs": [
        ".php-cs-fixer.dist.php",
        "biome.json"
      ],
      "has_editorconfig": true,
      "has_linter_config": true,
      "has_precommit_config": false
    },
    "security_signals": {
      "lockfiles": [
        "package-lock.json",
        "pnpm-lock.yaml"
      ],
      "scorecard": {
        "checks": [
          {
            "name": "Binary-Artifacts",
            "score": 10,
            "reason": "no binaries found in the repo",
            "documentation_url": "https://github.com/ossf/scorecard/blob/c395761df6afe1a69e476bc60a013a94bcbc153f/docs/checks.md#binary-artifacts"
          },
          {
            "name": "Branch-Protection",
            "score": 3,
            "reason": "branch protection is not maximal on development and all release branches",
            "documentation_url": "https://github.com/ossf/scorecard/blob/c395761df6afe1a69e476bc60a013a94bcbc153f/docs/checks.md#branch-protection"
          },
          {
            "name": "CI-Tests",
            "score": 10,
            "reason": "13 out of 13 merged PRs checked by a CI test -- score normalized to 10",
            "documentation_url": "https://github.com/ossf/scorecard/blob/c395761df6afe1a69e476bc60a013a94bcbc153f/docs/checks.md#ci-tests"
          },
          {
            "name": "CII-Best-Practices",
            "score": 0,
            "reason": "no effort to earn an OpenSSF best practices badge detected",
            "documentation_url": "https://github.com/ossf/scorecard/blob/c395761df6afe1a69e476bc60a013a94bcbc153f/docs/checks.md#cii-best-practices"
          },
          {
            "name": "Code-Review",
            "score": 5,
            "reason": "Found 7/14 approved changesets -- score normalized to 5",
            "documentation_url": "https://github.com/ossf/scorecard/blob/c395761df6afe1a69e476bc60a013a94bcbc153f/docs/checks.md#code-review"
          },
          {
            "name": "Contributors",
            "score": 10,
            "reason": "project has 59 contributing companies or organizations",
            "documentation_url": "https://github.com/ossf/scorecard/blob/c395761df6afe1a69e476bc60a013a94bcbc153f/docs/checks.md#contributors"
          },
          {
            "name": "Dangerous-Workflow",
            "score": 10,
            "reason": "no dangerous workflow patterns detected",
            "documentation_url": "https://github.com/ossf/scorecard/blob/c395761df6afe1a69e476bc60a013a94bcbc153f/docs/checks.md#dangerous-workflow"
          },
          {
            "name": "Dependency-Update-Tool",
            "score": 10,
            "reason": "update tool detected",
            "documentation_url": "https://github.com/ossf/scorecard/blob/c395761df6afe1a69e476bc60a013a94bcbc153f/docs/checks.md#dependency-update-tool"
          },
          {
            "name": "Fuzzing",
            "score": 0,
            "reason": "project is not fuzzed",
            "documentation_url": "https://github.com/ossf/scorecard/blob/c395761df6afe1a69e476bc60a013a94bcbc153f/docs/checks.md#fuzzing"
          },
          {
            "name": "License",
            "score": 10,
            "reason": "license file detected",
            "documentation_url": "https://github.com/ossf/scorecard/blob/c395761df6afe1a69e476bc60a013a94bcbc153f/docs/checks.md#license"
          },
          {
            "name": "Maintained",
            "score": 10,
            "reason": "30 commit(s) and 8 issue activity found in the last 90 days -- score normalized to 10",
            "documentation_url": "https://github.com/ossf/scorecard/blob/c395761df6afe1a69e476bc60a013a94bcbc153f/docs/checks.md#maintained"
          },
          {
            "name": "Packaging",
            "score": 10,
            "reason": "packaging workflow detected",
            "documentation_url": "https://github.com/ossf/scorecard/blob/c395761df6afe1a69e476bc60a013a94bcbc153f/docs/checks.md#packaging"
          },
          {
            "name": "Pinned-Dependencies",
            "score": 6,
            "reason": "dependency not pinned by hash detected -- score normalized to 6",
            "documentation_url": "https://github.com/ossf/scorecard/blob/c395761df6afe1a69e476bc60a013a94bcbc153f/docs/checks.md#pinned-dependencies"
          },
          {
            "name": "SAST",
            "score": 10,
            "reason": "SAST tool is run on all commits",
            "documentation_url": "https://github.com/ossf/scorecard/blob/c395761df6afe1a69e476bc60a013a94bcbc153f/docs/checks.md#sast"
          },
          {
            "name": "Security-Policy",
            "score": 10,
            "reason": "security policy file detected",
            "documentation_url": "https://github.com/ossf/scorecard/blob/c395761df6afe1a69e476bc60a013a94bcbc153f/docs/checks.md#security-policy"
          },
          {
            "name": "Signed-Releases",
            "score": null,
            "reason": "no releases found",
            "documentation_url": "https://github.com/ossf/scorecard/blob/c395761df6afe1a69e476bc60a013a94bcbc153f/docs/checks.md#signed-releases"
          },
          {
            "name": "Token-Permissions",
            "score": 0,
            "reason": "detected GitHub workflow tokens with excessive permissions",
            "documentation_url": "https://github.com/ossf/scorecard/blob/c395761df6afe1a69e476bc60a013a94bcbc153f/docs/checks.md#token-permissions"
          },
          {
            "name": "Vulnerabilities",
            "score": 0,
            "reason": "27 existing vulnerabilities detected",
            "documentation_url": "https://github.com/ossf/scorecard/blob/c395761df6afe1a69e476bc60a013a94bcbc153f/docs/checks.md#vulnerabilities"
          }
        ],
        "commit": "095f29610b644fa8260ee3407b4cab7bd52ac765",
        "ran_at": "2026-07-26T05:06:59Z",
        "aggregate_score": 6.6,
        "scorecard_version": "v5.5.0"
      },
      "has_codeql_workflow": false,
      "has_security_policy": false,
      "has_dependabot_config": true
    },
    "contribution_flow": {
      "collected": true,
      "ci_last_run_at": "2026-07-25T13:26:58Z",
      "oldest_open_prs": [
        {
          "number": 2155,
          "created_at": "2024-09-11T15:52:07Z",
          "last_comment_at": "2026-04-14T12:11:28Z",
          "last_comment_author": "pentiminax"
        },
        {
          "number": 2486,
          "created_at": "2025-01-06T14:19:52Z",
          "last_comment_at": "2026-04-14T12:04:41Z",
          "last_comment_author": "Kocal"
        },
        {
          "number": 2689,
          "created_at": "2025-04-10T14:27:31Z",
          "last_comment_at": "2025-09-20T15:00:13Z",
          "last_comment_author": "sukei"
        },
        {
          "number": 2767,
          "created_at": "2025-05-23T14:41:13Z",
          "last_comment_at": "2026-04-14T12:04:17Z",
          "last_comment_author": "Kocal"
        },
        {
          "number": 2967,
          "created_at": "2025-08-01T06:11:17Z",
          "last_comment_at": "2026-04-14T12:04:56Z",
          "last_comment_author": "Kocal"
        },
        {
          "number": 3111,
          "created_at": "2025-09-29T07:13:31Z",
          "last_comment_at": "2026-04-14T19:55:54Z",
          "last_comment_author": "github-actions"
        },
        {
          "number": 3188,
          "created_at": "2025-11-23T15:26:20Z",
          "last_comment_at": "2026-04-14T12:10:26Z",
          "last_comment_author": "razbakov"
        },
        {
          "number": 3232,
          "created_at": "2025-12-12T18:06:03Z",
          "last_comment_at": "2026-04-23T06:23:06Z",
          "last_comment_author": "daFish"
        },
        {
          "number": 3302,
          "created_at": "2026-01-16T11:52:08Z",
          "last_comment_at": "2026-04-21T11:36:00Z",
          "last_comment_author": "Wertisdk"
        },
        {
          "number": 3365,
          "created_at": "2026-03-07T18:12:15Z",
          "last_comment_at": "2026-06-24T18:29:07Z",
          "last_comment_author": "mmarton"
        },
        {
          "number": 3395,
          "created_at": "2026-03-20T14:19:55Z",
          "last_comment_at": "2026-07-16T18:26:36Z",
          "last_comment_author": "seb-jean"
        },
        {
          "number": 3441,
          "created_at": "2026-04-07T15:14:31Z",
          "last_comment_at": "2026-04-14T17:08:02Z",
          "last_comment_author": "Prometee"
        },
        {
          "number": 3443,
          "created_at": "2026-04-07T16:00:09Z",
          "last_comment_at": "2026-04-14T12:14:51Z",
          "last_comment_author": "github-actions"
        },
        {
          "number": 3448,
          "created_at": "2026-04-08T11:40:30Z",
          "last_comment_at": "2026-04-14T11:39:54Z",
          "last_comment_author": "Kocal"
        },
        {
          "number": 3463,
          "created_at": "2026-04-13T22:21:02Z",
          "last_comment_at": "2026-07-14T07:27:37Z",
          "last_comment_author": "BafS"
        },
        {
          "number": 3465,
          "created_at": "2026-04-14T15:26:55Z",
          "last_comment_at": "2026-04-27T09:18:43Z",
          "last_comment_author": "github-actions"
        },
        {
          "number": 3469,
          "created_at": "2026-04-14T18:09:58Z",
          "last_comment_at": "2026-07-24T13:57:05Z",
          "last_comment_author": "mlwymore"
        },
        {
          "number": 3473,
          "created_at": "2026-04-15T13:34:46Z",
          "last_comment_at": "2026-04-23T12:54:55Z",
          "last_comment_author": "Amoifr"
        },
        {
          "number": 3479,
          "created_at": "2026-04-18T14:30:55Z",
          "last_comment_at": "2026-04-19T08:53:02Z",
          "last_comment_author": "Amoifr"
        },
        {
          "number": 3480,
          "created_at": "2026-04-18T14:31:39Z",
          "last_comment_at": "2026-04-19T09:17:42Z",
          "last_comment_author": "Amoifr"
        }
      ],
      "last_merged_pr_at": "2026-07-24T18:26:02Z",
      "ci_last_conclusion": "CANCELLED",
      "oldest_open_issues": [
        {
          "number": 3,
          "created_at": "2020-12-03T14:07:36Z",
          "last_comment_at": "2021-05-04T07:15:58Z",
          "last_comment_author": "stakovicz"
        },
        {
          "number": 7,
          "created_at": "2020-12-04T11:36:27Z",
          "last_comment_at": "2023-10-23T13:41:46Z",
          "last_comment_author": "ytilotti"
        },
        {
          "number": 289,
          "created_at": "2022-02-25T10:31:22Z",
          "last_comment_at": "2022-03-25T12:30:18Z",
          "last_comment_author": "Lustmored"
        },
        {
          "number": 312,
          "created_at": "2022-04-17T15:49:06Z",
          "last_comment_at": null,
          "last_comment_author": null
        },
        {
          "number": 402,
          "created_at": "2022-07-26T16:12:54Z",
          "last_comment_at": "2025-06-03T20:04:06Z",
          "last_comment_author": "Bartheyrman22"
        },
        {
          "number": 441,
          "created_at": "2022-08-24T09:14:56Z",
          "last_comment_at": "2025-07-24T04:16:46Z",
          "last_comment_author": "Kocal"
        },
        {
          "number": 737,
          "created_at": "2023-02-14T12:33:22Z",
          "last_comment_at": "2024-12-18T17:20:12Z",
          "last_comment_author": "smnandre"
        },
        {
          "number": 767,
          "created_at": "2023-03-31T07:56:19Z",
          "last_comment_at": "2026-06-01T07:34:27Z",
          "last_comment_author": "Amoifr"
        },
        {
          "number": 995,
          "created_at": "2023-07-09T19:31:42Z",
          "last_comment_at": "2025-07-07T22:45:27Z",
          "last_comment_author": "smnandre"
        },
        {
          "number": 1021,
          "created_at": "2023-07-24T09:25:02Z",
          "last_comment_at": "2024-05-25T07:21:00Z",
          "last_comment_author": "carsonbot"
        },
        {
          "number": 1022,
          "created_at": "2023-07-25T10:33:54Z",
          "last_comment_at": "2025-05-23T13:40:55Z",
          "last_comment_author": "kbond"
        },
        {
          "number": 1108,
          "created_at": "2023-09-12T09:20:27Z",
          "last_comment_at": "2023-09-12T10:01:30Z",
          "last_comment_author": "norkunas"
        },
        {
          "number": 1212,
          "created_at": "2023-10-20T18:16:07Z",
          "last_comment_at": "2023-10-25T18:27:44Z",
          "last_comment_author": "weaverryan"
        },
        {
          "number": 1244,
          "created_at": "2023-11-01T12:00:55Z",
          "last_comment_at": "2025-07-14T12:45:59Z",
          "last_comment_author": "carsonbot"
        },
        {
          "number": 1384,
          "created_at": "2024-01-08T23:50:09Z",
          "last_comment_at": "2024-01-11T18:50:35Z",
          "last_comment_author": "smnandre"
        },
        {
          "number": 1516,
          "created_at": "2024-02-18T12:29:53Z",
          "last_comment_at": "2025-10-30T11:28:48Z",
          "last_comment_author": "CODEheures"
        },
        {
          "number": 1544,
          "created_at": "2024-02-23T16:18:59Z",
          "last_comment_at": "2026-03-18T01:44:46Z",
          "last_comment_author": "gremo"
        },
        {
          "number": 1589,
          "created_at": "2024-03-07T11:40:02Z",
          "last_comment_at": "2026-07-25T12:46:01Z",
          "last_comment_author": "carsonbot"
        },
        {
          "number": 1620,
          "created_at": "2024-03-13T22:06:14Z",
          "last_comment_at": "2025-01-29T10:33:35Z",
          "last_comment_author": "Kocal"
        },
        {
          "number": 1639,
          "created_at": "2024-03-21T09:08:49Z",
          "last_comment_at": "2025-07-13T12:43:43Z",
          "last_comment_author": "carsonbot"
        }
      ]
    }
  },
  "config": {
    "disabled_metrics": [],
    "disabled_categories": [],
    "disabled_components": {}
  },
  "source": {
    "url": "https://github.com/symfony/ux",
    "host": "github.com",
    "name": "ux",
    "owner": "symfony"
  },
  "metrics": {
    "overall": {
      "key": "overall",
      "band": "good",
      "name": "Overall health",
      "note": null,
      "notes": [],
      "value": 84,
      "inputs": {
        "security": 73,
        "vitality": 100,
        "community": 88,
        "governance": 79,
        "engineering": 80
      },
      "components": []
    },
    "categories": [
      {
        "key": "vitality",
        "band": "excellent",
        "name": "Vitality",
        "value": 100,
        "weight": 0.22,
        "metrics": [
          {
            "key": "development_activity",
            "band": "excellent",
            "name": "Development activity",
            "note": null,
            "notes": [],
            "value": 100,
            "inputs": {
              "commits_last_year": 1040,
              "human_commit_share": 0.97,
              "days_since_last_push": 0,
              "active_weeks_last_year": 52
            },
            "components": [
              {
                "key": "push_recency",
                "name": "Push recency",
                "detail": "last push 0 days ago",
                "points": 36,
                "status": "met",
                "details": [
                  {
                    "code": "push_recency",
                    "params": {
                      "days": 0
                    }
                  }
                ],
                "max_points": 36
              },
              {
                "key": "commit_cadence",
                "name": "Commit cadence",
                "detail": "52/52 weeks with commits",
                "points": 36,
                "status": "met",
                "details": [
                  {
                    "code": "commit_cadence_weeks",
                    "params": {
                      "weeks": 52
                    }
                  }
                ],
                "max_points": 36
              },
              {
                "key": "commit_volume",
                "name": "Commit volume",
                "detail": "1040 commits in the last year",
                "points": 18,
                "status": "met",
                "details": [
                  {
                    "code": "commits_last_year",
                    "params": {
                      "count": 1040
                    }
                  }
                ],
                "max_points": 18
              },
              {
                "key": "openssf_scorecard_maintained",
                "name": "OpenSSF Scorecard: Maintained",
                "detail": "30 commit(s) and 8 issue activity found in the last 90 days -- score normalized to 10",
                "points": 10,
                "status": "met",
                "details": [],
                "max_points": 10
              }
            ]
          },
          {
            "key": "release_discipline",
            "band": "excellent",
            "name": "Release discipline",
            "note": "Excluded from scoring (no data or not applicable): OpenSSF Scorecard: Signed-Releases. Remaining weights renormalized.",
            "notes": [
              {
                "code": "excluded_no_data",
                "params": {
                  "components": [
                    "openssf_scorecard_signed_releases"
                  ]
                }
              },
              {
                "code": "weights_renormalized",
                "params": {}
              }
            ],
            "value": 100,
            "inputs": {
              "releases_count": 62,
              "latest_release_tag": "v3.3.0",
              "releases_from_tags": false,
              "days_since_latest_release": 11,
              "mean_days_between_releases": 13.2
            },
            "components": [
              {
                "key": "ships_releases",
                "name": "Ships releases",
                "detail": "62 releases published",
                "points": 27,
                "status": "met",
                "details": [
                  {
                    "code": "releases_published",
                    "params": {
                      "count": 62
                    }
                  }
                ],
                "max_points": 27
              },
              {
                "key": "release_recency",
                "name": "Release recency",
                "detail": "latest release 11 days ago",
                "points": 36,
                "status": "met",
                "details": [
                  {
                    "code": "release_recency",
                    "params": {
                      "days": 11
                    }
                  }
                ],
                "max_points": 36
              },
              {
                "key": "release_cadence",
                "name": "Release cadence",
                "detail": "a release every ~13.2 days",
                "points": 27,
                "status": "met",
                "details": [
                  {
                    "code": "release_cadence",
                    "params": {
                      "gap": 13.2
                    }
                  }
                ],
                "max_points": 27
              },
              {
                "key": "openssf_scorecard_signed_releases",
                "name": "OpenSSF Scorecard: Signed-Releases",
                "detail": "no releases found",
                "points": 0,
                "status": "excluded",
                "details": [
                  {
                    "code": "no_data",
                    "params": {}
                  }
                ],
                "max_points": 10
              }
            ]
          },
          {
            "key": "abandonment",
            "band": "excellent",
            "name": "Abandonment",
            "note": null,
            "notes": [],
            "value": 100,
            "inputs": {
              "cap": null,
              "state": "maintained",
              "guards": [],
              "signals": [],
              "red_flag": false,
              "multiplier_pct": 100,
              "declared_reason": null,
              "unverified_reason": null,
              "unanswered_open_prs": null,
              "unanswered_open_issues": null,
              "days_since_last_merged_pr": null,
              "days_since_last_human_commit": 1,
              "days_since_last_human_commit_is_floor": false
            },
            "components": [
              {
                "key": "project_is_still_maintained",
                "name": "Project is still maintained",
                "detail": "last human commit 1 days ago",
                "points": 100,
                "status": "met",
                "details": [
                  {
                    "code": "abandonment_maintained",
                    "params": {
                      "days": 1
                    }
                  }
                ],
                "max_points": 100
              }
            ]
          }
        ],
        "description": "Is the project alive — is code being written and are releases shipping?"
      },
      {
        "key": "community",
        "band": "excellent",
        "name": "Community & Adoption",
        "value": 88,
        "weight": 0.18,
        "metrics": [
          {
            "key": "popularity",
            "band": "good",
            "name": "Popularity & adoption",
            "note": null,
            "notes": [],
            "value": 79,
            "inputs": {
              "forks": 425,
              "stars": 1068,
              "watchers": 31,
              "growth_state": "unverified",
              "growth_factor_pct": 100,
              "growth_unverified_reason": "no_history"
            },
            "components": [
              {
                "key": "stars",
                "name": "Stars",
                "detail": "1,068 stars",
                "points": 49.1,
                "status": "partial",
                "details": [
                  {
                    "code": "stars",
                    "params": {
                      "count": 1068
                    }
                  }
                ],
                "max_points": 60
              },
              {
                "key": "forks",
                "name": "Forks",
                "detail": "425 forks",
                "points": 21.9,
                "status": "partial",
                "details": [
                  {
                    "code": "forks",
                    "params": {
                      "count": 425
                    }
                  }
                ],
                "max_points": 25
              },
              {
                "key": "watchers",
                "name": "Watchers",
                "detail": "31 watchers",
                "points": 8.2,
                "status": "partial",
                "details": [
                  {
                    "code": "watchers",
                    "params": {
                      "count": 31
                    }
                  }
                ],
                "max_points": 15
              }
            ]
          },
          {
            "key": "community_health",
            "band": "excellent",
            "name": "Community health",
            "note": null,
            "notes": [],
            "value": 92,
            "inputs": {
              "has_readme": true,
              "has_license": true,
              "has_contributing": true,
              "has_issue_template": false,
              "has_code_of_conduct": true,
              "has_pull_request_template": true
            },
            "components": [
              {
                "key": "readme",
                "name": "README",
                "detail": null,
                "points": 22.5,
                "status": "met",
                "details": [],
                "max_points": 22.5
              },
              {
                "key": "license",
                "name": "License",
                "detail": "recognized license (MIT)",
                "points": 22.5,
                "status": "met",
                "details": [
                  {
                    "code": "license_standard",
                    "params": {}
                  },
                  {
                    "code": "license_spdx",
                    "params": {
                      "spdx": "MIT"
                    }
                  }
                ],
                "max_points": 22.5
              },
              {
                "key": "contributing_guide",
                "name": "CONTRIBUTING guide",
                "detail": null,
                "points": 18,
                "status": "met",
                "details": [],
                "max_points": 18
              },
              {
                "key": "code_of_conduct",
                "name": "Code of conduct",
                "detail": null,
                "points": 13.5,
                "status": "met",
                "details": [],
                "max_points": 13.5
              },
              {
                "key": "issue_template",
                "name": "Issue template",
                "detail": null,
                "points": 0,
                "status": "missed",
                "details": [],
                "max_points": 7.2
              },
              {
                "key": "pr_template",
                "name": "PR template",
                "detail": null,
                "points": 6.3,
                "status": "met",
                "details": [],
                "max_points": 6.3
              }
            ]
          },
          {
            "key": "ecosystem_adoption",
            "band": "excellent",
            "name": "Ecosystem adoption (downloads)",
            "note": null,
            "notes": [],
            "value": 95,
            "inputs": {
              "packages": [
                "symfony/ux-map",
                "symfony/ux-icons",
                "symfony/ux-react",
                "symfony/ux-turbo",
                "symfony/ux-native",
                "symfony/ux-notify",
                "symfony/ux-chartjs",
                "symfony/ux-toolkit"
              ],
              "dependents": 157,
              "ecosystems": "packagist",
              "total_downloads": 22514107,
              "monthly_downloads": 1216540
            },
            "components": [
              {
                "key": "monthly_downloads",
                "name": "Monthly downloads",
                "detail": "1,216,540 downloads/month across packagist",
                "points": 80,
                "status": "met",
                "details": [
                  {
                    "code": "downloads_monthly",
                    "params": {
                      "count": 1216540,
                      "ecosystems": "packagist"
                    }
                  }
                ],
                "max_points": 80
              },
              {
                "key": "registry_dependents",
                "name": "Registry dependents",
                "detail": "157 packages depend on it",
                "points": 14.7,
                "status": "partial",
                "details": [
                  {
                    "code": "registry_dependents",
                    "params": {
                      "count": 157
                    }
                  }
                ],
                "max_points": 20
              }
            ]
          }
        ],
        "description": "Does the project have users, downloads, attention, and a welcoming setup for contributors?"
      },
      {
        "key": "governance",
        "band": "good",
        "name": "Sustainability & Governance",
        "value": 79,
        "weight": 0.24,
        "metrics": [
          {
            "key": "maintainer_resilience",
            "band": "moderate",
            "name": "Maintainer resilience (bus factor)",
            "note": null,
            "notes": [],
            "value": 64,
            "inputs": {
              "bus_factor": 2,
              "contributors_sampled": 98,
              "top_contributor_share": 0.315
            },
            "components": [
              {
                "key": "bus_factor",
                "name": "Bus factor",
                "detail": "2 contributor(s) cover half of all commits",
                "points": 25.2,
                "status": "partial",
                "details": [
                  {
                    "code": "bus_factor",
                    "params": {
                      "count": 2
                    }
                  }
                ],
                "max_points": 54
              },
              {
                "key": "commit_distribution",
                "name": "Commit distribution",
                "detail": "top contributor authored 32% of commits",
                "points": 15.4,
                "status": "partial",
                "details": [
                  {
                    "code": "top_contributor_share",
                    "params": {
                      "share": 32
                    }
                  }
                ],
                "max_points": 22.5
              },
              {
                "key": "contributor_breadth",
                "name": "Contributor breadth",
                "detail": "98 contributors",
                "points": 13.5,
                "status": "met",
                "details": [
                  {
                    "code": "contributors_sampled",
                    "params": {
                      "count": 98
                    }
                  }
                ],
                "max_points": 13.5
              },
              {
                "key": "openssf_scorecard_contributors",
                "name": "OpenSSF Scorecard: Contributors",
                "detail": "project has 59 contributing companies or organizations",
                "points": 10,
                "status": "met",
                "details": [],
                "max_points": 10
              }
            ]
          },
          {
            "key": "responsiveness",
            "band": "good",
            "name": "Issue & PR responsiveness",
            "note": null,
            "notes": [],
            "value": 82,
            "inputs": {
              "merged_prs": 1891,
              "open_issues": 99,
              "closed_issues": 1168,
              "issue_closed_ratio": 0.922,
              "closed_unmerged_prs": 387
            },
            "components": [
              {
                "key": "issue_resolution",
                "name": "Issue resolution",
                "detail": "92% of issues closed",
                "points": 43.1,
                "status": "partial",
                "details": [
                  {
                    "code": "issues_closed_share",
                    "params": {
                      "share": 92
                    }
                  }
                ],
                "max_points": 46.75
              },
              {
                "key": "pr_acceptance",
                "name": "PR acceptance",
                "detail": "1891/2278 decided PRs merged",
                "points": 31.8,
                "status": "partial",
                "details": [
                  {
                    "code": "decided_prs_merged",
                    "params": {
                      "merged": 1891,
                      "decided": 2278
                    }
                  }
                ],
                "max_points": 38.25
              },
              {
                "key": "openssf_scorecard_code_review",
                "name": "OpenSSF Scorecard: Code-Review",
                "detail": "Found 7/14 approved changesets -- score normalized to 5",
                "points": 7.5,
                "status": "partial",
                "details": [],
                "max_points": 15
              }
            ]
          },
          {
            "key": "stewardship",
            "band": "good",
            "name": "Ownership & stewardship",
            "note": null,
            "notes": [],
            "value": 79,
            "inputs": {
              "followers": 2177,
              "owner_type": "Organization",
              "is_verified": null,
              "owner_login": "symfony",
              "public_repos": 414,
              "account_age_days": 6119
            },
            "components": [
              {
                "key": "ownership_backing",
                "name": "Ownership backing",
                "detail": "organization-owned",
                "points": 30,
                "status": "met",
                "details": [
                  {
                    "code": "owner_organization",
                    "params": {}
                  }
                ],
                "max_points": 30
              },
              {
                "key": "verified_domain",
                "name": "Verified domain",
                "detail": null,
                "points": 0,
                "status": "missed",
                "details": [],
                "max_points": 20
              },
              {
                "key": "owner_reach",
                "name": "Owner reach",
                "detail": "2,177 followers of symfony",
                "points": 24,
                "status": "partial",
                "details": [
                  {
                    "code": "owner_followers",
                    "params": {
                      "count": 2177,
                      "login": "symfony"
                    }
                  }
                ],
                "max_points": 25
              },
              {
                "key": "track_record",
                "name": "Track record",
                "detail": "414 public repos, account ~16 yr old",
                "points": 25,
                "status": "met",
                "details": [
                  {
                    "code": "public_repos",
                    "params": {
                      "count": 414
                    }
                  },
                  {
                    "code": "account_age_years",
                    "params": {
                      "years": 16
                    }
                  }
                ],
                "max_points": 25
              }
            ]
          },
          {
            "key": "package_maintenance",
            "band": "excellent",
            "name": "Package maintenance",
            "note": null,
            "notes": [],
            "value": 100,
            "inputs": {
              "packages": [
                "symfony/ux-map",
                "symfony/ux-icons",
                "symfony/ux-react",
                "symfony/ux-turbo",
                "symfony/ux-native",
                "symfony/ux-notify",
                "symfony/ux-chartjs",
                "symfony/ux-toolkit"
              ],
              "ecosystems": "packagist",
              "any_deprecated": false,
              "min_days_since_publish": 16
            },
            "components": [
              {
                "key": "published_resolvable",
                "name": "Published & resolvable",
                "detail": "8 package(s) on packagist",
                "points": 25,
                "status": "met",
                "details": [
                  {
                    "code": "packages_published",
                    "params": {
                      "count": 8,
                      "ecosystems": "packagist"
                    }
                  }
                ],
                "max_points": 25
              },
              {
                "key": "publish_recency",
                "name": "Publish recency",
                "detail": "latest publish 16 days ago",
                "points": 35,
                "status": "met",
                "details": [
                  {
                    "code": "publish_recency",
                    "params": {
                      "days": 16
                    }
                  }
                ],
                "max_points": 35
              },
              {
                "key": "version_history",
                "name": "Version history",
                "detail": "63 published versions",
                "points": 20,
                "status": "met",
                "details": [
                  {
                    "code": "published_versions",
                    "params": {
                      "count": 63
                    }
                  }
                ],
                "max_points": 20
              },
              {
                "key": "not_deprecated",
                "name": "Not deprecated",
                "detail": "active, not deprecated or yanked",
                "points": 20,
                "status": "met",
                "details": [
                  {
                    "code": "package_not_deprecated",
                    "params": {}
                  }
                ],
                "max_points": 20
              }
            ]
          }
        ],
        "description": "Will the project survive its people — bus factor, responsiveness, who backs it, and package upkeep?"
      },
      {
        "key": "engineering",
        "band": "good",
        "name": "Engineering Quality",
        "value": 80,
        "weight": 0.2,
        "metrics": [
          {
            "key": "engineering_practices",
            "band": "excellent",
            "name": "Engineering practices",
            "note": null,
            "notes": [],
            "value": 90,
            "inputs": {
              "has_ci": true,
              "has_tests": true,
              "has_editorconfig": true,
              "has_linter_config": true,
              "has_precommit_config": false
            },
            "components": [
              {
                "key": "ci_workflows",
                "name": "CI workflows",
                "detail": "14 workflow(s)",
                "points": 24,
                "status": "met",
                "details": [
                  {
                    "code": "ci_workflows",
                    "params": {
                      "count": 14
                    }
                  }
                ],
                "max_points": 24
              },
              {
                "key": "tests_present",
                "name": "Tests present",
                "detail": null,
                "points": 24,
                "status": "met",
                "details": [],
                "max_points": 24
              },
              {
                "key": "linter_config",
                "name": "Linter config",
                "detail": ".php-cs-fixer.dist.php, biome.json",
                "points": 16,
                "status": "met",
                "details": [
                  {
                    "code": "file_list",
                    "params": {
                      "files": ".php-cs-fixer.dist.php, biome.json"
                    }
                  }
                ],
                "max_points": 16
              },
              {
                "key": "pre_commit_hooks",
                "name": "Pre-commit hooks",
                "detail": null,
                "points": 0,
                "status": "missed",
                "details": [],
                "max_points": 9.6
              },
              {
                "key": "editorconfig",
                "name": ".editorconfig",
                "detail": null,
                "points": 6.4,
                "status": "met",
                "details": [],
                "max_points": 6.4
              },
              {
                "key": "openssf_scorecard_ci_tests",
                "name": "OpenSSF Scorecard: CI-Tests",
                "detail": "13 out of 13 merged PRs checked by a CI test -- score normalized to 10",
                "points": 20,
                "status": "met",
                "details": [],
                "max_points": 20
              }
            ]
          },
          {
            "key": "documentation",
            "band": "moderate",
            "name": "Documentation",
            "note": null,
            "notes": [],
            "value": 65,
            "inputs": {
              "topics": [
                "symfony",
                "javascript",
                "hacktoberfest"
              ],
              "has_wiki": false,
              "homepage": "https://ux.symfony.com/",
              "has_readme": true,
              "has_docs_dir": false,
              "has_description": true
            },
            "components": [
              {
                "key": "readme",
                "name": "README",
                "detail": null,
                "points": 30,
                "status": "met",
                "details": [],
                "max_points": 30
              },
              {
                "key": "documentation_directory",
                "name": "Documentation directory",
                "detail": null,
                "points": 0,
                "status": "missed",
                "details": [],
                "max_points": 25
              },
              {
                "key": "documentation_homepage_site",
                "name": "Documentation / homepage site",
                "detail": "https://ux.symfony.com/",
                "points": 15,
                "status": "met",
                "details": [],
                "max_points": 15
              },
              {
                "key": "repository_description",
                "name": "Repository description",
                "detail": null,
                "points": 10,
                "status": "met",
                "details": [],
                "max_points": 10
              },
              {
                "key": "topics",
                "name": "Topics",
                "detail": "3 topics",
                "points": 10,
                "status": "met",
                "details": [
                  {
                    "code": "topics_count",
                    "params": {
                      "count": 3
                    }
                  }
                ],
                "max_points": 10
              },
              {
                "key": "wiki",
                "name": "Wiki",
                "detail": null,
                "points": 0,
                "status": "missed",
                "details": [],
                "max_points": 10
              }
            ]
          }
        ],
        "description": "Are baseline engineering and documentation practices in place?"
      },
      {
        "key": "security",
        "band": "good",
        "name": "Security",
        "value": 73,
        "weight": 0.16,
        "metrics": [
          {
            "key": "security_posture",
            "band": "moderate",
            "name": "Security posture",
            "note": "Excluded from scoring (no data or not applicable): Signed-Releases. Remaining weights renormalized.",
            "notes": [
              {
                "code": "excluded_no_data",
                "params": {
                  "components": [
                    "signed_releases"
                  ]
                }
              },
              {
                "code": "weights_renormalized",
                "params": {}
              }
            ],
            "value": 66,
            "inputs": {
              "source": "openssf_scorecard",
              "checks_evaluated": 17,
              "scorecard_version": "v5.5.0",
              "checks_inconclusive": 1,
              "scorecard_aggregate": 6.6
            },
            "components": [
              {
                "key": "binary_artifacts",
                "name": "Binary-Artifacts",
                "detail": "no binaries found in the repo",
                "points": 7.5,
                "status": "met",
                "details": [],
                "max_points": 7.5
              },
              {
                "key": "branch_protection",
                "name": "Branch-Protection",
                "detail": "branch protection is not maximal on development and all release branches",
                "points": 2.2,
                "status": "partial",
                "details": [],
                "max_points": 7.5
              },
              {
                "key": "ci_tests",
                "name": "CI-Tests",
                "detail": "13 out of 13 merged PRs checked by a CI test -- score normalized to 10",
                "points": 2.5,
                "status": "met",
                "details": [],
                "max_points": 2.5
              },
              {
                "key": "cii_best_practices",
                "name": "CII-Best-Practices",
                "detail": "no effort to earn an OpenSSF best practices badge detected",
                "points": 0,
                "status": "missed",
                "details": [],
                "max_points": 2.5
              },
              {
                "key": "code_review",
                "name": "Code-Review",
                "detail": "Found 7/14 approved changesets -- score normalized to 5",
                "points": 3.8,
                "status": "partial",
                "details": [],
                "max_points": 7.5
              },
              {
                "key": "contributors",
                "name": "Contributors",
                "detail": "project has 59 contributing companies or organizations",
                "points": 2.5,
                "status": "met",
                "details": [],
                "max_points": 2.5
              },
              {
                "key": "dangerous_workflow",
                "name": "Dangerous-Workflow",
                "detail": "no dangerous workflow patterns detected",
                "points": 10,
                "status": "met",
                "details": [],
                "max_points": 10
              },
              {
                "key": "dependency_update_tool",
                "name": "Dependency-Update-Tool",
                "detail": "update tool detected",
                "points": 7.5,
                "status": "met",
                "details": [],
                "max_points": 7.5
              },
              {
                "key": "fuzzing",
                "name": "Fuzzing",
                "detail": "project is not fuzzed",
                "points": 0,
                "status": "missed",
                "details": [],
                "max_points": 5
              },
              {
                "key": "license",
                "name": "License",
                "detail": "license file detected",
                "points": 2.5,
                "status": "met",
                "details": [],
                "max_points": 2.5
              },
              {
                "key": "maintained",
                "name": "Maintained",
                "detail": "30 commit(s) and 8 issue activity found in the last 90 days -- score normalized to 10",
                "points": 7.5,
                "status": "met",
                "details": [],
                "max_points": 7.5
              },
              {
                "key": "packaging",
                "name": "Packaging",
                "detail": "packaging workflow detected",
                "points": 5,
                "status": "met",
                "details": [],
                "max_points": 5
              },
              {
                "key": "pinned_dependencies",
                "name": "Pinned-Dependencies",
                "detail": "dependency not pinned by hash detected -- score normalized to 6",
                "points": 3,
                "status": "partial",
                "details": [],
                "max_points": 5
              },
              {
                "key": "sast",
                "name": "SAST",
                "detail": "SAST tool is run on all commits",
                "points": 5,
                "status": "met",
                "details": [],
                "max_points": 5
              },
              {
                "key": "security_policy",
                "name": "Security-Policy",
                "detail": "security policy file detected",
                "points": 5,
                "status": "met",
                "details": [],
                "max_points": 5
              },
              {
                "key": "signed_releases",
                "name": "Signed-Releases",
                "detail": "no releases found",
                "points": 0,
                "status": "excluded",
                "details": [
                  {
                    "code": "no_data",
                    "params": {}
                  }
                ],
                "max_points": 7.5
              },
              {
                "key": "token_permissions",
                "name": "Token-Permissions",
                "detail": "detected GitHub workflow tokens with excessive permissions",
                "points": 0,
                "status": "missed",
                "details": [],
                "max_points": 7.5
              },
              {
                "key": "vulnerabilities",
                "name": "Vulnerabilities",
                "detail": "27 existing vulnerabilities detected",
                "points": 0,
                "status": "missed",
                "details": [],
                "max_points": 7.5
              }
            ]
          },
          {
            "key": "dependency_advisories",
            "band": "excellent",
            "name": "Dependency advisories",
            "note": "Excluded from scoring (no data or not applicable): Indirect dependencies free of known advisories, No advisories left outstanding. Remaining weights renormalized. Matched 606 resolved dependencies against OSV; 145 could not be assessed (no resolved version, an unsupported ecosystem, or beyond the reported package list). This repository publishes no package the index resolves, so the repository dependency graph was assessed instead. That graph mixes development and test pins with shipped dependencies, so only the declared runtime dependencies are scored; transitive findings are reported as context and excluded from the score. Reachability is not analyzed.",
            "notes": [
              {
                "code": "excluded_no_data",
                "params": {
                  "components": [
                    "indirect_dependencies_free_of_known_advisories",
                    "no_advisories_left_outstanding"
                  ]
                }
              },
              {
                "code": "weights_renormalized",
                "params": {}
              },
              {
                "code": "advisories_scope_repository",
                "params": {
                  "assessed": 606
                }
              },
              {
                "code": "advisories_unassessed",
                "params": {
                  "count": 145
                }
              },
              {
                "code": "advisories_repo_graph_caveat",
                "params": {}
              },
              {
                "code": "advisories_reachability",
                "params": {}
              }
            ],
            "value": 100,
            "inputs": {
              "source": "osv",
              "advisories": 30,
              "affected_packages": 14,
              "assessed_packages": 606,
              "unassessed_packages": 145,
              "affected_by_severity": "high 9, moderate 2, low 3",
              "direct_affected_packages": 0
            },
            "components": [
              {
                "key": "direct_dependencies_free_of_known_advisories",
                "name": "Direct dependencies free of known advisories",
                "detail": "no direct dependency carries a known advisory",
                "points": 35,
                "status": "met",
                "details": [
                  {
                    "code": "no_direct_advisories",
                    "params": {}
                  }
                ],
                "max_points": 35
              },
              {
                "key": "indirect_dependencies_free_of_known_advisories",
                "name": "Indirect dependencies free of known advisories",
                "detail": "transitive set not separable from development and test dependencies in this scope",
                "points": 0,
                "status": "excluded",
                "details": [
                  {
                    "code": "advisories_scope_not_separable",
                    "params": {}
                  }
                ],
                "max_points": 25
              },
              {
                "key": "no_advisories_left_outstanding",
                "name": "No advisories left outstanding",
                "detail": "no advisory carries a publication date",
                "points": 0,
                "status": "excluded",
                "details": [
                  {
                    "code": "advisories_no_publication_date",
                    "params": {}
                  }
                ],
                "max_points": 40
              }
            ]
          },
          {
            "key": "malicious_dependencies",
            "band": "excellent",
            "name": "Malicious dependencies",
            "note": null,
            "notes": [],
            "value": 100,
            "inputs": {
              "source": "osv",
              "meaning": "reported as a malicious package by the OpenSSF corpus; the remedy is removal or moving off the compromised name, never an upgrade of the same artifact. Versions the registry has since pulled are listed but not scored",
              "packages": [],
              "red_flag": false,
              "assessed_packages": 606,
              "malicious_packages": 0,
              "direct_malicious_packages": 0,
              "withdrawn_malicious_packages": 0,
              "installable_malicious_packages": 0
            },
            "components": [
              {
                "key": "no_dependency_reported_as_a_malicious_package",
                "name": "No dependency reported as a malicious package",
                "detail": "no dependency is reported as a malicious package",
                "points": 100,
                "status": "met",
                "details": [
                  {
                    "code": "no_malicious_dependencies",
                    "params": {}
                  }
                ],
                "max_points": 100
              }
            ]
          },
          {
            "key": "high_risk_jurisdiction_exposure",
            "band": "excellent",
            "name": "High-Risk Jurisdiction Exposure",
            "note": "Only high-confidence self-published location evidence affects this multiplier. Ambiguous matches are review-only; country evidence is not proof of nationality, citizenship, legal registration, malicious intent, or sanctions status.",
            "notes": [
              {
                "code": "jurisdiction_evidence_limits",
                "params": {}
              }
            ],
            "value": 100,
            "inputs": {
              "meaning": "self-published location evidence; not nationality or citizenship",
              "red_flag": false,
              "exposures": [],
              "policy_countries": [
                "Russia",
                "Iran",
                "North Korea"
              ],
              "review_only_matches": 0,
              "assessed_self_published_locations": 23
            },
            "components": [
              {
                "key": "policy_exposure_multiplier",
                "name": "Policy exposure multiplier",
                "detail": "no confirmed policy-scope location match",
                "points": 100,
                "status": "met",
                "details": [
                  {
                    "code": "jurisdiction_no_match",
                    "params": {}
                  }
                ],
                "max_points": 100
              }
            ]
          }
        ],
        "description": "Are visible security and supply-chain practices strong, with no malicious dependency and no unresolved high-risk jurisdiction exposure?"
      },
      {
        "key": "ai_readiness",
        "band": "good",
        "name": "AI Readiness",
        "value": 74,
        "weight": 0,
        "metrics": [
          {
            "key": "ai_agent_context",
            "band": "good",
            "name": "Agent context & guidance",
            "note": null,
            "notes": [],
            "value": 79,
            "inputs": {
              "has_llms_txt": false,
              "legible_history_share": 0.639,
              "agent_instruction_files": [
                "AGENTS.md",
                "CLAUDE.md"
              ],
              "agent_instruction_max_bytes": 5223
            },
            "components": [
              {
                "key": "agent_instructions",
                "name": "Agent instructions",
                "detail": "AGENTS.md, CLAUDE.md",
                "points": 45,
                "status": "met",
                "details": [
                  {
                    "code": "file_list",
                    "params": {
                      "files": "AGENTS.md, CLAUDE.md"
                    }
                  }
                ],
                "max_points": 45
              },
              {
                "key": "machine_readable_docs_llms_txt",
                "name": "Machine-readable docs (llms.txt)",
                "detail": null,
                "points": 0,
                "status": "missed",
                "details": [],
                "max_points": 15
              },
              {
                "key": "legible_commit_history",
                "name": "Legible commit history",
                "detail": "62 of 97 human commits state their intent (structured subject or explanatory body)",
                "points": 34.1,
                "status": "partial",
                "details": [
                  {
                    "code": "legible_history",
                    "params": {
                      "legible": 62,
                      "sampled": 97
                    }
                  }
                ],
                "max_points": 40
              }
            ]
          },
          {
            "key": "ai_verify_loop",
            "band": "moderate",
            "name": "Verify loop (build / test / typecheck)",
            "note": null,
            "notes": [],
            "value": 68,
            "inputs": {
              "has_nix": false,
              "has_tests": true,
              "lockfiles": [
                "package-lock.json",
                "pnpm-lock.yaml"
              ],
              "has_dockerfile": true,
              "typed_language": false,
              "bootstrap_files": [],
              "has_devcontainer": false,
              "has_linter_config": true,
              "typecheck_configs": [
                "src/Autocomplete/assets/tsconfig.json",
                "src/Chartjs/assets/tsconfig.json",
                "src/Cropperjs/assets/tsconfig.json",
                "src/Dropzone/assets/tsconfig.json",
                "src/LiveComponent/assets/tsconfig.json",
                "src/Map/assets/tsconfig.json",
                "src/Map/src/Bridge/Google/assets/tsconfig.json",
                "src/Map/src/Bridge/Leaflet/assets/tsconfig.json",
                "src/Notify/assets/tsconfig.json",
                "src/React/assets/tsconfig.json",
                "src/StimulusBundle/assets/tsconfig.json",
                "src/Translator/assets/tsconfig.json",
                "src/Turbo/assets/tsconfig.json",
                "src/Vue/assets/tsconfig.json",
                "tsconfig.json"
              ],
              "agent_commit_share": 0,
              "toolchain_manifests": [],
              "dependency_bot_commit_share": 0.01
            },
            "components": [
              {
                "key": "one_command_bootstrap",
                "name": "One-command bootstrap",
                "detail": null,
                "points": 0,
                "status": "missed",
                "details": [],
                "max_points": 18
              },
              {
                "key": "automated_tests",
                "name": "Automated tests",
                "detail": null,
                "points": 22,
                "status": "met",
                "details": [],
                "max_points": 22
              },
              {
                "key": "lint_format_config",
                "name": "Lint / format config",
                "detail": ".php-cs-fixer.dist.php, biome.json",
                "points": 11,
                "status": "met",
                "details": [
                  {
                    "code": "file_list",
                    "params": {
                      "files": ".php-cs-fixer.dist.php, biome.json"
                    }
                  }
                ],
                "max_points": 11
              },
              {
                "key": "static_type_checking",
                "name": "Static type checking",
                "detail": "src/Autocomplete/assets/tsconfig.json, src/Chartjs/assets/tsconfig.json, src/Cropperjs/assets/tsconfig.json, src/Dropzone/assets/tsconfig.json, src/LiveComponent/assets/tsconfig.json, src/Map/assets/tsconfig.json, src/Map/src/Bridge/Google/assets/tsconfig.json, src/Map/src/Bridge/Leaflet/assets/tsconfig.json, src/Notify/assets/tsconfig.json, src/React/assets/tsconfig.json, src/StimulusBundle/assets/tsconfig.json, src/Translator/assets/tsconfig.json, src/Turbo/assets/tsconfig.json, src/Vue/assets/tsconfig.json, tsconfig.json",
                "points": 11,
                "status": "met",
                "details": [
                  {
                    "code": "file_list",
                    "params": {
                      "files": "src/Autocomplete/assets/tsconfig.json, src/Chartjs/assets/tsconfig.json, src/Cropperjs/assets/tsconfig.json, src/Dropzone/assets/tsconfig.json, src/LiveComponent/assets/tsconfig.json, src/Map/assets/tsconfig.json, src/Map/src/Bridge/Google/assets/tsconfig.json, src/Map/src/Bridge/Leaflet/assets/tsconfig.json, src/Notify/assets/tsconfig.json, src/React/assets/tsconfig.json, src/StimulusBundle/assets/tsconfig.json, src/Translator/assets/tsconfig.json, src/Turbo/assets/tsconfig.json, src/Vue/assets/tsconfig.json, tsconfig.json"
                    }
                  }
                ],
                "max_points": 11
              },
              {
                "key": "reproducible_environment",
                "name": "Reproducible environment",
                "detail": "Dockerfile, lockfile",
                "points": 10,
                "status": "met",
                "details": [
                  {
                    "code": "file_list",
                    "params": {
                      "files": "Dockerfile, lockfile"
                    }
                  }
                ],
                "max_points": 10
              },
              {
                "key": "demonstrated_agent_practice",
                "name": "Demonstrated agent practice",
                "detail": "no agent-authored commits among the last 100",
                "points": 0,
                "status": "missed",
                "details": [
                  {
                    "code": "no_agent_authored_commits",
                    "params": {
                      "sampled": 100
                    }
                  }
                ],
                "max_points": 10
              },
              {
                "key": "automated_maintenance",
                "name": "Automated maintenance",
                "detail": "1 of the last 100 commits are automated dependency updates",
                "points": 8,
                "status": "met",
                "details": [
                  {
                    "code": "dependency_bot_commits",
                    "params": {
                      "count": 1,
                      "sampled": 100
                    }
                  }
                ],
                "max_points": 8
              },
              {
                "key": "openssf_scorecard_pinned_dependencies",
                "name": "OpenSSF Scorecard: Pinned-Dependencies",
                "detail": "dependency not pinned by hash detected -- score normalized to 6",
                "points": 6,
                "status": "partial",
                "details": [],
                "max_points": 10
              }
            ]
          },
          {
            "key": "ai_code_legibility",
            "band": "good",
            "name": "Code legibility for models",
            "note": null,
            "notes": [],
            "value": 82,
            "inputs": {
              "primary_language": "PHP",
              "largest_source_bytes": 100720,
              "source_files_sampled": 1243,
              "oversized_source_files": 1
            },
            "components": [
              {
                "key": "type_checkable_code",
                "name": "Type-checkable code",
                "detail": "PHP with type-check config (src/Autocomplete/assets/tsconfig.json, src/Chartjs/assets/tsconfig.json, src/Cropperjs/assets/tsconfig.json, src/Dropzone/assets/tsconfig.json, src/LiveComponent/assets/tsconfig.json, src/Map/assets/tsconfig.json, src/Map/src/Bridge/Google/assets/tsconfig.json, src/Map/src/Bridge/Leaflet/assets/tsconfig.json, src/Notify/assets/tsconfig.json, src/React/assets/tsconfig.json, src/StimulusBundle/assets/tsconfig.json, src/Translator/assets/tsconfig.json, src/Turbo/assets/tsconfig.json, src/Vue/assets/tsconfig.json, tsconfig.json)",
                "points": 27,
                "status": "partial",
                "details": [
                  {
                    "code": "typecheck_config_language",
                    "params": {
                      "files": "src/Autocomplete/assets/tsconfig.json, src/Chartjs/assets/tsconfig.json, src/Cropperjs/assets/tsconfig.json, src/Dropzone/assets/tsconfig.json, src/LiveComponent/assets/tsconfig.json, src/Map/assets/tsconfig.json, src/Map/src/Bridge/Google/assets/tsconfig.json, src/Map/src/Bridge/Leaflet/assets/tsconfig.json, src/Notify/assets/tsconfig.json, src/React/assets/tsconfig.json, src/StimulusBundle/assets/tsconfig.json, src/Translator/assets/tsconfig.json, src/Turbo/assets/tsconfig.json, src/Vue/assets/tsconfig.json, tsconfig.json",
                      "language": "PHP"
                    }
                  }
                ],
                "max_points": 45
              },
              {
                "key": "manageable_file_sizes",
                "name": "Manageable file sizes",
                "detail": "1/1243 source files over 60KB",
                "points": 55,
                "status": "partial",
                "details": [
                  {
                    "code": "oversized_source_files",
                    "params": {
                      "kb": 60,
                      "sampled": 1243,
                      "oversized": 1
                    }
                  }
                ],
                "max_points": 55
              }
            ]
          }
        ],
        "description": "How well is the repo equipped to be developed and maintained with AI coding agents? An independent, experimental badge — weight 0.0, so it is surfaced on its own and does not affect the overall health score."
      }
    ],
    "metrics_version": "1.13.0"
  },
  "warnings": [
    "Star history unavailable: GitHub GraphQL error: Resource not accessible by personal access token",
    "Could not fetch packagist package 'symfony/ux' from its registry"
  ],
  "report_type": "repository",
  "generated_at": "2026-07-26T05:07:26.502781Z",
  "schema_version": "0.27.0",
  "badge_url": "https://raw.githubusercontent.com/inspect-software/badges/main/v1/s/symfony/ux.svg",
  "full_name": "symfony/ux",
  "license_state": "standard",
  "license_spdx": "MIT"
}